--- /dev/null
+/*
+ * FastTree -- inferring approximately-maximum-likelihood trees for large
+ * multiple sequence alignments.
+ *
+ * Morgan N. Price
+ * http://www.microbesonline.org/fasttree/
+ *
+ * Thanks to Jim Hester of the Cleveland Clinic Foundation for
+ * providing the first parallel (OpenMP) code, Siavash Mirarab of
+ * UT Austin for implementing the WAG option, Samuel Shepard
+ * at the CDC for suggesting and helping with the -quote option, and
+ * Aaron Darling (University of Technology, Sydney) for numerical changes
+ * for wide alignments of closely-related sequences.
+ *
+ * Copyright (C) 2008-2015 The Regents of the University of California
+ * All rights reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ * or visit http://www.gnu.org/copyleft/gpl.html
+ *
+ * Disclaimer
+ *
+ * NEITHER THE UNITED STATES NOR THE UNITED STATES DEPARTMENT OF ENERGY,
+ * NOR ANY OF THEIR EMPLOYEES, MAKES ANY WARRANTY, EXPRESS OR IMPLIED,
+ * OR ASSUMES ANY LEGAL LIABILITY OR RESPONSIBILITY FOR THE ACCURACY,
+ * COMPLETENESS, OR USEFULNESS OF ANY INFORMATION, APPARATUS, PRODUCT,
+ * OR PROCESS DISCLOSED, OR REPRESENTS THAT ITS USE WOULD NOT INFRINGE
+ * PRIVATELY OWNED RIGHTS.
+ */
+
+/*
+ * To compile FastTree, do:
+ * gcc -Wall -O3 -finline-functions -funroll-loops -o FastTree -lm FastTree.c
+ * Use -DNO_SSE to turn off use of SSE3 instructions
+ * (should not be necessary because compiler should not set __SSE__ if
+ * not available, and modern mallocs should return 16-byte-aligned values)
+ * Use -DOPENMP -fopenmp to use multiple threads (note, old versions of gcc
+ * may not support -fopenmp)
+ * Use -DTRACK_MEMORY if you want detailed reports of memory usage,
+ * but results are not correct above 4GB because mallinfo stores int values.
+ * It also makes FastTree run significantly slower.
+ *
+ * To get usage guidance, do:
+ * FastTree -help
+ *
+ * FastTree uses profiles instead of a distance matrix, and computes
+ * support values for each split from the profiles of the 4 nodes
+ * around the split. It stores a profile for each node and a average
+ * profile over all active nodes (the "out-profile" for computing the
+ * total sum of distance to other nodes). The neighbor joining phase
+ * requires O(N*L*a) space, where N is the number of sequences, L is
+ * the alignment width, and a is the alphabet size. The top-hits
+ * heuristic requires an additional O(N sqrt(N)) memory. After
+ * neighbor-joining, FastTree improves the topology with
+ * nearest-neighbor interchanges (NNIs) and subtree-prune-regraft
+ * moves (SPRs), which does not have a significant additional memory
+ * requirement. (We need only store "up-profiles" on the path from our
+ * current traversal point to the root.) These take O(NLa) time per
+ * round, and with default settings, O(N log(N) L a) time total.
+ * FastTree further improves the topology with maximum-likelihood
+ * NNIs, using similar data structures and complexity, but with a
+ * higher constant factor, and now the "profiles" are actually
+ * posterior distributions for that subtree. Finally, FastTree
+ * resamples the site likelihoods around each NNI and uses
+ * the Shimodaira Hasegawa test to estimate the reliability of each split.
+ *
+ * Overview of the neighbor-joining phase:
+ *
+ * Although FastTree uses a log correction on profile distances to
+ * account for multiple substitutions when doing NNIs and SPRs, the
+ * operations on the profiles themselves involve "additive" distances
+ * -- either %different (for nucleotide) or by using an amino acid
+ * similarity matrix (for proteins). If we are using %different as
+ * our distance matrix then
+ *
+ * Profile_distance(A,B) = 1 - sum over characters of freq(A)*freq(B)
+ *
+ * and we can average this value over positions. Positions with gaps
+ * are weighted by %ungapped(A) * %ungapped(B).
+ *
+ * If we are using an amino acid dissimilarity matrix D(i,j) then at
+ * each position
+ *
+ * Profile_distance(A,B) = sum(i,j) freq(A==i) * freq(B==j) * D(i,j)
+ * = sum(k) Ak * Bk * Lambda(k)
+ *
+ * where k iterates over 20 eigenvectors, Lambda(k) is the eigenvalue,
+ * and if A==i, then Ak is the kth column of the inverse of the
+ * eigenvector matrix.
+ *
+ * The exhaustive approach (-slow) takes O(N**3*L*a) time, but
+ * this can be reduced to as little as O(N**(3/2)*log(N)*L*a) time
+ * by using heuristics.
+ *
+ * It uses a combination of three heuristics: a visible set similar to
+ * that of FastTree (Elias & Lagergren 2005), a local hill-climbing
+ * search for a better join (as in relaxed neighbor-joining, Evans et
+ * al. 2006), and a top-hit list to reduce the search space (see
+ * below).
+ *
+ * The "visible" set stores, for each node, the best join for that
+ * node, as identified at some point in the past
+ *
+ * If top-hits are not being used, then the neighbor-joining phase can
+ * be summarized as:
+ *
+ * Compute the out-profile by averaging the leaves
+ * Compute the out-distance of each leaf quickly, using the out-profile
+ * Compute the visible set (or approximate it using top-hits, see below)
+ * Until we're down to 3 active nodes:
+ * Find the best join in the visible set
+ * (This involves recomputing the neighbor-joining criterion,
+ * as out-distances and #active nodes may have changed)
+ * Follow a chain of best hits (again recomputing the criterion)
+ * until we find a locally best join, as in relaxed neighbor joining
+ * Create a profile of the parent node, either using simple averages (default)
+ * or using weighted joining as in BIONJ (if -bionj was specified)
+ * Update the out-profile and the out-distances
+ * Update the visible set:
+ * find the best join for the new joined node
+ * replace hits to the joined children with hits to the parent
+ * if we stumble across a join for the new node that is better
+ * than the corresponding entry in the visible set, "reset"
+ * that entry.
+ *
+ * For each iteration, this method does
+ * O(N) work to find the best hit in the visible set
+ * O(L*N*a*log(N)) work to do the local search, where log(N)
+ * is a pessimistic estimate of the number of iterations. In
+ * practice, we average <1 iteration for 2,000 sequences.
+ * With -fastest, this step is omitted.
+ * O(N*a) work to compute the joined profile and update the out-profile
+ * O(L*N*a) work to update the out-distances
+ * O(L*N*a) work to compare the joined profile to the other nodes
+ * (to find the new entry in the visible set)
+ *
+ * and there are N-3 iterations, so it takes O(N**2 * L * log(N) * a) time.
+ *
+ * The profile distances give exactly the same result as matrix
+ * distances in neighbor-joining or BIONJ would if there are no gaps
+ * in the alignment. If there are gaps, then it is an
+ * approximation. To get the same result we also store a "diameter"
+ * for each node (diameter is 0 for leaves).
+ *
+ * In the simpler case (NJ rather than BIONJ), when we join A and B to
+ * give a new node AB,
+ *
+ * Profile(AB) = (A+B)/2
+ * Profile_distance(AB,C) = (Profile_distance(A,C)+Profile_distance(B,C))/2
+ * because the formulas above are linear
+ *
+ * And according to the neighor-joining rule,
+ * d(AB,C) = (d(A,C)+d(B,C)-d(A,B))/2
+ *
+ * and we can achieve the same value by writing
+ * diameter(AB) = pd(A,B)/2
+ * diameter(leaf) = 0
+ * d(A,B) = pd(A,B) - diameter(A) - diameter(B)
+ *
+ * because
+ * d(AB,C) = (d(A,C)+d(B,C)-d(A,B))/2
+ * = (pd(A,C)-diam(A)-diam(C)+pd(B,C)-diam(B)-diam(C)-d(A,B)+diam(A)+diam(B))/2
+ * = (pd(A,C)+pd(B,C))/2 - diam(C) - pd(A,B)
+ * = pd(AB,C) - diam(AB) - diam(C)
+ *
+ * If we are using BIONJ, with weight lambda for the join:
+ * Profile(AB) = lambda*A + (1-lambda)*B
+ * then a similar argument gives
+ * diam(AB) = lambda*diam(A) + (1-lambda)*diam(B) + lambda*d(A,AB) + (1-lambda)*d(B,AB),
+ *
+ * where, as in neighbor joining,
+ * d(A,AB) = d(A,B) + (total out_distance(A) - total out_distance(B))/(n-2)
+ *
+ * A similar recursion formula works for the "variance" matrix of BIONJ,
+ * var(AB,C) = lambda*var(A,C) + (1-lambda)*var(B,C) - lambda*(1-lambda)*var(A,B)
+ * is equivalent to
+ * var(A,B) = pv(A,B) - vd(A) - vd(B), where
+ * pv(A,B) = pd(A,B)
+ * vd(A) = 0 for leaves
+ * vd(AB) = lambda*vd(A) + (1-lambda)*vd(B) + lambda*(1-lambda)*var(A,B)
+ *
+ * The top-hist heuristic to reduce the work below O(N**2*L) stores a top-hit
+ * list of size m=sqrt(N) for each active node.
+ *
+ * The list can be initialized for all the leaves in sub (N**2 * L) time as follows:
+ * Pick a "seed" sequence and compare it to all others
+ * Store the top m hits of the seed as its top-hit list
+ * Take "close" hits of the seed(within the top m, and see the "close" parameter),
+ * and assume that their top m hits lie within the top 2*m hits of the seed.
+ * So, compare them to the seed's neighors (if they do not already
+ * have a top hit list) and set their top hits.
+ *
+ * This method does O(N*L) work for each seed, or O(N**(3/2)*L) work total.
+ *
+ * To avoid doing O(N*L) work at each iteration, we need to avoid
+ * updating the visible set and the out-distances. So, we use "stale"
+ * out-distances, and when searching the visible set for the best hit,
+ * we only inspect the top m=sqrt(N) entries. We then update those
+ * out-distances (up to 2*m*L*a work) and then find the best hit.
+ *
+ * To avoid searching the entire visible set, FastTree keeps
+ * and updates a list of the top sqrt(N) entries in the visible set.
+ * This costs O(sqrt(N)) time per join to find the best entry and to
+ * update, or (N sqrt(N)) time overall.
+ *
+ * Similarly, when doing the local hill-climbing, we avoid O(N*L) work
+ * by only considering the top-hits for the current node. So this adds
+ * O(m*a*log(N)) work per iteration.
+ *
+ * When we join two nodes, we compute profiles and update the
+ * out-profile as before. We need to compute the best hits of the node
+ * -- we merge the lists for the children and select the best up-to-m
+ * hits. If the top hit list contains a stale node we replace it with
+ * its parent. If we still have <m/2 entries, we do a "refresh".
+ *
+ * In a "refresh", similar to the fast top-hit computation above, we
+ * compare the "seed", in this case the new joined node, to all other
+ * nodes. We compare its close neighbors (the top m hits) to all
+ * neighbors (the top 2*m hits) and update the top-hit lists of all
+ * neighbors (by merging to give a list of 3*m entries and then
+ * selecting the best m entries).
+ *
+ * Finally, during these processes we update the visible sets for
+ * other nodes with better hits if we find them, and we set the
+ * visible entry for the new joined node to the best entry in its
+ * top-hit list. (And whenever we update a visible entry, we
+ * do O(sqrt(N)) work to update the top-visible list.)
+ * These udpates are not common so they do not alter the
+ * O(N sqrt(N) log(N) L a) total running time for the joining phase.
+ *
+ * Second-level top hits
+ *
+ * With -fastest or with -2nd, FastTree uses an additional "2nd-level" top hits
+ * heuristic to reduce the running time for the top-hits phase to
+ * O(N**1.25 L) and for the neighbor-joining phase to O(N**1.25 L a).
+ * This also reduces the memory usage for the top-hits lists to
+ * O(N**1.25), which is important for alignments with a million
+ * sequences. The key idea is to store just q = sqrt(m) top hits for
+ * most sequences.
+ *
+ * Given the neighbors of A -- either for a seed or for a neighbor
+ * from the top-hits heuristic, if B is within the top q hits of A, we
+ * set top-hits(B) from the top 3*q top-hits of A. And, we record that
+ * A is the "source" of the hits for B, so if we run low on hits for
+ * B, instead of doing a full refresh, we can do top-hits(B) :=
+ * top-hits(B) union top-hits(active_ancestor(A)).
+ * During a refresh, these "2nd-level" top hits are updated just as
+ * normal, but the source is maintained and only q entries are stored,
+ * until we near the end of the neighbor joining phase (until the
+ * root as 2*m children or less).
+ *
+ * Parallel execution with OpenMP
+ *
+ * If you compile FastTree with OpenMP support, it will take
+ * advantage of multiple CPUs on one machine. It will parallelize:
+ *
+ * The top hits phase
+ * Comparing one node to many others during the NJ phase (the simplest kind of join)
+ * The refresh phase
+ * Optimizing likelihoods for 3 alternate topologies during ML NNIs and ML supports
+ * (only 3 threads can be used)
+ *
+ * This accounts for most of the O(N L a) or slower steps except for
+ * minimum-evolution NNIs (which are fast anyway), minimum-evolution SPRs,
+ * selecting per-site rates, and optimizing branch lengths outside of ML NNIs.
+ *
+ * Parallelizing the top hits phase may lead to a slight change in the tree,
+ * as some top hits are computed from different (and potentially less optimal source).
+ * This means that results on repeated runs may not be 100% identical.
+ * However, this should not have any significant effect on tree quality
+ * after the NNIs and SPRs.
+ *
+ * The OpenMP code also turns off the star-topology test during ML
+ * NNIs, which may lead to slight improvements in likelihood.
+ */
+
+#include <stdio.h>
+#include <stdbool.h>
+#include <string.h>
+#include <assert.h>
+#include <math.h>
+#include <stdlib.h>
+#include <sys/time.h>
+#include <ctype.h>
+#include <unistd.h>
+#ifdef TRACK_MEMORY
+/* malloc.h apparently doesn't exist on MacOS */
+#include <malloc.h>
+#endif
+
+/* Compile with -DOPENMP to turn on multithreading */
+#ifdef OPENMP
+#include <omp.h>
+#endif
+
+/* By default, tries to compile with SSE instructions for greater speed.
+ But if compiled with -DUSE_DOUBLE, uses double precision instead of single-precision
+ floating point (2x memory required), does not use SSE, and allows much shorter
+ branch lengths.
+*/
+#ifdef __SSE__
+#if !defined(NO_SSE) && !defined(USE_DOUBLE)
+#define USE_SSE3
+#endif
+#endif
+
+
+#ifdef USE_DOUBLE
+#define SSE_STRING "Double precision (No SSE3)"
+typedef double numeric_t;
+#define ScanNumericSpec "%lf"
+#else
+typedef float numeric_t;
+#define ScanNumericSpec "%f"
+#endif
+
+#ifdef USE_SSE3
+#define SSE_STRING "SSE3"
+#define ALIGNED __attribute__((aligned(16)))
+#define IS_ALIGNED(X) ((((unsigned long) new) & 15L) == 0L)
+#include <xmmintrin.h>
+
+#else
+
+#define ALIGNED
+#define IS_ALIGNED(X) 1
+
+#ifndef USE_DOUBLE
+#define SSE_STRING "No SSE3"
+#endif
+
+#endif /* USE_SSE3 */
+
+#define FT_VERSION "2.1.8"
+
+char *usage =
+ " FastTree protein_alignment > tree\n"
+ " FastTree < protein_alignment > tree\n"
+ " FastTree -out tree protein_alignment\n"
+ " FastTree -nt nucleotide_alignment > tree\n"
+ " FastTree -nt -gtr < nucleotide_alignment > tree\n"
+ " FastTree < nucleotide_alignment > tree\n"
+ "FastTree accepts alignments in fasta or phylip interleaved formats\n"
+ "\n"
+ "Common options (must be before the alignment file):\n"
+ " -quiet to suppress reporting information\n"
+ " -nopr to suppress progress indicator\n"
+ " -log logfile -- save intermediate trees, settings, and model details\n"
+ " -fastest -- speed up the neighbor joining phase & reduce memory usage\n"
+ " (recommended for >50,000 sequences)\n"
+ " -n <number> to analyze multiple alignments (phylip format only)\n"
+ " (use for global bootstrap, with seqboot and CompareToBootstrap.pl)\n"
+ " -nosupport to not compute support values\n"
+ " -intree newick_file to set the starting tree(s)\n"
+ " -intree1 newick_file to use this starting tree for all the alignments\n"
+ " (for faster global bootstrap on huge alignments)\n"
+ " -pseudo to use pseudocounts (recommended for highly gapped sequences)\n"
+ " -gtr -- generalized time-reversible model (nucleotide alignments only)\n"
+ " -wag -- Whelan-And-Goldman 2001 model (amino acid alignments only)\n"
+ " -quote -- allow spaces and other restricted characters (but not ' ) in\n"
+ " sequence names and quote names in the output tree (fasta input only;\n"
+ " FastTree will not be able to read these trees back in)\n"
+ " -noml to turn off maximum-likelihood\n"
+ " -nome to turn off minimum-evolution NNIs and SPRs\n"
+ " (recommended if running additional ML NNIs with -intree)\n"
+ " -nome -mllen with -intree to optimize branch lengths for a fixed topology\n"
+ " -cat # to specify the number of rate categories of sites (default 20)\n"
+ " or -nocat to use constant rates\n"
+ " -gamma -- after optimizing the tree under the CAT approximation,\n"
+ " rescale the lengths to optimize the Gamma20 likelihood\n"
+ " -constraints constraintAlignment to constrain the topology search\n"
+ " constraintAlignment should have 1s or 0s to indicates splits\n"
+ " -expert -- see more options\n"
+ "For more information, see http://www.microbesonline.org/fasttree/\n";
+
+char *expertUsage =
+ "FastTree [-nt] [-n 100] [-quote] [-pseudo | -pseudo 1.0]\n"
+ " [-boot 1000 | -nosupport]\n"
+ " [-intree starting_trees_file | -intree1 starting_tree_file]\n"
+ " [-quiet | -nopr]\n"
+ " [-nni 10] [-spr 2] [-noml | -mllen | -mlnni 10]\n"
+ " [-mlacc 2] [-cat 20 | -nocat] [-gamma]\n"
+ " [-slow | -fastest] [-2nd | -no2nd] [-slownni] [-seed 1253] \n"
+ " [-top | -notop] [-topm 1.0 [-close 0.75] [-refresh 0.8]]\n"
+ " [-matrix Matrix | -nomatrix] [-nj | -bionj]\n"
+ " [-wag] [-nt] [-gtr] [-gtrrates ac ag at cg ct gt] [-gtrfreq A C G T]\n"
+ " [ -constraints constraintAlignment [ -constraintWeight 100.0 ] ]\n"
+ " [-log logfile]\n"
+ " [ alignment_file ]\n"
+ " [ -out output_newick_file | > newick_tree]\n"
+ "\n"
+ "or\n"
+ "\n"
+ "FastTree [-nt] [-matrix Matrix | -nomatrix] [-rawdist] -makematrix [alignment]\n"
+ " [-n 100] > phylip_distance_matrix\n"
+ "\n"
+ " FastTree supports fasta or phylip interleaved alignments\n"
+ " By default FastTree expects protein alignments, use -nt for nucleotides\n"
+ " FastTree reads standard input if no alignment file is given\n"
+ "\n"
+ "Input/output options:\n"
+ " -n -- read in multiple alignments in. This only\n"
+ " works with phylip interleaved format. For example, you can\n"
+ " use it with the output from phylip's seqboot. If you use -n, FastTree\n"
+ " will write 1 tree per line to standard output.\n"
+ " -intree newickfile -- read the starting tree in from newickfile.\n"
+ " Any branch lengths in the starting trees are ignored.\n"
+ " -intree with -n will read a separate starting tree for each alignment.\n"
+ " -intree1 newickfile -- read the same starting tree for each alignment\n"
+ " -quiet -- do not write to standard error during normal operation (no progress\n"
+ " indicator, no options summary, no likelihood values, etc.)\n"
+ " -nopr -- do not write the progress indicator to stderr\n"
+ " -log logfile -- save intermediate trees so you can extract\n"
+ " the trees and restart long-running jobs if they crash\n"
+ " -log also reports the per-site rates (1 means slowest category)\n"
+ " -quote -- quote sequence names in the output and allow spaces, commas,\n"
+ " parentheses, and colons in them but not ' characters (fasta files only)\n"
+ "\n"
+ "Distances:\n"
+ " Default: For protein sequences, log-corrected distances and an\n"
+ " amino acid dissimilarity matrix derived from BLOSUM45\n"
+ " or for nucleotide sequences, Jukes-Cantor distances\n"
+ " To specify a different matrix, use -matrix FilePrefix or -nomatrix\n"
+ " Use -rawdist to turn the log-correction off\n"
+ " or to use %different instead of Jukes-Cantor\n"
+ "\n"
+ " -pseudo [weight] -- Use pseudocounts to estimate distances between\n"
+ " sequences with little or no overlap. (Off by default.) Recommended\n"
+ " if analyzing the alignment has sequences with little or no overlap.\n"
+ " If the weight is not specified, it is 1.0\n"
+ "\n"
+ "Topology refinement:\n"
+ " By default, FastTree tries to improve the tree with up to 4*log2(N)\n"
+ " rounds of minimum-evolution nearest-neighbor interchanges (NNI),\n"
+ " where N is the number of unique sequences, 2 rounds of\n"
+ " subtree-prune-regraft (SPR) moves (also min. evo.), and\n"
+ " up to 2*log(N) rounds of maximum-likelihood NNIs.\n"
+ " Use -nni to set the number of rounds of min. evo. NNIs,\n"
+ " and -spr to set the rounds of SPRs.\n"
+ " Use -noml to turn off both min-evo NNIs and SPRs (useful if refining\n"
+ " an approximately maximum-likelihood tree with further NNIs)\n"
+ " Use -sprlength set the maximum length of a SPR move (default 10)\n"
+ " Use -mlnni to set the number of rounds of maximum-likelihood NNIs\n"
+ " Use -mlacc 2 or -mlacc 3 to always optimize all 5 branches at each NNI,\n"
+ " and to optimize all 5 branches in 2 or 3 rounds\n"
+ " Use -mllen to optimize branch lengths without ML NNIs\n"
+ " Use -mllen -nome with -intree to optimize branch lengths on a fixed topology\n"
+ " Use -slownni to turn off heuristics to avoid constant subtrees (affects both\n"
+ " ML and ME NNIs)\n"
+ "\n"
+ "Maximum likelihood model options:\n"
+ " -wag -- Whelan-And-Goldman 2001 model instead of (default) Jones-Taylor-Thorton 1992 model (a.a. only)\n"
+ " -gtr -- generalized time-reversible instead of (default) Jukes-Cantor (nt only)\n"
+ " -cat # -- specify the number of rate categories of sites (default 20)\n"
+ " -nocat -- no CAT model (just 1 category)\n"
+ " -gamma -- after the final round of optimizing branch lengths with the CAT model,\n"
+ " report the likelihood under the discrete gamma model with the same\n"
+ " number of categories. FastTree uses the same branch lengths but\n"
+ " optimizes the gamma shape parameter and the scale of the lengths.\n"
+ " The final tree will have rescaled lengths. Used with -log, this\n"
+ " also generates per-site likelihoods for use with CONSEL, see\n"
+ " GammaLogToPaup.pl and documentation on the FastTree web site.\n"
+ "\n"
+ "Support value options:\n"
+ " By default, FastTree computes local support values by resampling the site\n"
+ " likelihoods 1,000 times and the Shimodaira Hasegawa test. If you specify -nome,\n"
+ " it will compute minimum-evolution bootstrap supports instead\n"
+ " In either case, the support values are proportions ranging from 0 to 1\n"
+ "\n"
+ " Use -nosupport to turn off support values or -boot 100 to use just 100 resamples\n"
+ " Use -seed to initialize the random number generator\n"
+ "\n"
+ "Searching for the best join:\n"
+ " By default, FastTree combines the 'visible set' of fast neighbor-joining with\n"
+ " local hill-climbing as in relaxed neighbor-joining\n"
+ " -slow -- exhaustive search (like NJ or BIONJ, but different gap handling)\n"
+ " -slow takes half an hour instead of 8 seconds for 1,250 proteins\n"
+ " -fastest -- search the visible set (the top hit for each node) only\n"
+ " Unlike the original fast neighbor-joining, -fastest updates visible(C)\n"
+ " after joining A and B if join(AB,C) is better than join(C,visible(C))\n"
+ " -fastest also updates out-distances in a very lazy way,\n"
+ " -fastest sets -2nd on as well, use -fastest -no2nd to avoid this\n"
+ "\n"
+ "Top-hit heuristics:\n"
+ " By default, FastTree uses a top-hit list to speed up search\n"
+ " Use -notop (or -slow) to turn this feature off\n"
+ " and compare all leaves to each other,\n"
+ " and all new joined nodes to each other\n"
+ " -topm 1.0 -- set the top-hit list size to parameter*sqrt(N)\n"
+ " FastTree estimates the top m hits of a leaf from the\n"
+ " top 2*m hits of a 'close' neighbor, where close is\n"
+ " defined as d(seed,close) < 0.75 * d(seed, hit of rank 2*m),\n"
+ " and updates the top-hits as joins proceed\n"
+ " -close 0.75 -- modify the close heuristic, lower is more conservative\n"
+ " -refresh 0.8 -- compare a joined node to all other nodes if its\n"
+ " top-hit list is less than 80% of the desired length,\n"
+ " or if the age of the top-hit list is log2(m) or greater\n"
+ " -2nd or -no2nd to turn 2nd-level top hits heuristic on or off\n"
+ " This reduces memory usage and running time but may lead to\n"
+ " marginal reductions in tree quality.\n"
+ " (By default, -fastest turns on -2nd.)\n"
+ "\n"
+ "Join options:\n"
+ " -nj: regular (unweighted) neighbor-joining (default)\n"
+ " -bionj: weighted joins as in BIONJ\n"
+ " FastTree will also weight joins during NNIs\n"
+ "\n"
+ "Constrained topology search options:\n"
+ " -constraints alignmentfile -- an alignment with values of 0, 1, and -\n"
+ " Not all sequences need be present. A column of 0s and 1s defines a\n"
+ " constrained split. Some constraints may be violated\n"
+ " (see 'violating constraints:' in standard error).\n"
+ " -constraintWeight -- how strongly to weight the constraints. A value of 1\n"
+ " means a penalty of 1 in tree length for violating a constraint\n"
+ " Default: 100.0\n"
+ "\n"
+ "For more information, see http://www.microbesonline.org/fasttree/\n"
+ " or the comments in the source code\n";
+;
+
+
+#define MAXCODES 20
+#define NOCODE 127
+/* Note -- sequence lines longer than BUFFER_SIZE are
+ allowed, but FASTA header lines must be within this limit */
+#define BUFFER_SIZE 5000
+#define MIN(X,Y) ((X) < (Y) ? (X) : (Y))
+#define MAX(X,Y) ((X) > (Y) ? (X) : (Y))
+
+typedef struct {
+ int nPos;
+ int nSeq;
+ char **names;
+ char **seqs;
+ int nSaved; /* actual allocated size of names and seqs */
+} alignment_t;
+
+/* For each position in a profile, we have a weight (% non-gapped) and a
+ frequency vector. (If using a matrix, the frequency vector is in eigenspace).
+ We also store codes for simple profile positions (all gaps or only 1 value)
+ If weight[pos] > 0 && codes[pos] == NOCODE then we store the vector
+ vectors itself is sets of nCodes long, so the vector for the ith nonconstant position
+ starts at &vectors[nCodes*i]
+
+ To speed up comparison of outprofile to a sequence or other simple profile, we also
+ (for outprofiles) store codeDist[iPos*nCodes+k] = dist(k,profile[iPos])
+
+ For constraints, we store a vector of nOn and nOff
+ If not using constraints, those will be NULL
+*/
+typedef struct {
+ /* alignment profile */
+ numeric_t *weights;
+ unsigned char *codes;
+ numeric_t *vectors; /* NULL if no non-constant positions, e.g. for leaves */
+ int nVectors;
+ numeric_t *codeDist; /* Optional -- distance to each code at each position */
+
+ /* constraint profile */
+ int *nOn;
+ int *nOff;
+} profile_t;
+
+/* A visible node is a pair of nodes i, j such that j is the best hit of i,
+ using the neighbor-joining criterion, at the time the comparison was made,
+ or approximately so since then.
+
+ Note that variance = dist because in BIONJ, constant factors of variance do not matter,
+ and because we weight ungapped sequences higher naturally when averaging profiles,
+ so we do not take this into account in the computation of "lambda" for BIONJ.
+
+ For the top-hit list heuristic, if the top hit list becomes "too short",
+ we store invalid entries with i=j=-1 and dist/criterion very high.
+*/
+typedef struct {
+ int i, j;
+ numeric_t weight; /* Total product of weights (maximum value is nPos)
+ This is needed for weighted joins and for pseudocounts,
+ but not in most other places.
+ For example, it is not maintained by the top hits code */
+ numeric_t dist; /* The uncorrected distance (includes diameter correction) */
+ numeric_t criterion; /* changes when we update the out-profile or change nActive */
+} besthit_t;
+
+typedef struct {
+ int nChild;
+ int child[3];
+} children_t;
+
+typedef struct {
+ /* Distances between amino acids */
+ numeric_t distances[MAXCODES][MAXCODES];
+
+ /* Inverse of the eigenvalue matrix, for rotating a frequency vector
+ into eigenspace so that profile similarity computations are
+ O(alphabet) not O(alphabet*alphabet) time.
+ */
+ numeric_t eigeninv[MAXCODES][MAXCODES];
+ numeric_t eigenval[MAXCODES]; /* eigenvalues */
+
+
+ /* eigentot=eigeninv times the all-1s frequency vector
+ useful for normalizing rotated frequency vectors
+ */
+ numeric_t eigentot[MAXCODES];
+
+ /* codeFreq is the transpose of the eigeninv matrix is
+ the rotated frequency vector for each code */
+ numeric_t codeFreq[MAXCODES][MAXCODES];
+ numeric_t gapFreq[MAXCODES];
+} distance_matrix_t;
+
+
+/* A transition matrix gives the instantaneous rate of change of frequencies
+ df/dt = M . f
+ which is solved by
+ f(t) = exp(M) . f(0)
+ and which is not a symmetric matrix because of
+ non-uniform stationary frequencies stat, so that
+ M stat = 0
+ M(i,j) is instantaneous rate of j -> i, not of i -> j
+
+ S = diag(sqrt(stat)) is a correction so that
+ M' = S**-1 M S is symmetric
+ Let W L W**-1 = M' be an eigendecomposition of M'
+ Because M' is symmetric, W can be a rotation, and W**-1 = t(W)
+ Set V = S*W
+ M = V L V**-1 is an eigendecomposition of M
+ Note V**-1 = W**-1 S**-1 = t(W) S**-1
+
+ Evolution by time t is given by
+
+ exp(M*t) = V exp(L*t) V**-1
+ P(A & B | t) = B . exp(M*t) . (A * stat)
+ note this is *not* the same as P(A->B | t)
+
+ and we can reduce some of the computations from O(a**2) to O(a) time,
+ where a is the alphabet size, by storing frequency vectors as
+ t(V) . f = t(W) . t(S) . f
+
+ Then
+ P(f0 & f1 | t) = f1 . exp(M*t) . f0 * (f0 . stat) = sum(r0j * r1j * exp(l_j*t))
+ where r0 and r1 are the transformed vectors
+
+ Posterior distribution of P given children f0 and f1 is given by
+ P(i | f0, f1, t0, t1) = stat * P(i->f0 | t0) * P(i->f1 | t1)
+ = P(i & f0 | t0) * P(i & f1 | t1) / stat
+ ~ (V . exp(t0*L) . r0) * (V . exp(t1*L) . r1) / stat
+
+ When normalize this posterior distribution (to sum to 1), divide by stat,
+ and transform by t(V) -- this is the "profile" of internal nodes
+
+ To eliminate the O(N**2) step of transforming by t(V), if the posterior
+ distribution of an amino acid is near 1 then we can approximate it by
+ P(i) ~= (i==A) * w + nearP(i) * (1-w), where
+ w is fit so that P(i==A) is correct
+ nearP = Posterior(i | i, i, 0.1, 0.1) [0.1 is an arbitrary choice]
+ and we confirm that the approximation works well before we use it.
+
+ Given this parameter w we can set
+ rotated_posterior = rotation(w * (i==A)/stat + (1-w) * nearP/stat)
+ = codeFreq(A) * w/stat(A) + nearFreq(A) * (1-w)
+ */
+typedef struct {
+ numeric_t stat[MAXCODES]; /* The stationary distribution */
+ numeric_t statinv[MAXCODES]; /* 1/stat */
+ /* the eigenmatrix, with the eigenvectors as columns and rotations of individual
+ characters as rows. Also includes a NOCODE entry for gaps */
+ numeric_t codeFreq[NOCODE+1][MAXCODES];
+ numeric_t eigeninv[MAXCODES][MAXCODES]; /* Inverse of eigenmatrix */
+ numeric_t eigeninvT[MAXCODES][MAXCODES]; /* transpose of eigeninv */
+ numeric_t eigenval[MAXCODES]; /* Eigenvalues */
+ /* These are for approximate posteriors (off by default) */
+ numeric_t nearP[MAXCODES][MAXCODES]; /* nearP[i][j] = P(parent=j | both children are i, both lengths are 0.1 */
+ numeric_t nearFreq[MAXCODES][MAXCODES]; /* rotation of nearP/stat */
+} transition_matrix_t;
+
+typedef struct {
+ int nRateCategories;
+ numeric_t *rates; /* 1 per rate category */
+ unsigned int *ratecat; /* 1 category per position */
+} rates_t;
+
+typedef struct {
+ /* The input */
+ int nSeq;
+ int nPos;
+ char **seqs; /* the aligment sequences array (not reallocated) */
+ distance_matrix_t *distance_matrix; /* a pointer (not reallocated), or NULL if using %identity distance */
+ transition_matrix_t *transmat; /* a pointer (is allocated), or NULL for Jukes-Cantor */
+ /* Topological constraints are represented for each sequence as binary characters
+ with values of '0', '1', or '-' (for missing data)
+ Sequences that have no constraint may have a NULL string
+ */
+ int nConstraints;
+ char **constraintSeqs;
+
+ /* The profile data structures */
+ int maxnode; /* The next index to allocate */
+ int maxnodes; /* Space allocated in data structures below */
+ profile_t **profiles; /* Profiles of leaves and intermediate nodes */
+ numeric_t *diameter; /* To correct for distance "up" from children (if any) */
+ numeric_t *varDiameter; /* To correct variances for distance "up" */
+ numeric_t *selfdist; /* Saved for use in some formulas */
+ numeric_t *selfweight; /* Saved for use in some formulas */
+
+ /* Average profile of all active nodes, the "outprofile"
+ * If all inputs are ungapped, this has weight 1 (not nSequences) at each position
+ * The frequencies all sum to one (or that is implied by the eigen-representation)
+ */
+ profile_t *outprofile;
+ double totdiam;
+
+ /* We sometimes use stale out-distances, so we remember what nActive was */
+ numeric_t *outDistances; /* Sum of distances to other active (parent==-1) nodes */
+ int *nOutDistActive; /* What nActive was when this outDistance was computed */
+
+ /* the inferred tree */
+ int root; /* index of the root. Unlike other internal nodes, it has 3 children */
+ int *parent; /* -1 or index of parent */
+ children_t *child;
+ numeric_t *branchlength; /* Distance to parent */
+ numeric_t *support; /* 1 for high-confidence nodes */
+
+ /* auxilliary data for maximum likelihood (defaults to 1 category of rate=1.0) */
+ rates_t rates;
+} NJ_t;
+
+/* Uniquify sequences in an alignment -- map from indices
+ in the alignment to unique indicies in a NJ_t
+*/
+typedef struct {
+ int nSeq;
+ int nUnique;
+ int *uniqueFirst; /* iUnique -> iAln */
+ int *alnNext; /* iAln -> next, or -1 */
+ int *alnToUniq; /* iAln -> iUnique, or -1 if another was the exemplar */
+ char **uniqueSeq; /* indexed by iUniq -- points to strings allocated elsewhere */
+} uniquify_t;
+
+/* Describes which switch to do */
+typedef enum {ABvsCD,ACvsBD,ADvsBC} nni_t;
+
+/* A list of these describes a chain of NNI moves in a rooted tree,
+ making up, in total, an SPR move
+*/
+typedef struct {
+ int nodes[2];
+ double deltaLength; /* change in tree length for this step (lower is better) */
+} spr_step_t;
+
+/* Keep track of hits for the top-hits heuristic without wasting memory
+ j = -1 means empty
+ If j is an inactive node, this may be replaced by that node's parent (and dist recomputed)
+ */
+typedef struct {
+ int j;
+ numeric_t dist;
+} hit_t;
+
+typedef struct {
+ int nHits; /* the allocated and desired size; some of them may be empty */
+ hit_t *hits;
+ int hitSource; /* where to refresh hits from if a 2nd-level top-hit list, or -1 */
+ int age; /* number of joins since a refresh */
+} top_hits_list_t;
+
+typedef struct {
+ int m; /* size of a full top hits list, usually sqrt(N) */
+ int q; /* size of a 2nd-level top hits, usually sqrt(m) */
+ int maxnodes;
+ top_hits_list_t *top_hits_lists; /* one per node */
+ hit_t *visible; /* the "visible" (very best) hit for each node */
+
+ /* The top-visible set is a subset, usually of size m, of the visible set --
+ it is the set of joins to select from
+ Each entry is either a node whose visible set entry has a good (low) criterion,
+ or -1 for empty, or is an obsolete node (which is effectively the same).
+ Whenever we update the visible set, should also call UpdateTopVisible()
+ which ensures that none of the topvisible set are stale (that is, they
+ all point to an active node).
+ */
+ int nTopVisible; /* nTopVisible = m * topvisibleMult */
+ int *topvisible;
+
+ int topvisibleAge; /* joins since the top-visible list was recomputed */
+
+#ifdef OPENMP
+ /* 1 lock to read or write any top hits list, no thread grabs more than one */
+ omp_lock_t *locks;
+#endif
+} top_hits_t;
+
+/* Global variables */
+/* Options */
+int verbose = 1;
+int showProgress = 1;
+int slow = 0;
+int fastest = 0;
+bool useTopHits2nd = false; /* use the second-level top hits heuristic? */
+int bionj = 0;
+double tophitsMult = 1.0; /* 0 means compare nodes to all other nodes */
+double tophitsClose = -1.0; /* Parameter for how close is close; also used as a coverage req. */
+double topvisibleMult = 1.5; /* nTopVisible = m * topvisibleMult; 1 or 2 did not make much difference
+ in either running time or accuracy so I chose a compromise. */
+
+double tophitsRefresh = 0.8; /* Refresh if fraction of top-hit-length drops to this */
+double tophits2Mult = 1.0; /* Second-level top heuristic -- only with -fastest */
+int tophits2Safety = 3; /* Safety factor for second level of top-hits heuristic */
+double tophits2Refresh = 0.6; /* Refresh 2nd-level top hits if drops down to this fraction of length */
+
+double staleOutLimit = 0.01; /* nActive changes by at most this amount before we recompute
+ an out-distance. (Only applies if using the top-hits heuristic) */
+double fResetOutProfile = 0.02; /* Recompute out profile from scratch if nActive has changed
+ by more than this proportion, and */
+int nResetOutProfile = 200; /* nActive has also changed more than this amount */
+int nCodes=20; /* 20 if protein, 4 if nucleotide */
+bool useMatrix=true; /* If false, use %different as the uncorrected distance */
+bool logdist = true; /* If true, do a log-correction (scoredist-like or Jukes-Cantor)
+ but only during NNIs and support values, not during neighbor-joining */
+double pseudoWeight = 0.0; /* The weight of pseudocounts to avoid artificial long branches when
+ nearby sequences in the tree have little or no overlap
+ (off by default). The prior distance is based on
+ all overlapping positions among the quartet or triplet under
+ consideration. The log correction takes place after the
+ pseudocount is used. */
+double constraintWeight = 100.0;/* Cost of violation of a topological constraint in evolutionary distance
+ or likelihood */
+double MEMinDelta = 1.0e-4; /* Changes of less than this in tree-length are discounted for
+ purposes of identifying fixed subtrees */
+bool fastNNI = true;
+bool gammaLogLk = false; /* compute gamma likelihood without reoptimizing branch lengths? */
+
+/* Maximum likelihood options and constants */
+/* These are used to rescale likelihood values and avoid taking a logarithm at each position */
+const double LkUnderflow = 1.0e-4;
+const double LkUnderflowInv = 1.0e4;
+const double LogLkUnderflow = 9.21034037197618; /* -log(LkUnderflowInv) */
+const double Log2 = 0.693147180559945;
+/* These are used to limit the optimization of branch lengths.
+ Also very short branch lengths can create numerical problems.
+ In version 2.1.7, the minimum branch lengths (MLMinBranchLength and MLMinRelBranchLength)
+ were increased to prevent numerical problems in rare cases.
+ In version 2.1.8, to provide useful branch lengths for genome-wide alignments,
+ the minimum branch lengths were dramatically decreased if USE_DOUBLE is defined.
+*/
+#ifndef USE_DOUBLE
+const double MLMinBranchLengthTolerance = 1.0e-4; /* absolute tolerance for optimizing branch lengths */
+const double MLFTolBranchLength = 0.001; /* fractional tolerance for optimizing branch lengths */
+const double MLMinBranchLength = 5.0e-4; /* minimum value for branch length */
+const double MLMinRelBranchLength = 2.5e-4; /* minimum of rate * length */
+const double fPostTotalTolerance = 1.0e-10; /* posterior vector must sum to at least this before rescaling */
+#else
+const double MLMinBranchLengthTolerance = 1.0e-9;
+const double MLFTolBranchLength = 0.001;
+const double MLMinBranchLength = 5.0e-9;
+const double MLMinRelBranchLength = 2.5e-9;
+const double fPostTotalTolerance = 1.0e-20;
+#endif
+
+int mlAccuracy = 1; /* Rounds of optimization of branch lengths; 1 means do 2nd round only if close */
+double closeLogLkLimit = 5.0; /* If partial optimization of an NNI looks like it would decrease the log likelihood
+ by this much or more then do not optimize it further */
+double treeLogLkDelta = 0.1; /* Give up if tree log-lk changes by less than this; NNIs that change
+ likelihood by less than this also are considered unimportant
+ by some heuristics */
+bool exactML = true; /* Exact or approximate posterior distributions for a.a.s */
+double approxMLminf = 0.95; /* Only try to approximate posterior distributions if max. value is at least this high */
+double approxMLminratio = 2/3.0;/* Ratio of approximated/true posterior values must be at least this high */
+double approxMLnearT = 0.2; /* 2nd component of near-constant posterior distribution uses this time scale */
+const int nDefaultRateCats = 20;
+
+/* Performance and memory usage */
+long profileOps = 0; /* Full profile-based distance operations */
+long outprofileOps = 0; /* How many of profileOps are comparisons to outprofile */
+long seqOps = 0; /* Faster leaf-based distance operations */
+long profileAvgOps = 0; /* Number of profile-average steps */
+long nHillBetter = 0; /* Number of hill-climbing steps */
+long nCloseUsed = 0; /* Number of "close" neighbors we avoid full search for */
+long nClose2Used = 0; /* Number of "close" neighbors we use 2nd-level top hits for */
+long nRefreshTopHits = 0; /* Number of full-blown searches (interior nodes) */
+long nVisibleUpdate = 0; /* Number of updates of the visible set */
+long nNNI = 0; /* Number of NNI changes performed */
+long nSPR = 0; /* Number of SPR changes performed */
+long nML_NNI = 0; /* Number of max-lik. NNI changes performed */
+long nSuboptimalSplits = 0; /* # of splits that are rejected given final tree (during bootstrap) */
+long nSuboptimalConstrained = 0; /* Bad splits that are due to constraints */
+long nConstraintViolations = 0; /* Number of constraint violations */
+long nProfileFreqAlloc = 0;
+long nProfileFreqAvoid = 0;
+long szAllAlloc = 0;
+long mymallocUsed = 0; /* useful allocations by mymalloc */
+long maxmallocHeap = 0; /* Maximum of mi.arena+mi.hblkhd from mallinfo (actual mem usage) */
+long nLkCompute = 0; /* # of likelihood computations for pairs of probability vectors */
+long nPosteriorCompute = 0; /* # of computations of posterior probabilities */
+long nAAPosteriorExact = 0; /* # of times compute exact AA posterior */
+long nAAPosteriorRough = 0; /* # of times use rough approximation */
+long nStarTests = 0; /* # of times we use star test to avoid testing an NNI */
+
+/* Protein character set */
+unsigned char *codesStringAA = (unsigned char*) "ARNDCQEGHILKMFPSTWYV";
+unsigned char *codesStringNT = (unsigned char*) "ACGT";
+unsigned char *codesString = NULL;
+
+distance_matrix_t *ReadDistanceMatrix(char *prefix);
+void SetupDistanceMatrix(/*IN/OUT*/distance_matrix_t *); /* set eigentot, codeFreq, gapFreq */
+void ReadMatrix(char *filename, /*OUT*/numeric_t codes[MAXCODES][MAXCODES], bool check_codes);
+void ReadVector(char *filename, /*OUT*/numeric_t codes[MAXCODES]);
+alignment_t *ReadAlignment(/*READ*/FILE *fp, bool bQuote); /* Returns a list of strings (exits on failure) */
+alignment_t *FreeAlignment(alignment_t *); /* returns NULL */
+void FreeAlignmentSeqs(/*IN/OUT*/alignment_t *);
+
+/* Takes as input the transpose of the matrix V, with i -> j
+ This routine takes care of setting the diagonals
+*/
+transition_matrix_t *CreateTransitionMatrix(/*IN*/double matrix[MAXCODES][MAXCODES],
+ /*IN*/double stat[MAXCODES]);
+transition_matrix_t *CreateGTR(double *gtrrates/*ac,ag,at,cg,ct,gt*/, double *gtrfreq/*ACGT*/);
+
+/* For converting profiles from 1 rotation to another, or converts NULL to NULL */
+distance_matrix_t *TransMatToDistanceMat(transition_matrix_t *transmat);
+
+/* Allocates memory, initializes leaf profiles */
+NJ_t *InitNJ(char **sequences, int nSeqs, int nPos,
+ /*IN OPTIONAL*/char **constraintSeqs, int nConstraints,
+ /*IN OPTIONAL*/distance_matrix_t *,
+ /*IN OPTIONAL*/transition_matrix_t *);
+
+NJ_t *FreeNJ(NJ_t *NJ); /* returns NULL */
+void FastNJ(/*IN/OUT*/NJ_t *NJ); /* Does the joins */
+void ReliabilityNJ(/*IN/OUT*/NJ_t *NJ, int nBootstrap); /* Estimates the reliability of the joins */
+
+/* nni_stats_t is meaningless for leaves and root, so all of those entries
+ will just be high (for age) or 0 (for delta)
+*/
+typedef struct {
+ int age; /* number of rounds since this node was modified by an NNI */
+ int subtreeAge; /* number of rounds since self or descendent had a significant improvement */
+ double delta; /* improvement in score for this node (or 0 if no change) */
+ double support; /* improvement of score for self over better of alternatives */
+} nni_stats_t;
+
+/* One round of nearest-neighbor interchanges according to the
+ minimum-evolution or approximate maximum-likelihood criterion.
+ If doing maximum likelihood then this modifies the branch lengths.
+ age is the # of rounds since a node was NNId
+ Returns the # of topological changes performed
+*/
+int NNI(/*IN/OUT*/NJ_t *NJ, int iRound, int nRounds, bool useML,
+ /*IN/OUT*/nni_stats_t *stats,
+ /*OUT*/double *maxDeltaCriterion);
+nni_stats_t *InitNNIStats(NJ_t *NJ);
+nni_stats_t *FreeNNIStats(nni_stats_t *, NJ_t *NJ); /* returns NULL */
+
+/* One round of subtree-prune-regraft moves (minimum evolution) */
+void SPR(/*IN/OUT*/NJ_t *NJ, int maxSPRLength, int iRound, int nRounds);
+
+/* Recomputes all branch lengths by minimum evolution criterion*/
+void UpdateBranchLengths(/*IN/OUT*/NJ_t *NJ);
+
+/* Recomputes all branch lengths and, optionally, internal profiles */
+double TreeLength(/*IN/OUT*/NJ_t *NJ, bool recomputeProfiles);
+
+typedef struct {
+ int nBadSplits;
+ int nConstraintViolations;
+ int nBadBoth;
+ int nSplits;
+ /* How much length would be reduce or likelihood would be increased by the
+ best NNI we find (the worst "miss") */
+ double dWorstDeltaUnconstrained;
+ double dWorstDeltaConstrained;
+} SplitCount_t;
+
+void TestSplitsMinEvo(NJ_t *NJ, /*OUT*/SplitCount_t *splitcount);
+
+/* Sets SH-like support values if nBootstrap>0 */
+void TestSplitsML(/*IN/OUT*/NJ_t *NJ, /*OUT*/SplitCount_t *splitcount, int nBootstrap);
+
+/* Pick columns for resampling, stored as returned_vector[iBoot*nPos + j] */
+int *ResampleColumns(int nPos, int nBootstrap);
+
+/* Use out-profile and NJ->totdiam to recompute out-distance for node iNode
+ Only does this computation if the out-distance is "stale" (nOutDistActive[iNode] != nActive)
+ Note "IN/UPDATE" for NJ always means that we may update out-distances but otherwise
+ make no changes.
+ */
+void SetOutDistance(/*IN/UPDATE*/NJ_t *NJ, int iNode, int nActive);
+
+/* Always sets join->criterion; may update NJ->outDistance and NJ->nOutDistActive,
+ assumes join's weight and distance are already set,
+ and that the constraint penalty (if any) is included in the distance
+*/
+void SetCriterion(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *join);
+
+/* Computes weight and distance (which includes the constraint penalty)
+ and then sets the criterion (maybe update out-distances)
+*/
+void SetDistCriterion(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *join);
+
+/* If join->i or join->j are inactive nodes, replaces them with their active ancestors.
+ After doing this, if i == j, or either is -1, sets weight to 0 and dist and criterion to 1e20
+ and returns false (not a valid join)
+ Otherwise, if i or j changed, recomputes the distance and criterion.
+ Note that if i and j are unchanged then the criterion could be stale
+ If bUpdateDist is false, and i or j change, then it just sets dist to a negative number
+*/
+bool UpdateBestHit(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *join,
+ bool bUpdateDist);
+
+/* This recomputes the criterion, or returns false if the visible node
+ is no longer active.
+*/
+bool GetVisible(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/top_hits_t *tophits,
+ int iNode, /*OUT*/besthit_t *visible);
+
+int ActiveAncestor(/*IN*/NJ_t *NJ, int node);
+
+/* Compute the constraint penalty for a join. This is added to the "distance"
+ by SetCriterion */
+int JoinConstraintPenalty(/*IN*/NJ_t *NJ, int node1, int node2);
+int JoinConstraintPenaltyPiece(NJ_t *NJ, int node1, int node2, int iConstraint);
+
+/* Helper function for computing the number of constraints violated by
+ a split, represented as counts of on and off on each side */
+int SplitConstraintPenalty(int nOn1, int nOff1, int nOn2, int nOff2);
+
+/* Reports the (min. evo.) support for the (1,2) vs. (3,4) split
+ col[iBoot*nPos+j] is column j for bootstrap iBoot
+*/
+double SplitSupport(profile_t *p1, profile_t *p2, profile_t *p3, profile_t *p4,
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ int nPos,
+ int nBootstrap,
+ int *col);
+
+/* Returns SH-like support given resampling spec. (in col) and site likelihods
+ for the three quartets
+*/
+double SHSupport(int nPos, int nBoostrap, int *col, double loglk[3], double *site_likelihoods[3]);
+
+profile_t *SeqToProfile(/*IN/OUT*/NJ_t *NJ,
+ char *seq, int nPos,
+ /*OPTIONAL*/char *constraintSeqs, int nConstraints,
+ int iNode,
+ unsigned long counts[256]);
+
+/* ProfileDist and SeqDist only set the dist and weight fields
+ If using an outprofile, use the second argument of ProfileDist
+ for better performance.
+
+ These produce uncorrected distances.
+*/
+void ProfileDist(profile_t *profile1, profile_t *profile2, int nPos,
+ /*OPTIONAL*/distance_matrix_t *distance_matrix,
+ /*OUT*/besthit_t *hit);
+void SeqDist(unsigned char *codes1, unsigned char *codes2, int nPos,
+ /*OPTIONAL*/distance_matrix_t *distance_matrix,
+ /*OUT*/besthit_t *hit);
+
+/* Computes all pairs of profile distances, applies pseudocounts
+ if pseudoWeight > 0, and applies log-correction if logdist is true.
+ The lower index is compared to the higher index, e.g. for profiles
+ A,B,C,D the comparison will be as in quartet_pair_t
+*/
+typedef enum {qAB,qAC,qAD,qBC,qBD,qCD} quartet_pair_t;
+void CorrectedPairDistances(profile_t **profiles, int nProfiles,
+ /*OPTIONAL*/distance_matrix_t *distance_matrix,
+ int nPos,
+ /*OUT*/double *distances);
+
+/* output is indexed by nni_t
+ To ensure good behavior while evaluating a subtree-prune-regraft move as a series
+ of nearest-neighbor interchanges, this uses a distance-ish model of constraints,
+ as given by PairConstraintDistance(), rather than
+ counting the number of violated splits (which is what FastTree does
+ during neighbor-joining).
+ Thus, penalty values may well be >0 even if no constraints are violated, but the
+ relative scores for the three NNIs will be correct.
+ */
+void QuartetConstraintPenalties(profile_t *profiles[4], int nConstraints, /*OUT*/double d[3]);
+
+double PairConstraintDistance(int nOn1, int nOff1, int nOn2, int nOff2);
+
+/* the split is consistent with the constraint if any of the profiles have no data
+ or if three of the profiles have the same uniform value (all on or all off)
+ or if AB|CD = 00|11 or 11|00 (all uniform)
+ */
+bool SplitViolatesConstraint(profile_t *profiles[4], int iConstraint);
+
+/* If false, no values were set because this constraint was not relevant.
+ output is for the 3 splits
+*/
+bool QuartetConstraintPenaltiesPiece(profile_t *profiles[4], int iConstraint, /*OUT*/double penalty[3]);
+
+/* Apply Jukes-Cantor or scoredist-like log(1-d) transform
+ to correct the distance for multiple substitutions.
+*/
+double LogCorrect(double distance);
+
+/* AverageProfile is used to do a weighted combination of nodes
+ when doing a join. If weight is negative, then the value is ignored and the profiles
+ are averaged. The weight is *not* adjusted for the gap content of the nodes.
+ Also, the weight does not affect the representation of the constraints
+*/
+profile_t *AverageProfile(profile_t *profile1, profile_t *profile2,
+ int nPos, int nConstraints,
+ distance_matrix_t *distance_matrix,
+ double weight1);
+
+/* PosteriorProfile() is like AverageProfile() but it computes posterior probabilities
+ rather than an average
+*/
+profile_t *PosteriorProfile(profile_t *profile1, profile_t *profile2,
+ double len1, double len2,
+ /*OPTIONAL*/transition_matrix_t *transmat,
+ rates_t *rates,
+ int nPos, int nConstraints);
+
+/* Set a node's profile from its children.
+ Deletes the previous profile if it exists
+ Use -1.0 for a balanced join
+ Fails unless the node has two children (e.g., no leaves or root)
+*/
+void SetProfile(/*IN/OUT*/NJ_t *NJ, int node, double weight1);
+
+/* OutProfile does an unweighted combination of nodes to create the
+ out-profile. It always sets code to NOCODE so that UpdateOutProfile
+ can work.
+*/
+profile_t *OutProfile(profile_t **profiles, int nProfiles,
+ int nPos, int nConstraints,
+ distance_matrix_t *distance_matrix);
+
+void UpdateOutProfile(/*UPDATE*/profile_t *out, profile_t *old1, profile_t *old2,
+ profile_t *new, int nActiveOld,
+ int nPos, int nConstraints,
+ distance_matrix_t *distance_matrix);
+
+profile_t *NewProfile(int nPos, int nConstraints); /* returned has no vectors */
+profile_t *FreeProfile(profile_t *profile, int nPos, int nConstraints); /* returns NULL */
+
+void AllocRateCategories(/*IN/OUT*/rates_t *rates, int nRateCategories, int nPos);
+
+/* f1 can be NULL if code1 != NOCODE, and similarly for f2
+ Or, if (say) weight1 was 0, then can have code1==NOCODE *and* f1==NULL
+ In that case, returns an arbitrary large number.
+*/
+double ProfileDistPiece(unsigned int code1, unsigned int code2,
+ numeric_t *f1, numeric_t *f2,
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ /*OPTIONAL*/numeric_t *codeDist2);
+
+/* Adds (or subtracts, if weight is negative) fIn/codeIn from fOut
+ fOut is assumed to exist (as from an outprofile)
+ do not call unless weight of input profile > 0
+ */
+void AddToFreq(/*IN/OUT*/numeric_t *fOut, double weight,
+ unsigned int codeIn, /*OPTIONAL*/numeric_t *fIn,
+ /*OPTIONAL*/distance_matrix_t *dmat);
+
+/* Divide the vector (of length nCodes) by a constant
+ so that the total (unrotated) frequency is 1.0 */
+void NormalizeFreq(/*IN/OUT*/numeric_t *freq, distance_matrix_t *distance_matrix);
+
+/* Allocate, if necessary, and recompute the codeDist*/
+void SetCodeDist(/*IN/OUT*/profile_t *profile, int nPos, distance_matrix_t *dmat);
+
+/* The allhits list contains the distances of the node to all other active nodes
+ This is useful for the "reset" improvement to the visible set
+ Note that the following routines do not handle the tophits heuristic
+ and assume that out-distances are up to date.
+*/
+void SetBestHit(int node, NJ_t *NJ, int nActive,
+ /*OUT*/besthit_t *bestjoin,
+ /*OUT OPTIONAL*/besthit_t *allhits);
+void ExhaustiveNJSearch(NJ_t *NJ, int nActive, /*OUT*/besthit_t *bestjoin);
+
+/* Searches the visible set */
+void FastNJSearch(NJ_t *NJ, int nActive, /*UPDATE*/besthit_t *visible, /*OUT*/besthit_t *bestjoin);
+
+/* Subroutines for handling the tophits heuristic */
+
+top_hits_t *InitTopHits(NJ_t *NJ, int m);
+top_hits_t *FreeTopHits(top_hits_t *tophits); /* returns NULL */
+
+/* Before we do any joins -- sets tophits and visible
+ NJ may be modified by setting out-distances
+ */
+void SetAllLeafTopHits(/*IN/UPDATE*/NJ_t *NJ, /*IN/OUT*/top_hits_t *tophits);
+
+/* Find the best join to do. */
+void TopHitNJSearch(/*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ /*IN/OUT*/top_hits_t *tophits,
+ /*OUT*/besthit_t *bestjoin);
+
+/* Returns the best hit within top hits
+ NJ may be modified because it updates out-distances if they are too stale
+ Does *not* update visible set
+*/
+void GetBestFromTopHits(int iNode, /*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN*/top_hits_t *tophits,
+ /*OUT*/besthit_t *bestjoin);
+
+/* visible set is modifiable so that we can reset it more globally when we do
+ a "refresh", but we also set the visible set for newnode and do any
+ "reset" updates too. And, we update many outdistances.
+ */
+void TopHitJoin(int newnode,
+ /*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN/OUT*/top_hits_t *tophits);
+
+/* Sort the input besthits by criterion
+ and save the best nOut hits as a new array in top_hits_lists
+ Does not update criterion or out-distances
+ Ignores (silently removes) hit to self
+ Saved list may be shorter than requested if there are insufficient entries
+*/
+void SortSaveBestHits(int iNode, /*IN/SORT*/besthit_t *besthits,
+ int nIn, int nOut,
+ /*IN/OUT*/top_hits_t *tophits);
+
+/* Given candidate hits from one node, "transfer" them to another node:
+ Stores them in a new place in the same order
+ searches up to active nodes if hits involve non-active nodes
+ If update flag is set, it also recomputes distance and criterion
+ (and ensures that out-distances are updated); otherwise
+ it sets dist to -1e20 and criterion to 1e20
+
+ */
+void TransferBestHits(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ int iNode,
+ /*IN*/besthit_t *oldhits,
+ int nOldHits,
+ /*OUT*/besthit_t *newhits,
+ bool updateDistance);
+
+/* Create best hit objects from 1 or more hits. Do not update out-distances or set criteria */
+void HitsToBestHits(/*IN*/hit_t *hits, int nHits, int iNode, /*OUT*/besthit_t *newhits);
+besthit_t HitToBestHit(int i, hit_t hit);
+
+/* Given a set of besthit entries,
+ look for improvements to the visible set of the j entries.
+ Updates out-distances as it goes.
+ Also replaces stale nodes with this node, because a join is usually
+ how this happens (i.e. it does not need to walk up to ancestors).
+ Note this calls UpdateTopVisible() on any change
+*/
+void UpdateVisible(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN*/besthit_t *tophitsNode,
+ int nTopHits,
+ /*IN/OUT*/top_hits_t *tophits);
+
+/* Update the top-visible list to perhaps include this hit (O(sqrt(N)) time) */
+void UpdateTopVisible(/*IN*/NJ_t * NJ, int nActive,
+ int iNode, /*IN*/hit_t *hit,
+ /*IN/OUT*/top_hits_t *tophits);
+
+/* Recompute the top-visible subset of the visible set */
+void ResetTopVisible(/*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ /*IN/OUT*/top_hits_t *tophits);
+
+/* Make a shorter list with only unique entries.
+ Replaces any "dead" hits to nodes that have parents with their active ancestors
+ and ignores any that become dead.
+ Updates all criteria.
+ Combined gets sorted by i & j
+ The returned list is allocated to nCombined even though only *nUniqueOut entries are filled
+*/
+besthit_t *UniqueBestHits(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN/SORT*/besthit_t *combined, int nCombined,
+ /*OUT*/int *nUniqueOut);
+
+nni_t ChooseNNI(profile_t *profiles[4],
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ int nPos, int nConstraints,
+ /*OUT*/double criteria[3]); /* The three internal branch lengths or log likelihoods*/
+
+/* length[] is ordered as described by quartet_length_t, but after we do the swap
+ of B with C (to give AC|BD) or B with D (to get AD|BC), if that is the returned choice
+ bFast means do not consider NNIs if AB|CD is noticeably better than the star topology
+ (as implemented by MLQuartetOptimize).
+ If there are constraints, then the constraint penalty is included in criteria[]
+*/
+nni_t MLQuartetNNI(profile_t *profiles[4],
+ /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ int nPos, int nConstraints,
+ /*OUT*/double criteria[3], /* The three potential quartet log-likelihoods */
+ /*IN/OUT*/numeric_t length[5],
+ bool bFast);
+
+void OptimizeAllBranchLengths(/*IN/OUT*/NJ_t *NJ);
+double TreeLogLk(/*IN*/NJ_t *NJ, /*OPTIONAL OUT*/double *site_loglk);
+double MLQuartetLogLk(profile_t *pA, profile_t *pB, profile_t *pC, profile_t *pD,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN*/double branch_lengths[5],
+ /*OPTIONAL OUT*/double *site_likelihoods);
+
+/* Given a topology and branch lengths, estimate rates & recompute profiles */
+void SetMLRates(/*IN/OUT*/NJ_t *NJ, int nRateCategories);
+
+/* Returns a set of nRateCategories potential rates; the caller must free it */
+numeric_t *MLSiteRates(int nRateCategories);
+
+/* returns site_loglk so that
+ site_loglk[nPos*iRate + j] is the log likelihood of site j with rate iRate
+ The caller must free it.
+*/
+double *MLSiteLikelihoodsByRate(/*IN*/NJ_t *NJ, /*IN*/numeric_t *rates, int nRateCategories);
+
+typedef struct {
+ double mult; /* multiplier for the rates / divisor for the tree-length */
+ double alpha;
+ int nPos;
+ int nRateCats;
+ numeric_t *rates;
+ double *site_loglk;
+} siteratelk_t;
+
+double GammaLogLk(/*IN*/siteratelk_t *s, /*OPTIONAL OUT*/double *gamma_loglk_sites);
+
+/* Input site_loglk must be for each rate. Note that FastTree does not reoptimize
+ the branch lengths under the Gamma model -- it optimizes the overall scale.
+ Reports the gamma log likelihhod (and logs site likelihoods if fpLog is set),
+ and reports the rescaling value.
+*/
+double RescaleGammaLogLk(int nPos, int nRateCats,
+ /*IN*/numeric_t *rates, /*IN*/double *site_loglk,
+ /*OPTIONAL*/FILE *fpLog);
+
+/* P(value<=x) for the gamma distribution with shape parameter alpha and scale 1/alpha */
+double PGamma(double x, double alpha);
+
+/* Given a topology and branch lengths, optimize GTR rates and quickly reoptimize branch lengths
+ If gtrfreq is NULL, then empirical frequencies are used
+*/
+void SetMLGtr(/*IN/OUT*/NJ_t *NJ, /*OPTIONAL IN*/double *gtrfreq, /*OPTIONAL WRITE*/FILE *fpLog);
+
+/* P(A & B | len) = P(B | A, len) * P(A)
+ If site_likelihoods is present, multiplies those values by the site likelihood at each point
+ (Note it does not handle underflow)
+ */
+double PairLogLk(/*IN*/profile_t *p1, /*IN*/profile_t *p2, double length,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*OPTIONAL IN/OUT*/double *site_likelihoods);
+
+/* Branch lengths for 4-taxon tree ((A,B),C,D); I means internal */
+typedef enum {LEN_A,LEN_B,LEN_C,LEN_D,LEN_I} quartet_length_t;
+
+typedef struct {
+ int nPos;
+ transition_matrix_t *transmat;
+ rates_t *rates;
+ int nEval; /* number of likelihood evaluations */
+ /* The pair to optimize */
+ profile_t *pair1;
+ profile_t *pair2;
+} quartet_opt_t;
+
+double PairNegLogLk(double x, void *data); /* data must be a quartet_opt_t */
+
+typedef struct {
+ NJ_t *NJ;
+ double freq[4];
+ double rates[6];
+ int iRate; /* which rate to set x from */
+} gtr_opt_t;
+
+/* Returns -log_likelihood for the tree with the given rates
+ data must be a gtr_opt_t and x is used to set rate iRate
+ Does not recompute profiles -- assumes that the caller will
+*/
+double GTRNegLogLk(double x, void *data);
+
+/* Returns the resulting log likelihood. Optionally returns whether other
+ topologies should be abandoned, based on the difference between AB|CD and
+ the "star topology" (AB|CD with a branch length of MLMinBranchLength) exceeding
+ closeLogLkLimit.
+ If bStarTest is passed in, it only optimized the internal branch if
+ the star test is true. Otherwise, it optimized all 5 branch lengths
+ in turn.
+ */
+double MLQuartetOptimize(profile_t *pA, profile_t *pB, profile_t *pC, profile_t *pD,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN/OUT*/double branch_lengths[5],
+ /*OPTIONAL OUT*/bool *pStarTest,
+ /*OPTIONAL OUT*/double *site_likelihoods);
+
+/* Returns the resulting log likelihood */
+double MLPairOptimize(profile_t *pA, profile_t *pB,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN/OUT*/double *branch_length);
+
+/* Returns the number of steps considered, with the actual steps in steps[]
+ Modifies the tree by this chain of NNIs
+*/
+int FindSPRSteps(/*IN/OUT*/NJ_t *NJ,
+ int node,
+ int parent, /* sibling or parent of node to NNI to start the chain */
+ /*IN/OUT*/profile_t **upProfiles,
+ /*OUT*/spr_step_t *steps,
+ int maxSteps,
+ bool bFirstAC);
+
+/* Undo a single NNI */
+void UnwindSPRStep(/*IN/OUT*/NJ_t *NJ,
+ /*IN*/spr_step_t *step,
+ /*IN/OUT*/profile_t **upProfiles);
+
+
+/* Update the profile of node and its ancestor, and delete nearby out-profiles */
+void UpdateForNNI(/*IN/OUT*/NJ_t *NJ, int node, /*IN/OUT*/profile_t **upProfiles, bool useML);
+
+/* Sets NJ->parent[newchild] and replaces oldchild with newchild
+ in the list of children of parent
+*/
+void ReplaceChild(/*IN/OUT*/NJ_t *NJ, int parent, int oldchild, int newchild);
+
+int CompareHitsByCriterion(const void *c1, const void *c2);
+int CompareHitsByIJ(const void *c1, const void *c2);
+
+int NGaps(NJ_t *NJ, int node); /* only handles leaf sequences */
+
+/* node is the parent of AB, sibling of C
+ node cannot be root or a leaf
+ If node is the child of root, then D is the other sibling of node,
+ and the 4th profile is D's profile.
+ Otherwise, D is the parent of node, and we use its upprofile
+ Call this with profiles=NULL to get the nodes, without fetching or
+ computing profiles
+*/
+void SetupABCD(NJ_t *NJ, int node,
+ /* the 4 profiles for ABCD; the last one is an upprofile */
+ /*OPTIONAL OUT*/profile_t *profiles[4],
+ /*OPTIONAL IN/OUT*/profile_t **upProfiles,
+ /*OUT*/int nodeABCD[4],
+ bool useML);
+
+int Sibling(NJ_t *NJ, int node); /* At root, no unique sibling so returns -1 */
+void RootSiblings(NJ_t *NJ, int node, /*OUT*/int sibs[2]);
+
+/* JC probability of nucleotide not changing, for each rate category */
+double *PSameVector(double length, rates_t *rates);
+
+/* JC probability of nucleotide not changing, for each rate category */
+double *PDiffVector(double *pSame, rates_t *rates);
+
+/* expeigen[iRate*nCodes + j] = exp(length * rate iRate * eigenvalue j) */
+numeric_t *ExpEigenRates(double length, transition_matrix_t *transmat, rates_t *rates);
+
+/* Print a progress report if more than 0.1 second has gone by since the progress report */
+/* Format should include 0-4 %d references and no newlines */
+void ProgressReport(char *format, int iArg1, int iArg2, int iArg3, int iArg4);
+void LogTree(char *format, int round, /*OPTIONAL WRITE*/FILE *fp, NJ_t *NJ, char **names, uniquify_t *unique, bool bQuote);
+void LogMLRates(/*OPTIONAL WRITE*/FILE *fpLog, NJ_t *NJ);
+
+void *mymalloc(size_t sz); /* Prints "Out of memory" and exits on failure */
+void *myfree(void *, size_t sz); /* Always returns NULL */
+
+/* One-dimensional minimization using brent's function, with
+ a fractional and an absolute tolerance */
+double onedimenmin(double xmin, double xguess, double xmax, double (*f)(double,void*), void *data,
+ double ftol, double atol,
+ /*OUT*/double *fx, /*OUT*/double *f2x);
+
+double brent(double ax, double bx, double cx, double (*f)(double, void *), void *data,
+ double ftol, double atol,
+ double *foptx, double *f2optx, double fax, double fbx, double fcx);
+
+/* Vector operations, either using SSE3 or not
+ Code assumes that vectors are a multiple of 4 in size
+*/
+void vector_multiply(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, int n, /*OUT*/numeric_t *fOut);
+numeric_t vector_multiply_sum(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, int n);
+void vector_add_mult(/*IN/OUT*/numeric_t *f, /*IN*/numeric_t *add, numeric_t weight, int n);
+
+/* multiply the transpose of a matrix by a vector */
+void matrixt_by_vector4(/*IN*/numeric_t mat[4][MAXCODES], /*IN*/numeric_t vec[4], /*OUT*/numeric_t out[4]);
+
+/* sum(f1*fBy)*sum(f2*fBy) */
+numeric_t vector_dot_product_rot(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, /*IN*/numeric_t* fBy, int n);
+
+/* sum(f1*f2*f3) */
+numeric_t vector_multiply3_sum(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, /*IN*/numeric_t* f3, int n);
+
+numeric_t vector_sum(/*IN*/numeric_t *f1, int n);
+void vector_multiply_by(/*IN/OUT*/numeric_t *f, /*IN*/numeric_t fBy, int n);
+
+double clockDiff(/*IN*/struct timeval *clock_start);
+int timeval_subtract (/*OUT*/struct timeval *result, /*IN*/struct timeval *x, /*IN*/struct timeval *y);
+
+char *OpenMPString(void);
+
+void ran_start(long seed);
+double knuth_rand(); /* Random number between 0 and 1 */
+void tred2 (double *a, const int n, const int np, double *d, double *e);
+double pythag(double a, double b);
+void tqli(double *d, double *e, int n, int np, double *z);
+
+/* Like mymalloc; duplicates the input (returns NULL if given NULL) */
+void *mymemdup(void *data, size_t sz);
+void *myrealloc(void *data, size_t szOld, size_t szNew, bool bCopy);
+
+double pnorm(double z); /* Probability(value <=z) */
+
+/* Hashtable functions */
+typedef struct
+{
+ char *string;
+ int nCount; /* number of times this entry was seen */
+ int first; /* index of first entry with this value */
+} hashbucket_t;
+
+typedef struct {
+ int nBuckets;
+ /* hashvalue -> bucket. Or look in bucket + 1, +2, etc., till you hit a NULL string */
+ hashbucket_t *buckets;
+} hashstrings_t;
+typedef int hashiterator_t;
+
+hashstrings_t *MakeHashtable(char **strings, int nStrings);
+hashstrings_t *FreeHashtable(hashstrings_t* hash); /*returns NULL*/
+hashiterator_t FindMatch(hashstrings_t *hash, char *string);
+
+/* Return NULL if we have run out of values */
+char *GetHashString(hashstrings_t *hash, hashiterator_t hi);
+int HashCount(hashstrings_t *hash, hashiterator_t hi);
+int HashFirst(hashstrings_t *hash, hashiterator_t hi);
+
+void PrintNJ(/*WRITE*/FILE *, NJ_t *NJ, char **names, uniquify_t *unique, bool bShowSupport, bool bQuoteNames);
+
+/* Print topology using node indices as node names */
+void PrintNJInternal(/*WRITE*/FILE *, NJ_t *NJ, bool useLen);
+
+uniquify_t *UniquifyAln(/*IN*/alignment_t *aln);
+uniquify_t *FreeUniquify(uniquify_t *); /* returns NULL */
+
+/* Convert a constraint alignment to a list of sequences. The returned array is indexed
+ by iUnique and points to values in the input alignment
+*/
+char **AlnToConstraints(alignment_t *constraints, uniquify_t *unique, hashstrings_t *hashnames);
+
+/* ReadTree ignores non-unique leaves after the first instance.
+ At the end, it prunes the tree to ignore empty children and it
+ unroots the tree if necessary.
+*/
+void ReadTree(/*IN/OUT*/NJ_t *NJ,
+ /*IN*/uniquify_t *unique,
+ /*IN*/hashstrings_t *hashnames,
+ /*READ*/FILE *fpInTree);
+char *ReadTreeToken(/*READ*/FILE *fp); /* returns a static array, or NULL on EOF */
+void ReadTreeAddChild(int parent, int child, /*IN/OUT*/int *parents, /*IN/OUT*/children_t *children);
+/* Do not add the leaf if we already set this unique-set to another parent */
+void ReadTreeMaybeAddLeaf(int parent, char *name,
+ hashstrings_t *hashnames, uniquify_t *unique,
+ /*IN/OUT*/int *parents, /*IN/OUT*/children_t *children);
+void ReadTreeRemove(/*IN/OUT*/int *parents, /*IN/OUT*/children_t *children, int node);
+
+/* Routines to support tree traversal and prevent visiting a node >1 time
+ (esp. if topology changes).
+*/
+typedef bool *traversal_t;
+traversal_t InitTraversal(NJ_t*);
+void SkipTraversalInto(int node, /*IN/OUT*/traversal_t traversal);
+traversal_t FreeTraversal(traversal_t, NJ_t*); /*returns NULL*/
+
+/* returns new node, or -1 if nothing left to do. Use root for the first call.
+ Will return every node and then root.
+ Uses postorder tree traversal (depth-first search going down to leaves first)
+ Keeps track of which nodes are visited, so even after an NNI that swaps a
+ visited child with an unvisited uncle, the next call will visit the
+ was-uncle-now-child. (However, after SPR moves, there is no such guarantee.)
+
+ If pUp is not NULL, then, if going "back up" through a previously visited node
+ (presumably due to an NNI), then it will return the node another time,
+ with *pUp = true.
+*/
+int TraversePostorder(int lastnode, NJ_t *NJ, /*IN/OUT*/traversal_t,
+ /*OUT OPTIONAL*/bool *pUp);
+
+/* Routines to support storing up-profiles during tree traversal
+ Eventually these should be smart enough to do weighted joins and
+ to minimize memory usage
+*/
+profile_t **UpProfiles(NJ_t *NJ);
+profile_t *GetUpProfile(/*IN/OUT*/profile_t **upProfiles, NJ_t *NJ, int node, bool useML);
+profile_t *DeleteUpProfile(/*IN/OUT*/profile_t **upProfiles, NJ_t *NJ, int node); /* returns NULL */
+profile_t **FreeUpProfiles(profile_t **upProfiles, NJ_t *NJ); /* returns NULL */
+
+/* Recomputes the profile for a node, presumably to reflect topology changes
+ If bionj is set, does a weighted join -- which requires using upProfiles
+ If useML is set, computes the posterior probability instead of averaging
+ */
+void RecomputeProfile(/*IN/OUT*/NJ_t *NJ, /*IN/OUT*/profile_t **upProfiles, int node, bool useML);
+
+/* Recompute profiles going up from the leaves, using the provided distance matrix
+ and unweighted joins
+*/
+void RecomputeProfiles(/*IN/OUT*/NJ_t *NJ, /*OPTIONAL*/distance_matrix_t *dmat);
+
+void RecomputeMLProfiles(/*IN/OUT*/NJ_t *NJ);
+
+/* If bionj is set, computes the weight to be given to A when computing the
+ profile for the ancestor of A and B. C and D are the other profiles in the quartet
+ If bionj is not set, returns -1 (which means unweighted in AverageProfile).
+ (A and B are the first two profiles in the array)
+*/
+double QuartetWeight(profile_t *profiles[4], distance_matrix_t *dmat, int nPos);
+
+/* Returns a list of nodes, starting with node and ending with root */
+int *PathToRoot(NJ_t *NJ, int node, /*OUT*/int *depth);
+int *FreePath(int *path, NJ_t *NJ); /* returns NULL */
+
+/* The default amino acid distance matrix, derived from the BLOSUM45 similarity matrix */
+distance_matrix_t matrixBLOSUM45;
+
+/* The default amino acid transition matrix (Jones Taylor Thorton 1992) */
+double matrixJTT92[MAXCODES][MAXCODES];
+double statJTT92[MAXCODES];
+
+/* The WAG amino acid transition matrix (Whelan-And-Goldman 2001) */
+double matrixWAG01[MAXCODES][MAXCODES];
+double statWAG01[MAXCODES];
+
+
+int main(int argc, char **argv) {
+ int nAlign = 1; /* number of alignments to read */
+ int iArg;
+ char *matrixPrefix = NULL;
+ distance_matrix_t *distance_matrix = NULL;
+ bool make_matrix = false;
+ char *constraintsFile = NULL;
+ char *intreeFile = NULL;
+ bool intree1 = false; /* the same starting tree each round */
+ int nni = -1; /* number of rounds of NNI, defaults to 4*log2(n) */
+ int spr = 2; /* number of rounds of SPR */
+ int maxSPRLength = 10; /* maximum distance to move a node */
+ int MLnni = -1; /* number of rounds of ML NNI, defaults to 2*log2(n) */
+ bool MLlen = false; /* optimize branch lengths; no topology changes */
+ int nBootstrap = 1000; /* If set, number of replicates of local bootstrap to do */
+ int nRateCats = nDefaultRateCats;
+ char *logfile = NULL;
+ bool bUseGtr = false;
+ bool bUseWag = false;
+ bool bUseGtrRates = false;
+ double gtrrates[6] = {1,1,1,1,1,1};
+ bool bUseGtrFreq = false;
+ double gtrfreq[4] = {0.25,0.25,0.25,0.25};
+ bool bQuote = false;
+ FILE *fpOut = stdout;
+
+ if (isatty(STDIN_FILENO) && argc == 1) {
+ fprintf(stderr,"Usage for FastTree version %s %s%s:\n%s",
+ FT_VERSION, SSE_STRING, OpenMPString(), usage);
+#if (defined _WIN32 || defined WIN32 || defined WIN64 || defined _WIN64)
+ fprintf(stderr, "Windows users: Please remember to run this inside a command shell\n");
+ fprintf(stderr,"Hit return to continue\n");
+ fgetc(stdin);
+#endif
+ exit(0);
+ }
+ for (iArg = 1; iArg < argc; iArg++) {
+ if (strcmp(argv[iArg],"-makematrix") == 0) {
+ make_matrix = true;
+ } else if (strcmp(argv[iArg],"-logdist") == 0) {
+ fprintf(stderr, "Warning: logdist is now on by default and obsolete\n");
+ } else if (strcmp(argv[iArg],"-rawdist") == 0) {
+ logdist = false;
+ } else if (strcmp(argv[iArg],"-verbose") == 0 && iArg < argc-1) {
+ verbose = atoi(argv[++iArg]);
+ } else if (strcmp(argv[iArg],"-quiet") == 0) {
+ verbose = 0;
+ showProgress = 0;
+ } else if (strcmp(argv[iArg],"-nopr") == 0) {
+ showProgress = 0;
+ } else if (strcmp(argv[iArg],"-slow") == 0) {
+ slow = 1;
+ } else if (strcmp(argv[iArg],"-fastest") == 0) {
+ fastest = 1;
+ tophitsRefresh = 0.5;
+ useTopHits2nd = true;
+ } else if (strcmp(argv[iArg],"-2nd") == 0) {
+ useTopHits2nd = true;
+ } else if (strcmp(argv[iArg],"-no2nd") == 0) {
+ useTopHits2nd = false;
+ } else if (strcmp(argv[iArg],"-slownni") == 0) {
+ fastNNI = false;
+ } else if (strcmp(argv[iArg], "-matrix") == 0 && iArg < argc-1) {
+ iArg++;
+ matrixPrefix = argv[iArg];
+ } else if (strcmp(argv[iArg], "-nomatrix") == 0) {
+ useMatrix = false;
+ } else if (strcmp(argv[iArg], "-n") == 0 && iArg < argc-1) {
+ iArg++;
+ nAlign = atoi(argv[iArg]);
+ if (nAlign < 1) {
+ fprintf(stderr, "-n argument for #input alignments must be > 0 not %s\n", argv[iArg]);
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg], "-quote") == 0) {
+ bQuote = true;
+ } else if (strcmp(argv[iArg], "-nt") == 0) {
+ nCodes = 4;
+ } else if (strcmp(argv[iArg], "-intree") == 0 && iArg < argc-1) {
+ iArg++;
+ intreeFile = argv[iArg];
+ } else if (strcmp(argv[iArg], "-intree1") == 0 && iArg < argc-1) {
+ iArg++;
+ intreeFile = argv[iArg];
+ intree1 = true;
+ } else if (strcmp(argv[iArg], "-nj") == 0) {
+ bionj = 0;
+ } else if (strcmp(argv[iArg], "-bionj") == 0) {
+ bionj = 1;
+ } else if (strcmp(argv[iArg], "-boot") == 0 && iArg < argc-1) {
+ iArg++;
+ nBootstrap = atoi(argv[iArg]);
+ } else if (strcmp(argv[iArg], "-noboot") == 0 || strcmp(argv[iArg], "-nosupport") == 0) {
+ nBootstrap = 0;
+ } else if (strcmp(argv[iArg], "-seed") == 0 && iArg < argc-1) {
+ iArg++;
+ long seed = atol(argv[iArg]);
+ ran_start(seed);
+ } else if (strcmp(argv[iArg],"-top") == 0) {
+ if(tophitsMult < 0.01)
+ tophitsMult = 1.0;
+ } else if (strcmp(argv[iArg],"-notop") == 0) {
+ tophitsMult = 0.0;
+ } else if (strcmp(argv[iArg], "-topm") == 0 && iArg < argc-1) {
+ iArg++;
+ tophitsMult = atof(argv[iArg]);
+ } else if (strcmp(argv[iArg], "-close") == 0 && iArg < argc-1) {
+ iArg++;
+ tophitsClose = atof(argv[iArg]);
+ if (tophitsMult <= 0) {
+ fprintf(stderr, "Cannot use -close unless -top is set above 0\n");
+ exit(1);
+ }
+ if (tophitsClose <= 0 || tophitsClose >= 1) {
+ fprintf(stderr, "-close argument must be between 0 and 1\n");
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg], "-refresh") == 0 && iArg < argc-1) {
+ iArg++;
+ tophitsRefresh = atof(argv[iArg]);
+ if (tophitsMult <= 0) {
+ fprintf(stderr, "Cannot use -refresh unless -top is set above 0\n");
+ exit(1);
+ }
+ if (tophitsRefresh <= 0 || tophitsRefresh >= 1) {
+ fprintf(stderr, "-refresh argument must be between 0 and 1\n");
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg],"-nni") == 0 && iArg < argc-1) {
+ iArg++;
+ nni = atoi(argv[iArg]);
+ if (nni == 0)
+ spr = 0;
+ } else if (strcmp(argv[iArg],"-spr") == 0 && iArg < argc-1) {
+ iArg++;
+ spr = atoi(argv[iArg]);
+ } else if (strcmp(argv[iArg],"-sprlength") == 0 && iArg < argc-1) {
+ iArg++;
+ maxSPRLength = atoi(argv[iArg]);
+ } else if (strcmp(argv[iArg],"-mlnni") == 0 && iArg < argc-1) {
+ iArg++;
+ MLnni = atoi(argv[iArg]);
+ } else if (strcmp(argv[iArg],"-noml") == 0) {
+ MLnni = 0;
+ } else if (strcmp(argv[iArg],"-mllen") == 0) {
+ MLnni = 0;
+ MLlen = true;
+ } else if (strcmp(argv[iArg],"-nome") == 0) {
+ spr = 0;
+ nni = 0;
+ } else if (strcmp(argv[iArg],"-help") == 0) {
+ fprintf(stderr,"FastTree %s %s%s:\n%s", FT_VERSION, SSE_STRING, OpenMPString(), usage);
+ exit(0);
+ } else if (strcmp(argv[iArg],"-expert") == 0) {
+ fprintf(stderr, "Detailed usage for FastTree %s %s%s:\n%s",
+ FT_VERSION, SSE_STRING, OpenMPString(), expertUsage);
+ exit(0);
+ } else if (strcmp(argv[iArg],"-pseudo") == 0) {
+ if (iArg < argc-1 && isdigit(argv[iArg+1][0])) {
+ iArg++;
+ pseudoWeight = atof(argv[iArg]);
+ if (pseudoWeight < 0.0) {
+ fprintf(stderr,"Illegal argument to -pseudo: %s\n", argv[iArg]);
+ exit(1);
+ }
+ } else {
+ pseudoWeight = 1.0;
+ }
+ } else if (strcmp(argv[iArg],"-constraints") == 0 && iArg < argc-1) {
+ iArg++;
+ constraintsFile = argv[iArg];
+ } else if (strcmp(argv[iArg],"-constraintWeight") == 0 && iArg < argc-1) {
+ iArg++;
+ constraintWeight = atof(argv[iArg]);
+ if (constraintWeight <= 0.0) {
+ fprintf(stderr, "Illegal argument to -constraintWeight (must be greater than zero): %s\n", argv[iArg]);
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg],"-mlacc") == 0 && iArg < argc-1) {
+ iArg++;
+ mlAccuracy = atoi(argv[iArg]);
+ if (mlAccuracy < 1) {
+ fprintf(stderr, "Illlegal -mlacc argument: %s\n", argv[iArg]);
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg],"-exactml") == 0 || strcmp(argv[iArg],"-mlexact") == 0) {
+ fprintf(stderr,"-exactml is not required -- exact posteriors is the default now\n");
+ } else if (strcmp(argv[iArg],"-approxml") == 0 || strcmp(argv[iArg],"-mlapprox") == 0) {
+ exactML = false;
+ } else if (strcmp(argv[iArg],"-cat") == 0 && iArg < argc-1) {
+ iArg++;
+ nRateCats = atoi(argv[iArg]);
+ if (nRateCats < 1) {
+ fprintf(stderr, "Illlegal argument to -ncat (must be greater than zero): %s\n", argv[iArg]);
+ exit(1);
+ }
+ } else if (strcmp(argv[iArg],"-nocat") == 0) {
+ nRateCats = 1;
+ } else if (strcmp(argv[iArg], "-wag") == 0) {
+ bUseWag = true;
+ } else if (strcmp(argv[iArg], "-gtr") == 0) {
+ bUseGtr = true;
+ } else if (strcmp(argv[iArg], "-gtrrates") == 0 && iArg < argc-6) {
+ bUseGtr = true;
+ bUseGtrRates = true;
+ int i;
+ for (i = 0; i < 6; i++) {
+ gtrrates[i] = atof(argv[++iArg]);
+ if (gtrrates[i] < 1e-5) {
+ fprintf(stderr, "Illegal or too small value of GTR rate: %s\n", argv[iArg]);
+ exit(1);
+ }
+ }
+ } else if (strcmp(argv[iArg],"-gtrfreq") == 0 && iArg < argc-4) {
+ bUseGtr = true;
+ bUseGtrFreq = true;
+ int i;
+ double sum = 0;
+ for (i = 0; i < 4; i++) {
+ gtrfreq[i] = atof(argv[++iArg]);
+ sum += gtrfreq[i];
+ if (gtrfreq[i] < 1e-5) {
+ fprintf(stderr, "Illegal or too small value of GTR frequency: %s\n", argv[iArg]);
+ exit(1);
+ }
+ }
+ if (fabs(1.0-sum) > 0.01) {
+ fprintf(stderr, "-gtrfreq values do not sum to 1\n");
+ exit(1);
+ }
+ for (i = 0; i < 4; i++)
+ gtrfreq[i] /= sum;
+ } else if (strcmp(argv[iArg],"-log") == 0 && iArg < argc-1) {
+ iArg++;
+ logfile = argv[iArg];
+ } else if (strcmp(argv[iArg],"-gamma") == 0) {
+ gammaLogLk = true;
+ } else if (strcmp(argv[iArg],"-out") == 0 && iArg < argc-1) {
+ iArg++;
+ fpOut = fopen(argv[iArg],"w");
+ if(fpOut==NULL) {
+ fprintf(stderr,"Cannot write to %s\n",argv[iArg]);
+ exit(1);
+ }
+ } else if (argv[iArg][0] == '-') {
+ fprintf(stderr, "Unknown or incorrect use of option %s\n%s", argv[iArg], usage);
+ exit(1);
+ } else
+ break;
+ }
+ if(iArg < argc-1) {
+ fprintf(stderr, "%s", usage);
+ exit(1);
+ }
+
+ codesString = nCodes == 20 ? codesStringAA : codesStringNT;
+ if (nCodes == 4 && matrixPrefix == NULL)
+ useMatrix = false; /* no default nucleotide matrix */
+
+ char *fileName = iArg == (argc-1) ? argv[argc-1] : NULL;
+
+ if (slow && fastest) {
+ fprintf(stderr,"Cannot be both slow and fastest\n");
+ exit(1);
+ }
+ if (slow && tophitsMult > 0) {
+ tophitsMult = 0.0;
+ }
+
+ FILE *fpLog = NULL;
+ if (logfile != NULL) {
+ fpLog = fopen(logfile, "w");
+ if (fpLog == NULL) {
+ fprintf(stderr, "Cannot write to: %s\n", logfile);
+ exit(1);
+ }
+ fprintf(fpLog, "Command:");
+ int i;
+ for (i=0; i < argc; i++)
+ fprintf(fpLog, " %s", argv[i]);
+ fprintf(fpLog,"\n");
+ fflush(fpLog);
+ }
+
+ int i;
+ FILE *fps[2] = {NULL,NULL};
+ int nFPs = 0;
+ if (verbose)
+ fps[nFPs++] = stderr;
+ if (fpLog != NULL)
+ fps[nFPs++] = fpLog;
+
+ if (!make_matrix) { /* Report settings */
+ char tophitString[100] = "no";
+ char tophitsCloseStr[100] = "default";
+ if(tophitsClose > 0) sprintf(tophitsCloseStr,"%.2f",tophitsClose);
+ if(tophitsMult>0) sprintf(tophitString,"%.2f*sqrtN close=%s refresh=%.2f",
+ tophitsMult, tophitsCloseStr, tophitsRefresh);
+ char supportString[100] = "none";
+ if (nBootstrap>0) {
+ if (MLnni != 0 || MLlen)
+ sprintf(supportString, "SH-like %d", nBootstrap);
+ else
+ sprintf(supportString,"Local boot %d",nBootstrap);
+ }
+ char nniString[100] = "(no NNI)";
+ if (nni > 0)
+ sprintf(nniString, "+NNI (%d rounds)", nni);
+ if (nni == -1)
+ strcpy(nniString, "+NNI");
+ char sprString[100] = "(no SPR)";
+ if (spr > 0)
+ sprintf(sprString, "+SPR (%d rounds range %d)", spr, maxSPRLength);
+ char mlnniString[100] = "(no ML-NNI)";
+ if(MLnni > 0)
+ sprintf(mlnniString, "+ML-NNI (%d rounds)", MLnni);
+ else if (MLnni == -1)
+ sprintf(mlnniString, "+ML-NNI");
+ else if (MLlen)
+ sprintf(mlnniString, "+ML branch lengths");
+ if ((MLlen || MLnni != 0) && !exactML)
+ strcat(mlnniString, " approx");
+ if (MLnni != 0)
+ sprintf(mlnniString+strlen(mlnniString), " opt-each=%d",mlAccuracy);
+
+ for (i = 0; i < nFPs; i++) {
+ FILE *fp = fps[i];
+ fprintf(fp,"FastTree Version %s %s%s\nAlignment: %s",
+ FT_VERSION, SSE_STRING, OpenMPString(), fileName != NULL ? fileName : "standard input");
+ if (nAlign>1)
+ fprintf(fp, " (%d alignments)", nAlign);
+ fprintf(fp,"\n%s distances: %s Joins: %s Support: %s\n",
+ nCodes == 20 ? "Amino acid" : "Nucleotide",
+ matrixPrefix ? matrixPrefix : (useMatrix? "BLOSUM45"
+ : (nCodes==4 && logdist ? "Jukes-Cantor" : "%different")),
+ bionj ? "weighted" : "balanced" ,
+ supportString);
+ if (intreeFile == NULL)
+ fprintf(fp, "Search: %s%s %s %s %s\nTopHits: %s\n",
+ slow?"Exhaustive (slow)" : (fastest ? "Fastest" : "Normal"),
+ useTopHits2nd ? "+2nd" : "",
+ nniString, sprString, mlnniString,
+ tophitString);
+ else
+ fprintf(fp, "Start at tree from %s %s %s\n", intreeFile, nniString, sprString);
+
+ if (MLnni != 0 || MLlen) {
+ fprintf(fp, "ML Model: %s,",
+ (nCodes == 4) ? (bUseGtr ? "Generalized Time-Reversible" : "Jukes-Cantor") : (bUseWag ? "Whelan-And-Goldman" : "Jones-Taylor-Thorton"));
+ if (nRateCats == 1)
+ fprintf(fp, " No rate variation across sites");
+ else
+ fprintf(fp, " CAT approximation with %d rate categories", nRateCats);
+ fprintf(fp, "\n");
+ if (nCodes == 4 && bUseGtrRates)
+ fprintf(fp, "GTR rates(ac ag at cg ct gt) %.4f %.4f %.4f %.4f %.4f %.4f\n",
+ gtrrates[0],gtrrates[1],gtrrates[2],gtrrates[3],gtrrates[4],gtrrates[5]);
+ if (nCodes == 4 && bUseGtrFreq)
+ fprintf(fp, "GTR frequencies(A C G T) %.4f %.4f %.4f %.4f\n",
+ gtrfreq[0],gtrfreq[1],gtrfreq[2],gtrfreq[3]);
+ }
+ if (constraintsFile != NULL)
+ fprintf(fp, "Constraints: %s Weight: %.3f\n", constraintsFile, constraintWeight);
+ if (pseudoWeight > 0)
+ fprintf(fp, "Pseudocount weight for comparing sequences with little overlap: %.3lf\n",pseudoWeight);
+ fflush(fp);
+ }
+ }
+ if (matrixPrefix != NULL) {
+ if (!useMatrix) {
+ fprintf(stderr,"Cannot use both -matrix and -nomatrix arguments!");
+ exit(1);
+ }
+ distance_matrix = ReadDistanceMatrix(matrixPrefix);
+ } else if (useMatrix) { /* use default matrix */
+ assert(nCodes==20);
+ distance_matrix = &matrixBLOSUM45;
+ SetupDistanceMatrix(distance_matrix);
+ } else {
+ distance_matrix = NULL;
+ }
+
+ int iAln;
+ FILE *fpIn = fileName != NULL ? fopen(fileName, "r") : stdin;
+ if (fpIn == NULL) {
+ fprintf(stderr, "Cannot read %s\n", fileName);
+ exit(1);
+ }
+ FILE *fpConstraints = NULL;
+ if (constraintsFile != NULL) {
+ fpConstraints = fopen(constraintsFile, "r");
+ if (fpConstraints == NULL) {
+ fprintf(stderr, "Cannot read %s\n", constraintsFile);
+ exit(1);
+ }
+ }
+
+ FILE *fpInTree = NULL;
+ if (intreeFile != NULL) {
+ fpInTree = fopen(intreeFile,"r");
+ if (fpInTree == NULL) {
+ fprintf(stderr, "Cannot read %s\n", intreeFile);
+ exit(1);
+ }
+ }
+
+ for(iAln = 0; iAln < nAlign; iAln++) {
+ alignment_t *aln = ReadAlignment(fpIn, bQuote);
+ if (aln->nSeq < 1) {
+ fprintf(stderr, "No alignment sequences\n");
+ exit(1);
+ }
+ if (fpLog) {
+ fprintf(fpLog, "Read %d sequences, %d positions\n", aln->nSeq, aln->nPos);
+ fflush(fpLog);
+ }
+
+ struct timeval clock_start;
+ gettimeofday(&clock_start,NULL);
+ ProgressReport("Read alignment",0,0,0,0);
+
+ /* Check that all names in alignment are unique */
+ hashstrings_t *hashnames = MakeHashtable(aln->names, aln->nSeq);
+ int i;
+ for (i=0; i<aln->nSeq; i++) {
+ hashiterator_t hi = FindMatch(hashnames,aln->names[i]);
+ if (HashCount(hashnames,hi) != 1) {
+ fprintf(stderr,"Non-unique name '%s' in the alignment\n",aln->names[i]);
+ exit(1);
+ }
+ }
+
+ /* Make a list of unique sequences -- note some lists are bigger than required */
+ ProgressReport("Hashed the names",0,0,0,0);
+ if (make_matrix) {
+ NJ_t *NJ = InitNJ(aln->seqs, aln->nSeq, aln->nPos,
+ /*constraintSeqs*/NULL, /*nConstraints*/0,
+ distance_matrix, /*transmat*/NULL);
+ printf(" %d\n",aln->nSeq);
+ int i,j;
+ for(i = 0; i < NJ->nSeq; i++) {
+ printf("%s",aln->names[i]);
+ for (j = 0; j < NJ->nSeq; j++) {
+ besthit_t hit;
+ SeqDist(NJ->profiles[i]->codes,NJ->profiles[j]->codes,NJ->nPos,NJ->distance_matrix,/*OUT*/&hit);
+ if (logdist)
+ hit.dist = LogCorrect(hit.dist);
+ /* Make sure -0 prints as 0 */
+ printf(" %f", hit.dist <= 0.0 ? 0.0 : hit.dist);
+ }
+ printf("\n");
+ }
+ } else {
+ /* reset counters*/
+ profileOps = 0;
+ outprofileOps = 0;
+ seqOps = 0;
+ profileAvgOps = 0;
+ nHillBetter = 0;
+ nCloseUsed = 0;
+ nClose2Used = 0;
+ nRefreshTopHits = 0;
+ nVisibleUpdate = 0;
+ nNNI = 0;
+ nML_NNI = 0;
+ nProfileFreqAlloc = 0;
+ nProfileFreqAvoid = 0;
+ szAllAlloc = 0;
+ mymallocUsed = 0;
+ maxmallocHeap = 0;
+ nLkCompute = 0;
+ nPosteriorCompute = 0;
+ nAAPosteriorExact = 0;
+ nAAPosteriorRough = 0;
+ nStarTests = 0;
+
+ uniquify_t *unique = UniquifyAln(aln);
+ ProgressReport("Identified unique sequences",0,0,0,0);
+
+ /* read constraints */
+ alignment_t *constraints = NULL;
+ char **uniqConstraints = NULL;
+ if (constraintsFile != NULL) {
+ constraints = ReadAlignment(fpConstraints, bQuote);
+ if (constraints->nSeq < 4) {
+ fprintf(stderr, "Warning: constraints file with less than 4 sequences ignored:\nalignment #%d in %s\n",
+ iAln+1, constraintsFile);
+ constraints = FreeAlignment(constraints);
+ } else {
+ uniqConstraints = AlnToConstraints(constraints, unique, hashnames);
+ ProgressReport("Read the constraints",0,0,0,0);
+ }
+ } /* end load constraints */
+
+ transition_matrix_t *transmat = NULL;
+ if (nCodes == 20) {
+ transmat = bUseWag? CreateTransitionMatrix(matrixWAG01,statWAG01) : CreateTransitionMatrix(matrixJTT92,statJTT92);
+ } else if (nCodes == 4 && bUseGtr && (bUseGtrRates || bUseGtrFreq)) {
+ transmat = CreateGTR(gtrrates,gtrfreq);
+ }
+ NJ_t *NJ = InitNJ(unique->uniqueSeq, unique->nUnique, aln->nPos,
+ uniqConstraints,
+ uniqConstraints != NULL ? constraints->nPos : 0, /* nConstraints */
+ distance_matrix,
+ transmat);
+ if (verbose>2) fprintf(stderr, "read %s seqs %d (%d unique) positions %d nameLast %s seqLast %s\n",
+ fileName ? fileName : "standard input",
+ aln->nSeq, unique->nUnique, aln->nPos, aln->names[aln->nSeq-1], aln->seqs[aln->nSeq-1]);
+ FreeAlignmentSeqs(/*IN/OUT*/aln); /*no longer needed*/
+ if (fpInTree != NULL) {
+ if (intree1)
+ fseek(fpInTree, 0L, SEEK_SET);
+ ReadTree(/*IN/OUT*/NJ, /*IN*/unique, /*IN*/hashnames, /*READ*/fpInTree);
+ if (verbose > 2)
+ fprintf(stderr, "Read tree from %s\n", intreeFile);
+ if (verbose > 2)
+ PrintNJ(stderr, NJ, aln->names, unique, /*support*/false, bQuote);
+ } else {
+ FastNJ(NJ);
+ }
+ LogTree("NJ", 0, fpLog, NJ, aln->names, unique, bQuote);
+
+ /* profile-frequencies for the "up-profiles" in ReliabilityNJ take only diameter(Tree)*L*a
+ space not N*L*a space, because we can free them as we go.
+ And up-profile by their nature tend to be complicated.
+ So save the profile-frequency memory allocation counters now to exclude later results.
+ */
+#ifdef TRACK_MEMORY
+ long svProfileFreqAlloc = nProfileFreqAlloc;
+ long svProfileFreqAvoid = nProfileFreqAvoid;
+#endif
+ int nniToDo = nni == -1 ? (int)(0.5 + 4.0 * log(NJ->nSeq)/log(2)) : nni;
+ int sprRemaining = spr;
+ int MLnniToDo = (MLnni != -1) ? MLnni : (int)(0.5 + 2.0*log(NJ->nSeq)/log(2));
+ if(verbose>0) {
+ if (fpInTree == NULL)
+ fprintf(stderr, "Initial topology in %.2f seconds\n", clockDiff(&clock_start));
+ if (spr > 0 || nniToDo > 0 || MLnniToDo > 0)
+ fprintf(stderr,"Refining topology: %d rounds ME-NNIs, %d rounds ME-SPRs, %d rounds ML-NNIs\n", nniToDo, spr, MLnniToDo);
+ }
+
+ if (nniToDo>0) {
+ int i;
+ bool bConverged = false;
+ nni_stats_t *nni_stats = InitNNIStats(NJ);
+ for (i=0; i < nniToDo; i++) {
+ double maxDelta;
+ if (!bConverged) {
+ int nChange = NNI(/*IN/OUT*/NJ, i, nniToDo, /*use ml*/false, /*IN/OUT*/nni_stats, /*OUT*/&maxDelta);
+ LogTree("ME_NNI%d",i+1, fpLog, NJ, aln->names, unique, bQuote);
+ if (nChange == 0) {
+ bConverged = true;
+ if (verbose>1)
+ fprintf(stderr, "Min_evolution NNIs converged at round %d -- skipping some rounds\n", i+1);
+ if (fpLog)
+ fprintf(fpLog, "Min_evolution NNIs converged at round %d -- skipping some rounds\n", i+1);
+ }
+ }
+
+ /* Interleave SPRs with NNIs (typically 1/3rd NNI, SPR, 1/3rd NNI, SPR, 1/3rd NNI */
+ if (sprRemaining > 0 && (nniToDo/(spr+1) > 0 && ((i+1) % (nniToDo/(spr+1))) == 0)) {
+ SPR(/*IN/OUT*/NJ, maxSPRLength, spr-sprRemaining, spr);
+ LogTree("ME_SPR%d",spr-sprRemaining+1, fpLog, NJ, aln->names, unique, bQuote);
+ sprRemaining--;
+ /* Restart the NNIs -- set all ages to 0, etc. */
+ bConverged = false;
+ nni_stats = FreeNNIStats(nni_stats, NJ);
+ nni_stats = InitNNIStats(NJ);
+ }
+ }
+ nni_stats = FreeNNIStats(nni_stats, NJ);
+ }
+ while(sprRemaining > 0) { /* do any remaining SPR rounds */
+ SPR(/*IN/OUT*/NJ, maxSPRLength, spr-sprRemaining, spr);
+ LogTree("ME_SPR%d",spr-sprRemaining+1, fpLog, NJ, aln->names, unique, bQuote);
+ sprRemaining--;
+ }
+
+ /* In minimum-evolution mode, update branch lengths, even if no NNIs or SPRs,
+ so that they are log-corrected, do not include penalties from constraints,
+ and avoid errors due to approximation of out-distances.
+ If doing maximum-likelihood NNIs, then we'll also use these
+ to get estimates of starting distances for quartets, etc.
+ */
+ UpdateBranchLengths(/*IN/OUT*/NJ);
+ LogTree("ME_Lengths",0, fpLog, NJ, aln->names, unique, bQuote);
+
+ double total_len = 0;
+ int iNode;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++)
+ total_len += fabs(NJ->branchlength[iNode]);
+
+ if (verbose>0) {
+ fprintf(stderr, "Total branch-length %.3f after %.2f sec\n",
+ total_len, clockDiff(&clock_start));
+ fflush(stderr);
+ }
+ if (fpLog) {
+ fprintf(fpLog, "Total branch-length %.3f after %.2f sec\n",
+ total_len, clockDiff(&clock_start));
+ fflush(stderr);
+ }
+
+#ifdef TRACK_MEMORY
+ if (verbose>1) {
+ struct mallinfo mi = mallinfo();
+ fprintf(stderr, "Memory @ end of ME phase: %.2f MB (%.1f byte/pos) useful %.2f expected %.2f\n",
+ (mi.arena+mi.hblkhd)/1.0e6, (mi.arena+mi.hblkhd)/(double)(NJ->nSeq*(double)NJ->nPos),
+ mi.uordblks/1.0e6, mymallocUsed/1e6);
+ }
+#endif
+
+ SplitCount_t splitcount = {0,0,0,0,0.0,0.0};
+
+ if (MLnniToDo > 0 || MLlen) {
+ bool warn_len = total_len/NJ->maxnode < 0.001 && MLMinBranchLengthTolerance > 1.0/aln->nPos;
+ bool warn = warn_len || (total_len/NJ->maxnode < 0.001 && aln->nPos >= 10000);
+ if (warn)
+ fprintf(stderr, "\nWARNING! This alignment consists of closely-related and very-long sequences.\n");
+ if (warn_len)
+ fprintf(stderr,
+ "This version of FastTree may not report reasonable branch lengths!\n"
+#ifdef USE_DOUBLE
+ "Consider changing MLMinBranchLengthTolerance.\n"
+#else
+ "Consider recompiling FastTree with -DUSE_DOUBLE.\n"
+#endif
+ "For more information, visit\n"
+ "http://www.microbesonline.org/fasttree/#BranchLen\n\n");
+ if (warn)
+ fprintf(stderr, "WARNING! FastTree (or other standard maximum-likelihood tools)\n"
+ "may not be appropriate for aligments of very closely-related sequences\n"
+ "like this one, as FastTree does not account for recombination or gene conversion\n\n");
+
+ /* Do maximum-likelihood computations */
+ /* Convert profiles to use the transition matrix */
+ distance_matrix_t *tmatAsDist = TransMatToDistanceMat(/*OPTIONAL*/NJ->transmat);
+ RecomputeProfiles(NJ, /*OPTIONAL*/tmatAsDist);
+ tmatAsDist = myfree(tmatAsDist, sizeof(distance_matrix_t));
+ double lastloglk = -1e20;
+ nni_stats_t *nni_stats = InitNNIStats(NJ);
+ bool resetGtr = nCodes == 4 && bUseGtr && !bUseGtrRates;
+
+ if (MLlen) {
+ int iRound;
+ int maxRound = (int)(0.5 + log(NJ->nSeq)/log(2));
+ double dLastLogLk = -1e20;
+ for (iRound = 1; iRound <= maxRound; iRound++) {
+ int node;
+ numeric_t *oldlength = (numeric_t*)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (node = 0; node < NJ->maxnode; node++)
+ oldlength[node] = NJ->branchlength[node];
+ OptimizeAllBranchLengths(/*IN/OUT*/NJ);
+ LogTree("ML_Lengths",iRound, fpLog, NJ, aln->names, unique, bQuote);
+ double dMaxChange = 0; /* biggest change in branch length */
+ for (node = 0; node < NJ->maxnode; node++) {
+ double d = fabs(oldlength[node] - NJ->branchlength[node]);
+ if (dMaxChange < d)
+ dMaxChange = d;
+ }
+ oldlength = myfree(oldlength, sizeof(numeric_t)*NJ->maxnodes);
+ double loglk = TreeLogLk(NJ, /*site_likelihoods*/NULL);
+ bool bConverged = iRound > 1 && (dMaxChange < 0.001 || loglk < (dLastLogLk+treeLogLkDelta));
+ if (verbose)
+ fprintf(stderr, "%d rounds ML lengths: LogLk %s= %.3lf Max-change %.4lf%s Time %.2f\n",
+ iRound,
+ exactML || nCodes != 20 ? "" : "~",
+ loglk,
+ dMaxChange,
+ bConverged ? " (converged)" : "",
+ clockDiff(&clock_start));
+ if (fpLog)
+ fprintf(fpLog, "TreeLogLk\tLength%d\t%.4lf\tMaxChange\t%.4lf\n",
+ iRound, loglk, dMaxChange);
+ if (iRound == 1) {
+ if (resetGtr)
+ SetMLGtr(/*IN/OUT*/NJ, bUseGtrFreq ? gtrfreq : NULL, fpLog);
+ SetMLRates(/*IN/OUT*/NJ, nRateCats);
+ LogMLRates(fpLog, NJ);
+ }
+ if (bConverged)
+ break;
+ }
+ }
+
+ if (MLnniToDo > 0) {
+ /* This may help us converge faster, and is fast */
+ OptimizeAllBranchLengths(/*IN/OUT*/NJ);
+ LogTree("ML_Lengths%d",1, fpLog, NJ, aln->names, unique, bQuote);
+ }
+
+ int iMLnni;
+ double maxDelta;
+ bool bConverged = false;
+ for (iMLnni = 0; iMLnni < MLnniToDo; iMLnni++) {
+ int changes = NNI(/*IN/OUT*/NJ, iMLnni, MLnniToDo, /*use ml*/true, /*IN/OUT*/nni_stats, /*OUT*/&maxDelta);
+ LogTree("ML_NNI%d",iMLnni+1, fpLog, NJ, aln->names, unique, bQuote);
+ double loglk = TreeLogLk(NJ, /*site_likelihoods*/NULL);
+ bool bConvergedHere = (iMLnni > 0) && ((loglk < lastloglk + treeLogLkDelta) || maxDelta < treeLogLkDelta);
+ if (verbose)
+ fprintf(stderr, "ML-NNI round %d: LogLk %s= %.3f NNIs %d max delta %.2f Time %.2f%s\n",
+ iMLnni+1,
+ exactML || nCodes != 20 ? "" : "~",
+ loglk, changes, maxDelta, clockDiff(&clock_start),
+ bConverged ? " (final)" : "");
+ if (fpLog)
+ fprintf(fpLog, "TreeLogLk\tML_NNI%d\t%.4lf\tMaxChange\t%.4lf\n", iMLnni+1, loglk, maxDelta);
+ if (bConverged)
+ break; /* we did our extra round */
+ if (bConvergedHere)
+ bConverged = true;
+ if (bConverged || iMLnni == MLnniToDo-2) {
+ /* last round uses high-accuracy seettings -- reset NNI stats to tone down heuristics */
+ nni_stats = FreeNNIStats(nni_stats, NJ);
+ nni_stats = InitNNIStats(NJ);
+ if (verbose)
+ fprintf(stderr, "Turning off heuristics for final round of ML NNIs%s\n",
+ bConvergedHere? " (converged)" : "");
+ if (fpLog)
+ fprintf(fpLog, "Turning off heuristics for final round of ML NNIs%s\n",
+ bConvergedHere? " (converged)" : "");
+ }
+ lastloglk = loglk;
+ if (iMLnni == 0 && NJ->rates.nRateCategories == 1) {
+ if (resetGtr)
+ SetMLGtr(/*IN/OUT*/NJ, bUseGtrFreq ? gtrfreq : NULL, fpLog);
+ SetMLRates(/*IN/OUT*/NJ, nRateCats);
+ LogMLRates(fpLog, NJ);
+ }
+ }
+ nni_stats = FreeNNIStats(nni_stats, NJ);
+
+ /* This does not take long and improves the results */
+ if (MLnniToDo > 0) {
+ OptimizeAllBranchLengths(/*IN/OUT*/NJ);
+ LogTree("ML_Lengths%d",2, fpLog, NJ, aln->names, unique, bQuote);
+ if (verbose || fpLog) {
+ double loglk = TreeLogLk(NJ, /*site_likelihoods*/NULL);
+ if (verbose)
+ fprintf(stderr, "Optimize all lengths: LogLk %s= %.3f Time %.2f\n",
+ exactML || nCodes != 20 ? "" : "~",
+ loglk,
+ clockDiff(&clock_start));
+ if (fpLog) {
+ fprintf(fpLog, "TreeLogLk\tML_Lengths%d\t%.4f\n", 2, loglk);
+ fflush(fpLog);
+ }
+ }
+ }
+
+ /* Count bad splits and compute SH-like supports if desired */
+ if ((MLnniToDo > 0 && !fastest) || nBootstrap > 0)
+ TestSplitsML(NJ, /*OUT*/&splitcount, nBootstrap);
+
+ /* Compute gamma-based likelihood? */
+ if (gammaLogLk && nRateCats > 1) {
+ numeric_t *rates = MLSiteRates(nRateCats);
+ double *site_loglk = MLSiteLikelihoodsByRate(NJ, rates, nRateCats);
+ double scale = RescaleGammaLogLk(NJ->nPos, nRateCats, rates, /*IN*/site_loglk, /*OPTIONAL*/fpLog);
+ rates = myfree(rates, sizeof(numeric_t) * nRateCats);
+ site_loglk = myfree(site_loglk, sizeof(double) * nRateCats * NJ->nPos);
+
+ for (i = 0; i < NJ->maxnodes; i++)
+ NJ->branchlength[i] *= scale;
+ }
+ } else {
+ /* Minimum evolution supports */
+ TestSplitsMinEvo(NJ, /*OUT*/&splitcount);
+ if (nBootstrap > 0)
+ ReliabilityNJ(NJ, nBootstrap);
+ }
+
+ for (i = 0; i < nFPs; i++) {
+ FILE *fp = fps[i];
+ fprintf(fp, "Total time: %.2f seconds Unique: %d/%d Bad splits: %d/%d",
+ clockDiff(&clock_start),
+ NJ->nSeq, aln->nSeq,
+ splitcount.nBadSplits, splitcount.nSplits);
+ if (splitcount.dWorstDeltaUnconstrained > 0)
+ fprintf(fp, " Worst %sdelta-%s %.3f",
+ uniqConstraints != NULL ? "unconstrained " : "",
+ (MLnniToDo > 0 || MLlen) ? "LogLk" : "Len",
+ splitcount.dWorstDeltaUnconstrained);
+ fprintf(fp,"\n");
+ if (NJ->nSeq > 3 && NJ->nConstraints > 0) {
+ fprintf(fp, "Violating constraints: %d both bad: %d",
+ splitcount.nConstraintViolations, splitcount.nBadBoth);
+ if (splitcount.dWorstDeltaConstrained > 0)
+ fprintf(fp, " Worst delta-%s due to constraints: %.3f",
+ (MLnniToDo > 0 || MLlen) ? "LogLk" : "Len",
+ splitcount.dWorstDeltaConstrained);
+ fprintf(fp,"\n");
+ }
+ if (verbose > 1 || fp == fpLog) {
+ double dN2 = NJ->nSeq*(double)NJ->nSeq;
+ fprintf(fp, "Dist/N**2: by-profile %.3f (out %.3f) by-leaf %.3f avg-prof %.3f\n",
+ profileOps/dN2, outprofileOps/dN2, seqOps/dN2, profileAvgOps/dN2);
+ if (nCloseUsed>0 || nClose2Used > 0 || nRefreshTopHits>0)
+ fprintf(fp, "Top hits: close neighbors %ld/%d 2nd-level %ld refreshes %ld",
+ nCloseUsed, NJ->nSeq, nClose2Used, nRefreshTopHits);
+ if(!slow) fprintf(fp, " Hill-climb: %ld Update-best: %ld\n", nHillBetter, nVisibleUpdate);
+ if (nniToDo > 0 || spr > 0 || MLnniToDo > 0)
+ fprintf(fp, "NNI: %ld SPR: %ld ML-NNI: %ld\n", nNNI, nSPR, nML_NNI);
+ if (MLnniToDo > 0) {
+ fprintf(fp, "Max-lk operations: lk %ld posterior %ld", nLkCompute, nPosteriorCompute);
+ if (nAAPosteriorExact > 0 || nAAPosteriorRough > 0)
+ fprintf(fp, " approximate-posteriors %.2f%%",
+ (100.0*nAAPosteriorRough)/(double)(nAAPosteriorExact+nAAPosteriorRough));
+ if (mlAccuracy < 2)
+ fprintf(fp, " star-only %ld", nStarTests);
+ fprintf(fp, "\n");
+ }
+ }
+#ifdef TRACK_MEMORY
+ fprintf(fp, "Memory: %.2f MB (%.1f byte/pos) ",
+ maxmallocHeap/1.0e6, maxmallocHeap/(double)(aln->nSeq*(double)aln->nPos));
+ /* Only report numbers from before we do reliability estimates */
+ fprintf(fp, "profile-freq-alloc %ld avoided %.2f%%\n",
+ svProfileFreqAlloc,
+ svProfileFreqAvoid > 0 ?
+ 100.0*svProfileFreqAvoid/(double)(svProfileFreqAlloc+svProfileFreqAvoid)
+ : 0);
+#endif
+ fflush(fp);
+ }
+ PrintNJ(fpOut, NJ, aln->names, unique, /*support*/nBootstrap > 0, bQuote);
+ fflush(fpOut);
+ if (fpLog) {
+ fprintf(fpLog,"TreeCompleted\n");
+ fflush(fpLog);
+ }
+ FreeNJ(NJ);
+ if (uniqConstraints != NULL)
+ uniqConstraints = myfree(uniqConstraints, sizeof(char*) * unique->nUnique);
+ constraints = FreeAlignment(constraints);
+ unique = FreeUniquify(unique);
+ } /* end build tree */
+ hashnames = FreeHashtable(hashnames);
+ aln = FreeAlignment(aln);
+ } /* end loop over alignments */
+ if (fpLog != NULL)
+ fclose(fpLog);
+ if (fpOut != stdout) fclose(fpOut);
+ exit(0);
+}
+
+void ProgressReport(char *format, int i1, int i2, int i3, int i4) {
+ static bool time_set = false;
+ static struct timeval time_last;
+ static struct timeval time_begin;
+
+ if (!showProgress)
+ return;
+
+ static struct timeval time_now;
+ gettimeofday(&time_now,NULL);
+ if (!time_set) {
+ time_begin = time_last = time_now;
+ time_set = true;
+ }
+ static struct timeval elapsed;
+ timeval_subtract(&elapsed,&time_now,&time_last);
+
+ if (elapsed.tv_sec > 1 || elapsed.tv_usec > 100*1000 || verbose > 1) {
+ timeval_subtract(&elapsed,&time_now,&time_begin);
+ fprintf(stderr, "%7i.%2.2i seconds: ", (int)elapsed.tv_sec, (int)(elapsed.tv_usec/10000));
+ fprintf(stderr, format, i1, i2, i3, i4);
+ if (verbose > 1 || !isatty(STDERR_FILENO)) {
+ fprintf(stderr, "\n");
+ } else {
+ fprintf(stderr, " \r");
+ }
+ fflush(stderr);
+ time_last = time_now;
+ }
+}
+
+void LogMLRates(/*OPTIONAL WRITE*/FILE *fpLog, NJ_t *NJ) {
+ if (fpLog != NULL) {
+ rates_t *rates = &NJ->rates;
+ fprintf(fpLog, "NCategories\t%d\nRates",rates->nRateCategories);
+ assert(rates->nRateCategories > 0);
+ int iRate;
+ for (iRate = 0; iRate < rates->nRateCategories; iRate++)
+ fprintf(fpLog, " %f", rates->rates[iRate]);
+ fprintf(fpLog,"\nSiteCategories");
+ int iPos;
+ for (iPos = 0; iPos < NJ->nPos; iPos++) {
+ iRate = rates->ratecat[iPos];
+ fprintf(fpLog," %d",iRate+1);
+ }
+ fprintf(fpLog,"\n");
+ fflush(fpLog);
+ }
+}
+
+void LogTree(char *format, int i, /*OPTIONAL WRITE*/FILE *fpLog, NJ_t *NJ, char **names, uniquify_t *unique, bool bQuote) {
+ if(fpLog != NULL) {
+ fprintf(fpLog, format, i);
+ fprintf(fpLog, "\t");
+ PrintNJ(fpLog, NJ, names, unique, /*support*/false, bQuote);
+ fflush(fpLog);
+ }
+}
+
+NJ_t *InitNJ(char **sequences, int nSeq, int nPos,
+ /*OPTIONAL*/char **constraintSeqs, int nConstraints,
+ /*OPTIONAL*/distance_matrix_t *distance_matrix,
+ /*OPTIONAL*/transition_matrix_t *transmat) {
+ int iNode;
+
+ NJ_t *NJ = (NJ_t*)mymalloc(sizeof(NJ_t));
+ NJ->root = -1; /* set at end of FastNJ() */
+ NJ->maxnode = NJ->nSeq = nSeq;
+ NJ->nPos = nPos;
+ NJ->maxnodes = 2*nSeq;
+ NJ->seqs = sequences;
+ NJ->distance_matrix = distance_matrix;
+ NJ->transmat = transmat;
+ NJ->nConstraints = nConstraints;
+ NJ->constraintSeqs = constraintSeqs;
+
+ NJ->profiles = (profile_t **)mymalloc(sizeof(profile_t*) * NJ->maxnodes);
+
+ unsigned long counts[256];
+ int i;
+ for (i = 0; i < 256; i++)
+ counts[i] = 0;
+ for (iNode = 0; iNode < NJ->nSeq; iNode++) {
+ NJ->profiles[iNode] = SeqToProfile(NJ, NJ->seqs[iNode], nPos,
+ constraintSeqs != NULL ? constraintSeqs[iNode] : NULL,
+ nConstraints,
+ iNode,
+ /*IN/OUT*/counts);
+ }
+ unsigned long totCount = 0;
+ for (i = 0; i < 256; i++)
+ totCount += counts[i];
+
+ /* warnings about unknown characters */
+ for (i = 0; i < 256; i++) {
+ if (counts[i] == 0 || i == '.' || i == '-')
+ continue;
+ unsigned char *codesP;
+ bool bMatched = false;
+ for (codesP = codesString; *codesP != '\0'; codesP++) {
+ if (*codesP == i || tolower(*codesP) == i) {
+ bMatched = true;
+ break;
+ }
+ }
+ if (!bMatched)
+ fprintf(stderr, "Ignored unknown character %c (seen %lu times)\n", i, counts[i]);
+ }
+
+
+ /* warnings about the counts */
+ double fACGTUN = (counts['A'] + counts['C'] + counts['G'] + counts['T'] + counts['U'] + counts['N']
+ + counts['a'] + counts['c'] + counts['g'] + counts['t'] + counts['u'] + counts['n'])
+ / (double)(totCount - counts['-'] - counts['.']);
+ if (nCodes == 4 && fACGTUN < 0.9)
+ fprintf(stderr, "WARNING! ONLY %.1f%% NUCLEOTIDE CHARACTERS -- IS THIS REALLY A NUCLEOTIDE ALIGNMENT?\n",
+ 100.0 * fACGTUN);
+ else if (nCodes == 20 && fACGTUN >= 0.9)
+ fprintf(stderr, "WARNING! %.1f%% NUCLEOTIDE CHARACTERS -- IS THIS REALLY A PROTEIN ALIGNMENT?\n",
+ 100.0 * fACGTUN);
+
+ if(verbose>10) fprintf(stderr,"Made sequence profiles\n");
+ for (iNode = NJ->nSeq; iNode < NJ->maxnodes; iNode++)
+ NJ->profiles[iNode] = NULL; /* not yet exists */
+
+ NJ->outprofile = OutProfile(NJ->profiles, NJ->nSeq,
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix);
+ if(verbose>10) fprintf(stderr,"Made out-profile\n");
+
+ NJ->totdiam = 0.0;
+
+ NJ->diameter = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->diameter[iNode] = 0;
+
+ NJ->varDiameter = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->varDiameter[iNode] = 0;
+
+ NJ->selfdist = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->selfdist[iNode] = 0;
+
+ NJ->selfweight = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->nSeq; iNode++)
+ NJ->selfweight[iNode] = NJ->nPos - NGaps(NJ,iNode);
+
+ NJ->outDistances = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ NJ->nOutDistActive = (int *)mymalloc(sizeof(int)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++)
+ NJ->nOutDistActive[iNode] = NJ->nSeq * 10; /* unreasonably high value */
+ NJ->parent = NULL; /* so SetOutDistance ignores it */
+ for (iNode = 0; iNode < NJ->nSeq; iNode++)
+ SetOutDistance(/*IN/UPDATE*/NJ, iNode, /*nActive*/NJ->nSeq);
+
+ if (verbose>2) {
+ for (iNode = 0; iNode < 4 && iNode < NJ->nSeq; iNode++)
+ fprintf(stderr, "Node %d outdist %f\n", iNode, NJ->outDistances[iNode]);
+ }
+
+ NJ->parent = (int *)mymalloc(sizeof(int)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->parent[iNode] = -1;
+
+ NJ->branchlength = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes); /* distance to parent */
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->branchlength[iNode] = 0;
+
+ NJ->support = (numeric_t *)mymalloc(sizeof(numeric_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->maxnodes; iNode++) NJ->support[iNode] = -1.0;
+
+ NJ->child = (children_t*)mymalloc(sizeof(children_t)*NJ->maxnodes);
+ for (iNode= 0; iNode < NJ->maxnode; iNode++) NJ->child[iNode].nChild = 0;
+
+ NJ->rates.nRateCategories = 0;
+ NJ->rates.rates = NULL;
+ NJ->rates.ratecat = NULL;
+ AllocRateCategories(&NJ->rates, 1, NJ->nPos);
+ return(NJ);
+}
+
+NJ_t *FreeNJ(NJ_t *NJ) {
+ if (NJ==NULL)
+ return(NJ);
+
+ int i;
+ for (i=0; i < NJ->maxnode; i++)
+ NJ->profiles[i] = FreeProfile(NJ->profiles[i], NJ->nPos, NJ->nConstraints);
+ NJ->profiles = myfree(NJ->profiles, sizeof(profile_t*) * NJ->maxnodes);
+ NJ->outprofile = FreeProfile(NJ->outprofile, NJ->nPos, NJ->nConstraints);
+ NJ->diameter = myfree(NJ->diameter, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->varDiameter = myfree(NJ->varDiameter, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->selfdist = myfree(NJ->selfdist, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->selfweight = myfree(NJ->selfweight, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->outDistances = myfree(NJ->outDistances, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->nOutDistActive = myfree(NJ->nOutDistActive, sizeof(int)*NJ->maxnodes);
+ NJ->parent = myfree(NJ->parent, sizeof(int)*NJ->maxnodes);
+ NJ->branchlength = myfree(NJ->branchlength, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->support = myfree(NJ->support, sizeof(numeric_t)*NJ->maxnodes);
+ NJ->child = myfree(NJ->child, sizeof(children_t)*NJ->maxnodes);
+ NJ->transmat = myfree(NJ->transmat, sizeof(transition_matrix_t));
+ AllocRateCategories(&NJ->rates, 0, NJ->nPos);
+ return(myfree(NJ, sizeof(NJ_t)));
+}
+
+/* Allocate or reallocate the rate categories, and set every position
+ to category 0 and every category's rate to 1.0
+ If nRateCategories=0, just deallocate
+*/
+void AllocRateCategories(/*IN/OUT*/rates_t *rates, int nRateCategories, int nPos) {
+ assert(nRateCategories >= 0);
+ rates->rates = myfree(rates->rates, sizeof(numeric_t)*rates->nRateCategories);
+ rates->ratecat = myfree(rates->ratecat, sizeof(unsigned int)*nPos);
+ rates->nRateCategories = nRateCategories;
+ if (rates->nRateCategories > 0) {
+ rates->rates = (numeric_t*)mymalloc(sizeof(numeric_t)*rates->nRateCategories);
+ int i;
+ for (i = 0; i < nRateCategories; i++)
+ rates->rates[i] = 1.0;
+ rates->ratecat = (unsigned int *)mymalloc(sizeof(unsigned int)*nPos);
+ for (i = 0; i < nPos; i++)
+ rates->ratecat[i] = 0;
+ }
+}
+
+void FastNJ(NJ_t *NJ) {
+ int iNode;
+
+ assert(NJ->nSeq >= 1);
+ if (NJ->nSeq < 3) {
+ NJ->root = NJ->maxnode++;
+ NJ->child[NJ->root].nChild = NJ->nSeq;
+ for (iNode = 0; iNode < NJ->nSeq; iNode++) {
+ NJ->parent[iNode] = NJ->root;
+ NJ->child[NJ->root].child[iNode] = iNode;
+ }
+ if (NJ->nSeq == 1) {
+ NJ->branchlength[0] = 0;
+ } else {
+ assert (NJ->nSeq == 2);
+ besthit_t hit;
+ SeqDist(NJ->profiles[0]->codes,NJ->profiles[1]->codes,NJ->nPos,NJ->distance_matrix,/*OUT*/&hit);
+ NJ->branchlength[0] = hit.dist/2.0;
+ NJ->branchlength[1] = hit.dist/2.0;
+ }
+ return;
+ }
+
+ /* else 3 or more sequences */
+
+ /* The visible set stores the best hit of each node (unless using top hits, in which case
+ it is handled by the top hits routines) */
+ besthit_t *visible = NULL; /* Not used if doing top hits */
+ besthit_t *besthitNew = NULL; /* All hits of new node -- not used if doing top-hits */
+
+ /* The top-hits lists, with the key parameter m = length of each top-hit list */
+ top_hits_t *tophits = NULL;
+ int m = 0; /* maximum length of a top-hits list */
+ if (tophitsMult > 0) {
+ m = (int)(0.5 + tophitsMult*sqrt(NJ->nSeq));
+ if(m<4 || 2*m >= NJ->nSeq) {
+ m=0;
+ if(verbose>1) fprintf(stderr,"Too few leaves, turning off top-hits\n");
+ } else {
+ if(verbose>2) fprintf(stderr,"Top-hit-list size = %d of %d\n", m, NJ->nSeq);
+ }
+ }
+ assert(!(slow && m>0));
+
+ /* Initialize top-hits or visible set */
+ if (m>0) {
+ tophits = InitTopHits(NJ, m);
+ SetAllLeafTopHits(/*IN/UPDATE*/NJ, /*OUT*/tophits);
+ ResetTopVisible(/*IN/UPDATE*/NJ, /*nActive*/NJ->nSeq, /*IN/OUT*/tophits);
+ } else if (!slow) {
+ visible = (besthit_t*)mymalloc(sizeof(besthit_t)*NJ->maxnodes);
+ besthitNew = (besthit_t*)mymalloc(sizeof(besthit_t)*NJ->maxnodes);
+ for (iNode = 0; iNode < NJ->nSeq; iNode++)
+ SetBestHit(iNode, NJ, /*nActive*/NJ->nSeq, /*OUT*/&visible[iNode], /*OUT IGNORED*/NULL);
+ }
+
+ /* Iterate over joins */
+ int nActiveOutProfileReset = NJ->nSeq;
+ int nActive;
+ for (nActive = NJ->nSeq; nActive > 3; nActive--) {
+ int nJoinsDone = NJ->nSeq - nActive;
+ if (nJoinsDone > 0 && (nJoinsDone % 100) == 0)
+ ProgressReport("Joined %6d of %6d", nJoinsDone, NJ->nSeq-3, 0, 0);
+
+ besthit_t join; /* the join to do */
+ if (slow) {
+ ExhaustiveNJSearch(NJ,nActive,/*OUT*/&join);
+ } else if (m>0) {
+ TopHitNJSearch(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits, /*OUT*/&join);
+ } else {
+ FastNJSearch(NJ, nActive, /*IN/OUT*/visible, /*OUT*/&join);
+ }
+
+ if (verbose>2) {
+ double penalty = constraintWeight
+ * (double)JoinConstraintPenalty(NJ, join.i, join.j);
+ if (penalty > 0.001) {
+ fprintf(stderr, "Constraint violation during neighbor-joining %d %d into %d penalty %.3f\n",
+ join.i, join.j, NJ->maxnode, penalty);
+ int iC;
+ for (iC = 0; iC < NJ->nConstraints; iC++) {
+ int local = JoinConstraintPenaltyPiece(NJ, join.i, join.j, iC);
+ if (local > 0)
+ fprintf(stderr, "Constraint %d piece %d %d/%d %d/%d %d/%d\n", iC, local,
+ NJ->profiles[join.i]->nOn[iC],
+ NJ->profiles[join.i]->nOff[iC],
+ NJ->profiles[join.j]->nOn[iC],
+ NJ->profiles[join.j]->nOff[iC],
+ NJ->outprofile->nOn[iC] - NJ->profiles[join.i]->nOn[iC] - NJ->profiles[join.j]->nOn[iC],
+ NJ->outprofile->nOff[iC] - NJ->profiles[join.i]->nOff[iC] - NJ->profiles[join.j]->nOff[iC]);
+ }
+ }
+ }
+
+ /* because of the stale out-distance heuristic, make sure that these are up-to-date */
+ SetOutDistance(NJ, join.i, nActive);
+ SetOutDistance(NJ, join.j, nActive);
+ /* Make sure weight is set and criterion is up to date */
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/&join);
+ assert(NJ->nOutDistActive[join.i] == nActive);
+ assert(NJ->nOutDistActive[join.j] == nActive);
+
+ int newnode = NJ->maxnode++;
+ NJ->parent[join.i] = newnode;
+ NJ->parent[join.j] = newnode;
+ NJ->child[newnode].nChild = 2;
+ NJ->child[newnode].child[0] = join.i < join.j ? join.i : join.j;
+ NJ->child[newnode].child[1] = join.i > join.j ? join.i : join.j;
+
+ double rawIJ = join.dist + NJ->diameter[join.i] + NJ->diameter[join.j];
+ double distIJ = join.dist;
+
+ double deltaDist = (NJ->outDistances[join.i]-NJ->outDistances[join.j])/(double)(nActive-2);
+ NJ->branchlength[join.i] = (distIJ + deltaDist)/2;
+ NJ->branchlength[join.j] = (distIJ - deltaDist)/2;
+
+ double bionjWeight = 0.5; /* IJ = bionjWeight*I + (1-bionjWeight)*J */
+ double varIJ = rawIJ - NJ->varDiameter[join.i] - NJ->varDiameter[join.j];
+
+ if (bionj && join.weight > 0.01 && varIJ > 0.001) {
+ /* Set bionjWeight according to the BIONJ formula, where
+ the variance matrix is approximated by
+
+ Vij = ProfileVar(i,j) - varDiameter(i) - varDiameter(j)
+ ProfileVar(i,j) = distance(i,j) = top(i,j)/weight(i,j)
+
+ (The node's distance diameter does not affect the variances.)
+
+ The BIONJ formula is equation 9 from Gascuel 1997:
+
+ bionjWeight = 1/2 + sum(k!=i,j) (Vjk - Vik) / ((nActive-2)*Vij)
+ sum(k!=i,j) (Vjk - Vik) = sum(k!=i,j) Vik - varDiameter(j) + varDiameter(i)
+ = sum(k!=i,j) ProfileVar(j,k) - sum(k!=i,j) ProfileVar(i,k) + (nActive-2)*(varDiameter(i)-varDiameter(j))
+
+ sum(k!=i,j) ProfileVar(i,k)
+ ~= (sum(k!=i,j) distance(i,k) * weight(i,k))/(mean(k!=i,j) weight(i,k))
+ ~= (N-2) * top(i, Out-i-j) / weight(i, Out-i-j)
+
+ weight(i, Out-i-j) = N*weight(i,Out) - weight(i,i) - weight(i,j)
+ top(i, Out-i-j) = N*top(i,Out) - top(i,i) - top(i,j)
+ */
+ besthit_t outI;
+ besthit_t outJ;
+ ProfileDist(NJ->profiles[join.i],NJ->outprofile,NJ->nPos,NJ->distance_matrix,/*OUT*/&outI);
+ ProfileDist(NJ->profiles[join.j],NJ->outprofile,NJ->nPos,NJ->distance_matrix,/*OUT*/&outJ);
+ outprofileOps += 2;
+
+ double varIWeight = (nActive * outI.weight - NJ->selfweight[join.i] - join.weight);
+ double varJWeight = (nActive * outJ.weight - NJ->selfweight[join.j] - join.weight);
+
+ double varITop = outI.dist * outI.weight * nActive
+ - NJ->selfdist[join.i] * NJ->selfweight[join.i] - rawIJ * join.weight;
+ double varJTop = outJ.dist * outJ.weight * nActive
+ - NJ->selfdist[join.j] * NJ->selfweight[join.j] - rawIJ * join.weight;
+
+ double deltaProfileVarOut = (nActive-2) * (varJTop/varJWeight - varITop/varIWeight);
+ double deltaVarDiam = (nActive-2)*(NJ->varDiameter[join.i] - NJ->varDiameter[join.j]);
+ if (varJWeight > 0.01 && varIWeight > 0.01)
+ bionjWeight = 0.5 + (deltaProfileVarOut+deltaVarDiam)/(2*(nActive-2)*varIJ);
+ if(bionjWeight<0) bionjWeight=0;
+ if(bionjWeight>1) bionjWeight=1;
+ if (verbose>2) fprintf(stderr,"dVarO %f dVarDiam %f varIJ %f from dist %f weight %f (pos %d) bionjWeight %f %f\n",
+ deltaProfileVarOut, deltaVarDiam,
+ varIJ, join.dist, join.weight, NJ->nPos,
+ bionjWeight, 1-bionjWeight);
+ if (verbose>3 && (newnode%5) == 0) {
+ /* Compare weight estimated from outprofiles from weight made by summing over other nodes */
+ double deltaProfileVarTot = 0;
+ for (iNode = 0; iNode < newnode; iNode++) {
+ if (NJ->parent[iNode] < 0) { /* excludes join.i, join.j */
+ besthit_t di, dj;
+ ProfileDist(NJ->profiles[join.i],NJ->profiles[iNode],NJ->nPos,NJ->distance_matrix,/*OUT*/&di);
+ ProfileDist(NJ->profiles[join.j],NJ->profiles[iNode],NJ->nPos,NJ->distance_matrix,/*OUT*/&dj);
+ deltaProfileVarTot += dj.dist - di.dist;
+ }
+ }
+ double lambdaTot = 0.5 + (deltaProfileVarTot+deltaVarDiam)/(2*(nActive-2)*varIJ);
+ if (lambdaTot < 0) lambdaTot = 0;
+ if (lambdaTot > 1) lambdaTot = 1;
+ if (fabs(bionjWeight-lambdaTot) > 0.01 || verbose > 4)
+ fprintf(stderr, "deltaProfileVar actual %.6f estimated %.6f lambda actual %.3f estimated %.3f\n",
+ deltaProfileVarTot,deltaProfileVarOut,lambdaTot,bionjWeight);
+ }
+ }
+ if (verbose > 2) fprintf(stderr, "Join\t%d\t%d\t%.6f\tlambda\t%.6f\tselfw\t%.3f\t%.3f\tnew\t%d\n",
+ join.i < join.j ? join.i : join.j,
+ join.i < join.j ? join.j : join.i,
+ join.criterion, bionjWeight,
+ NJ->selfweight[join.i < join.j ? join.i : join.j],
+ NJ->selfweight[join.i < join.j ? join.j : join.i],
+ newnode);
+
+ NJ->diameter[newnode] = bionjWeight * (NJ->branchlength[join.i] + NJ->diameter[join.i])
+ + (1-bionjWeight) * (NJ->branchlength[join.j] + NJ->diameter[join.j]);
+ NJ->varDiameter[newnode] = bionjWeight * NJ->varDiameter[join.i]
+ + (1-bionjWeight) * NJ->varDiameter[join.j]
+ + bionjWeight * (1-bionjWeight) * varIJ;
+
+ NJ->profiles[newnode] = AverageProfile(NJ->profiles[join.i],NJ->profiles[join.j],
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix,
+ bionj ? bionjWeight : /*noweight*/-1.0);
+
+ /* Update out-distances and total diameters */
+ int changedActiveOutProfile = nActiveOutProfileReset - (nActive-1);
+ if (changedActiveOutProfile >= nResetOutProfile
+ && changedActiveOutProfile >= fResetOutProfile * nActiveOutProfileReset) {
+ /* Recompute the outprofile from scratch to avoid roundoff error */
+ profile_t **activeProfiles = (profile_t**)mymalloc(sizeof(profile_t*)*(nActive-1));
+ int nSaved = 0;
+ NJ->totdiam = 0;
+ for (iNode=0;iNode<NJ->maxnode;iNode++) {
+ if (NJ->parent[iNode]<0) {
+ assert(nSaved < nActive-1);
+ activeProfiles[nSaved++] = NJ->profiles[iNode];
+ NJ->totdiam += NJ->diameter[iNode];
+ }
+ }
+ assert(nSaved==nActive-1);
+ FreeProfile(NJ->outprofile, NJ->nPos, NJ->nConstraints);
+ if(verbose>2) fprintf(stderr,"Recomputing outprofile %d %d\n",nActiveOutProfileReset,nActive-1);
+ NJ->outprofile = OutProfile(activeProfiles, nSaved,
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix);
+ activeProfiles = myfree(activeProfiles, sizeof(profile_t*)*(nActive-1));
+ nActiveOutProfileReset = nActive-1;
+ } else {
+ UpdateOutProfile(/*OUT*/NJ->outprofile,
+ NJ->profiles[join.i], NJ->profiles[join.j], NJ->profiles[newnode],
+ nActive,
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix);
+ NJ->totdiam += NJ->diameter[newnode] - NJ->diameter[join.i] - NJ->diameter[join.j];
+ }
+
+ /* Store self-dist for use in other computations */
+ besthit_t selfdist;
+ ProfileDist(NJ->profiles[newnode],NJ->profiles[newnode],NJ->nPos,NJ->distance_matrix,/*OUT*/&selfdist);
+ NJ->selfdist[newnode] = selfdist.dist;
+ NJ->selfweight[newnode] = selfdist.weight;
+
+ /* Find the best hit of the joined node IJ */
+ if (m>0) {
+ TopHitJoin(newnode, /*IN/UPDATE*/NJ, nActive-1, /*IN/OUT*/tophits);
+ } else {
+ /* Not using top-hits, so we update all out-distances */
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ if (NJ->parent[iNode] < 0) {
+ /* True nActive is now nActive-1 */
+ SetOutDistance(/*IN/UPDATE*/NJ, iNode, nActive-1);
+ }
+ }
+
+ if(visible != NULL) {
+ SetBestHit(newnode, NJ, nActive-1, /*OUT*/&visible[newnode], /*OUT OPTIONAL*/besthitNew);
+ if (verbose>2)
+ fprintf(stderr,"Visible %d %d %f %f\n",
+ visible[newnode].i, visible[newnode].j,
+ visible[newnode].dist, visible[newnode].criterion);
+ if (besthitNew != NULL) {
+ /* Use distances to new node to update visible set entries that are non-optimal */
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ if (NJ->parent[iNode] >= 0 || iNode == newnode)
+ continue;
+ int iOldVisible = visible[iNode].j;
+ assert(iOldVisible>=0);
+ assert(visible[iNode].i == iNode);
+
+ /* Update the criterion; use nActive-1 because haven't decremented nActive yet */
+ if (NJ->parent[iOldVisible] < 0)
+ SetCriterion(/*IN/OUT*/NJ, nActive-1, &visible[iNode]);
+
+ if (NJ->parent[iOldVisible] >= 0
+ || besthitNew[iNode].criterion < visible[iNode].criterion) {
+ if(verbose>3) fprintf(stderr,"Visible %d reset from %d to %d (%f vs. %f)\n",
+ iNode, iOldVisible,
+ newnode, visible[iNode].criterion, besthitNew[iNode].criterion);
+ if(NJ->parent[iOldVisible] < 0) nVisibleUpdate++;
+ visible[iNode].j = newnode;
+ visible[iNode].dist = besthitNew[iNode].dist;
+ visible[iNode].criterion = besthitNew[iNode].criterion;
+ }
+ } /* end loop over all nodes */
+ } /* end if recording all hits of new node */
+ } /* end if keeping a visible set */
+ } /* end else (m==0) */
+ } /* end loop over nActive */
+
+#ifdef TRACK_MEMORY
+ if (verbose>1) {
+ struct mallinfo mi = mallinfo();
+ fprintf(stderr, "Memory @ end of FastNJ(): %.2f MB (%.1f byte/pos) useful %.2f expected %.2f\n",
+ (mi.arena+mi.hblkhd)/1.0e6, (mi.arena+mi.hblkhd)/(double)(NJ->nSeq*(double)NJ->nPos),
+ mi.uordblks/1.0e6, mymallocUsed/1e6);
+ }
+#endif
+
+ /* We no longer need the tophits, visible set, etc. */
+ if (visible != NULL) visible = myfree(visible,sizeof(besthit_t)*NJ->maxnodes);
+ if (besthitNew != NULL) besthitNew = myfree(besthitNew,sizeof(besthit_t)*NJ->maxnodes);
+ tophits = FreeTopHits(tophits);
+
+ /* Add a root for the 3 remaining nodes */
+ int top[3];
+ int nTop = 0;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ if (NJ->parent[iNode] < 0) {
+ assert(nTop <= 2);
+ top[nTop++] = iNode;
+ }
+ }
+ assert(nTop==3);
+
+ NJ->root = NJ->maxnode++;
+ NJ->child[NJ->root].nChild = 3;
+ for (nTop = 0; nTop < 3; nTop++) {
+ NJ->parent[top[nTop]] = NJ->root;
+ NJ->child[NJ->root].child[nTop] = top[nTop];
+ }
+
+ besthit_t dist01, dist02, dist12;
+ ProfileDist(NJ->profiles[top[0]], NJ->profiles[top[1]], NJ->nPos, NJ->distance_matrix, /*OUT*/&dist01);
+ ProfileDist(NJ->profiles[top[0]], NJ->profiles[top[2]], NJ->nPos, NJ->distance_matrix, /*OUT*/&dist02);
+ ProfileDist(NJ->profiles[top[1]], NJ->profiles[top[2]], NJ->nPos, NJ->distance_matrix, /*OUT*/&dist12);
+
+ double d01 = dist01.dist - NJ->diameter[top[0]] - NJ->diameter[top[1]];
+ double d02 = dist02.dist - NJ->diameter[top[0]] - NJ->diameter[top[2]];
+ double d12 = dist12.dist - NJ->diameter[top[1]] - NJ->diameter[top[2]];
+ NJ->branchlength[top[0]] = (d01 + d02 - d12)/2;
+ NJ->branchlength[top[1]] = (d01 + d12 - d02)/2;
+ NJ->branchlength[top[2]] = (d02 + d12 - d01)/2;
+
+ /* Check how accurate the outprofile is */
+ if (verbose>2) {
+ profile_t *p[3] = {NJ->profiles[top[0]], NJ->profiles[top[1]], NJ->profiles[top[2]]};
+ profile_t *out = OutProfile(p, 3, NJ->nPos, NJ->nConstraints, NJ->distance_matrix);
+ int i;
+ double freqerror = 0;
+ double weighterror = 0;
+ for (i=0;i<NJ->nPos;i++) {
+ weighterror += fabs(out->weights[i] - NJ->outprofile->weights[i]);
+ int k;
+ for(k=0;k<nCodes;k++)
+ freqerror += fabs(out->vectors[nCodes*i+k] - NJ->outprofile->vectors[nCodes*i+k]);
+ }
+ fprintf(stderr,"Roundoff error in outprofile@end: WeightError %f FreqError %f\n", weighterror, freqerror);
+ FreeProfile(out, NJ->nPos, NJ->nConstraints);
+ }
+ return;
+}
+
+void ExhaustiveNJSearch(NJ_t *NJ, int nActive, /*OUT*/besthit_t *join) {
+ join->i = -1;
+ join->j = -1;
+ join->weight = 0;
+ join->dist = 1e20;
+ join->criterion = 1e20;
+ double bestCriterion = 1e20;
+
+ int i, j;
+ for (i = 0; i < NJ->maxnode-1; i++) {
+ if (NJ->parent[i] < 0) {
+ for (j = i+1; j < NJ->maxnode; j++) {
+ if (NJ->parent[j] < 0) {
+ besthit_t hit;
+ hit.i = i;
+ hit.j = j;
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/&hit);
+ if (hit.criterion < bestCriterion) {
+ *join = hit;
+ bestCriterion = hit.criterion;
+ }
+ }
+ }
+ }
+ }
+ assert (join->i >= 0 && join->j >= 0);
+}
+
+void FastNJSearch(NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *besthits, /*OUT*/besthit_t *join) {
+ join->i = -1;
+ join->j = -1;
+ join->dist = 1e20;
+ join->weight = 0;
+ join->criterion = 1e20;
+ int iNode;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ int jNode = besthits[iNode].j;
+ if (NJ->parent[iNode] < 0 && NJ->parent[jNode] < 0) { /* both i and j still active */
+ /* recompute criterion to reflect the current out-distances */
+ SetCriterion(NJ, nActive, /*IN/OUT*/&besthits[iNode]);
+ if (besthits[iNode].criterion < join->criterion)
+ *join = besthits[iNode];
+ }
+ }
+
+ if(!fastest) {
+ int changed;
+ do {
+ changed = 0;
+ assert(join->i >= 0 && join->j >= 0);
+ SetBestHit(join->i, NJ, nActive, /*OUT*/&besthits[join->i], /*OUT IGNORED*/NULL);
+ if (besthits[join->i].j != join->j) {
+ changed = 1;
+ if (verbose>2)
+ fprintf(stderr,"BetterI\t%d\t%d\t%d\t%d\t%f\t%f\n",
+ join->i,join->j,besthits[join->i].i,besthits[join->i].j,
+ join->criterion,besthits[join->i].criterion);
+ }
+
+ /* Save the best hit either way, because the out-distance has probably changed
+ since we started the computation. */
+ join->j = besthits[join->i].j;
+ join->weight = besthits[join->i].weight;
+ join->dist = besthits[join->i].dist;
+ join->criterion = besthits[join->i].criterion;
+
+ SetBestHit(join->j, NJ, nActive, /*OUT*/&besthits[join->j], /*OUT IGNORE*/NULL);
+ if (besthits[join->j].j != join->i) {
+ changed = 1;
+ if (verbose>2)
+ fprintf(stderr,"BetterJ\t%d\t%d\t%d\t%d\t%f\t%f\n",
+ join->i,join->j,besthits[join->j].i,besthits[join->j].j,
+ join->criterion,besthits[join->j].criterion);
+ join->i = besthits[join->j].j;
+ join->weight = besthits[join->j].weight;
+ join->dist = besthits[join->j].dist;
+ join->criterion = besthits[join->j].criterion;
+ }
+ if(changed) nHillBetter++;
+ } while(changed);
+ }
+}
+
+/* A token is one of ():;, or an alphanumeric string without whitespace
+ Any whitespace between tokens is ignored */
+char *ReadTreeToken(FILE *fp) {
+ static char buf[BUFFER_SIZE];
+ int len = 0;
+ int c;
+ for (c = fgetc(fp); c != EOF; c = fgetc(fp)) {
+ if (c == '(' || c == ')' || c == ':' || c == ';' || c == ',') {
+ /* standalone token */
+ if (len == 0) {
+ buf[len++] = c;
+ buf[len] = '\0';
+ return(buf);
+ } else {
+ ungetc(c, fp);
+ buf[len] = '\0';
+ return(buf);
+ }
+ } else if (isspace(c)) {
+ if (len > 0) {
+ buf[len] = '\0';
+ return(buf);
+ }
+ /* else ignore whitespace at beginning of token */
+ } else {
+ /* not whitespace or standalone token */
+ buf[len++] = c;
+ if (len >= BUFFER_SIZE) {
+ buf[BUFFER_SIZE-1] = '\0';
+ fprintf(stderr, "Token too long in tree file, token begins with\n%s\n", buf);
+ exit(1);
+ }
+ }
+ }
+ if (len > 0) {
+ /* return the token we have so far */
+ buf[len] = '\0';
+ return(buf);
+ }
+ /* else */
+ return(NULL);
+}
+
+void ReadTreeError(char *err, char *token) {
+ fprintf(stderr, "Tree parse error: unexpected token '%s' -- %s\n",
+ token == NULL ? "(End of file)" : token,
+ err);
+ exit(1);
+}
+
+void ReadTreeAddChild(int parent, int child, /*IN/OUT*/int *parents, /*IN/OUT*/children_t *children) {
+ assert(parent >= 0);
+ assert(child >= 0);
+ assert(parents[child] < 0);
+ assert(children[parent].nChild < 3);
+ parents[child] = parent;
+ children[parent].child[children[parent].nChild++] = child;
+}
+
+void ReadTreeMaybeAddLeaf(int parent, char *name,
+ hashstrings_t *hashnames, uniquify_t *unique,
+ /*IN/OUT*/int *parents, /*IN/OUT*/children_t *children) {
+ hashiterator_t hi = FindMatch(hashnames,name);
+ if (HashCount(hashnames,hi) != 1)
+ ReadTreeError("not recognized as a sequence name", name);
+
+ int iSeqNonunique = HashFirst(hashnames,hi);
+ assert(iSeqNonunique >= 0 && iSeqNonunique < unique->nSeq);
+ int iSeqUnique = unique->alnToUniq[iSeqNonunique];
+ assert(iSeqUnique >= 0 && iSeqUnique < unique->nUnique);
+ /* Either record this leaves' parent (if it is -1) or ignore this leaf (if already seen) */
+ if (parents[iSeqUnique] < 0) {
+ ReadTreeAddChild(parent, iSeqUnique, /*IN/OUT*/parents, /*IN/OUT*/children);
+ if(verbose > 5)
+ fprintf(stderr, "Found leaf uniq%d name %s child of %d\n", iSeqUnique, name, parent);
+ } else {
+ if (verbose > 5)
+ fprintf(stderr, "Skipped redundant leaf uniq%d name %s\n", iSeqUnique, name);
+ }
+}
+
+void ReadTreeRemove(/*IN/OUT*/int *parents, /*IN/OUT*/children_t *children, int node) {
+ if(verbose > 5)
+ fprintf(stderr,"Removing node %d parent %d\n", node, parents[node]);
+ assert(parents[node] >= 0);
+ int parent = parents[node];
+ parents[node] = -1;
+ children_t *pc = &children[parent];
+ int oldn;
+ for (oldn = 0; oldn < pc->nChild; oldn++) {
+ if (pc->child[oldn] == node)
+ break;
+ }
+ assert(oldn < pc->nChild);
+
+ /* move successor nodes back in child list and shorten list */
+ int i;
+ for (i = oldn; i < pc->nChild-1; i++)
+ pc->child[i] = pc->child[i+1];
+ pc->nChild--;
+
+ /* add its children to parent's child list */
+ children_t *nc = &children[node];
+ if (nc->nChild > 0) {
+ assert(nc->nChild<=2);
+ assert(pc->nChild < 3);
+ assert(pc->nChild + nc->nChild <= 3);
+ int j;
+ for (j = 0; j < nc->nChild; j++) {
+ if(verbose > 5)
+ fprintf(stderr,"Repointing parent %d to child %d\n", parent, nc->child[j]);
+ pc->child[pc->nChild++] = nc->child[j];
+ parents[nc->child[j]] = parent;
+ }
+ nc->nChild = 0;
+ }
+}
+
+void ReadTree(/*IN/OUT*/NJ_t *NJ,
+ /*IN*/uniquify_t *unique,
+ /*IN*/hashstrings_t *hashnames,
+ /*READ*/FILE *fpInTree) {
+ assert(NJ->nSeq == unique->nUnique);
+ /* First, do a preliminary parse of the tree to with non-unique leaves ignored
+ We need to store this separately from NJ because it may have too many internal nodes
+ (matching sequences show up once in the NJ but could be in multiple places in the tree)
+ Will use iUnique as the index of nodes, as in the NJ structure
+ */
+ int maxnodes = unique->nSeq*2;
+ int maxnode = unique->nSeq;
+ int *parent = (int*)mymalloc(sizeof(int)*maxnodes);
+ children_t *children = (children_t *)mymalloc(sizeof(children_t)*maxnodes);
+ int root = maxnode++;
+ int i;
+ for (i = 0; i < maxnodes; i++) {
+ parent[i] = -1;
+ children[i].nChild = 0;
+ }
+
+ /* The stack is the current path to the root, with the root at the first (top) position */
+ int stack_size = 1;
+ int *stack = (int*)mymalloc(sizeof(int)*maxnodes);
+ stack[0] = root;
+ int nDown = 0;
+ int nUp = 0;
+
+ char *token;
+ token = ReadTreeToken(fpInTree);
+ if (token == NULL || *token != '(')
+ ReadTreeError("No '(' at start", token);
+ /* nDown is still 0 because we have created the root */
+
+ while ((token = ReadTreeToken(fpInTree)) != NULL) {
+ if (nDown > 0) { /* In a stream of parentheses */
+ if (*token == '(')
+ nDown++;
+ else if (*token == ',' || *token == ';' || *token == ':' || *token == ')')
+ ReadTreeError("while reading parentheses", token);
+ else {
+ /* Add intermediate nodes if nDown was > 1 (for nDown=1, the only new node is the leaf) */
+ while (nDown-- > 0) {
+ int new = maxnode++;
+ assert(new < maxnodes);
+ ReadTreeAddChild(stack[stack_size-1], new, /*IN/OUT*/parent, /*IN/OUT*/children);
+ if(verbose > 5)
+ fprintf(stderr, "Added internal child %d of %d, stack size increase to %d\n",
+ new, stack[stack_size-1],stack_size+1);
+ stack[stack_size++] = new;
+ assert(stack_size < maxnodes);
+ }
+ ReadTreeMaybeAddLeaf(stack[stack_size-1], token,
+ hashnames, unique,
+ /*IN/OUT*/parent, /*IN/OUT*/children);
+ }
+ } else if (nUp > 0) {
+ if (*token == ';') { /* end the tree? */
+ if (nUp != stack_size)
+ ReadTreeError("unbalanced parentheses", token);
+ else
+ break;
+ } else if (*token == ')')
+ nUp++;
+ else if (*token == '(')
+ ReadTreeError("unexpected '(' after ')'", token);
+ else if (*token == ':') {
+ token = ReadTreeToken(fpInTree);
+ /* Read the branch length and ignore it */
+ if (token == NULL || (*token != '-' && !isdigit(*token)))
+ ReadTreeError("not recognized as a branch length", token);
+ } else if (*token == ',') {
+ /* Go back up the stack the correct #times */
+ while (nUp-- > 0) {
+ stack_size--;
+ if(verbose > 5)
+ fprintf(stderr, "Up to nUp=%d stack size %d at %d\n",
+ nUp, stack_size, stack[stack_size-1]);
+ if (stack_size <= 0)
+ ReadTreeError("too many ')'", token);
+ }
+ nUp = 0;
+ } else if (*token == '-' || isdigit(*token))
+ ; /* ignore bootstrap value */
+ else
+ fprintf(stderr, "Warning while parsing tree: non-numeric label %s for internal node\n",
+ token);
+ } else if (*token == '(') {
+ nDown = 1;
+ } else if (*token == ')') {
+ nUp = 1;
+ } else if (*token == ':') {
+ token = ReadTreeToken(fpInTree);
+ if (token == NULL || (*token != '-' && !isdigit(*token)))
+ ReadTreeError("not recognized as a branch length", token);
+ } else if (*token == ',') {
+ ; /* do nothing */
+ } else if (*token == ';')
+ ReadTreeError("unexpected token", token);
+ else
+ ReadTreeMaybeAddLeaf(stack[stack_size-1], token,
+ hashnames, unique,
+ /*IN/OUT*/parent, /*IN/OUT*/children);
+ }
+
+ /* Verify that all sequences were seen */
+ for (i = 0; i < unique->nUnique; i++) {
+ if (parent[i] < 0) {
+ fprintf(stderr, "Alignment sequence %d (unique %d) absent from input tree\n"
+ "The starting tree (the argument to -intree) must include all sequences in the alignment!\n",
+ unique->uniqueFirst[i], i);
+ exit(1);
+ }
+ }
+
+ /* Simplify the tree -- remove all internal nodes with < 2 children
+ Keep trying until no nodes get removed
+ */
+ int nRemoved;
+ do {
+ nRemoved = 0;
+ /* Here stack is the list of nodes we haven't visited yet while doing
+ a tree traversal */
+ stack_size = 1;
+ stack[0] = root;
+ while (stack_size > 0) {
+ int node = stack[--stack_size];
+ if (node >= unique->nUnique) { /* internal node */
+ if (children[node].nChild <= 1) {
+ if (node != root) {
+ ReadTreeRemove(/*IN/OUT*/parent,/*IN/OUT*/children,node);
+ nRemoved++;
+ } else if (node == root && children[node].nChild == 1) {
+ int newroot = children[node].child[0];
+ parent[newroot] = -1;
+ children[root].nChild = 0;
+ nRemoved++;
+ if(verbose > 5)
+ fprintf(stderr,"Changed root from %d to %d\n",root,newroot);
+ root = newroot;
+ stack[stack_size++] = newroot;
+ }
+ } else {
+ int j;
+ for (j = 0; j < children[node].nChild; j++) {
+ assert(stack_size < maxnodes);
+ stack[stack_size++] = children[node].child[j];
+ if(verbose > 5)
+ fprintf(stderr,"Added %d to stack\n", stack[stack_size-1]);
+ }
+ }
+ }
+ }
+ } while (nRemoved > 0);
+
+ /* Simplify the root node to 3 children if it has 2 */
+ if (children[root].nChild == 2) {
+ for (i = 0; i < 2; i++) {
+ int child = children[root].child[i];
+ assert(child >= 0 && child < maxnodes);
+ if (children[child].nChild == 2) {
+ ReadTreeRemove(parent,children,child); /* replace root -> child -> A,B with root->A,B */
+ break;
+ }
+ }
+ }
+
+ for (i = 0; i < maxnodes; i++)
+ if(verbose > 5)
+ fprintf(stderr,"Simplfied node %d has parent %d nchild %d\n",
+ i, parent[i], children[i].nChild);
+
+ /* Map the remaining internal nodes to NJ nodes */
+ int *map = (int*)mymalloc(sizeof(int)*maxnodes);
+ for (i = 0; i < unique->nUnique; i++)
+ map[i] = i;
+ for (i = unique->nUnique; i < maxnodes; i++)
+ map[i] = -1;
+ stack_size = 1;
+ stack[0] = root;
+ while (stack_size > 0) {
+ int node = stack[--stack_size];
+ if (node >= unique->nUnique) { /* internal node */
+ assert(node == root || children[node].nChild > 1);
+ map[node] = NJ->maxnode++;
+ for (i = 0; i < children[node].nChild; i++) {
+ assert(stack_size < maxnodes);
+ stack[stack_size++] = children[node].child[i];
+ }
+ }
+ }
+ for (i = 0; i < maxnodes; i++)
+ if(verbose > 5)
+ fprintf(stderr,"Map %d to %d (parent %d nchild %d)\n",
+ i, map[i], parent[i], children[i].nChild);
+
+ /* Set NJ->parent, NJ->children, NJ->root */
+ NJ->root = map[root];
+ int node;
+ for (node = 0; node < maxnodes; node++) {
+ int njnode = map[node];
+ if (njnode >= 0) {
+ NJ->child[njnode].nChild = children[node].nChild;
+ for (i = 0; i < children[node].nChild; i++) {
+ assert(children[node].child[i] >= 0 && children[node].child[i] < maxnodes);
+ NJ->child[njnode].child[i] = map[children[node].child[i]];
+ }
+ if (parent[node] >= 0)
+ NJ->parent[njnode] = map[parent[node]];
+ }
+ }
+
+ /* Make sure that parent/child relationships match */
+ for (i = 0; i < NJ->maxnode; i++) {
+ children_t *c = &NJ->child[i];
+ int j;
+ for (j = 0; j < c->nChild;j++)
+ assert(c->child[j] >= 0 && c->child[j] < NJ->maxnode && NJ->parent[c->child[j]] == i);
+ }
+ assert(NJ->parent[NJ->root] < 0);
+
+ map = myfree(map,sizeof(int)*maxnodes);
+ stack = myfree(stack,sizeof(int)*maxnodes);
+ children = myfree(children,sizeof(children_t)*maxnodes);
+ parent = myfree(parent,sizeof(int)*maxnodes);
+
+ /* Compute profiles as balanced -- the NNI stage will recompute these
+ profiles anyway
+ */
+ traversal_t traversal = InitTraversal(NJ);
+ node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (node >= NJ->nSeq && node != NJ->root)
+ SetProfile(/*IN/OUT*/NJ, node, /*noweight*/-1.0);
+ }
+ traversal = FreeTraversal(traversal,NJ);
+}
+
+/* Print topology using node indices as node names */
+void PrintNJInternal(FILE *fp, NJ_t *NJ, bool useLen) {
+ if (NJ->nSeq < 4) {
+ return;
+ }
+ typedef struct { int node; int end; } stack_t;
+ stack_t *stack = (stack_t *)mymalloc(sizeof(stack_t)*NJ->maxnodes);
+ int stackSize = 1;
+ stack[0].node = NJ->root;
+ stack[0].end = 0;
+
+ while(stackSize>0) {
+ stack_t *last = &stack[stackSize-1];
+ stackSize--;
+ /* Save last, as we are about to overwrite it */
+ int node = last->node;
+ int end = last->end;
+
+ if (node < NJ->nSeq) {
+ if (NJ->child[NJ->parent[node]].child[0] != node) fputs(",",fp);
+ fprintf(fp, "%d", node);
+ if (useLen)
+ fprintf(fp, ":%.4f", NJ->branchlength[node]);
+ } else if (end) {
+ fprintf(fp, ")%d", node);
+ if (useLen)
+ fprintf(fp, ":%.4f", NJ->branchlength[node]);
+ } else {
+ if (node != NJ->root && NJ->child[NJ->parent[node]].child[0] != node) fprintf(fp, ",");
+ fprintf(fp, "(");
+ stackSize++;
+ stack[stackSize-1].node = node;
+ stack[stackSize-1].end = 1;
+ children_t *c = &NJ->child[node];
+ /* put children on in reverse order because we use the last one first */
+ int i;
+ for (i = c->nChild-1; i >=0; i--) {
+ stackSize++;
+ stack[stackSize-1].node = c->child[i];
+ stack[stackSize-1].end = 0;
+ }
+ }
+ }
+ fprintf(fp, ";\n");
+ stack = myfree(stack, sizeof(stack_t)*NJ->maxnodes);
+}
+
+void PrintNJ(FILE *fp, NJ_t *NJ, char **names, uniquify_t *unique, bool bShowSupport, bool bQuote) {
+ /* And print the tree: depth first search
+ * The stack contains
+ * list of remaining children with their depth
+ * parent node, with a flag of -1 so I know to print right-paren
+ */
+ if (NJ->nSeq==1 && unique->alnNext[unique->uniqueFirst[0]] >= 0) {
+ /* Special case -- otherwise we end up with double parens */
+ int first = unique->uniqueFirst[0];
+ assert(first >= 0 && first < unique->nSeq);
+ fprintf(fp, bQuote ? "('%s':0.0" : "(%s:0.0", names[first]);
+ int iName = unique->alnNext[first];
+ while (iName >= 0) {
+ assert(iName < unique->nSeq);
+ fprintf(fp, bQuote ? ",'%s':0.0" : ",%s:0.0", names[iName]);
+ iName = unique->alnNext[iName];
+ }
+ fprintf(fp,");\n");
+ return;
+ }
+
+ typedef struct { int node; int end; } stack_t;
+ stack_t *stack = (stack_t *)mymalloc(sizeof(stack_t)*NJ->maxnodes);
+ int stackSize = 1;
+ stack[0].node = NJ->root;
+ stack[0].end = 0;
+
+ while(stackSize>0) {
+ stack_t *last = &stack[stackSize-1];
+ stackSize--;
+ /* Save last, as we are about to overwrite it */
+ int node = last->node;
+ int end = last->end;
+
+ if (node < NJ->nSeq) {
+ if (NJ->child[NJ->parent[node]].child[0] != node) fputs(",",fp);
+ int first = unique->uniqueFirst[node];
+ assert(first >= 0 && first < unique->nSeq);
+ /* Print the name, or the subtree of duplicate names */
+ if (unique->alnNext[first] == -1) {
+ fprintf(fp, bQuote ? "'%s'" : "%s", names[first]);
+ } else {
+ fprintf(fp, bQuote ? "('%s':0.0" : "(%s:0.0", names[first]);
+ int iName = unique->alnNext[first];
+ while (iName >= 0) {
+ assert(iName < unique->nSeq);
+ fprintf(fp, bQuote ? ",'%s':0.0" : ",%s:0.0", names[iName]);
+ iName = unique->alnNext[iName];
+ }
+ fprintf(fp,")");
+ }
+ /* Print the branch length */
+#ifdef USE_DOUBLE
+#define FP_FORMAT "%.9f"
+#else
+#define FP_FORMAT "%.5f"
+#endif
+ fprintf(fp, ":" FP_FORMAT, NJ->branchlength[node]);
+ } else if (end) {
+ if (node == NJ->root)
+ fprintf(fp, ")");
+ else if (bShowSupport)
+ fprintf(fp, ")%.3f:" FP_FORMAT, NJ->support[node], NJ->branchlength[node]);
+ else
+ fprintf(fp, "):" FP_FORMAT, NJ->branchlength[node]);
+ } else {
+ if (node != NJ->root && NJ->child[NJ->parent[node]].child[0] != node) fprintf(fp, ",");
+ fprintf(fp, "(");
+ stackSize++;
+ stack[stackSize-1].node = node;
+ stack[stackSize-1].end = 1;
+ children_t *c = &NJ->child[node];
+ /* put children on in reverse order because we use the last one first */
+ int i;
+ for (i = c->nChild-1; i >=0; i--) {
+ stackSize++;
+ stack[stackSize-1].node = c->child[i];
+ stack[stackSize-1].end = 0;
+ }
+ }
+ }
+ fprintf(fp, ";\n");
+ stack = myfree(stack, sizeof(stack_t)*NJ->maxnodes);
+}
+
+alignment_t *ReadAlignment(/*IN*/FILE *fp, bool bQuote) {
+ /* bQuote supports the -quote option */
+ int nSeq = 0;
+ int nPos = 0;
+ char **names = NULL;
+ char **seqs = NULL;
+ char buf[BUFFER_SIZE] = "";
+ if (fgets(buf,sizeof(buf),fp) == NULL) {
+ fprintf(stderr, "Error reading header line\n");
+ exit(1);
+ }
+ int nSaved = 100;
+ if (buf[0] == '>') {
+ /* FASTA, truncate names at any of these */
+ char *nameStop = bQuote ? "'\t\r\n" : "(),: \t\r\n";
+ char *seqSkip = " \t\r\n"; /* skip these characters in the sequence */
+ seqs = (char**)mymalloc(sizeof(char*) * nSaved);
+ names = (char**)mymalloc(sizeof(char*) * nSaved);
+
+ do {
+ /* loop over lines */
+ if (buf[0] == '>') {
+ /* truncate the name */
+ char *p, *q;
+ for (p = buf+1; *p != '\0'; p++) {
+ for (q = nameStop; *q != '\0'; q++) {
+ if (*p == *q) {
+ *p = '\0';
+ break;
+ }
+ }
+ if (*p == '\0') break;
+ }
+
+ /* allocate space for another sequence */
+ nSeq++;
+ if (nSeq > nSaved) {
+ int nNewSaved = nSaved*2;
+ seqs = myrealloc(seqs,sizeof(char*)*nSaved,sizeof(char*)*nNewSaved, /*copy*/false);
+ names = myrealloc(names,sizeof(char*)*nSaved,sizeof(char*)*nNewSaved, /*copy*/false);
+ nSaved = nNewSaved;
+ }
+ names[nSeq-1] = (char*)mymemdup(buf+1,strlen(buf));
+ seqs[nSeq-1] = NULL;
+ } else {
+ /* count non-space characters and append to sequence */
+ int nKeep = 0;
+ char *p, *q;
+ for (p=buf; *p != '\0'; p++) {
+ for (q=seqSkip; *q != '\0'; q++) {
+ if (*p == *q)
+ break;
+ }
+ if (*p != *q)
+ nKeep++;
+ }
+ int nOld = (seqs[nSeq-1] == NULL) ? 0 : strlen(seqs[nSeq-1]);
+ seqs[nSeq-1] = (char*)myrealloc(seqs[nSeq-1], nOld, nOld+nKeep+1, /*copy*/false);
+ if (nOld+nKeep > nPos)
+ nPos = nOld + nKeep;
+ char *out = seqs[nSeq-1] + nOld;
+ for (p=buf; *p != '\0'; p++) {
+ for (q=seqSkip; *q != '\0'; q++) {
+ if (*p == *q)
+ break;
+ }
+ if (*p != *q) {
+ *out = *p;
+ out++;
+ }
+ }
+ assert(out-seqs[nSeq-1] == nKeep + nOld);
+ *out = '\0';
+ }
+ } while(fgets(buf,sizeof(buf),fp) != NULL);
+
+ if (seqs[nSeq-1] == NULL) {
+ fprintf(stderr, "No sequence data for last entry %s\n",names[nSeq-1]);
+ exit(1);
+ }
+ names = myrealloc(names,sizeof(char*)*nSaved,sizeof(char*)*nSeq, /*copy*/false);
+ seqs = myrealloc(seqs,sizeof(char*)*nSaved,sizeof(char*)*nSeq, /*copy*/false);
+ } else {
+ /* PHYLIP interleaved-like format
+ Allow arbitrary length names, require spaces between names and sequences
+ Allow multiple alignments, either separated by a single empty line (e.g. seqboot output)
+ or not.
+ */
+ if (buf[0] == '\n' || buf[0] == '\r') {
+ if (fgets(buf,sizeof(buf),fp) == NULL) {
+ fprintf(stderr, "Empty header line followed by EOF\n");
+ exit(1);
+ }
+ }
+ if (sscanf(buf, "%d%d", &nSeq, &nPos) != 2
+ || nSeq < 1 || nPos < 1) {
+ fprintf(stderr, "Error parsing header line:%s\n", buf);
+ exit(1);
+ }
+ names = (char **)mymalloc(sizeof(char*) * nSeq);
+ seqs = (char **)mymalloc(sizeof(char*) * nSeq);
+ nSaved = nSeq;
+
+ int i;
+ for (i = 0; i < nSeq; i++) {
+ names[i] = NULL;
+ seqs[i] = (char *)mymalloc(nPos+1); /* null-terminate */
+ seqs[i][0] = '\0';
+ }
+ int iSeq = 0;
+
+ while(fgets(buf,sizeof(buf),fp)) {
+ if ((buf[0] == '\n' || buf[0] == '\r') && (iSeq == nSeq || iSeq == 0)) {
+ iSeq = 0;
+ } else {
+ int j = 0; /* character just past end of name */
+ if (buf[0] == ' ') {
+ if (names[iSeq] == NULL) {
+ fprintf(stderr, "No name in phylip line %s", buf);
+ exit(1);
+ }
+ } else {
+ while (buf[j] != '\n' && buf[j] != '\0' && buf[j] != ' ')
+ j++;
+ if (buf[j] != ' ' || j == 0) {
+ fprintf(stderr, "No sequence in phylip line %s", buf);
+ exit(1);
+ }
+ if (iSeq >= nSeq) {
+ fprintf(stderr, "No empty line between sequence blocks (is the sequence count wrong?)\n");
+ exit(1);
+ }
+ if (names[iSeq] == NULL) {
+ /* save the name */
+ names[iSeq] = (char *)mymalloc(j+1);
+ int k;
+ for (k = 0; k < j; k++) names[iSeq][k] = buf[k];
+ names[iSeq][j] = '\0';
+ } else {
+ /* check the name */
+ int k;
+ int match = 1;
+ for (k = 0; k < j; k++) {
+ if (names[iSeq][k] != buf[k]) {
+ match = 0;
+ break;
+ }
+ }
+ if (!match || names[iSeq][j] != '\0') {
+ fprintf(stderr, "Wrong name in phylip line %s\nExpected %s\n", buf, names[iSeq]);
+ exit(1);
+ }
+ }
+ }
+ int seqlen = strlen(seqs[iSeq]);
+ for (; buf[j] != '\n' && buf[j] != '\0'; j++) {
+ if (buf[j] != ' ') {
+ if (seqlen >= nPos) {
+ fprintf(stderr, "Too many characters (expected %d) for sequence named %s\nSo far have:\n%s\n",
+ nPos, names[iSeq], seqs[iSeq]);
+ exit(1);
+ }
+ seqs[iSeq][seqlen++] = toupper(buf[j]);
+ }
+ }
+ seqs[iSeq][seqlen] = '\0'; /* null-terminate */
+ if(verbose>10) fprintf(stderr,"Read iSeq %d name %s seqsofar %s\n", iSeq, names[iSeq], seqs[iSeq]);
+ iSeq++;
+ if (iSeq == nSeq && strlen(seqs[0]) == nPos)
+ break; /* finished alignment */
+ } /* end else non-empty phylip line */
+ }
+ if (iSeq != nSeq && iSeq != 0) {
+ fprintf(stderr, "Wrong number of sequences: expected %d\n", nSeq);
+ exit(1);
+ }
+ }
+ /* Check lengths of sequences */
+ int i;
+ for (i = 0; i < nSeq; i++) {
+ int seqlen = strlen(seqs[i]);
+ if (seqlen != nPos) {
+ fprintf(stderr, "Wrong number of characters for %s: expected %d but have %d instead.\n"
+ "This sequence may be truncated, or another sequence may be too long.\n",
+ names[i], nPos, seqlen);
+ exit(1);
+ }
+ }
+ /* Replace "." with "-" and warn if we find any */
+ /* If nucleotide sequences, replace U with T and N with X */
+ bool findDot = false;
+ for (i = 0; i < nSeq; i++) {
+ char *p;
+ for (p = seqs[i]; *p != '\0'; p++) {
+ if (*p == '.') {
+ findDot = true;
+ *p = '-';
+ }
+ if (nCodes == 4 && *p == 'U')
+ *p = 'T';
+ if (nCodes == 4 && *p == 'N')
+ *p = 'X';
+ }
+ }
+ if (findDot)
+ fprintf(stderr, "Warning! Found \".\" character(s). These are treated as gaps\n");
+
+ if (ferror(fp)) {
+ fprintf(stderr, "Error reading input file\n");
+ exit(1);
+ }
+
+ alignment_t *align = (alignment_t*)mymalloc(sizeof(alignment_t));
+ align->nSeq = nSeq;
+ align->nPos = nPos;
+ align->names = names;
+ align->seqs = seqs;
+ align->nSaved = nSaved;
+ return(align);
+}
+
+void FreeAlignmentSeqs(/*IN/OUT*/alignment_t *aln) {
+ assert(aln != NULL);
+ int i;
+ for (i = 0; i < aln->nSeq; i++)
+ aln->seqs[i] = myfree(aln->seqs[i], aln->nPos+1);
+}
+
+alignment_t *FreeAlignment(alignment_t *aln) {
+ if(aln==NULL)
+ return(NULL);
+ int i;
+ for (i = 0; i < aln->nSeq; i++) {
+ aln->names[i] = myfree(aln->names[i],strlen(aln->names[i])+1);
+ aln->seqs[i] = myfree(aln->seqs[i], aln->nPos+1);
+ }
+ aln->names = myfree(aln->names, sizeof(char*)*aln->nSaved);
+ aln->seqs = myfree(aln->seqs, sizeof(char*)*aln->nSaved);
+ myfree(aln, sizeof(alignment_t));
+ return(NULL);
+}
+
+char **AlnToConstraints(alignment_t *constraints, uniquify_t *unique, hashstrings_t *hashnames) {
+ /* look up constraints as names and map to unique-space */
+ char ** uniqConstraints = (char**)mymalloc(sizeof(char*) * unique->nUnique);
+ int i;
+ for (i = 0; i < unique->nUnique; i++)
+ uniqConstraints[i] = NULL;
+ for (i = 0; i < constraints->nSeq; i++) {
+ char *name = constraints->names[i];
+ char *constraintSeq = constraints->seqs[i];
+ hashiterator_t hi = FindMatch(hashnames,name);
+ if (HashCount(hashnames,hi) != 1) {
+ fprintf(stderr, "Sequence %s from constraints file is not in the alignment\n", name);
+ exit(1);
+ }
+ int iSeqNonunique = HashFirst(hashnames,hi);
+ assert(iSeqNonunique >= 0 && iSeqNonunique < unique->nSeq);
+ int iSeqUnique = unique->alnToUniq[iSeqNonunique];
+ assert(iSeqUnique >= 0 && iSeqUnique < unique->nUnique);
+ if (uniqConstraints[iSeqUnique] != NULL) {
+ /* Already set a constraint for this group of sequences!
+ Warn that we are ignoring this one unless the constraints match */
+ if (strcmp(uniqConstraints[iSeqUnique],constraintSeq) != 0) {
+ fprintf(stderr,
+ "Warning: ignoring constraints for %s:\n%s\n"
+ "Another sequence has the same sequence but different constraints\n",
+ name, constraintSeq);
+ }
+ } else {
+ uniqConstraints[iSeqUnique] = constraintSeq;
+ }
+ }
+ return(uniqConstraints);
+}
+
+
+profile_t *SeqToProfile(/*IN/OUT*/NJ_t *NJ,
+ char *seq, int nPos,
+ /*OPTIONAL*/char *constraintSeq, int nConstraints,
+ int iNode,
+ unsigned long counts[256]) {
+ static unsigned char charToCode[256];
+ static int codeSet = 0;
+ int c, i;
+
+ if (!codeSet) {
+ for (c = 0; c < 256; c++) {
+ charToCode[c] = nCodes;
+ }
+ for (i = 0; codesString[i]; i++) {
+ charToCode[codesString[i]] = i;
+ charToCode[tolower(codesString[i])] = i;
+ }
+ charToCode['-'] = NOCODE;
+ codeSet=1;
+ }
+
+ assert(strlen(seq) == nPos);
+ profile_t *profile = NewProfile(nPos,nConstraints);
+
+ for (i = 0; i < nPos; i++) {
+ unsigned int character = (unsigned int) seq[i];
+ counts[character]++;
+ c = charToCode[character];
+ if(verbose>10 && i < 2) fprintf(stderr,"pos %d char %c code %d\n", i, seq[i], c);
+ /* treat unknowns as gaps */
+ if (c == nCodes || c == NOCODE) {
+ profile->codes[i] = NOCODE;
+ profile->weights[i] = 0.0;
+ } else {
+ profile->codes[i] = c;
+ profile->weights[i] = 1.0;
+ }
+ }
+ if (nConstraints > 0) {
+ for (i = 0; i < nConstraints; i++) {
+ profile->nOn[i] = 0;
+ profile->nOff[i] = 0;
+ }
+ bool bWarn = false;
+ if (constraintSeq != NULL) {
+ assert(strlen(constraintSeq) == nConstraints);
+ for (i = 0; i < nConstraints; i++) {
+ if (constraintSeq[i] == '1') {
+ profile->nOn[i] = 1;
+ } else if (constraintSeq[i] == '0') {
+ profile->nOff[i] = 1;
+ } else if (constraintSeq[i] != '-') {
+ if (!bWarn) {
+ fprintf(stderr, "Constraint characters in unique sequence %d replaced with gap:", iNode+1);
+ bWarn = true;
+ }
+ fprintf(stderr, " %c%d", constraintSeq[i], i+1);
+ /* For the benefit of ConstraintSequencePenalty -- this is a bit of a hack, as
+ this modifies the value read from the alignment
+ */
+ constraintSeq[i] = '-';
+ }
+ }
+ if (bWarn)
+ fprintf(stderr, "\n");
+ }
+ }
+ return profile;
+}
+
+void SeqDist(unsigned char *codes1, unsigned char *codes2, int nPos,
+ distance_matrix_t *dmat,
+ /*OUT*/besthit_t *hit) {
+ double top = 0; /* summed over positions */
+ int nUse = 0;
+ int i;
+ if (dmat==NULL) {
+ int nDiff = 0;
+ for (i = 0; i < nPos; i++) {
+ if (codes1[i] != NOCODE && codes2[i] != NOCODE) {
+ nUse++;
+ if (codes1[i] != codes2[i]) nDiff++;
+ }
+ }
+ top = (double)nDiff;
+ } else {
+ for (i = 0; i < nPos; i++) {
+ if (codes1[i] != NOCODE && codes2[i] != NOCODE) {
+ nUse++;
+ top += dmat->distances[(unsigned int)codes1[i]][(unsigned int)codes2[i]];
+ }
+ }
+ }
+ hit->weight = (double)nUse;
+ hit->dist = nUse > 0 ? top/(double)nUse : 1.0;
+ seqOps++;
+}
+
+void CorrectedPairDistances(profile_t **profiles, int nProfiles,
+ /*OPTIONAL*/distance_matrix_t *distance_matrix,
+ int nPos,
+ /*OUT*/double *distances) {
+ assert(distances != NULL);
+ assert(profiles != NULL);
+ assert(nProfiles>1 && nProfiles <= 4);
+ besthit_t hit[6];
+ int iHit,i,j;
+
+ for (iHit=0, i=0; i < nProfiles; i++) {
+ for (j=i+1; j < nProfiles; j++, iHit++) {
+ ProfileDist(profiles[i],profiles[j],nPos,distance_matrix,/*OUT*/&hit[iHit]);
+ distances[iHit] = hit[iHit].dist;
+ }
+ }
+ if (pseudoWeight > 0) {
+ /* Estimate the prior distance */
+ double dTop = 0;
+ double dBottom = 0;
+ for (iHit=0; iHit < (nProfiles*(nProfiles-1))/2; iHit++) {
+ dTop += hit[iHit].dist * hit[iHit].weight;
+ dBottom += hit[iHit].weight;
+ }
+ double prior = (dBottom > 0.01) ? dTop/dBottom : 3.0;
+ for (iHit=0; iHit < (nProfiles*(nProfiles-1))/2; iHit++)
+ distances[iHit] = (distances[iHit] * hit[iHit].weight + prior * pseudoWeight)
+ / (hit[iHit].weight + pseudoWeight);
+ }
+ if (logdist) {
+ for (iHit=0; iHit < (nProfiles*(nProfiles-1))/2; iHit++)
+ distances[iHit] = LogCorrect(distances[iHit]);
+ }
+}
+
+/* During the neighbor-joining phase, a join only violates our constraints if
+ node1, node2, and other are all represented in the constraint
+ and if one of the 3 is split and the other two do not agree
+ */
+int JoinConstraintPenalty(/*IN*/NJ_t *NJ, int node1, int node2) {
+ if (NJ->nConstraints == 0)
+ return(0.0);
+ int penalty = 0;
+ int iC;
+ for (iC = 0; iC < NJ->nConstraints; iC++)
+ penalty += JoinConstraintPenaltyPiece(NJ, node1, node2, iC);
+ return(penalty);
+}
+
+int JoinConstraintPenaltyPiece(NJ_t *NJ, int node1, int node2, int iC) {
+ profile_t *pOut = NJ->outprofile;
+ profile_t *p1 = NJ->profiles[node1];
+ profile_t *p2 = NJ->profiles[node2];
+ int nOn1 = p1->nOn[iC];
+ int nOff1 = p1->nOff[iC];
+ int nOn2 = p2->nOn[iC];
+ int nOff2 = p2->nOff[iC];
+ int nOnOut = pOut->nOn[iC] - nOn1 - nOn2;
+ int nOffOut = pOut->nOff[iC] - nOff1 - nOff2;
+
+ if ((nOn1+nOff1) > 0 && (nOn2+nOff2) > 0 && (nOnOut+nOffOut) > 0) {
+ /* code is -1 for split, 0 for off, 1 for on */
+ int code1 = (nOn1 > 0 && nOff1 > 0) ? -1 : (nOn1 > 0 ? 1 : 0);
+ int code2 = (nOn2 > 0 && nOff2 > 0) ? -1 : (nOn2 > 0 ? 1 : 0);
+ int code3 = (nOnOut > 0 && nOffOut) > 0 ? -1 : (nOnOut > 0 ? 1 : 0);
+ int nSplit = (code1 == -1 ? 1 : 0) + (code2 == -1 ? 1 : 0) + (code3 == -1 ? 1 : 0);
+ int nOn = (code1 == 1 ? 1 : 0) + (code2 == 1 ? 1 : 0) + (code3 == 1 ? 1 : 0);
+ if (nSplit == 1 && nOn == 1)
+ return(SplitConstraintPenalty(nOn1+nOn2, nOff1+nOff2, nOnOut, nOffOut));
+ }
+ /* else */
+ return(0);
+}
+
+void QuartetConstraintPenalties(profile_t *profiles[4], int nConstraints, /*OUT*/double penalty[3]) {
+ int i;
+ for (i=0; i < 3; i++)
+ penalty[i] = 0.0;
+ if(nConstraints == 0)
+ return;
+ int iC;
+ for (iC = 0; iC < nConstraints; iC++) {
+ double part[3];
+ if (QuartetConstraintPenaltiesPiece(profiles, iC, /*OUT*/part)) {
+ for (i=0;i<3;i++)
+ penalty[i] += part[i];
+
+ if (verbose>2
+ && (fabs(part[ABvsCD]-part[ACvsBD]) > 0.001 || fabs(part[ABvsCD]-part[ADvsBC]) > 0.001))
+ fprintf(stderr, "Constraint Penalties at %d: ABvsCD %.3f ACvsBD %.3f ADvsBC %.3f %d/%d %d/%d %d/%d %d/%d\n",
+ iC, part[ABvsCD], part[ACvsBD], part[ADvsBC],
+ profiles[0]->nOn[iC], profiles[0]->nOff[iC],
+ profiles[1]->nOn[iC], profiles[1]->nOff[iC],
+ profiles[2]->nOn[iC], profiles[2]->nOff[iC],
+ profiles[3]->nOn[iC], profiles[3]->nOff[iC]);
+ }
+ }
+ if (verbose>2)
+ fprintf(stderr, "Total Constraint Penalties: ABvsCD %.3f ACvsBD %.3f ADvsBC %.3f\n",
+ penalty[ABvsCD], penalty[ACvsBD], penalty[ADvsBC]);
+}
+
+double PairConstraintDistance(int nOn1, int nOff1, int nOn2, int nOff2) {
+ double f1 = nOn1/(double)(nOn1+nOff1);
+ double f2 = nOn2/(double)(nOn2+nOff2);
+ /* 1 - f1 * f2 - (1-f1)*(1-f2) = 1 - f1 * f2 - 1 + f1 + f2 - f1 * f2 */
+ return(f1 + f2 - 2.0 * f1 * f2);
+}
+
+bool QuartetConstraintPenaltiesPiece(profile_t *profiles[4], int iC, /*OUT*/double piece[3]) {
+ int nOn[4];
+ int nOff[4];
+ int i;
+ int nSplit = 0;
+ int nPlus = 0;
+ int nMinus = 0;
+
+ for (i=0; i < 4; i++) {
+ nOn[i] = profiles[i]->nOn[iC];
+ nOff[i] = profiles[i]->nOff[iC];
+ if (nOn[i] + nOff[i] == 0)
+ return(false); /* ignore */
+ else if (nOn[i] > 0 && nOff[i] > 0)
+ nSplit++;
+ else if (nOn[i] > 0)
+ nPlus++;
+ else
+ nMinus++;
+ }
+ /* If just one of them is split or on the other side and the others all agree, also ignore */
+ if (nPlus >= 3 || nMinus >= 3)
+ return(false);
+ piece[ABvsCD] = constraintWeight
+ * (PairConstraintDistance(nOn[0],nOff[0],nOn[1],nOff[1])
+ + PairConstraintDistance(nOn[2],nOff[2],nOn[3],nOff[3]));
+ piece[ACvsBD] = constraintWeight
+ * (PairConstraintDistance(nOn[0],nOff[0],nOn[2],nOff[2])
+ + PairConstraintDistance(nOn[1],nOff[1],nOn[3],nOff[3]));
+ piece[ADvsBC] = constraintWeight
+ * (PairConstraintDistance(nOn[0],nOff[0],nOn[3],nOff[3])
+ + PairConstraintDistance(nOn[2],nOff[2],nOn[1],nOff[1]));
+ return(true);
+}
+
+/* Minimum number of constrained leaves that need to be moved
+ to satisfy the constraint (or 0 if constraint is satisfied)
+ Defining it this way should ensure that SPR moves that break
+ constraints get a penalty
+*/
+int SplitConstraintPenalty(int nOn1, int nOff1, int nOn2, int nOff2) {
+ return(nOn1 + nOff2 < nOn2 + nOff1 ?
+ (nOn1 < nOff2 ? nOn1 : nOff2)
+ : (nOn2 < nOff1 ? nOn2 : nOff1));
+}
+
+bool SplitViolatesConstraint(profile_t *profiles[4], int iConstraint) {
+ int i;
+ int codes[4]; /* 0 for off, 1 for on, -1 for split (quit if not constrained at all) */
+ for (i = 0; i < 4; i++) {
+ if (profiles[i]->nOn[iConstraint] + profiles[i]->nOff[iConstraint] == 0)
+ return(false);
+ else if (profiles[i]->nOn[iConstraint] > 0 && profiles[i]->nOff[iConstraint] == 0)
+ codes[i] = 1;
+ else if (profiles[i]->nOn[iConstraint] == 0 && profiles[i]->nOff[iConstraint] > 0)
+ codes[i] = 0;
+ else
+ codes[i] = -1;
+ }
+ int n0 = 0;
+ int n1 = 0;
+ for (i = 0; i < 4; i++) {
+ if (codes[i] == 0)
+ n0++;
+ else if (codes[i] == 1)
+ n1++;
+ }
+ /* 3 on one side means no violation, even if other is code -1
+ otherwise must have code != -1 and agreement on the split
+ */
+ if (n0 >= 3 || n1 >= 3)
+ return(false);
+ if (n0==2 && n1==2 && codes[0] == codes[1] && codes[2] == codes[3])
+ return(false);
+ return(true);
+}
+
+double LogCorrect(double dist) {
+ const double maxscore = 3.0;
+ if (nCodes == 4 && !useMatrix) { /* Jukes-Cantor */
+ dist = dist < 0.74 ? -0.75*log(1.0 - dist * 4.0/3.0) : maxscore;
+ } else { /* scoredist-like */
+ dist = dist < 0.99 ? -1.3*log(1.0 - dist) : maxscore;
+ }
+ return (dist < maxscore ? dist : maxscore);
+}
+
+/* A helper function -- f1 and f2 can be NULL if the corresponding code != NOCODE
+*/
+double ProfileDistPiece(unsigned int code1, unsigned int code2,
+ numeric_t *f1, numeric_t *f2,
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ /*OPTIONAL*/numeric_t *codeDist2) {
+ if (dmat) {
+ if (code1 != NOCODE && code2 != NOCODE) { /* code1 vs code2 */
+ return(dmat->distances[code1][code2]);
+ } else if (codeDist2 != NULL && code1 != NOCODE) { /* code1 vs. codeDist2 */
+ return(codeDist2[code1]);
+ } else { /* f1 vs f2 */
+ if (f1 == NULL) {
+ if(code1 == NOCODE) return(10.0);
+ f1 = &dmat->codeFreq[code1][0];
+ }
+ if (f2 == NULL) {
+ if(code2 == NOCODE) return(10.0);
+ f2 = &dmat->codeFreq[code2][0];
+ }
+ return(vector_multiply3_sum(f1,f2,dmat->eigenval,nCodes));
+ }
+ } else {
+ /* no matrix */
+ if (code1 != NOCODE) {
+ if (code2 != NOCODE) {
+ return(code1 == code2 ? 0.0 : 1.0); /* code1 vs code2 */
+ } else {
+ if(f2 == NULL) return(10.0);
+ return(1.0 - f2[code1]); /* code1 vs. f2 */
+ }
+ } else {
+ if (code2 != NOCODE) {
+ if(f1 == NULL) return(10.0);
+ return(1.0 - f1[code2]); /* f1 vs code2 */
+ } else { /* f1 vs. f2 */
+ if (f1 == NULL || f2 == NULL) return(10.0);
+ double piece = 1.0;
+ int k;
+ for (k = 0; k < nCodes; k++) {
+ piece -= f1[k] * f2[k];
+ }
+ return(piece);
+ }
+ }
+ }
+ assert(0);
+}
+
+/* E.g. GET_FREQ(profile,iPos,iVector)
+ Gets the next element of the vectors (and updates iVector), or
+ returns NULL if we didn't store a vector
+*/
+#define GET_FREQ(P,I,IVECTOR) \
+(P->weights[I] > 0 && P->codes[I] == NOCODE ? &P->vectors[nCodes*(IVECTOR++)] : NULL)
+
+void ProfileDist(profile_t *profile1, profile_t *profile2, int nPos,
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ /*OUT*/besthit_t *hit) {
+ double top = 0;
+ double denom = 0;
+ int iFreq1 = 0;
+ int iFreq2 = 0;
+ int i = 0;
+ for (i = 0; i < nPos; i++) {
+ numeric_t *f1 = GET_FREQ(profile1,i,/*IN/OUT*/iFreq1);
+ numeric_t *f2 = GET_FREQ(profile2,i,/*IN/OUT*/iFreq2);
+ if (profile1->weights[i] > 0 && profile2->weights[i] > 0) {
+ double weight = profile1->weights[i] * profile2->weights[i];
+ denom += weight;
+ double piece = ProfileDistPiece(profile1->codes[i],profile2->codes[i],f1,f2,dmat,
+ profile2->codeDist ? &profile2->codeDist[i*nCodes] : NULL);
+ top += weight * piece;
+ }
+ }
+ assert(iFreq1 == profile1->nVectors);
+ assert(iFreq2 == profile2->nVectors);
+ hit->weight = denom > 0 ? denom : 0.01; /* 0.01 is an arbitrarily low value of weight (normally >>1) */
+ hit->dist = denom > 0 ? top/denom : 1;
+ profileOps++;
+}
+
+/* This should not be called if the update weight is 0, as
+ in that case code==NOCODE and in=NULL is possible, and then
+ it will fail.
+*/
+void AddToFreq(/*IN/OUT*/numeric_t *fOut,
+ double weight,
+ unsigned int codeIn, /*OPTIONAL*/numeric_t *fIn,
+ /*OPTIONAL*/distance_matrix_t *dmat) {
+ assert(fOut != NULL);
+ if (fIn != NULL) {
+ vector_add_mult(fOut, fIn, weight, nCodes);
+ } else if (dmat) {
+ assert(codeIn != NOCODE);
+ vector_add_mult(fOut, dmat->codeFreq[codeIn], weight, nCodes);
+ } else {
+ assert(codeIn != NOCODE);
+ fOut[codeIn] += weight;
+ }
+}
+
+void SetProfile(/*IN/OUT*/NJ_t *NJ, int node, double weight1) {
+ children_t *c = &NJ->child[node];
+ assert(c->nChild == 2);
+ assert(NJ->profiles[c->child[0]] != NULL);
+ assert(NJ->profiles[c->child[1]] != NULL);
+ if (NJ->profiles[node] != NULL)
+ FreeProfile(NJ->profiles[node], NJ->nPos, NJ->nConstraints);
+ NJ->profiles[node] = AverageProfile(NJ->profiles[c->child[0]],
+ NJ->profiles[c->child[1]],
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix,
+ weight1);
+}
+
+/* bionjWeight is the weight of the first sequence (between 0 and 1),
+ or -1 to do the average.
+ */
+profile_t *AverageProfile(profile_t *profile1, profile_t *profile2,
+ int nPos, int nConstraints,
+ distance_matrix_t *dmat,
+ double bionjWeight) {
+ int i;
+ if (bionjWeight < 0) {
+ bionjWeight = 0.5;
+ }
+
+ /* First, set codes and weights and see how big vectors will be */
+ profile_t *out = NewProfile(nPos, nConstraints);
+
+ for (i = 0; i < nPos; i++) {
+ out->weights[i] = bionjWeight * profile1->weights[i]
+ + (1-bionjWeight) * profile2->weights[i];
+ out->codes[i] = NOCODE;
+ if (out->weights[i] > 0) {
+ if (profile1->weights[i] > 0 && profile1->codes[i] != NOCODE
+ && (profile2->weights[i] <= 0 || profile1->codes[i] == profile2->codes[i])) {
+ out->codes[i] = profile1->codes[i];
+ } else if (profile1->weights[i] <= 0
+ && profile2->weights[i] > 0
+ && profile2->codes[i] != NOCODE) {
+ out->codes[i] = profile2->codes[i];
+ }
+ if (out->codes[i] == NOCODE) out->nVectors++;
+ }
+ }
+
+ /* Allocate and set the vectors */
+ out->vectors = (numeric_t*)mymalloc(sizeof(numeric_t)*nCodes*out->nVectors);
+ for (i = 0; i < nCodes * out->nVectors; i++) out->vectors[i] = 0;
+ nProfileFreqAlloc += out->nVectors;
+ nProfileFreqAvoid += nPos - out->nVectors;
+ int iFreqOut = 0;
+ int iFreq1 = 0;
+ int iFreq2 = 0;
+ for (i=0; i < nPos; i++) {
+ numeric_t *f = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ numeric_t *f1 = GET_FREQ(profile1,i,/*IN/OUT*/iFreq1);
+ numeric_t *f2 = GET_FREQ(profile2,i,/*IN/OUT*/iFreq2);
+ if (f != NULL) {
+ if (profile1->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/f, profile1->weights[i] * bionjWeight,
+ profile1->codes[i], f1, dmat);
+ if (profile2->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/f, profile2->weights[i] * (1.0-bionjWeight),
+ profile2->codes[i], f2, dmat);
+ NormalizeFreq(/*IN/OUT*/f, dmat);
+ } /* end if computing f */
+ if (verbose > 10 && i < 5) {
+ fprintf(stderr,"Average profiles: pos %d in-w1 %f in-w2 %f bionjWeight %f to weight %f code %d\n",
+ i, profile1->weights[i], profile2->weights[i], bionjWeight,
+ out->weights[i], out->codes[i]);
+ if (f!= NULL) {
+ int k;
+ for (k = 0; k < nCodes; k++)
+ fprintf(stderr, "\t%c:%f", codesString[k], f ? f[k] : -1.0);
+ fprintf(stderr,"\n");
+ }
+ }
+ } /* end loop over positions */
+ assert(iFreq1 == profile1->nVectors);
+ assert(iFreq2 == profile2->nVectors);
+ assert(iFreqOut == out->nVectors);
+
+ /* compute total constraints */
+ for (i = 0; i < nConstraints; i++) {
+ out->nOn[i] = profile1->nOn[i] + profile2->nOn[i];
+ out->nOff[i] = profile1->nOff[i] + profile2->nOff[i];
+ }
+ profileAvgOps++;
+ return(out);
+}
+
+/* Make the (unrotated) frequencies sum to 1
+ Simply dividing by total_weight is not ideal because of roundoff error
+ So compute total_freq instead
+*/
+void NormalizeFreq(/*IN/OUT*/numeric_t *freq, distance_matrix_t *dmat) {
+ double total_freq = 0;
+ int k;
+ if (dmat != NULL) {
+ /* The total frequency is dot_product(true_frequencies, 1)
+ So we rotate the 1 vector by eigeninv (stored in eigentot)
+ */
+ total_freq = vector_multiply_sum(freq, dmat->eigentot, nCodes);
+ } else {
+ for (k = 0; k < nCodes; k++)
+ total_freq += freq[k];
+ }
+ if (total_freq > fPostTotalTolerance) {
+ numeric_t inverse_weight = 1.0/total_freq;
+ vector_multiply_by(/*IN/OUT*/freq, inverse_weight, nCodes);
+ } else {
+ /* This can happen if we are in a very low-weight region, e.g. if a mostly-gap position gets weighted down
+ repeatedly; just set them all to arbitrary but legal values */
+ if (dmat == NULL) {
+ for (k = 0; k < nCodes; k++)
+ freq[k] = 1.0/nCodes;
+ } else {
+ for (k = 0; k < nCodes; k++)
+ freq[k] = dmat->codeFreq[0][k];/*XXX gapFreq[k];*/
+ }
+ }
+}
+
+/* OutProfile() computes the out-profile */
+profile_t *OutProfile(profile_t **profiles, int nProfiles,
+ int nPos, int nConstraints,
+ distance_matrix_t *dmat) {
+ int i; /* position */
+ int in; /* profile */
+ profile_t *out = NewProfile(nPos, nConstraints);
+
+ double inweight = 1.0/(double)nProfiles; /* The maximal output weight is 1.0 */
+
+ /* First, set weights -- code is always NOCODE, prevent weight=0 */
+ for (i = 0; i < nPos; i++) {
+ out->weights[i] = 0;
+ for (in = 0; in < nProfiles; in++)
+ out->weights[i] += profiles[in]->weights[i] * inweight;
+ if (out->weights[i] <= 0) out->weights[i] = 1e-20; /* always store a vector */
+ out->nVectors++;
+ out->codes[i] = NOCODE; /* outprofile is normally complicated */
+ }
+
+ /* Initialize the frequencies to 0 */
+ out->vectors = (numeric_t*)mymalloc(sizeof(numeric_t)*nCodes*out->nVectors);
+ for (i = 0; i < nCodes*out->nVectors; i++)
+ out->vectors[i] = 0;
+
+ /* Add up the weights, going through each sequence in turn */
+ for (in = 0; in < nProfiles; in++) {
+ int iFreqOut = 0;
+ int iFreqIn = 0;
+ for (i = 0; i < nPos; i++) {
+ numeric_t *fIn = GET_FREQ(profiles[in],i,/*IN/OUT*/iFreqIn);
+ numeric_t *fOut = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ if (profiles[in]->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/fOut, profiles[in]->weights[i],
+ profiles[in]->codes[i], fIn, dmat);
+ }
+ assert(iFreqOut == out->nVectors);
+ assert(iFreqIn == profiles[in]->nVectors);
+ }
+
+ /* And normalize the frequencies to sum to 1 */
+ int iFreqOut = 0;
+ for (i = 0; i < nPos; i++) {
+ numeric_t *fOut = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ if (fOut)
+ NormalizeFreq(/*IN/OUT*/fOut, dmat);
+ }
+ assert(iFreqOut == out->nVectors);
+ if (verbose > 10) fprintf(stderr,"Average %d profiles\n", nProfiles);
+ if(dmat)
+ SetCodeDist(/*IN/OUT*/out, nPos, dmat);
+
+ /* Compute constraints */
+ for (i = 0; i < nConstraints; i++) {
+ out->nOn[i] = 0;
+ out->nOff[i] = 0;
+ for (in = 0; in < nProfiles; in++) {
+ out->nOn[i] += profiles[in]->nOn[i];
+ out->nOff[i] += profiles[in]->nOff[i];
+ }
+ }
+ return(out);
+}
+
+void UpdateOutProfile(/*IN/OUT*/profile_t *out, profile_t *old1, profile_t *old2,
+ profile_t *new, int nActiveOld,
+ int nPos, int nConstraints,
+ distance_matrix_t *dmat) {
+ int i, k;
+ int iFreqOut = 0;
+ int iFreq1 = 0;
+ int iFreq2 = 0;
+ int iFreqNew = 0;
+ assert(nActiveOld > 0);
+
+ for (i = 0; i < nPos; i++) {
+ numeric_t *fOut = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ numeric_t *fOld1 = GET_FREQ(old1,i,/*IN/OUT*/iFreq1);
+ numeric_t *fOld2 = GET_FREQ(old2,i,/*IN/OUT*/iFreq2);
+ numeric_t *fNew = GET_FREQ(new,i,/*IN/OUT*/iFreqNew);
+
+ assert(out->codes[i] == NOCODE && fOut != NULL); /* No no-vector optimization for outprofiles */
+ if (verbose > 3 && i < 3) {
+ fprintf(stderr,"Updating out-profile position %d weight %f (mult %f)\n",
+ i, out->weights[i], out->weights[i]*nActiveOld);
+ }
+ double originalMult = out->weights[i]*nActiveOld;
+ double newMult = originalMult + new->weights[i] - old1->weights[i] - old2->weights[i];
+ out->weights[i] = newMult/(nActiveOld-1);
+ if (out->weights[i] <= 0) out->weights[i] = 1e-20; /* always use the vector */
+
+ for (k = 0; k < nCodes; k++) fOut[k] *= originalMult;
+
+ if (old1->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/fOut, -old1->weights[i], old1->codes[i], fOld1, dmat);
+ if (old2->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/fOut, -old2->weights[i], old2->codes[i], fOld2, dmat);
+ if (new->weights[i] > 0)
+ AddToFreq(/*IN/OUT*/fOut, new->weights[i], new->codes[i], fNew, dmat);
+
+ /* And renormalize */
+ NormalizeFreq(/*IN/OUT*/fOut, dmat);
+
+ if (verbose > 2 && i < 3) {
+ fprintf(stderr,"Updated out-profile position %d weight %f (mult %f)",
+ i, out->weights[i], out->weights[i]*nActiveOld);
+ if(out->weights[i] > 0)
+ for (k=0;k<nCodes;k++)
+ fprintf(stderr, " %c:%f", dmat?'?':codesString[k], fOut[k]);
+ fprintf(stderr,"\n");
+ }
+ }
+ assert(iFreqOut == out->nVectors);
+ assert(iFreq1 == old1->nVectors);
+ assert(iFreq2 == old2->nVectors);
+ assert(iFreqNew == new->nVectors);
+ if(dmat)
+ SetCodeDist(/*IN/OUT*/out,nPos,dmat);
+
+ /* update constraints -- note in practice this should be a no-op */
+ for (i = 0; i < nConstraints; i++) {
+ out->nOn[i] += new->nOn[i] - old1->nOn[i] - old2->nOn[i];
+ out->nOff[i] += new->nOff[i] - old1->nOff[i] - old2->nOff[i];
+ }
+}
+
+void SetCodeDist(/*IN/OUT*/profile_t *profile, int nPos,
+ distance_matrix_t *dmat) {
+ if (profile->codeDist == NULL)
+ profile->codeDist = (numeric_t*)mymalloc(sizeof(numeric_t)*nPos*nCodes);
+ int i;
+ int iFreq = 0;
+ for (i = 0; i < nPos; i++) {
+ numeric_t *f = GET_FREQ(profile,i,/*IN/OUT*/iFreq);
+
+ int k;
+ for (k = 0; k < nCodes; k++)
+ profile->codeDist[i*nCodes+k] = ProfileDistPiece(/*code1*/profile->codes[i], /*code2*/k,
+ /*f1*/f, /*f2*/NULL,
+ dmat, NULL);
+ }
+ assert(iFreq==profile->nVectors);
+}
+
+
+void SetBestHit(int node, NJ_t *NJ, int nActive,
+ /*OUT*/besthit_t *bestjoin, /*OUT OPTIONAL*/besthit_t *allhits) {
+ assert(NJ->parent[node] < 0);
+
+ bestjoin->i = node;
+ bestjoin->j = -1;
+ bestjoin->dist = 1e20;
+ bestjoin->criterion = 1e20;
+
+ int j;
+ besthit_t tmp;
+
+#ifdef OPENMP
+ /* Note -- if we are already in a parallel region, this will be ignored */
+ #pragma omp parallel for schedule(dynamic, 50)
+#endif
+ for (j = 0; j < NJ->maxnode; j++) {
+ besthit_t *sv = allhits != NULL ? &allhits[j] : &tmp;
+ sv->i = node;
+ sv->j = j;
+ if (NJ->parent[j] >= 0) {
+ sv->i = -1; /* illegal/empty join */
+ sv->weight = 0.0;
+ sv->criterion = sv->dist = 1e20;
+ continue;
+ }
+ /* Note that we compute self-distances (allow j==node) because the top-hit heuristic
+ expects self to be within its top hits, but we exclude those from the bestjoin
+ that we return...
+ */
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/sv);
+ if (sv->criterion < bestjoin->criterion && node != j)
+ *bestjoin = *sv;
+ }
+ if (verbose>5) {
+ fprintf(stderr, "SetBestHit %d %d %f %f\n", bestjoin->i, bestjoin->j, bestjoin->dist, bestjoin->criterion);
+ }
+}
+
+void ReadMatrix(char *filename, /*OUT*/numeric_t codes[MAXCODES][MAXCODES], bool checkCodes) {
+ char buf[BUFFER_SIZE] = "";
+ FILE *fp = fopen(filename, "r");
+ if (fp == NULL) {
+ fprintf(stderr, "Cannot read %s\n",filename);
+ exit(1);
+ }
+ if (fgets(buf,sizeof(buf),fp) == NULL) {
+ fprintf(stderr, "Error reading header line for %s:\n%s\n", filename, buf);
+ exit(1);
+ }
+ if (checkCodes) {
+ int i;
+ int iBufPos;
+ for (iBufPos=0,i=0;i<nCodes;i++,iBufPos++) {
+ if(buf[iBufPos] != codesString[i]) {
+ fprintf(stderr,"Header line\n%s\nin file %s does not have expected code %c # %d in %s\n",
+ buf, filename, codesString[i], i, codesString);
+ exit(1);
+ }
+ iBufPos++;
+ if(buf[iBufPos] != '\n' && buf[iBufPos] != '\r' && buf[iBufPos] != '\0' && buf[iBufPos] != '\t') {
+ fprintf(stderr, "Header line in %s should be tab-delimited\n", filename);
+ exit(1);
+ }
+ if (buf[iBufPos] == '\0' && i < nCodes-1) {
+ fprintf(stderr, "Header line in %s ends prematurely\n",filename);
+ exit(1);
+ }
+ } /* end loop over codes */
+ /* Should be at end, but allow \n because of potential DOS \r\n */
+ if(buf[iBufPos] != '\0' && buf[iBufPos] != '\n' && buf[iBufPos] != '\r') {
+ fprintf(stderr, "Header line in %s has too many entries\n", filename);
+ exit(1);
+ }
+ }
+ int iLine;
+ for (iLine = 0; iLine < nCodes; iLine++) {
+ buf[0] = '\0';
+ if (fgets(buf,sizeof(buf),fp) == NULL) {
+ fprintf(stderr, "Cannot read line %d from file %s\n", iLine+2, filename);
+ exit(1);
+ }
+ char *field = strtok(buf,"\t\r\n");
+ field = strtok(NULL, "\t"); /* ignore first column */
+ int iColumn;
+ for (iColumn = 0; iColumn < nCodes && field != NULL; iColumn++, field = strtok(NULL,"\t")) {
+ if(sscanf(field,ScanNumericSpec,&codes[iLine][iColumn]) != 1) {
+ fprintf(stderr,"Cannot parse field %s in file %s\n", field, filename);
+ exit(1);
+ }
+ }
+ }
+}
+
+void ReadVector(char *filename, /*OUT*/numeric_t codes[MAXCODES]) {
+ FILE *fp = fopen(filename,"r");
+ if (fp == NULL) {
+ fprintf(stderr, "Cannot read %s\n",filename);
+ exit(1);
+ }
+ int i;
+ for (i = 0; i < nCodes; i++) {
+ if (fscanf(fp,ScanNumericSpec,&codes[i]) != 1) {
+ fprintf(stderr,"Cannot read %d entry of %s\n",i+1,filename);
+ exit(1);
+ }
+ }
+ if (fclose(fp) != 0) {
+ fprintf(stderr, "Error reading %s\n",filename);
+ exit(1);
+ }
+}
+
+distance_matrix_t *ReadDistanceMatrix(char *prefix) {
+ char buffer[BUFFER_SIZE];
+ distance_matrix_t *dmat = (distance_matrix_t*)mymalloc(sizeof(distance_matrix_t));
+
+ if(strlen(prefix) > BUFFER_SIZE-20) {
+ fprintf(stderr,"Filename %s too long\n", prefix);
+ exit(1);
+ }
+
+ strcpy(buffer, prefix);
+ strcat(buffer, ".distances");
+ ReadMatrix(buffer, /*OUT*/dmat->distances, /*checkCodes*/true);
+
+ strcpy(buffer, prefix);
+ strcat(buffer, ".inverses");
+ ReadMatrix(buffer, /*OUT*/dmat->eigeninv, /*checkCodes*/false);
+
+ strcpy(buffer, prefix);
+ strcat(buffer, ".eigenvalues");
+ ReadVector(buffer, /*OUT*/dmat->eigenval);
+
+ if(verbose>1) fprintf(stderr, "Read distance matrix from %s\n",prefix);
+ SetupDistanceMatrix(/*IN/OUT*/dmat);
+ return(dmat);
+}
+
+void SetupDistanceMatrix(/*IN/OUT*/distance_matrix_t *dmat) {
+ /* Check that the eigenvalues and eigen-inverse are consistent with the
+ distance matrix and that the matrix is symmetric */
+ int i,j,k;
+ for (i = 0; i < nCodes; i++) {
+ for (j = 0; j < nCodes; j++) {
+ if(fabs(dmat->distances[i][j]-dmat->distances[j][i]) > 1e-6) {
+ fprintf(stderr,"Distance matrix not symmetric for %d,%d: %f vs %f\n",
+ i+1,j+1,
+ dmat->distances[i][j],
+ dmat->distances[j][i]);
+ exit(1);
+ }
+ double total = 0.0;
+ for (k = 0; k < nCodes; k++)
+ total += dmat->eigenval[k] * dmat->eigeninv[k][i] * dmat->eigeninv[k][j];
+ if(fabs(total - dmat->distances[i][j]) > 1e-6) {
+ fprintf(stderr,"Distance matrix entry %d,%d should be %f but eigen-representation gives %f\n",
+ i+1,j+1,dmat->distances[i][j],total);
+ exit(1);
+ }
+ }
+ }
+
+ /* And compute eigentot */
+ for (k = 0; k < nCodes; k++) {
+ dmat->eigentot[k] = 0.;
+ int j;
+ for (j = 0; j < nCodes; j++)
+ dmat->eigentot[k] += dmat->eigeninv[k][j];
+ }
+
+ /* And compute codeFreq */
+ int code;
+ for(code = 0; code < nCodes; code++) {
+ for (k = 0; k < nCodes; k++) {
+ dmat->codeFreq[code][k] = dmat->eigeninv[k][code];
+ }
+ }
+ /* And gapFreq */
+ for(code = 0; code < nCodes; code++) {
+ double gapFreq = 0.0;
+ for (k = 0; k < nCodes; k++)
+ gapFreq += dmat->codeFreq[k][code];
+ dmat->gapFreq[code] = gapFreq / nCodes;
+ }
+
+ if(verbose>10) fprintf(stderr, "Made codeFreq\n");
+}
+
+nni_t ChooseNNI(profile_t *profiles[4],
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ int nPos, int nConstraints,
+ /*OUT*/double criteria[3]) {
+ double d[6];
+ CorrectedPairDistances(profiles, 4, dmat, nPos, /*OUT*/d);
+ double penalty[3]; /* indexed as nni_t */
+ QuartetConstraintPenalties(profiles, nConstraints, /*OUT*/penalty);
+ criteria[ABvsCD] = d[qAB] + d[qCD] + penalty[ABvsCD];
+ criteria[ACvsBD] = d[qAC] + d[qBD] + penalty[ACvsBD];
+ criteria[ADvsBC] = d[qAD] + d[qBC] + penalty[ADvsBC];
+
+ nni_t choice = ABvsCD;
+ if (criteria[ACvsBD] < criteria[ABvsCD] && criteria[ACvsBD] <= criteria[ADvsBC]) {
+ choice = ACvsBD;
+ } else if (criteria[ADvsBC] < criteria[ABvsCD] && criteria[ADvsBC] <= criteria[ACvsBD]) {
+ choice = ADvsBC;
+ }
+ if (verbose > 1 && penalty[choice] > penalty[ABvsCD] + 1e-6) {
+ fprintf(stderr, "Worsen constraint: from %.3f to %.3f distance %.3f to %.3f: ",
+ penalty[ABvsCD], penalty[choice],
+ criteria[ABvsCD], choice == ACvsBD ? criteria[ACvsBD] : criteria[ADvsBC]);
+ int iC;
+ for (iC = 0; iC < nConstraints; iC++) {
+ double ppart[3];
+ if (QuartetConstraintPenaltiesPiece(profiles, iC, /*OUT*/ppart)) {
+ double old_penalty = ppart[ABvsCD];
+ double new_penalty = ppart[choice];
+ if (new_penalty > old_penalty + 1e-6)
+ fprintf(stderr, " %d (%d/%d %d/%d %d/%d %d/%d)", iC,
+ profiles[0]->nOn[iC], profiles[0]->nOff[iC],
+ profiles[1]->nOn[iC], profiles[1]->nOff[iC],
+ profiles[2]->nOn[iC], profiles[2]->nOff[iC],
+ profiles[3]->nOn[iC], profiles[3]->nOff[iC]);
+ }
+ }
+ fprintf(stderr,"\n");
+ }
+ if (verbose > 3)
+ fprintf(stderr, "NNI scores ABvsCD %.5f ACvsBD %.5f ADvsBC %.5f choice %s\n",
+ criteria[ABvsCD], criteria[ACvsBD], criteria[ADvsBC],
+ choice == ABvsCD ? "AB|CD" : (choice == ACvsBD ? "AC|BD" : "AD|BC"));
+ return(choice);
+}
+
+profile_t *PosteriorProfile(profile_t *p1, profile_t *p2,
+ double len1, double len2,
+ /*OPTIONAL*/transition_matrix_t *transmat,
+ rates_t *rates,
+ int nPos, int nConstraints) {
+ if (len1 < MLMinBranchLength)
+ len1 = MLMinBranchLength;
+ if (len2 < MLMinBranchLength)
+ len2 = MLMinBranchLength;
+
+ int i,j,k;
+ profile_t *out = NewProfile(nPos, nConstraints);
+ for (i = 0; i < nPos; i++) {
+ out->codes[i] = NOCODE;
+ out->weights[i] = 1.0;
+ }
+ out->nVectors = nPos;
+ out->vectors = (numeric_t*)mymalloc(sizeof(numeric_t)*nCodes*out->nVectors);
+ for (i = 0; i < nCodes * out->nVectors; i++) out->vectors[i] = 0;
+ int iFreqOut = 0;
+ int iFreq1 = 0;
+ int iFreq2 = 0;
+ numeric_t *expeigenRates1 = NULL, *expeigenRates2 = NULL;
+
+ if (transmat != NULL) {
+ expeigenRates1 = ExpEigenRates(len1, transmat, rates);
+ expeigenRates2 = ExpEigenRates(len2, transmat, rates);
+ }
+
+ if (transmat == NULL) { /* Jukes-Cantor */
+ assert(nCodes == 4);
+
+ numeric_t fAll[128][4];
+ for (j = 0; j < 4; j++)
+ for (k = 0; k < 4; k++)
+ fAll[j][k] = (j==k) ? 1.0 : 0.0;
+ for (k = 0; k < 4; k++)
+ fAll[NOCODE][k] = 0.25;
+
+ double *PSame1 = PSameVector(len1, rates);
+ double *PDiff1 = PDiffVector(PSame1, rates);
+ double *PSame2 = PSameVector(len2, rates);
+ double *PDiff2 = PDiffVector(PSame2, rates);
+
+ numeric_t mix1[4], mix2[4];
+
+ for (i=0; i < nPos; i++) {
+ int iRate = rates->ratecat[i];
+ double w1 = p1->weights[i];
+ double w2 = p2->weights[i];
+ int code1 = p1->codes[i];
+ int code2 = p2->codes[i];
+ numeric_t *f1 = GET_FREQ(p1,i,/*IN/OUT*/iFreq1);
+ numeric_t *f2 = GET_FREQ(p2,i,/*IN/OUT*/iFreq2);
+
+ /* First try to store a simple profile */
+ if (f1 == NULL && f2 == NULL) {
+ if (code1 == NOCODE && code2 == NOCODE) {
+ out->codes[i] = NOCODE;
+ out->weights[i] = 0.0;
+ continue;
+ } else if (code1 == NOCODE) {
+ /* Posterior(parent | character & gap, len1, len2) = Posterior(parent | character, len1)
+ = PSame() for matching characters and 1-PSame() for the rest
+ = (pSame - pDiff) * character + (1-(pSame-pDiff)) * gap
+ */
+ out->codes[i] = code2;
+ out->weights[i] = w2 * (PSame2[iRate] - PDiff2[iRate]);
+ continue;
+ } else if (code2 == NOCODE) {
+ out->codes[i] = code1;
+ out->weights[i] = w1 * (PSame1[iRate] - PDiff1[iRate]);
+ continue;
+ } else if (code1 == code2) {
+ out->codes[i] = code1;
+ double f12code = (w1*PSame1[iRate] + (1-w1)*0.25) * (w2*PSame2[iRate] + (1-w2)*0.25);
+ double f12other = (w1*PDiff1[iRate] + (1-w1)*0.25) * (w2*PDiff2[iRate] + (1-w2)*0.25);
+ /* posterior probability of code1/code2 after scaling */
+ double pcode = f12code/(f12code+3*f12other);
+ /* Now f = w * (code ? 1 : 0) + (1-w) * 0.25, so to get pcode we need
+ fcode = 1/4 + w1*3/4 or w = (f-1/4)*4/3
+ */
+ out->weights[i] = (pcode - 0.25) * 4.0/3.0;
+ /* This can be zero because of numerical problems, I think */
+ if (out->weights[i] < 1e-6) {
+ if (verbose > 1)
+ fprintf(stderr, "Replaced weight %f with %f from w1 %f w2 %f PSame %f %f f12code %f f12other %f\n",
+ out->weights[i], 1e-6,
+ w1, w2,
+ PSame1[iRate], PSame2[iRate],
+ f12code, f12other);
+ out->weights[i] = 1e-6;
+ }
+ continue;
+ }
+ }
+ /* if we did not compute a simple profile, then do the full computation and
+ store the full vector
+ */
+ if (f1 == NULL) {
+ for (j = 0; j < 4; j++)
+ mix1[j] = (1-w1)*0.25;
+ if(code1 != NOCODE)
+ mix1[code1] += w1;
+ f1 = mix1;
+ }
+ if (f2 == NULL) {
+ for (j = 0; j < 4; j++)
+ mix2[j] = (1-w2)*0.25;
+ if(code2 != NOCODE)
+ mix2[code2] += w2;
+ f2 = mix2;
+ }
+ out->codes[i] = NOCODE;
+ out->weights[i] = 1.0;
+ numeric_t *f = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ double lkAB = 0;
+ for (j = 0; j < 4; j++) {
+ f[j] = (f1[j] * PSame1[iRate] + (1.0-f1[j]) * PDiff1[iRate])
+ * (f2[j] * PSame2[iRate] + (1.0-f2[j]) * PDiff2[iRate]);
+ lkAB += f[j];
+ }
+ double lkABInv = 1.0/lkAB;
+ for (j = 0; j < 4; j++)
+ f[j] *= lkABInv;
+ }
+ PSame1 = myfree(PSame1, sizeof(double) * rates->nRateCategories);
+ PSame2 = myfree(PSame2, sizeof(double) * rates->nRateCategories);
+ PDiff1 = myfree(PDiff1, sizeof(double) * rates->nRateCategories);
+ PDiff2 = myfree(PDiff2, sizeof(double) * rates->nRateCategories);
+ } else if (nCodes == 4) { /* matrix model on nucleotides */
+ numeric_t *fGap = &transmat->codeFreq[NOCODE][0];
+ numeric_t f1mix[4], f2mix[4];
+
+ for (i=0; i < nPos; i++) {
+ if (p1->codes[i] == NOCODE && p2->codes[i] == NOCODE
+ && p1->weights[i] == 0 && p2->weights[i] == 0) {
+ /* aligning gap with gap -- just output a gap
+ out->codes[i] is already set to NOCODE so need not set that */
+ out->weights[i] = 0;
+ continue;
+ }
+ int iRate = rates->ratecat[i];
+ numeric_t *expeigen1 = &expeigenRates1[iRate*4];
+ numeric_t *expeigen2 = &expeigenRates2[iRate*4];
+ numeric_t *f1 = GET_FREQ(p1,i,/*IN/OUT*/iFreq1);
+ numeric_t *f2 = GET_FREQ(p2,i,/*IN/OUT*/iFreq2);
+ numeric_t *fOut = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ assert(fOut != NULL);
+
+ if (f1 == NULL) {
+ f1 = &transmat->codeFreq[p1->codes[i]][0]; /* codeFreq includes an entry for NOCODE */
+ double w = p1->weights[i];
+ if (w > 0.0 && w < 1.0) {
+ for (j = 0; j < 4; j++)
+ f1mix[j] = w * f1[j] + (1.0-w) * fGap[j];
+ f1 = f1mix;
+ }
+ }
+ if (f2 == NULL) {
+ f2 = &transmat->codeFreq[p2->codes[i]][0];
+ double w = p2->weights[i];
+ if (w > 0.0 && w < 1.0) {
+ for (j = 0; j < 4; j++)
+ f2mix[j] = w * f2[j] + (1.0-w) * fGap[j];
+ f2 = f2mix;
+ }
+ }
+ numeric_t fMult1[4] ALIGNED; /* rotated1 * expeigen1 */
+ numeric_t fMult2[4] ALIGNED; /* rotated2 * expeigen2 */
+#if 0 /* SSE3 is slower */
+ vector_multiply(f1, expeigen1, 4, /*OUT*/fMult1);
+ vector_multiply(f2, expeigen2, 4, /*OUT*/fMult2);
+#else
+ for (j = 0; j < 4; j++) {
+ fMult1[j] = f1[j]*expeigen1[j];
+ fMult2[j] = f2[j]*expeigen2[j];
+ }
+#endif
+ numeric_t fPost[4] ALIGNED; /* in unrotated space */
+ for (j = 0; j < 4; j++) {
+#if 0 /* SSE3 is slower */
+ fPost[j] = vector_dot_product_rot(fMult1, fMult2, &transmat->codeFreq[j][0], 4)
+ * transmat->statinv[j]; */
+#else
+ double out1 = 0;
+ double out2 = 0;
+ for (k = 0; k < 4; k++) {
+ out1 += fMult1[k] * transmat->codeFreq[j][k];
+ out2 += fMult2[k] * transmat->codeFreq[j][k];
+ }
+ fPost[j] = out1*out2*transmat->statinv[j];
+#endif
+ }
+ double fPostTot = 0;
+ for (j = 0; j < 4; j++)
+ fPostTot += fPost[j];
+ assert(fPostTot > fPostTotalTolerance);
+ double fPostInv = 1.0/fPostTot;
+#if 0 /* SSE3 is slower */
+ vector_multiply_by(fPost, fPostInv, 4);
+#else
+ for (j = 0; j < 4; j++)
+ fPost[j] *= fPostInv;
+#endif
+
+ /* and finally, divide by stat again & rotate to give the new frequencies */
+ matrixt_by_vector4(transmat->eigeninvT, fPost, /*OUT*/fOut);
+ } /* end loop over position i */
+ } else if (nCodes == 20) { /* matrix model on amino acids */
+ numeric_t *fGap = &transmat->codeFreq[NOCODE][0];
+ numeric_t f1mix[20] ALIGNED;
+ numeric_t f2mix[20] ALIGNED;
+
+ for (i=0; i < nPos; i++) {
+ if (p1->codes[i] == NOCODE && p2->codes[i] == NOCODE
+ && p1->weights[i] == 0 && p2->weights[i] == 0) {
+ /* aligning gap with gap -- just output a gap
+ out->codes[i] is already set to NOCODE so need not set that */
+ out->weights[i] = 0;
+ continue;
+ }
+ int iRate = rates->ratecat[i];
+ numeric_t *expeigen1 = &expeigenRates1[iRate*20];
+ numeric_t *expeigen2 = &expeigenRates2[iRate*20];
+ numeric_t *f1 = GET_FREQ(p1,i,/*IN/OUT*/iFreq1);
+ numeric_t *f2 = GET_FREQ(p2,i,/*IN/OUT*/iFreq2);
+ numeric_t *fOut = GET_FREQ(out,i,/*IN/OUT*/iFreqOut);
+ assert(fOut != NULL);
+
+ if (f1 == NULL) {
+ f1 = &transmat->codeFreq[p1->codes[i]][0]; /* codeFreq includes an entry for NOCODE */
+ double w = p1->weights[i];
+ if (w > 0.0 && w < 1.0) {
+ for (j = 0; j < 20; j++)
+ f1mix[j] = w * f1[j] + (1.0-w) * fGap[j];
+ f1 = f1mix;
+ }
+ }
+ if (f2 == NULL) {
+ f2 = &transmat->codeFreq[p2->codes[i]][0];
+ double w = p2->weights[i];
+ if (w > 0.0 && w < 1.0) {
+ for (j = 0; j < 20; j++)
+ f2mix[j] = w * f2[j] + (1.0-w) * fGap[j];
+ f2 = f2mix;
+ }
+ }
+ numeric_t fMult1[20] ALIGNED; /* rotated1 * expeigen1 */
+ numeric_t fMult2[20] ALIGNED; /* rotated2 * expeigen2 */
+ vector_multiply(f1, expeigen1, 20, /*OUT*/fMult1);
+ vector_multiply(f2, expeigen2, 20, /*OUT*/fMult2);
+ numeric_t fPost[20] ALIGNED; /* in unrotated space */
+ for (j = 0; j < 20; j++) {
+ numeric_t value = vector_dot_product_rot(fMult1, fMult2, &transmat->codeFreq[j][0], 20)
+ * transmat->statinv[j];
+ /* Added this logic try to avoid rare numerical problems */
+ fPost[j] = value >= 0 ? value : 0;
+ }
+ double fPostTot = vector_sum(fPost, 20);
+ assert(fPostTot > fPostTotalTolerance);
+ double fPostInv = 1.0/fPostTot;
+ vector_multiply_by(/*IN/OUT*/fPost, fPostInv, 20);
+ int ch = -1; /* the dominant character, if any */
+ if (!exactML) {
+ for (j = 0; j < 20; j++) {
+ if (fPost[j] >= approxMLminf) {
+ ch = j;
+ break;
+ }
+ }
+ }
+
+ /* now, see if we can use the approximation
+ fPost ~= (1 or 0) * w + nearP * (1-w)
+ to avoid rotating */
+ double w = 0;
+ if (ch >= 0) {
+ w = (fPost[ch] - transmat->nearP[ch][ch]) / (1.0 - transmat->nearP[ch][ch]);
+ for (j = 0; j < 20; j++) {
+ if (j != ch) {
+ double fRough = (1.0-w) * transmat->nearP[ch][j];
+ if (fRough < fPost[j] * approxMLminratio) {
+ ch = -1; /* give up on the approximation */
+ break;
+ }
+ }
+ }
+ }
+ if (ch >= 0) {
+ nAAPosteriorRough++;
+ double wInvStat = w * transmat->statinv[ch];
+ for (j = 0; j < 20; j++)
+ fOut[j] = wInvStat * transmat->codeFreq[ch][j] + (1.0-w) * transmat->nearFreq[ch][j];
+ } else {
+ /* and finally, divide by stat again & rotate to give the new frequencies */
+ nAAPosteriorExact++;
+ for (j = 0; j < 20; j++)
+ fOut[j] = vector_multiply_sum(fPost, &transmat->eigeninv[j][0], 20);
+ }
+ } /* end loop over position i */
+ } else {
+ assert(0); /* illegal nCodes */
+ }
+
+ if (transmat != NULL) {
+ expeigenRates1 = myfree(expeigenRates1, sizeof(numeric_t) * rates->nRateCategories * nCodes);
+ expeigenRates2 = myfree(expeigenRates2, sizeof(numeric_t) * rates->nRateCategories * nCodes);
+ }
+
+ /* Reallocate out->vectors to be the right size */
+ out->nVectors = iFreqOut;
+ if (out->nVectors == 0)
+ out->vectors = (numeric_t*)myfree(out->vectors, sizeof(numeric_t)*nCodes*nPos);
+ else
+ out->vectors = (numeric_t*)myrealloc(out->vectors,
+ /*OLDSIZE*/sizeof(numeric_t)*nCodes*nPos,
+ /*NEWSIZE*/sizeof(numeric_t)*nCodes*out->nVectors,
+ /*copy*/true); /* try to save space */
+ nProfileFreqAlloc += out->nVectors;
+ nProfileFreqAvoid += nPos - out->nVectors;
+
+ /* compute total constraints */
+ for (i = 0; i < nConstraints; i++) {
+ out->nOn[i] = p1->nOn[i] + p2->nOn[i];
+ out->nOff[i] = p1->nOff[i] + p2->nOff[i];
+ }
+ nPosteriorCompute++;
+ return(out);
+}
+
+double *PSameVector(double length, rates_t *rates) {
+ double *pSame = mymalloc(sizeof(double) * rates->nRateCategories);
+ int iRate;
+ for (iRate = 0; iRate < rates->nRateCategories; iRate++)
+ pSame[iRate] = 0.25 + 0.75 * exp((-4.0/3.0) * fabs(length*rates->rates[iRate]));
+ return(pSame);
+}
+
+double *PDiffVector(double *pSame, rates_t *rates) {
+ double *pDiff = mymalloc(sizeof(double) * rates->nRateCategories);
+ int iRate;
+ for (iRate = 0; iRate < rates->nRateCategories; iRate++)
+ pDiff[iRate] = (1.0 - pSame[iRate])/3.0;
+ return(pDiff);
+}
+
+numeric_t *ExpEigenRates(double length, transition_matrix_t *transmat, rates_t *rates) {
+ numeric_t *expeigen = mymalloc(sizeof(numeric_t) * nCodes * rates->nRateCategories);
+ int iRate, j;
+ for (iRate = 0; iRate < rates->nRateCategories; iRate++) {
+ for (j = 0; j < nCodes; j++) {
+ double relLen = length * rates->rates[iRate];
+ /* very short branch lengths lead to numerical problems so prevent them */
+ if (relLen < MLMinRelBranchLength)
+ relLen = MLMinRelBranchLength;
+ expeigen[iRate*nCodes + j] = exp(relLen * transmat->eigenval[j]);
+ }
+ }
+ return(expeigen);
+}
+
+double PairLogLk(profile_t *pA, profile_t *pB, double length, int nPos,
+ /*OPTIONAL*/transition_matrix_t *transmat,
+ rates_t *rates,
+ /*OPTIONAL IN/OUT*/double *site_likelihoods) {
+ double lk = 1.0;
+ double loglk = 0.0; /* stores underflow of lk during the loop over positions */
+ int i,j,k;
+ assert(rates != NULL && rates->nRateCategories > 0);
+ numeric_t *expeigenRates = NULL;
+ if (transmat != NULL)
+ expeigenRates = ExpEigenRates(length, transmat, rates);
+
+ if (transmat == NULL) { /* Jukes-Cantor */
+ assert (nCodes == 4);
+ double *pSame = PSameVector(length, rates);
+ double *pDiff = PDiffVector(pSame, rates);
+ numeric_t fAll[128][4];
+ for (j = 0; j < 4; j++)
+ for (k = 0; k < 4; k++)
+ fAll[j][k] = (j==k) ? 1.0 : 0.0;
+ for (k = 0; k < 4; k++)
+ fAll[NOCODE][k] = 0.25;
+
+ int iFreqA = 0;
+ int iFreqB = 0;
+ for (i = 0; i < nPos; i++) {
+ int iRate = rates->ratecat[i];
+ double wA = pA->weights[i];
+ double wB = pB->weights[i];
+ int codeA = pA->codes[i];
+ int codeB = pB->codes[i];
+ numeric_t *fA = GET_FREQ(pA,i,/*IN/OUT*/iFreqA);
+ numeric_t *fB = GET_FREQ(pB,i,/*IN/OUT*/iFreqB);
+ double lkAB = 0;
+
+ if (fA == NULL && fB == NULL) {
+ if (codeA == NOCODE) { /* A is all gaps */
+ /* gap to gap is sum(j) 0.25 * (0.25 * pSame + 0.75 * pDiff) = sum(i) 0.25*0.25 = 0.25
+ gap to any character gives the same result
+ */
+ lkAB = 0.25;
+ } else if (codeB == NOCODE) { /* B is all gaps */
+ lkAB = 0.25;
+ } else if (codeA == codeB) { /* A and B match */
+ lkAB = pSame[iRate] * wA*wB + 0.25 * (1-wA*wB);
+ } else { /* codeA != codeB */
+ lkAB = pDiff[iRate] * wA*wB + 0.25 * (1-wA*wB);
+ }
+ } else if (fA == NULL) {
+ /* Compare codeA to profile of B */
+ if (codeA == NOCODE)
+ lkAB = 0.25;
+ else
+ lkAB = wA * (pDiff[iRate] + fB[codeA] * (pSame[iRate]-pDiff[iRate])) + (1.0-wA) * 0.25;
+ /* because lkAB = wA * P(codeA->B) + (1-wA) * 0.25
+ P(codeA -> B) = sum(j) P(B==j) * (j==codeA ? pSame : pDiff)
+ = sum(j) P(B==j) * pDiff +
+ = pDiff + P(B==codeA) * (pSame-pDiff)
+ */
+ } else if (fB == NULL) { /* Compare codeB to profile of A */
+ if (codeB == NOCODE)
+ lkAB = 0.25;
+ else
+ lkAB = wB * (pDiff[iRate] + fA[codeB] * (pSame[iRate]-pDiff[iRate])) + (1.0-wB) * 0.25;
+ } else { /* both are full profiles */
+ for (j = 0; j < 4; j++)
+ lkAB += fB[j] * (fA[j] * pSame[iRate] + (1-fA[j])* pDiff[iRate]); /* P(A|B) */
+ }
+ assert(lkAB > 0);
+ lk *= lkAB;
+ while (lk < LkUnderflow) {
+ lk *= LkUnderflowInv;
+ loglk -= LogLkUnderflow;
+ }
+ if (site_likelihoods != NULL)
+ site_likelihoods[i] *= lkAB;
+ }
+ pSame = myfree(pSame, sizeof(double) * rates->nRateCategories);
+ pDiff = myfree(pDiff, sizeof(double) * rates->nRateCategories);
+ } else if (nCodes == 4) { /* matrix model on nucleotides */
+ int iFreqA = 0;
+ int iFreqB = 0;
+ numeric_t fAmix[4], fBmix[4];
+ numeric_t *fGap = &transmat->codeFreq[NOCODE][0];
+
+ for (i = 0; i < nPos; i++) {
+ int iRate = rates->ratecat[i];
+ numeric_t *expeigen = &expeigenRates[iRate*4];
+ double wA = pA->weights[i];
+ double wB = pB->weights[i];
+ if (wA == 0 && wB == 0 && pA->codes[i] == NOCODE && pB->codes[i] == NOCODE) {
+ /* Likelihood of A vs B is 1, so nothing changes
+ Do not need to advance iFreqA or iFreqB */
+ continue;
+ }
+ numeric_t *fA = GET_FREQ(pA,i,/*IN/OUT*/iFreqA);
+ numeric_t *fB = GET_FREQ(pB,i,/*IN/OUT*/iFreqB);
+ if (fA == NULL)
+ fA = &transmat->codeFreq[pA->codes[i]][0];
+ if (wA > 0.0 && wA < 1.0) {
+ for (j = 0; j < 4; j++)
+ fAmix[j] = wA*fA[j] + (1.0-wA)*fGap[j];
+ fA = fAmix;
+ }
+ if (fB == NULL)
+ fB = &transmat->codeFreq[pB->codes[i]][0];
+ if (wB > 0.0 && wB < 1.0) {
+ for (j = 0; j < 4; j++)
+ fBmix[j] = wB*fB[j] + (1.0-wB)*fGap[j];
+ fB = fBmix;
+ }
+ /* SSE3 instructions do not speed this step up:
+ numeric_t lkAB = vector_multiply3_sum(expeigen, fA, fB); */
+ double lkAB = 0;
+ for (j = 0; j < 4; j++)
+ lkAB += expeigen[j]*fA[j]*fB[j];
+ assert(lkAB > 0);
+ if (site_likelihoods != NULL)
+ site_likelihoods[i] *= lkAB;
+ lk *= lkAB;
+ while (lk < LkUnderflow) {
+ lk *= LkUnderflowInv;
+ loglk -= LogLkUnderflow;
+ }
+ while (lk > LkUnderflowInv) {
+ lk *= LkUnderflow;
+ loglk += LogLkUnderflow;
+ }
+ }
+ } else if (nCodes == 20) { /* matrix model on amino acids */
+ int iFreqA = 0;
+ int iFreqB = 0;
+ numeric_t fAmix[20], fBmix[20];
+ numeric_t *fGap = &transmat->codeFreq[NOCODE][0];
+
+ for (i = 0; i < nPos; i++) {
+ int iRate = rates->ratecat[i];
+ numeric_t *expeigen = &expeigenRates[iRate*20];
+ double wA = pA->weights[i];
+ double wB = pB->weights[i];
+ if (wA == 0 && wB == 0 && pA->codes[i] == NOCODE && pB->codes[i] == NOCODE) {
+ /* Likelihood of A vs B is 1, so nothing changes
+ Do not need to advance iFreqA or iFreqB */
+ continue;
+ }
+ numeric_t *fA = GET_FREQ(pA,i,/*IN/OUT*/iFreqA);
+ numeric_t *fB = GET_FREQ(pB,i,/*IN/OUT*/iFreqB);
+ if (fA == NULL)
+ fA = &transmat->codeFreq[pA->codes[i]][0];
+ if (wA > 0.0 && wA < 1.0) {
+ for (j = 0; j < 20; j++)
+ fAmix[j] = wA*fA[j] + (1.0-wA)*fGap[j];
+ fA = fAmix;
+ }
+ if (fB == NULL)
+ fB = &transmat->codeFreq[pB->codes[i]][0];
+ if (wB > 0.0 && wB < 1.0) {
+ for (j = 0; j < 20; j++)
+ fBmix[j] = wB*fB[j] + (1.0-wB)*fGap[j];
+ fB = fBmix;
+ }
+ numeric_t lkAB = vector_multiply3_sum(expeigen, fA, fB, 20);
+ if (!(lkAB > 0)) {
+ /* If this happens, it indicates a numerical problem that needs to be addressed elsewhere,
+ so report all the details */
+ fprintf(stderr, "# FastTree.c::PairLogLk -- numerical problem!\n");
+ fprintf(stderr, "# This block is intended for loading into R\n");
+
+ fprintf(stderr, "lkAB = %.8g\n", lkAB);
+ fprintf(stderr, "Branch_length= %.8g\nalignment_position=%d\nnCodes=%d\nrate_category=%d\nrate=%.8g\n",
+ length, i, nCodes, iRate, rates->rates[iRate]);
+ fprintf(stderr, "wA=%.8g\nwB=%.8g\n", wA, wB);
+ fprintf(stderr, "codeA = %d\ncodeB = %d\n", pA->codes[i], pB->codes[i]);
+
+ fprintf(stderr, "fA = c(");
+ for (j = 0; j < nCodes; j++) fprintf(stderr, "%s %.8g", j==0?"":",", fA[j]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "fB = c(");
+ for (j = 0; j < nCodes; j++) fprintf(stderr, "%s %.8g", j==0?"":",", fB[j]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "stat = c(");
+ for (j = 0; j < nCodes; j++) fprintf(stderr, "%s %.8g", j==0?"":",", transmat->stat[j]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "eigenval = c(");
+ for (j = 0; j < nCodes; j++) fprintf(stderr, "%s %.8g", j==0?"":",", transmat->eigenval[j]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "expeigen = c(");
+ for (j = 0; j < nCodes; j++) fprintf(stderr, "%s %.8g", j==0?"":",", expeigen[j]);
+ fprintf(stderr,")\n");
+
+ int k;
+ fprintf(stderr, "codeFreq = c(");
+ for (j = 0; j < nCodes; j++) for(k = 0; k < nCodes; k++) fprintf(stderr, "%s %.8g", j==0 && k==0?"":",",
+ transmat->codeFreq[j][k]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "eigeninv = c(");
+ for (j = 0; j < nCodes; j++) for(k = 0; k < nCodes; k++) fprintf(stderr, "%s %.8g", j==0 && k==0?"":",",
+ transmat->eigeninv[j][k]);
+ fprintf(stderr,")\n");
+
+ fprintf(stderr, "# Transform into matrices and compute un-rotated vectors for profiles A and B\n");
+ fprintf(stderr, "codeFreq = matrix(codeFreq,nrow=20);\n");
+ fprintf(stderr, "eigeninv = matrix(eigeninv,nrow=20);\n");
+ fputs("unrotA = stat * (eigeninv %*% fA)\n", stderr);
+ fputs("unrotB = stat * (eigeninv %*% fB)\n", stderr);
+ fprintf(stderr,"# End of R block\n");
+ }
+ assert(lkAB > 0);
+ if (site_likelihoods != NULL)
+ site_likelihoods[i] *= lkAB;
+ lk *= lkAB;
+ while (lk < LkUnderflow) {
+ lk *= LkUnderflowInv;
+ loglk -= LogLkUnderflow;
+ }
+ while (lk > LkUnderflowInv) {
+ lk *= LkUnderflow;
+ loglk += LogLkUnderflow;
+ }
+ }
+ } else {
+ assert(0); /* illegal nCodes */
+ }
+ if (transmat != NULL)
+ expeigenRates = myfree(expeigenRates, sizeof(numeric_t) * rates->nRateCategories * 20);
+ loglk += log(lk);
+ nLkCompute++;
+ return(loglk);
+}
+
+double MLQuartetLogLk(profile_t *pA, profile_t *pB, profile_t *pC, profile_t *pD,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN*/double branch_lengths[5],
+ /*OPTIONAL OUT*/double *site_likelihoods) {
+ profile_t *pAB = PosteriorProfile(pA, pB,
+ branch_lengths[0], branch_lengths[1],
+ transmat,
+ rates,
+ nPos, /*nConstraints*/0);
+ profile_t *pCD = PosteriorProfile(pC, pD,
+ branch_lengths[2], branch_lengths[3],
+ transmat,
+ rates,
+ nPos, /*nConstraints*/0);
+ if (site_likelihoods != NULL) {
+ int i;
+ for (i = 0; i < nPos; i++)
+ site_likelihoods[i] = 1.0;
+ }
+ /* Roughly, P(A,B,C,D) = P(A) P(B|A) P(D|C) P(AB | CD) */
+ double loglk = PairLogLk(pA, pB, branch_lengths[0]+branch_lengths[1],
+ nPos, transmat, rates, /*OPTIONAL IN/OUT*/site_likelihoods)
+ + PairLogLk(pC, pD, branch_lengths[2]+branch_lengths[3],
+ nPos, transmat, rates, /*OPTIONAL IN/OUT*/site_likelihoods)
+ + PairLogLk(pAB, pCD, branch_lengths[4],
+ nPos, transmat, rates, /*OPTIONAL IN/OUT*/site_likelihoods);
+ pAB = FreeProfile(pAB, nPos, /*nConstraints*/0);
+ pCD = FreeProfile(pCD, nPos, /*nConstraints*/0);
+ return(loglk);
+}
+
+double PairNegLogLk(double x, void *data) {
+ quartet_opt_t *qo = (quartet_opt_t *)data;
+ assert(qo != NULL);
+ assert(qo->pair1 != NULL && qo->pair2 != NULL);
+ qo->nEval++;
+ double loglk = PairLogLk(qo->pair1, qo->pair2, x, qo->nPos, qo->transmat, qo->rates, /*site_lk*/NULL);
+ assert(loglk < 1e100);
+ if (verbose > 5)
+ fprintf(stderr, "PairLogLk(%.4f) = %.4f\n", x, loglk);
+ return(-loglk);
+}
+
+double MLQuartetOptimize(profile_t *pA, profile_t *pB, profile_t *pC, profile_t *pD,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN/OUT*/double branch_lengths[5],
+ /*OPTIONAL OUT*/bool *pStarTest,
+ /*OPTIONAL OUT*/double *site_likelihoods) {
+ int j;
+ double start_length[5];
+ for (j = 0; j < 5; j++) {
+ start_length[j] = branch_lengths[j];
+ if (branch_lengths[j] < MLMinBranchLength)
+ branch_lengths[j] = MLMinBranchLength;
+ }
+ quartet_opt_t qopt = { nPos, transmat, rates, /*nEval*/0,
+ /*pair1*/NULL, /*pair2*/NULL };
+ double f2x, negloglk;
+
+ if (pStarTest != NULL)
+ *pStarTest = false;
+
+ /* First optimize internal branch, then branch to A, B, C, D, in turn
+ May use star test to quit after internal branch
+ */
+ profile_t *pAB = PosteriorProfile(pA, pB,
+ branch_lengths[LEN_A], branch_lengths[LEN_B],
+ transmat, rates, nPos, /*nConstraints*/0);
+ profile_t *pCD = PosteriorProfile(pC, pD,
+ branch_lengths[LEN_C], branch_lengths[LEN_D],
+ transmat, rates, nPos, /*nConstraints*/0);
+ qopt.pair1 = pAB;
+ qopt.pair2 = pCD;
+ branch_lengths[LEN_I] = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/branch_lengths[LEN_I],
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+
+ if (pStarTest != NULL) {
+ assert(site_likelihoods == NULL);
+ double loglkStar = -PairNegLogLk(MLMinBranchLength, &qopt);
+ if (loglkStar < -negloglk - closeLogLkLimit) {
+ *pStarTest = true;
+ double off = PairLogLk(pA, pB,
+ branch_lengths[LEN_A] + branch_lengths[LEN_B],
+ qopt.nPos, qopt.transmat, qopt.rates, /*site_lk*/NULL)
+ + PairLogLk(pC, pD,
+ branch_lengths[LEN_C] + branch_lengths[LEN_D],
+ qopt.nPos, qopt.transmat, qopt.rates, /*site_lk*/NULL);
+ pAB = FreeProfile(pAB, nPos, /*nConstraints*/0);
+ pCD = FreeProfile(pCD, nPos, /*nConstraints*/0);
+ return (-negloglk + off);
+ }
+ }
+ pAB = FreeProfile(pAB, nPos, /*nConstraints*/0);
+ profile_t *pBCD = PosteriorProfile(pB, pCD,
+ branch_lengths[LEN_B], branch_lengths[LEN_I],
+ transmat, rates, nPos, /*nConstraints*/0);
+ qopt.pair1 = pA;
+ qopt.pair2 = pBCD;
+ branch_lengths[LEN_A] = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/branch_lengths[LEN_A],
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+ pBCD = FreeProfile(pBCD, nPos, /*nConstraints*/0);
+ profile_t *pACD = PosteriorProfile(pA, pCD,
+ branch_lengths[LEN_A], branch_lengths[LEN_I],
+ transmat, rates, nPos, /*nConstraints*/0);
+ qopt.pair1 = pB;
+ qopt.pair2 = pACD;
+ branch_lengths[LEN_B] = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/branch_lengths[LEN_B],
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+ pACD = FreeProfile(pACD, nPos, /*nConstraints*/0);
+ pCD = FreeProfile(pCD, nPos, /*nConstraints*/0);
+ pAB = PosteriorProfile(pA, pB,
+ branch_lengths[LEN_A], branch_lengths[LEN_B],
+ transmat, rates, nPos, /*nConstraints*/0);
+ profile_t *pABD = PosteriorProfile(pAB, pD,
+ branch_lengths[LEN_I], branch_lengths[LEN_D],
+ transmat, rates, nPos, /*nConstraints*/0);
+ qopt.pair1 = pC;
+ qopt.pair2 = pABD;
+ branch_lengths[LEN_C] = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/branch_lengths[LEN_C],
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+ pABD = FreeProfile(pABD, nPos, /*nConstraints*/0);
+ profile_t *pABC = PosteriorProfile(pAB, pC,
+ branch_lengths[LEN_I], branch_lengths[LEN_C],
+ transmat, rates, nPos, /*nConstraints*/0);
+ qopt.pair1 = pD;
+ qopt.pair2 = pABC;
+ branch_lengths[LEN_D] = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/branch_lengths[LEN_D],
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+
+ /* Compute the total quartet likelihood
+ PairLogLk(ABC,D) + PairLogLk(AB,C) + PairLogLk(A,B)
+ */
+ double loglkABCvsD = -negloglk;
+ if (site_likelihoods) {
+ for (j = 0; j < nPos; j++)
+ site_likelihoods[j] = 1.0;
+ PairLogLk(pABC, pD, branch_lengths[LEN_D],
+ qopt.nPos, qopt.transmat, qopt.rates, /*IN/OUT*/site_likelihoods);
+ }
+ double quartetloglk = loglkABCvsD
+ + PairLogLk(pAB, pC, branch_lengths[LEN_I] + branch_lengths[LEN_C],
+ qopt.nPos, qopt.transmat, qopt.rates,
+ /*IN/OUT*/site_likelihoods)
+ + PairLogLk(pA, pB, branch_lengths[LEN_A] + branch_lengths[LEN_B],
+ qopt.nPos, qopt.transmat, qopt.rates,
+ /*IN/OUT*/site_likelihoods);
+
+ pABC = FreeProfile(pABC, nPos, /*nConstraints*/0);
+ pAB = FreeProfile(pAB, nPos, /*nConstraints*/0);
+
+ if (verbose > 3) {
+ double loglkStart = MLQuartetLogLk(pA, pB, pC, pD, nPos, transmat, rates, start_length, /*site_lk*/NULL);
+ fprintf(stderr, "Optimize loglk from %.5f to %.5f eval %d lengths from\n"
+ " %.5f %.5f %.5f %.5f %.5f to\n"
+ " %.5f %.5f %.5f %.5f %.5f\n",
+ loglkStart, quartetloglk, qopt.nEval,
+ start_length[0], start_length[1], start_length[2], start_length[3], start_length[4],
+ branch_lengths[0], branch_lengths[1], branch_lengths[2], branch_lengths[3], branch_lengths[4]);
+ }
+ return(quartetloglk);
+}
+
+nni_t MLQuartetNNI(profile_t *profiles[4],
+ /*OPTIONAL*/transition_matrix_t *transmat,
+ rates_t *rates,
+ int nPos, int nConstraints,
+ /*OUT*/double criteria[3], /* The three potential quartet log-likelihoods */
+ /*IN/OUT*/numeric_t len[5],
+ bool bFast)
+{
+ int i;
+ double lenABvsCD[5] = {len[LEN_A], len[LEN_B], len[LEN_C], len[LEN_D], len[LEN_I]};
+ double lenACvsBD[5] = {len[LEN_A], len[LEN_C], len[LEN_B], len[LEN_D], len[LEN_I]}; /* Swap B & C */
+ double lenADvsBC[5] = {len[LEN_A], len[LEN_D], len[LEN_C], len[LEN_B], len[LEN_I]}; /* Swap B & D */
+ bool bConsiderAC = true;
+ bool bConsiderAD = true;
+ int iRound;
+ int nRounds = mlAccuracy < 2 ? 2 : mlAccuracy;
+ double penalty[3];
+ QuartetConstraintPenalties(profiles, nConstraints, /*OUT*/penalty);
+ if (penalty[ABvsCD] > penalty[ACvsBD] || penalty[ABvsCD] > penalty[ADvsBC])
+ bFast = false;
+#ifdef OPENMP
+ bFast = false; /* turn off star topology test */
+#endif
+
+ for (iRound = 0; iRound < nRounds; iRound++) {
+ bool bStarTest = false;
+ {
+#ifdef OPENMP
+ #pragma omp parallel
+ #pragma omp sections
+#endif
+ {
+#ifdef OPENMP
+ #pragma omp section
+#endif
+ {
+ criteria[ABvsCD] = MLQuartetOptimize(profiles[0], profiles[1], profiles[2], profiles[3],
+ nPos, transmat, rates,
+ /*IN/OUT*/lenABvsCD,
+ bFast ? &bStarTest : NULL,
+ /*site_likelihoods*/NULL)
+ - penalty[ABvsCD]; /* subtract penalty b/c we are trying to maximize log lk */
+ }
+
+#ifdef OPENMP
+ #pragma omp section
+#else
+ if (bStarTest) {
+ nStarTests++;
+ criteria[ACvsBD] = -1e20;
+ criteria[ADvsBC] = -1e20;
+ len[LEN_I] = lenABvsCD[LEN_I];
+ return(ABvsCD);
+ }
+#endif
+ {
+ if (bConsiderAC)
+ criteria[ACvsBD] = MLQuartetOptimize(profiles[0], profiles[2], profiles[1], profiles[3],
+ nPos, transmat, rates,
+ /*IN/OUT*/lenACvsBD, NULL, /*site_likelihoods*/NULL)
+ - penalty[ACvsBD];
+ }
+
+#ifdef OPENMP
+ #pragma omp section
+#endif
+ {
+ if (bConsiderAD)
+ criteria[ADvsBC] = MLQuartetOptimize(profiles[0], profiles[3], profiles[2], profiles[1],
+ nPos, transmat, rates,
+ /*IN/OUT*/lenADvsBC, NULL, /*site_likelihoods*/NULL)
+ - penalty[ADvsBC];
+ }
+ }
+ } /* end parallel sections */
+ if (mlAccuracy < 2) {
+ /* If clearly worse then ABvsCD, or have short internal branch length and worse, then
+ give up */
+ if (criteria[ACvsBD] < criteria[ABvsCD] - closeLogLkLimit
+ || (lenACvsBD[LEN_I] <= 2.0*MLMinBranchLength && criteria[ACvsBD] < criteria[ABvsCD]))
+ bConsiderAC = false;
+ if (criteria[ADvsBC] < criteria[ABvsCD] - closeLogLkLimit
+ || (lenADvsBC[LEN_I] <= 2.0*MLMinBranchLength && criteria[ADvsBC] < criteria[ABvsCD]))
+ bConsiderAD = false;
+ if (!bConsiderAC && !bConsiderAD)
+ break;
+ /* If clearly better than either alternative, then give up
+ (Comparison is probably biased in favor of ABvsCD anyway) */
+ if (criteria[ACvsBD] > criteria[ABvsCD] + closeLogLkLimit
+ && criteria[ACvsBD] > criteria[ADvsBC] + closeLogLkLimit)
+ break;
+ if (criteria[ADvsBC] > criteria[ABvsCD] + closeLogLkLimit
+ && criteria[ADvsBC] > criteria[ACvsBD] + closeLogLkLimit)
+ break;
+ }
+ } /* end loop over rounds */
+
+ if (verbose > 2) {
+ fprintf(stderr, "Optimized quartet for %d rounds: ABvsCD %.5f ACvsBD %.5f ADvsBC %.5f\n",
+ iRound, criteria[ABvsCD], criteria[ACvsBD], criteria[ADvsBC]);
+ }
+ if (criteria[ACvsBD] > criteria[ABvsCD] && criteria[ACvsBD] > criteria[ADvsBC]) {
+ for (i = 0; i < 5; i++) len[i] = lenACvsBD[i];
+ return(ACvsBD);
+ } else if (criteria[ADvsBC] > criteria[ABvsCD] && criteria[ADvsBC] > criteria[ACvsBD]) {
+ for (i = 0; i < 5; i++) len[i] = lenADvsBC[i];
+ return(ADvsBC);
+ } else {
+ for (i = 0; i < 5; i++) len[i] = lenABvsCD[i];
+ return(ABvsCD);
+ }
+}
+
+double TreeLength(/*IN/OUT*/NJ_t *NJ, bool recomputeProfiles) {
+ if (recomputeProfiles) {
+ traversal_t traversal2 = InitTraversal(NJ);
+ int j = NJ->root;
+ while((j = TraversePostorder(j, NJ, /*IN/OUT*/traversal2, /*pUp*/NULL)) >= 0) {
+ /* nothing to do for leaves or root */
+ if (j >= NJ->nSeq && j != NJ->root)
+ SetProfile(/*IN/OUT*/NJ, j, /*noweight*/-1.0);
+ }
+ traversal2 = FreeTraversal(traversal2,NJ);
+ }
+ UpdateBranchLengths(/*IN/OUT*/NJ);
+ double total_len = 0;
+ int iNode;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++)
+ total_len += NJ->branchlength[iNode];
+ return(total_len);
+}
+
+double TreeLogLk(/*IN*/NJ_t *NJ, /*OPTIONAL OUT*/double *site_loglk) {
+ int i;
+ if (NJ->nSeq < 2)
+ return(0.0);
+ double loglk = 0.0;
+ double *site_likelihood = NULL;
+ if (site_loglk != NULL) {
+ site_likelihood = mymalloc(sizeof(double)*NJ->nPos);
+ for (i = 0; i < NJ->nPos; i++) {
+ site_likelihood[i] = 1.0;
+ site_loglk[i] = 0.0;
+ }
+ }
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ int nChild = NJ->child[node].nChild;
+ if (nChild == 0)
+ continue;
+ assert(nChild >= 2);
+ int *children = NJ->child[node].child;
+ double loglkchild = PairLogLk(NJ->profiles[children[0]], NJ->profiles[children[1]],
+ NJ->branchlength[children[0]]+NJ->branchlength[children[1]],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/site_likelihood);
+ loglk += loglkchild;
+ if (site_likelihood != NULL) {
+ /* prevent underflows */
+ for (i = 0; i < NJ->nPos; i++) {
+ while(site_likelihood[i] < LkUnderflow) {
+ site_likelihood[i] *= LkUnderflowInv;
+ site_loglk[i] -= LogLkUnderflow;
+ }
+ }
+ }
+ if (verbose > 2)
+ fprintf(stderr, "At %d: LogLk(%d:%.4f,%d:%.4f) = %.3f\n",
+ node,
+ children[0], NJ->branchlength[children[0]],
+ children[1], NJ->branchlength[children[1]],
+ loglkchild);
+ if (NJ->child[node].nChild == 3) {
+ assert(node == NJ->root);
+ /* Infer the common parent of the 1st two to define the third... */
+ profile_t *pAB = PosteriorProfile(NJ->profiles[children[0]],
+ NJ->profiles[children[1]],
+ NJ->branchlength[children[0]],
+ NJ->branchlength[children[1]],
+ NJ->transmat, &NJ->rates,
+ NJ->nPos, /*nConstraints*/0);
+ double loglkup = PairLogLk(pAB, NJ->profiles[children[2]],
+ NJ->branchlength[children[2]],
+ NJ->nPos, NJ->transmat, &NJ->rates,
+ /*IN/OUT*/site_likelihood);
+ loglk += loglkup;
+ if (verbose > 2)
+ fprintf(stderr, "At root %d: LogLk((%d/%d),%d:%.3f) = %.3f\n",
+ node, children[0], children[1], children[2],
+ NJ->branchlength[children[2]],
+ loglkup);
+ pAB = FreeProfile(pAB, NJ->nPos, NJ->nConstraints);
+ }
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ if (site_likelihood != NULL) {
+ for (i = 0; i < NJ->nPos; i++) {
+ site_loglk[i] += log(site_likelihood[i]);
+ }
+ site_likelihood = myfree(site_likelihood, sizeof(double)*NJ->nPos);
+ }
+
+ /* For Jukes-Cantor, with a tree of size 4, if the children of the root are
+ (A,B), C, and D, then
+ P(ABCD) = P(A) P(B|A) P(C|AB) P(D|ABC)
+
+ Above we compute P(B|A) P(C|AB) P(D|ABC) -- note P(B|A) is at the child of root
+ and P(C|AB) P(D|ABC) is at root.
+
+ Similarly if the children of the root are C, D, and (A,B), then
+ P(ABCD) = P(C|D) P(A|B) P(AB|CD) P(D), and above we compute that except for P(D)
+
+ So we need to multiply by P(A) = 0.25, so we pay log(4) at each position
+ (if ungapped). Each gapped position in any sequence reduces the payment by log(4)
+
+ For JTT or GTR, we are computing P(A & B) and the posterior profiles are scaled to take
+ the prior into account, so we do not need any correction.
+ codeFreq[NOCODE] is scaled x higher so that P(-) = 1 not P(-)=1/nCodes, so gaps
+ do not need to be corrected either.
+ */
+
+ if (nCodes == 4 && NJ->transmat == NULL) {
+ int nGaps = 0;
+ double logNCodes = log((double)nCodes);
+ for (i = 0; i < NJ->nPos; i++) {
+ int nGapsThisPos = 0;
+ for (node = 0; node < NJ->nSeq; node++) {
+ unsigned char *codes = NJ->profiles[node]->codes;
+ if (codes[i] == NOCODE)
+ nGapsThisPos++;
+ }
+ nGaps += nGapsThisPos;
+ if (site_loglk != NULL) {
+ site_loglk[i] += nGapsThisPos * logNCodes;
+ if (nCodes == 4 && NJ->transmat == NULL)
+ site_loglk[i] -= logNCodes;
+ }
+ }
+ loglk -= NJ->nPos * logNCodes;
+ loglk += nGaps * logNCodes; /* do not pay for gaps -- only Jukes-Cantor */
+ }
+ return(loglk);
+}
+
+void SetMLGtr(/*IN/OUT*/NJ_t *NJ, /*OPTIONAL IN*/double *freq_in, /*OPTIONAL WRITE*/FILE *fpLog) {
+ int i;
+ assert(nCodes==4);
+ gtr_opt_t gtr;
+ gtr.NJ = NJ;
+ if (freq_in != NULL) {
+ for (i=0; i<4; i++)
+ gtr.freq[i]=freq_in[i];
+ } else {
+ int n[4] = {1,1,1,1}; /* pseudocounts */
+ for (i=0; i<NJ->nSeq; i++) {
+ unsigned char *codes = NJ->profiles[i]->codes;
+ int iPos;
+ for (iPos=0; iPos<NJ->nPos; iPos++)
+ if (codes[iPos] < 4)
+ n[codes[iPos]]++;
+ }
+ int sum = n[0]+n[1]+n[2]+n[3];
+ for (i=0; i<4; i++)
+ gtr.freq[i] = n[i]/(double)sum;
+ }
+ for (i=0; i<6; i++)
+ gtr.rates[i] = 1.0;
+ int nRounds = mlAccuracy < 2 ? 2 : mlAccuracy;
+ for (i = 0; i < nRounds; i++) {
+ for (gtr.iRate = 0; gtr.iRate < 6; gtr.iRate++) {
+ ProgressReport("Optimizing GTR model, step %d of %d", i*6+gtr.iRate+1, 12, 0, 0);
+ double negloglk, f2x;
+ gtr.rates[gtr.iRate] = onedimenmin(/*xmin*/0.05,
+ /*xguess*/gtr.rates[gtr.iRate],
+ /*xmax*/20.0,
+ GTRNegLogLk,
+ /*data*/>r,
+ /*ftol*/0.001,
+ /*atol*/0.0001,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+ }
+ }
+ /* normalize gtr so last rate is 1 -- specifying that rate separately is useful for optimization only */
+ for (i = 0; i < 5; i++)
+ gtr.rates[i] /= gtr.rates[5];
+ gtr.rates[5] = 1.0;
+ if (verbose) {
+ fprintf(stderr, "GTR Frequencies: %.4f %.4f %.4f %.4f\n", gtr.freq[0], gtr.freq[1], gtr.freq[2], gtr.freq[3]);
+ fprintf(stderr, "GTR rates(ac ag at cg ct gt) %.4f %.4f %.4f %.4f %.4f %.4f\n",
+ gtr.rates[0],gtr.rates[1],gtr.rates[2],gtr.rates[3],gtr.rates[4],gtr.rates[5]);
+ }
+ if (fpLog != NULL) {
+ fprintf(fpLog, "GTRFreq\t%.4f\t%.4f\t%.4f\t%.4f\n", gtr.freq[0], gtr.freq[1], gtr.freq[2], gtr.freq[3]);
+ fprintf(fpLog, "GTRRates\t%.4f\t%.4f\t%.4f\t%.4f\t%.4f\t%.4f\n",
+ gtr.rates[0],gtr.rates[1],gtr.rates[2],gtr.rates[3],gtr.rates[4],gtr.rates[5]);
+ }
+ myfree(NJ->transmat, sizeof(transition_matrix_t));
+ NJ->transmat = CreateGTR(gtr.rates, gtr.freq);
+ RecomputeMLProfiles(/*IN/OUT*/NJ);
+ OptimizeAllBranchLengths(/*IN/OUT*/NJ);
+}
+
+double GTRNegLogLk(double x, void *data) {
+ gtr_opt_t *gtr = (gtr_opt_t*)data;
+ assert(nCodes == 4);
+ assert(gtr->NJ != NULL);
+ assert(gtr->iRate >= 0 && gtr->iRate < 6);
+ assert(x > 0);
+ transition_matrix_t *old = gtr->NJ->transmat;
+ double rates[6];
+ int i;
+ for (i = 0; i < 6; i++)
+ rates[i] = gtr->rates[i];
+ rates[gtr->iRate] = x;
+
+ gtr->NJ->transmat = CreateGTR(rates, gtr->freq);
+ RecomputeMLProfiles(/*IN/OUT*/gtr->NJ);
+ double loglk = TreeLogLk(gtr->NJ, /*site_loglk*/NULL);
+ myfree(gtr->NJ->transmat, sizeof(transition_matrix_t));
+ gtr->NJ->transmat = old;
+ /* Do not recompute profiles -- assume the caller will do that */
+ if (verbose > 2)
+ fprintf(stderr, "GTR LogLk(%.5f %.5f %.5f %.5f %.5f %.5f) = %f\n",
+ rates[0], rates[1], rates[2], rates[3], rates[4], rates[5], loglk);
+ return(-loglk);
+}
+
+/* Caller must free the resulting vector of n rates */
+numeric_t *MLSiteRates(int nRateCategories) {
+ /* Even spacing from 1/nRate to nRate */
+ double logNCat = log((double)nRateCategories);
+ double logMinRate = -logNCat;
+ double logMaxRate = logNCat;
+ double logd = (logMaxRate-logMinRate)/(double)(nRateCategories-1);
+
+ numeric_t *rates = mymalloc(sizeof(numeric_t)*nRateCategories);
+ int i;
+ for (i = 0; i < nRateCategories; i++)
+ rates[i] = exp(logMinRate + logd*(double)i);
+ return(rates);
+}
+
+double *MLSiteLikelihoodsByRate(/*IN*/NJ_t *NJ, /*IN*/numeric_t *rates, int nRateCategories) {
+ double *site_loglk = mymalloc(sizeof(double)*NJ->nPos*nRateCategories);
+
+ /* save the original rates */
+ assert(NJ->rates.nRateCategories > 0);
+ numeric_t *oldRates = NJ->rates.rates;
+ NJ->rates.rates = mymalloc(sizeof(numeric_t) * NJ->rates.nRateCategories);
+
+ /* Compute site likelihood for each rate */
+ int iPos;
+ int iRate;
+ for (iRate = 0; iRate < nRateCategories; iRate++) {
+ int i;
+ for (i = 0; i < NJ->rates.nRateCategories; i++)
+ NJ->rates.rates[i] = rates[iRate];
+ RecomputeMLProfiles(/*IN/OUT*/NJ);
+ double loglk = TreeLogLk(NJ, /*OUT*/&site_loglk[NJ->nPos*iRate]);
+ ProgressReport("Site likelihoods with rate category %d of %d", iRate+1, nRateCategories, 0, 0);
+ if(verbose > 2) {
+ fprintf(stderr, "Rate %.3f Loglk %.3f SiteLogLk", rates[iRate], loglk);
+ for (iPos = 0; iPos < NJ->nPos; iPos++)
+ fprintf(stderr,"\t%.3f", site_loglk[NJ->nPos*iRate + iPos]);
+ fprintf(stderr,"\n");
+ }
+ }
+
+ /* restore original rates and profiles */
+ myfree(NJ->rates.rates, sizeof(numeric_t) * NJ->rates.nRateCategories);
+ NJ->rates.rates = oldRates;
+ RecomputeMLProfiles(/*IN/OUT*/NJ);
+
+ return(site_loglk);
+}
+
+void SetMLRates(/*IN/OUT*/NJ_t *NJ, int nRateCategories) {
+ assert(nRateCategories > 0);
+ AllocRateCategories(/*IN/OUT*/&NJ->rates, 1, NJ->nPos); /* set to 1 category of rate 1 */
+ if (nRateCategories == 1) {
+ RecomputeMLProfiles(/*IN/OUT*/NJ);
+ return;
+ }
+ numeric_t *rates = MLSiteRates(nRateCategories);
+ double *site_loglk = MLSiteLikelihoodsByRate(/*IN*/NJ, /*IN*/rates, nRateCategories);
+
+ /* Select best rate for each site, correcting for the prior
+ For a prior, use a gamma distribution with shape parameter 3, scale 1/3, so
+ Prior(rate) ~ rate**2 * exp(-3*rate)
+ log Prior(rate) = C + 2 * log(rate) - 3 * rate
+ */
+ double sumRates = 0;
+ int iPos;
+ int iRate;
+ for (iPos = 0; iPos < NJ->nPos; iPos++) {
+ int iBest = -1;
+ double dBest = -1e20;
+ for (iRate = 0; iRate < nRateCategories; iRate++) {
+ double site_loglk_with_prior = site_loglk[NJ->nPos*iRate + iPos]
+ + 2.0 * log(rates[iRate]) - 3.0 * rates[iRate];
+ if (site_loglk_with_prior > dBest) {
+ iBest = iRate;
+ dBest = site_loglk_with_prior;
+ }
+ }
+ if (verbose > 2)
+ fprintf(stderr, "Selected rate category %d rate %.3f for position %d\n",
+ iBest, rates[iBest], iPos+1);
+ NJ->rates.ratecat[iPos] = iBest;
+ sumRates += rates[iBest];
+ }
+ site_loglk = myfree(site_loglk, sizeof(double)*NJ->nPos*nRateCategories);
+
+ /* Force the rates to average to 1 */
+ double avgRate = sumRates/NJ->nPos;
+ for (iRate = 0; iRate < nRateCategories; iRate++)
+ rates[iRate] /= avgRate;
+
+ /* Save the rates */
+ NJ->rates.rates = myfree(NJ->rates.rates, sizeof(numeric_t) * NJ->rates.nRateCategories);
+ NJ->rates.rates = rates;
+ NJ->rates.nRateCategories = nRateCategories;
+
+ /* Update profiles based on rates */
+ RecomputeMLProfiles(/*IN/OUT*/NJ);
+
+ if (verbose) {
+ fprintf(stderr, "Switched to using %d rate categories (CAT approximation)\n", nRateCategories);
+ fprintf(stderr, "Rate categories were divided by %.3f so that average rate = 1.0\n", avgRate);
+ fprintf(stderr, "CAT-based log-likelihoods may not be comparable across runs\n");
+ if (!gammaLogLk)
+ fprintf(stderr, "Use -gamma for approximate but comparable Gamma(20) log-likelihoods\n");
+ }
+}
+
+double GammaLogLk(/*IN*/siteratelk_t *s, /*OPTIONAL OUT*/double *gamma_loglk_sites) {
+ int iRate, iPos;
+ double *dRate = mymalloc(sizeof(double) * s->nRateCats);
+ for (iRate = 0; iRate < s->nRateCats; iRate++) {
+ /* The probability density for each rate is approximated by the total
+ density between the midpoints */
+ double pMin = iRate == 0 ? 0.0 :
+ PGamma(s->mult * (s->rates[iRate-1] + s->rates[iRate])/2.0, s->alpha);
+ double pMax = iRate == s->nRateCats-1 ? 1.0 :
+ PGamma(s->mult * (s->rates[iRate]+s->rates[iRate+1])/2.0, s->alpha);
+ dRate[iRate] = pMax-pMin;
+ }
+
+ double loglk = 0.0;
+ for (iPos = 0; iPos < s->nPos; iPos++) {
+ /* Prevent underflow on large trees by comparing to maximum loglk */
+ double maxloglk = -1e20;
+ for (iRate = 0; iRate < s->nRateCats; iRate++) {
+ double site_loglk = s->site_loglk[s->nPos*iRate + iPos];
+ if (site_loglk > maxloglk)
+ maxloglk = site_loglk;
+ }
+ double rellk = 0; /* likelihood scaled by exp(maxloglk) */
+ for (iRate = 0; iRate < s->nRateCats; iRate++) {
+ double lk = exp(s->site_loglk[s->nPos*iRate + iPos] - maxloglk);
+ rellk += lk * dRate[iRate];
+ }
+ double loglk_site = maxloglk + log(rellk);
+ loglk += loglk_site;
+ if (gamma_loglk_sites != NULL)
+ gamma_loglk_sites[iPos] = loglk_site;
+ }
+ dRate = myfree(dRate, sizeof(double)*s->nRateCats);
+ return(loglk);
+}
+
+double OptAlpha(double alpha, void *data) {
+ siteratelk_t *s = (siteratelk_t *)data;
+ s->alpha = alpha;
+ return(-GammaLogLk(s, NULL));
+}
+
+double OptMult(double mult, void *data) {
+ siteratelk_t *s = (siteratelk_t *)data;
+ s->mult = mult;
+ return(-GammaLogLk(s, NULL));
+}
+
+/* Input site_loglk must be for each rate */
+double RescaleGammaLogLk(int nPos, int nRateCats, /*IN*/numeric_t *rates, /*IN*/double *site_loglk,
+ /*OPTIONAL*/FILE *fpLog) {
+ siteratelk_t s = { /*mult*/1.0, /*alpha*/1.0, nPos, nRateCats, rates, site_loglk };
+ double fx, f2x;
+ int i;
+ fx = -GammaLogLk(&s, NULL);
+ if (verbose>2)
+ fprintf(stderr, "Optimizing alpha, starting at loglk %.3f\n", -fx);
+ for (i = 0; i < 10; i++) {
+ ProgressReport("Optimizing alpha round %d", i+1, 0, 0, 0);
+ double start = fx;
+ s.alpha = onedimenmin(0.01, s.alpha, 10.0, OptAlpha, &s, 0.001, 0.001, &fx, &f2x);
+ if (verbose>2)
+ fprintf(stderr, "Optimize alpha round %d to %.3f lk %.3f\n", i+1, s.alpha, -fx);
+ s.mult = onedimenmin(0.01, s.mult, 10.0, OptMult, &s, 0.001, 0.001, &fx, &f2x);
+ if (verbose>2)
+ fprintf(stderr, "Optimize mult round %d to %.3f lk %.3f\n", i+1, s.mult, -fx);
+ if (fx > start - 0.001) {
+ if (verbose>2)
+ fprintf(stderr, "Optimizing alpha & mult converged\n");
+ break;
+ }
+ }
+
+ double *gamma_loglk_sites = mymalloc(sizeof(double) * nPos);
+ double gammaLogLk = GammaLogLk(&s, /*OUT*/gamma_loglk_sites);
+ if (verbose > 0)
+ fprintf(stderr, "Gamma(%d) LogLk = %.3f alpha = %.3f rescaling lengths by %.3f\n",
+ nRateCats, gammaLogLk, s.alpha, 1/s.mult);
+ if (fpLog) {
+ int iPos;
+ int iRate;
+ fprintf(fpLog, "Gamma%dLogLk\t%.3f\tApproximate\tAlpha\t%.3f\tRescale\t%.3f\n",
+ nRateCats, gammaLogLk, s.alpha, 1/s.mult);
+ fprintf(fpLog, "Gamma%d\tSite\tLogLk", nRateCats);
+ for (iRate = 0; iRate < nRateCats; iRate++)
+ fprintf(fpLog, "\tr=%.3f", rates[iRate]/s.mult);
+ fprintf(fpLog,"\n");
+ for (iPos = 0; iPos < nPos; iPos++) {
+ fprintf(fpLog, "Gamma%d\t%d\t%.3f", nRateCats, iPos, gamma_loglk_sites[iPos]);
+ for (iRate = 0; iRate < nRateCats; iRate++)
+ fprintf(fpLog, "\t%.3f", site_loglk[nPos*iRate + iPos]);
+ fprintf(fpLog,"\n");
+ }
+ }
+ gamma_loglk_sites = myfree(gamma_loglk_sites, sizeof(double) * nPos);
+ return(1.0/s.mult);
+}
+
+double MLPairOptimize(profile_t *pA, profile_t *pB,
+ int nPos, /*OPTIONAL*/transition_matrix_t *transmat, rates_t *rates,
+ /*IN/OUT*/double *branch_length) {
+ double len5[5];
+ int j;
+ for (j=0;j<5;j++) len5[j] = *branch_length;
+ quartet_opt_t qopt = { nPos, transmat, rates,
+ /*nEval*/0, /*pair1*/pA, /*pair2*/pB };
+ double f2x,negloglk;
+ *branch_length = onedimenmin(/*xmin*/MLMinBranchLength,
+ /*xguess*/*branch_length,
+ /*xmax*/6.0,
+ PairNegLogLk,
+ /*data*/&qopt,
+ /*ftol*/MLFTolBranchLength,
+ /*atol*/MLMinBranchLengthTolerance,
+ /*OUT*/&negloglk,
+ /*OUT*/&f2x);
+ return(-negloglk); /* the log likelihood */
+}
+
+void OptimizeAllBranchLengths(/*IN/OUT*/NJ_t *NJ) {
+ if (NJ->nSeq < 2)
+ return;
+ if (NJ->nSeq == 2) {
+ int parent = NJ->root;
+ assert(NJ->child[parent].nChild==2);
+ int nodes[2] = { NJ->child[parent].child[0], NJ->child[parent].child[1] };
+ double length = 1.0;
+ (void)MLPairOptimize(NJ->profiles[nodes[0]], NJ->profiles[nodes[1]],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/&length);
+ NJ->branchlength[nodes[0]] = length/2.0;
+ NJ->branchlength[nodes[1]] = length/2.0;
+ return;
+ };
+
+ traversal_t traversal = InitTraversal(NJ);
+ profile_t **upProfiles = UpProfiles(NJ);
+ int node = NJ->root;
+ int iDone = 0;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ int nChild = NJ->child[node].nChild;
+ if (nChild > 0) {
+ if ((iDone % 100) == 0)
+ ProgressReport("ML Lengths %d of %d splits", iDone+1, NJ->maxnode - NJ->nSeq, 0, 0);
+ iDone++;
+
+ /* optimize the branch lengths between self, parent, and children,
+ with two iterations
+ */
+ assert(nChild == 2 || nChild == 3);
+ int nodes[3] = { NJ->child[node].child[0],
+ NJ->child[node].child[1],
+ nChild == 3 ? NJ->child[node].child[2] : node };
+ profile_t *profiles[3] = { NJ->profiles[nodes[0]],
+ NJ->profiles[nodes[1]],
+ nChild == 3 ? NJ->profiles[nodes[2]]
+ : GetUpProfile(/*IN/OUT*/upProfiles, NJ, node, /*useML*/true) };
+ int iter;
+ for (iter = 0; iter < 2; iter++) {
+ int i;
+ for (i = 0; i < 3; i++) {
+ profile_t *pA = profiles[i];
+ int b1 = (i+1) % 3;
+ int b2 = (i+2) % 3;
+ profile_t *pB = PosteriorProfile(profiles[b1], profiles[b2],
+ NJ->branchlength[nodes[b1]],
+ NJ->branchlength[nodes[b2]],
+ NJ->transmat, &NJ->rates, NJ->nPos, /*nConstraints*/0);
+ double len = NJ->branchlength[nodes[i]];
+ if (len < MLMinBranchLength)
+ len = MLMinBranchLength;
+ (void)MLPairOptimize(pA, pB, NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/&len);
+ NJ->branchlength[nodes[i]] = len;
+ pB = FreeProfile(pB, NJ->nPos, /*nConstraints*/0);
+ if (verbose>3)
+ fprintf(stderr, "Optimize length for %d to %.3f\n",
+ nodes[i], NJ->branchlength[nodes[i]]);
+ }
+ }
+ if (node != NJ->root) {
+ RecomputeProfile(/*IN/OUT*/NJ, /*IN/OUT*/upProfiles, node, /*useML*/true);
+ DeleteUpProfile(upProfiles, NJ, node);
+ }
+ }
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+}
+
+void RecomputeMLProfiles(/*IN/OUT*/NJ_t *NJ) {
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (NJ->child[node].nChild == 2) {
+ NJ->profiles[node] = FreeProfile(NJ->profiles[node], NJ->nPos, NJ->nConstraints);
+ int *children = NJ->child[node].child;
+ NJ->profiles[node] = PosteriorProfile(NJ->profiles[children[0]], NJ->profiles[children[1]],
+ NJ->branchlength[children[0]], NJ->branchlength[children[1]],
+ NJ->transmat, &NJ->rates, NJ->nPos, NJ->nConstraints);
+ }
+ }
+ traversal = FreeTraversal(traversal, NJ);
+}
+
+void RecomputeProfiles(/*IN/OUT*/NJ_t *NJ, /*OPTIONAL*/distance_matrix_t *dmat) {
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (NJ->child[node].nChild == 2) {
+ int *child = NJ->child[node].child;
+ NJ->profiles[node] = FreeProfile(NJ->profiles[node], NJ->nPos, NJ->nConstraints);
+ NJ->profiles[node] = AverageProfile(NJ->profiles[child[0]], NJ->profiles[child[1]],
+ NJ->nPos, NJ->nConstraints,
+ dmat, /*unweighted*/-1.0);
+ }
+ }
+ traversal = FreeTraversal(traversal,NJ);
+}
+
+int NNI(/*IN/OUT*/NJ_t *NJ, int iRound, int nRounds, bool useML,
+ /*IN/OUT*/nni_stats_t *stats,
+ /*OUT*/double *dMaxDelta) {
+ /* For each non-root node N, with children A,B, sibling C, and uncle D,
+ we compare the current topology AB|CD to the alternate topologies
+ AC|BD and AD|BC, by using the 4 relevant profiles.
+
+ If useML is true, it uses quartet maximum likelihood, and it
+ updates branch lengths as it goes.
+
+ If useML is false, it uses the minimum-evolution criterion with
+ log-corrected distances on profiles. (If logdist is false, then
+ the log correction is not done.) If useML is false, then NNI()
+ does NOT modify the branch lengths.
+
+ Regardless of whether it changes the topology, it recomputes the
+ profile for the node, using the pairwise distances and BIONJ-like
+ weightings (if bionj is set). The parent's profile has changed,
+ but recomputing it is not necessary because we will visit it
+ before we need it (we use postorder, so we may visit the sibling
+ and its children before we visit the parent, but we never
+ consider an ancestor's profile, so that is OK). When we change
+ the parent's profile, this alters the uncle's up-profile, so we
+ remove that. Finally, if the topology has changed, we remove the
+ up-profiles of the nodes.
+
+ If we do an NNI during post-order traversal, the result is a bit
+ tricky. E.g. if we are at node N, and have visited its children A
+ and B but not its uncle C, and we do an NNI that swaps B & C,
+ then the post-order traversal will visit C, and its children, but
+ then on the way back up, it will skip N, as it has already
+ visited it. So, the profile of N will not be recomputed: any
+ changes beneath C will not be reflected in the profile of N, and
+ the profile of N will be slightly stale. This will be corrected
+ on the next round of NNIs.
+ */
+ double supportThreshold = useML ? treeLogLkDelta : MEMinDelta;
+ int i;
+ *dMaxDelta = 0.0;
+ int nNNIThisRound = 0;
+
+ if (NJ->nSeq <= 3)
+ return(0); /* nothing to do */
+ if (verbose > 2) {
+ fprintf(stderr, "Beginning round %d of NNIs with ml? %d\n", iRound, useML?1:0);
+ PrintNJInternal(/*WRITE*/stderr, NJ, /*useLen*/useML && iRound > 0 ? 1 : 0);
+ }
+ /* For each node the upProfile or NULL */
+ profile_t **upProfiles = UpProfiles(NJ);
+
+ traversal_t traversal = InitTraversal(NJ);
+
+ /* Identify nodes we can skip traversing into */
+ int node;
+ if (fastNNI) {
+ for (node = 0; node < NJ->maxnode; node++) {
+ if (node != NJ->root
+ && node >= NJ->nSeq
+ && stats[node].age >= 2
+ && stats[node].subtreeAge >= 2
+ && stats[node].support > supportThreshold) {
+ int nodeABCD[4];
+ SetupABCD(NJ, node, NULL, NULL, /*OUT*/nodeABCD, useML);
+ for (i = 0; i < 4; i++)
+ if (stats[nodeABCD[i]].age == 0 && stats[nodeABCD[i]].support > supportThreshold)
+ break;
+ if (i == 4) {
+ SkipTraversalInto(node, /*IN/OUT*/traversal);
+ if (verbose > 2)
+ fprintf(stderr, "Skipping subtree at %d: child %d %d parent %d age %d subtreeAge %d support %.3f\n",
+ node, nodeABCD[0], nodeABCD[1], NJ->parent[node],
+ stats[node].age, stats[node].subtreeAge, stats[node].support);
+ }
+ }
+ }
+ }
+
+ int iDone = 0;
+ bool bUp;
+ node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, &bUp)) >= 0) {
+ if (node < NJ->nSeq || node == NJ->root)
+ continue; /* nothing to do for leaves or root */
+ if (bUp) {
+ if(verbose > 2)
+ fprintf(stderr, "Going up back to node %d\n", node);
+ /* No longer needed */
+ for (i = 0; i < NJ->child[node].nChild; i++)
+ DeleteUpProfile(upProfiles, NJ, NJ->child[node].child[i]);
+ DeleteUpProfile(upProfiles, NJ, node);
+ RecomputeProfile(/*IN/OUT*/NJ, /*IN/OUT*/upProfiles, node, useML);
+ continue;
+ }
+ if ((iDone % 100) == 0) {
+ char buf[100];
+ sprintf(buf, "%s NNI round %%d of %%d, %%d of %%d splits", useML ? "ML" : "ME");
+ if (iDone > 0)
+ sprintf(buf+strlen(buf), ", %d changes", nNNIThisRound);
+ if (nNNIThisRound > 0)
+ sprintf(buf+strlen(buf), " (max delta %.3f)", *dMaxDelta);
+ ProgressReport(buf, iRound+1, nRounds, iDone+1, NJ->maxnode - NJ->nSeq);
+ }
+ iDone++;
+
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ /* Note -- during the first round of ML NNIs, we use the min-evo-based branch lengths,
+ which may be suboptimal */
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, useML);
+
+ /* Given our 4 profiles, consider doing a swap */
+ int nodeA = nodeABCD[0];
+ int nodeB = nodeABCD[1];
+ int nodeC = nodeABCD[2];
+ int nodeD = nodeABCD[3];
+
+ nni_t choice = ABvsCD;
+
+ if (verbose > 2)
+ fprintf(stderr,"Considering NNI around %d: Swap A=%d B=%d C=%d D=up(%d) or parent %d\n",
+ node, nodeA, nodeB, nodeC, nodeD, NJ->parent[node]);
+ if (verbose > 3 && useML) {
+ double len[5] = { NJ->branchlength[nodeA], NJ->branchlength[nodeB], NJ->branchlength[nodeC], NJ->branchlength[nodeD],
+ NJ->branchlength[node] };
+ for (i=0; i < 5; i++)
+ if (len[i] < MLMinBranchLength)
+ len[i] = MLMinBranchLength;
+ fprintf(stderr, "Starting quartet likelihood %.3f len %.3f %.3f %.3f %.3f %.3f\n",
+ MLQuartetLogLk(profiles[0],profiles[1],profiles[2],profiles[3],NJ->nPos,NJ->transmat,&NJ->rates,len, /*site_lk*/NULL),
+ len[0], len[1], len[2], len[3], len[4]);
+ }
+
+ numeric_t newlength[5];
+ double criteria[3];
+ if (useML) {
+ for (i = 0; i < 4; i++)
+ newlength[i] = NJ->branchlength[nodeABCD[i]];
+ newlength[4] = NJ->branchlength[node];
+ bool bFast = mlAccuracy < 2 && stats[node].age > 0;
+ choice = MLQuartetNNI(profiles, NJ->transmat, &NJ->rates, NJ->nPos, NJ->nConstraints,
+ /*OUT*/criteria, /*IN/OUT*/newlength, bFast);
+ } else {
+ choice = ChooseNNI(profiles, NJ->distance_matrix, NJ->nPos, NJ->nConstraints,
+ /*OUT*/criteria);
+ /* invert criteria so that higher is better, as in ML case, to simplify code below */
+ for (i = 0; i < 3; i++)
+ criteria[i] = -criteria[i];
+ }
+
+ if (choice == ACvsBD) {
+ /* swap B and C */
+ ReplaceChild(/*IN/OUT*/NJ, node, nodeB, nodeC);
+ ReplaceChild(/*IN/OUT*/NJ, NJ->parent[node], nodeC, nodeB);
+ } else if (choice == ADvsBC) {
+ /* swap A and C */
+ ReplaceChild(/*IN/OUT*/NJ, node, nodeA, nodeC);
+ ReplaceChild(/*IN/OUT*/NJ, NJ->parent[node], nodeC, nodeA);
+ }
+
+ if (useML) {
+ /* update branch length for the internal branch, and of any
+ branches that lead to leaves, b/c those will not are not
+ the internal branch for NNI and would not otherwise be set.
+ */
+ if (choice == ADvsBC) {
+ /* For ADvsBC, MLQuartetNNI swaps B with D, but we swap A with C */
+ double length2[5] = { newlength[LEN_C], newlength[LEN_D],
+ newlength[LEN_A], newlength[LEN_B],
+ newlength[LEN_I] };
+ int i;
+ for (i = 0; i < 5; i++) newlength[i] = length2[i];
+ /* and swap A and C */
+ double tmp = newlength[LEN_A];
+ newlength[LEN_A] = newlength[LEN_C];
+ newlength[LEN_C] = tmp;
+ } else if (choice == ACvsBD) {
+ /* swap B and C */
+ double tmp = newlength[LEN_B];
+ newlength[LEN_B] = newlength[LEN_C];
+ newlength[LEN_C] = tmp;
+ }
+
+ NJ->branchlength[node] = newlength[LEN_I];
+ NJ->branchlength[nodeA] = newlength[LEN_A];
+ NJ->branchlength[nodeB] = newlength[LEN_B];
+ NJ->branchlength[nodeC] = newlength[LEN_C];
+ NJ->branchlength[nodeD] = newlength[LEN_D];
+ }
+
+ if (verbose>2 && (choice != ABvsCD || verbose > 2))
+ fprintf(stderr,"NNI around %d: Swap A=%d B=%d C=%d D=out(C) -- choose %s %s %.4f\n",
+ node, nodeA, nodeB, nodeC,
+ choice == ACvsBD ? "AC|BD" : (choice == ABvsCD ? "AB|CD" : "AD|BC"),
+ useML ? "delta-loglk" : "-deltaLen",
+ criteria[choice] - criteria[ABvsCD]);
+ if(verbose >= 3 && slow && useML)
+ fprintf(stderr, "Old tree lk -- %.4f\n", TreeLogLk(NJ, /*site_likelihoods*/NULL));
+
+ /* update stats, *dMaxDelta, etc. */
+ if (choice == ABvsCD) {
+ stats[node].age++;
+ } else {
+ if (useML)
+ nML_NNI++;
+ else
+ nNNI++;
+ nNNIThisRound++;
+ stats[node].age = 0;
+ stats[nodeA].age = 0;
+ stats[nodeB].age = 0;
+ stats[nodeC].age = 0;
+ stats[nodeD].age = 0;
+ }
+ stats[node].delta = criteria[choice] - criteria[ABvsCD]; /* 0 if ABvsCD */
+ if (stats[node].delta > *dMaxDelta)
+ *dMaxDelta = stats[node].delta;
+
+ /* support is improvement of score for self over better of alternatives */
+ stats[node].support = 1e20;
+ for (i = 0; i < 3; i++)
+ if (choice != i && criteria[choice]-criteria[i] < stats[node].support)
+ stats[node].support = criteria[choice]-criteria[i];
+
+ /* subtreeAge is the number of rounds since self or descendent had a significant improvement */
+ if (stats[node].delta > supportThreshold)
+ stats[node].subtreeAge = 0;
+ else {
+ stats[node].subtreeAge++;
+ for (i = 0; i < 2; i++) {
+ int child = NJ->child[node].child[i];
+ if (stats[node].subtreeAge > stats[child].subtreeAge)
+ stats[node].subtreeAge = stats[child].subtreeAge;
+ }
+ }
+
+ /* update profiles and free up unneeded up-profiles */
+ if (choice == ABvsCD) {
+ /* No longer needed */
+ DeleteUpProfile(upProfiles, NJ, nodeA);
+ DeleteUpProfile(upProfiles, NJ, nodeB);
+ DeleteUpProfile(upProfiles, NJ, nodeC);
+ RecomputeProfile(/*IN/OUT*/NJ, /*IN/OUT*/upProfiles, node, useML);
+ if(slow && useML)
+ UpdateForNNI(NJ, node, upProfiles, useML);
+ } else {
+ UpdateForNNI(NJ, node, upProfiles, useML);
+ }
+ if(verbose > 2 && slow && useML) {
+ /* Note we recomputed profiles back up to root already if slow */
+ PrintNJInternal(/*WRITE*/stderr, NJ, /*useLen*/true);
+ fprintf(stderr, "New tree lk -- %.4f\n", TreeLogLk(NJ, /*site_likelihoods*/NULL));
+ }
+ } /* end postorder traversal */
+ traversal = FreeTraversal(traversal,NJ);
+ if (verbose>=2) {
+ int nUp = 0;
+ for (i = 0; i < NJ->maxnodes; i++)
+ if (upProfiles[i] != NULL)
+ nUp++;
+ fprintf(stderr, "N up profiles at end of NNI: %d\n", nUp);
+ }
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+ return(nNNIThisRound);
+}
+
+nni_stats_t *InitNNIStats(NJ_t *NJ) {
+ nni_stats_t *stats = mymalloc(sizeof(nni_stats_t)*NJ->maxnode);
+ const int LargeAge = 1000000;
+ int i;
+ for (i = 0; i < NJ->maxnode; i++) {
+ stats[i].delta = 0;
+ stats[i].support = 0;
+ if (i == NJ->root || i < NJ->nSeq) {
+ stats[i].age = LargeAge;
+ stats[i].subtreeAge = LargeAge;
+ } else {
+ stats[i].age = 0;
+ stats[i].subtreeAge = 0;
+ }
+ }
+ return(stats);
+}
+
+nni_stats_t *FreeNNIStats(nni_stats_t *stats, NJ_t *NJ) {
+ return(myfree(stats, sizeof(nni_stats_t)*NJ->maxnode));
+}
+
+int FindSPRSteps(/*IN/OUT*/NJ_t *NJ,
+ int nodeMove, /* the node to move multiple times */
+ int nodeAround, /* sibling or parent of node to NNI to start the chain */
+ /*IN/OUT*/profile_t **upProfiles,
+ /*OUT*/spr_step_t *steps,
+ int maxSteps,
+ bool bFirstAC) {
+ int iStep;
+ for (iStep = 0; iStep < maxSteps; iStep++) {
+ if (NJ->child[nodeAround].nChild != 2)
+ break; /* no further to go */
+
+ /* Consider the NNIs around nodeAround */
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, nodeAround, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, /*useML*/false);
+ double criteria[3];
+ (void) ChooseNNI(profiles, NJ->distance_matrix, NJ->nPos, NJ->nConstraints,
+ /*OUT*/criteria);
+
+ /* Do & save the swap */
+ spr_step_t *step = &steps[iStep];
+ if (iStep == 0 ? bFirstAC : criteria[ACvsBD] < criteria[ADvsBC]) {
+ /* swap B & C to put AC together */
+ step->deltaLength = criteria[ACvsBD] - criteria[ABvsCD];
+ step->nodes[0] = nodeABCD[1];
+ step->nodes[1] = nodeABCD[2];
+ } else {
+ /* swap AC to put AD together */
+ step->deltaLength = criteria[ADvsBC] - criteria[ABvsCD];
+ step->nodes[0] = nodeABCD[0];
+ step->nodes[1] = nodeABCD[2];
+ }
+
+ if (verbose>3) {
+ fprintf(stderr, "SPR chain step %d for %d around %d swap %d %d deltaLen %.5f\n",
+ iStep+1, nodeAround, nodeMove, step->nodes[0], step->nodes[1], step->deltaLength);
+ if (verbose>4)
+ PrintNJInternal(stderr, NJ, /*useLen*/false);
+ }
+ ReplaceChild(/*IN/OUT*/NJ, nodeAround, step->nodes[0], step->nodes[1]);
+ ReplaceChild(/*IN/OUT*/NJ, NJ->parent[nodeAround], step->nodes[1], step->nodes[0]);
+ UpdateForNNI(/*IN/OUT*/NJ, nodeAround, /*IN/OUT*/upProfiles, /*useML*/false);
+
+ /* set the new nodeAround -- either parent(nodeMove) or sibling(nodeMove) --
+ so that it different from current nodeAround
+ */
+ int newAround[2] = { NJ->parent[nodeMove], Sibling(NJ, nodeMove) };
+ if (NJ->parent[nodeMove] == NJ->root)
+ RootSiblings(NJ, nodeMove, /*OUT*/newAround);
+ assert(newAround[0] == nodeAround || newAround[1] == nodeAround);
+ assert(newAround[0] != newAround[1]);
+ nodeAround = newAround[newAround[0] == nodeAround ? 1 : 0];
+ }
+ return(iStep);
+}
+
+void UnwindSPRStep(/*IN/OUT*/NJ_t *NJ,
+ /*IN*/spr_step_t *step,
+ /*IN/OUT*/profile_t **upProfiles) {
+ int parents[2];
+ int i;
+ for (i = 0; i < 2; i++) {
+ assert(step->nodes[i] >= 0 && step->nodes[i] < NJ->maxnodes);
+ parents[i] = NJ->parent[step->nodes[i]];
+ assert(parents[i] >= 0);
+ }
+ assert(parents[0] != parents[1]);
+ ReplaceChild(/*IN/OUT*/NJ, parents[0], step->nodes[0], step->nodes[1]);
+ ReplaceChild(/*IN/OUT*/NJ, parents[1], step->nodes[1], step->nodes[0]);
+ int iYounger = 0;
+ if (NJ->parent[parents[0]] == parents[1]) {
+ iYounger = 0;
+ } else {
+ assert(NJ->parent[parents[1]] == parents[0]);
+ iYounger = 1;
+ }
+ UpdateForNNI(/*IN/OUT*/NJ, parents[iYounger], /*IN/OUT*/upProfiles, /*useML*/false);
+}
+
+/* Update the profile of node and its ancestor, and delete nearby out-profiles */
+void UpdateForNNI(/*IN/OUT*/NJ_t *NJ, int node, /*IN/OUT*/profile_t **upProfiles,
+ bool useML) {
+ int i;
+ if (slow) {
+ /* exhaustive update */
+ for (i = 0; i < NJ->maxnodes; i++)
+ DeleteUpProfile(upProfiles, NJ, i);
+
+ /* update profiles back to root */
+ int ancestor;
+ for (ancestor = node; ancestor >= 0; ancestor = NJ->parent[ancestor])
+ RecomputeProfile(/*IN/OUT*/NJ, upProfiles, ancestor, useML);
+
+ /* remove any up-profiles made while doing that*/
+ for (i = 0; i < NJ->maxnodes; i++)
+ DeleteUpProfile(upProfiles, NJ, i);
+ } else {
+ /* if fast, only update around self
+ note that upProfile(parent) is still OK after an NNI, but
+ up-profiles of uncles may not be
+ */
+ DeleteUpProfile(upProfiles, NJ, node);
+ for (i = 0; i < NJ->child[node].nChild; i++)
+ DeleteUpProfile(upProfiles, NJ, NJ->child[node].child[i]);
+ assert(node != NJ->root);
+ int parent = NJ->parent[node];
+ int neighbors[2] = { parent, Sibling(NJ, node) };
+ if (parent == NJ->root)
+ RootSiblings(NJ, node, /*OUT*/neighbors);
+ DeleteUpProfile(upProfiles, NJ, neighbors[0]);
+ DeleteUpProfile(upProfiles, NJ, neighbors[1]);
+ int uncle = Sibling(NJ, parent);
+ if (uncle >= 0)
+ DeleteUpProfile(upProfiles, NJ, uncle);
+ RecomputeProfile(/*IN/OUT*/NJ, upProfiles, node, useML);
+ RecomputeProfile(/*IN/OUT*/NJ, upProfiles, parent, useML);
+ }
+}
+
+void SPR(/*IN/OUT*/NJ_t *NJ, int maxSPRLength, int iRound, int nRounds) {
+ /* Given a non-root node N with children A,B, sibling C, and uncle D,
+ we can try to move A by doing three types of moves (4 choices):
+ "down" -- swap A with a child of B (if B is not a leaf) [2 choices]
+ "over" -- swap B with C
+ "up" -- swap A with D
+ We follow down moves with down moves, over moves with down moves, and
+ up moves with either up or over moves. (Other choices are just backing
+ up and hence useless.)
+
+ As with NNIs, we keep track of up-profiles as we go. However, some of the regular
+ profiles may also become "stale" so it is a bit trickier.
+
+ We store the traversal before we do SPRs to avoid any possible infinite loop
+ */
+ double last_tot_len = 0.0;
+ if (NJ->nSeq <= 3 || maxSPRLength < 1)
+ return;
+ if (slow)
+ last_tot_len = TreeLength(NJ, /*recomputeLengths*/true);
+ int *nodeList = mymalloc(sizeof(int) * NJ->maxnodes);
+ int nodeListLen = 0;
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ nodeList[nodeListLen++] = node;
+ }
+ assert(nodeListLen == NJ->maxnode);
+ traversal = FreeTraversal(traversal,NJ);
+
+ profile_t **upProfiles = UpProfiles(NJ);
+ spr_step_t *steps = mymalloc(sizeof(spr_step_t) * maxSPRLength); /* current chain of SPRs */
+
+ int i;
+ for (i = 0; i < nodeListLen; i++) {
+ node = nodeList[i];
+ if ((i % 100) == 0)
+ ProgressReport("SPR round %3d of %3d, %d of %d nodes",
+ iRound+1, nRounds, i+1, nodeListLen);
+ if (node == NJ->root)
+ continue; /* nothing to do for root */
+ /* The nodes to NNI around */
+ int nodeAround[2] = { NJ->parent[node], Sibling(NJ, node) };
+ if (NJ->parent[node] == NJ->root) {
+ /* NNI around both siblings instead */
+ RootSiblings(NJ, node, /*OUT*/nodeAround);
+ }
+ bool bChanged = false;
+ int iAround;
+ for (iAround = 0; iAround < 2 && bChanged == false; iAround++) {
+ int ACFirst;
+ for (ACFirst = 0; ACFirst < 2 && bChanged == false; ACFirst++) {
+ if(verbose > 3)
+ PrintNJInternal(stderr, NJ, /*useLen*/false);
+ int chainLength = FindSPRSteps(/*IN/OUT*/NJ, node, nodeAround[iAround],
+ upProfiles, /*OUT*/steps, maxSPRLength, (bool)ACFirst);
+ double dMinDelta = 0.0;
+ int iCBest = -1;
+ double dTotDelta = 0.0;
+ int iC;
+ for (iC = 0; iC < chainLength; iC++) {
+ dTotDelta += steps[iC].deltaLength;
+ if (dTotDelta < dMinDelta) {
+ dMinDelta = dTotDelta;
+ iCBest = iC;
+ }
+ }
+
+ if (verbose>3) {
+ fprintf(stderr, "SPR %s %d around %d chainLength %d of %d deltaLength %.5f swaps:",
+ iCBest >= 0 ? "move" : "abandoned",
+ node,nodeAround[iAround],iCBest+1,chainLength,dMinDelta);
+ for (iC = 0; iC < chainLength; iC++)
+ fprintf(stderr, " (%d,%d)%.4f", steps[iC].nodes[0], steps[iC].nodes[1], steps[iC].deltaLength);
+ fprintf(stderr,"\n");
+ }
+ for (iC = chainLength - 1; iC > iCBest; iC--)
+ UnwindSPRStep(/*IN/OUT*/NJ, /*IN*/&steps[iC], /*IN/OUT*/upProfiles);
+ if(verbose > 3)
+ PrintNJInternal(stderr, NJ, /*useLen*/false);
+ while (slow && iCBest >= 0) {
+ double expected_tot_len = last_tot_len + dMinDelta;
+ double new_tot_len = TreeLength(NJ, /*recompute*/true);
+ if (verbose > 2)
+ fprintf(stderr, "Total branch-length is now %.4f was %.4f expected %.4f\n",
+ new_tot_len, last_tot_len, expected_tot_len);
+ if (new_tot_len < last_tot_len) {
+ last_tot_len = new_tot_len;
+ break; /* no rewinding necessary */
+ }
+ if (verbose > 2)
+ fprintf(stderr, "Rewinding SPR to %d\n",iCBest);
+ UnwindSPRStep(/*IN/OUT*/NJ, /*IN*/&steps[iCBest], /*IN/OUT*/upProfiles);
+ dMinDelta -= steps[iCBest].deltaLength;
+ iCBest--;
+ }
+ if (iCBest >= 0)
+ bChanged = true;
+ } /* loop over which step to take at 1st NNI */
+ } /* loop over which node to pivot around */
+
+ if (bChanged) {
+ nSPR++; /* the SPR move is OK */
+ /* make sure all the profiles are OK */
+ int j;
+ for (j = 0; j < NJ->maxnodes; j++)
+ DeleteUpProfile(upProfiles, NJ, j);
+ int ancestor;
+ for (ancestor = NJ->parent[node]; ancestor >= 0; ancestor = NJ->parent[ancestor])
+ RecomputeProfile(/*IN/OUT*/NJ, upProfiles, ancestor, /*useML*/false);
+ }
+ } /* end loop over subtrees to prune & regraft */
+ steps = myfree(steps, sizeof(spr_step_t) * maxSPRLength);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+ nodeList = myfree(nodeList, sizeof(int) * NJ->maxnodes);
+}
+
+void RecomputeProfile(/*IN/OUT*/NJ_t *NJ, /*IN/OUT*/profile_t **upProfiles, int node,
+ bool useML) {
+ if (node < NJ->nSeq || node == NJ->root)
+ return; /* no profile to compute */
+ assert(NJ->child[node].nChild==2);
+
+ profile_t *profiles[4];
+ double weight = 0.5;
+ if (useML || !bionj) {
+ profiles[0] = NJ->profiles[NJ->child[node].child[0]];
+ profiles[1] = NJ->profiles[NJ->child[node].child[1]];
+ } else {
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, useML);
+ weight = QuartetWeight(profiles, NJ->distance_matrix, NJ->nPos);
+ }
+ if (verbose>3) {
+ if (useML) {
+ fprintf(stderr, "Recompute %d from %d %d lengths %.4f %.4f\n",
+ node,
+ NJ->child[node].child[0],
+ NJ->child[node].child[1],
+ NJ->branchlength[NJ->child[node].child[0]],
+ NJ->branchlength[NJ->child[node].child[1]]);
+ } else {
+ fprintf(stderr, "Recompute %d from %d %d weight %.3f\n",
+ node, NJ->child[node].child[0], NJ->child[node].child[1], weight);
+ }
+ }
+ NJ->profiles[node] = FreeProfile(NJ->profiles[node], NJ->nPos, NJ->nConstraints);
+ if (useML) {
+ NJ->profiles[node] = PosteriorProfile(profiles[0], profiles[1],
+ NJ->branchlength[NJ->child[node].child[0]],
+ NJ->branchlength[NJ->child[node].child[1]],
+ NJ->transmat, &NJ->rates, NJ->nPos, NJ->nConstraints);
+ } else {
+ NJ->profiles[node] = AverageProfile(profiles[0], profiles[1],
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix, weight);
+ }
+}
+
+/* The BIONJ-like formula for the weight of A when building a profile for AB is
+ 1/2 + (avgD(B,CD) - avgD(A,CD))/(2*d(A,B))
+*/
+double QuartetWeight(profile_t *profiles[4], distance_matrix_t *dmat, int nPos) {
+ if (!bionj)
+ return(-1.0); /* even weighting */
+ double d[6];
+ CorrectedPairDistances(profiles, 4, dmat, nPos, /*OUT*/d);
+ if (d[qAB] < 0.01)
+ return -1.0;
+ double weight = 0.5 + ((d[qBC]+d[qBD])-(d[qAC]+d[qAD]))/(4*d[qAB]);
+ if (weight < 0)
+ weight = 0;
+ if (weight > 1)
+ weight = 1;
+ return (weight);
+}
+
+/* Resets the children entry of parent and also the parent entry of newchild */
+void ReplaceChild(/*IN/OUT*/NJ_t *NJ, int parent, int oldchild, int newchild) {
+ NJ->parent[newchild] = parent;
+
+ int iChild;
+ for (iChild = 0; iChild < NJ->child[parent].nChild; iChild++) {
+ if (NJ->child[parent].child[iChild] == oldchild) {
+ NJ->child[parent].child[iChild] = newchild;
+ return;
+ }
+ }
+ assert(0);
+}
+
+/* Recomputes all branch lengths
+
+ For internal branches such as (A,B) vs. (C,D), uses the formula
+
+ length(AB|CD) = (d(A,C)+d(A,D)+d(B,C)+d(B,D))/4 - d(A,B)/2 - d(C,D)/2
+
+ (where all distances are profile distances - diameters).
+
+ For external branches (e.g. to leaves) A vs. (B,C), use the formula
+
+ length(A|BC) = (d(A,B)+d(A,C)-d(B,C))/2
+*/
+void UpdateBranchLengths(/*IN/OUT*/NJ_t *NJ) {
+ if (NJ->nSeq < 2)
+ return;
+ else if (NJ->nSeq == 2) {
+ int root = NJ->root;
+ int nodeA = NJ->child[root].child[0];
+ int nodeB = NJ->child[root].child[1];
+ besthit_t h;
+ ProfileDist(NJ->profiles[nodeA],NJ->profiles[nodeB],
+ NJ->nPos, NJ->distance_matrix, /*OUT*/&h);
+ if (logdist)
+ h.dist = LogCorrect(h.dist);
+ NJ->branchlength[nodeA] = h.dist/2.0;
+ NJ->branchlength[nodeB] = h.dist/2.0;
+ return;
+ }
+
+ profile_t **upProfiles = UpProfiles(NJ);
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ /* reset branch length of node (distance to its parent) */
+ if (node == NJ->root)
+ continue; /* no branch length to set */
+ if (node < NJ->nSeq) { /* a leaf */
+ profile_t *profileA = NJ->profiles[node];
+ profile_t *profileB = NULL;
+ profile_t *profileC = NULL;
+
+ int sib = Sibling(NJ,node);
+ if (sib == -1) { /* at root, have 2 siblings */
+ int sibs[2];
+ RootSiblings(NJ, node, /*OUT*/sibs);
+ profileB = NJ->profiles[sibs[0]];
+ profileC = NJ->profiles[sibs[1]];
+ } else {
+ profileB = NJ->profiles[sib];
+ profileC = GetUpProfile(/*IN/OUT*/upProfiles, NJ, NJ->parent[node], /*useML*/false);
+ }
+ profile_t *profiles[3] = {profileA,profileB,profileC};
+ double d[3]; /*AB,AC,BC*/
+ CorrectedPairDistances(profiles, 3, NJ->distance_matrix, NJ->nPos, /*OUT*/d);
+ /* d(A,BC) = (dAB+dAC-dBC)/2 */
+ NJ->branchlength[node] = (d[0]+d[1]-d[2])/2.0;
+ } else {
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, /*useML*/false);
+ double d[6];
+ CorrectedPairDistances(profiles, 4, NJ->distance_matrix, NJ->nPos, /*OUT*/d);
+ NJ->branchlength[node] = (d[qAC]+d[qAD]+d[qBC]+d[qBD])/4.0 - (d[qAB]+d[qCD])/2.0;
+
+ /* no longer needed */
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[0]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[1]);
+ }
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+}
+
+/* Pick columns for resampling, stored as returned_vector[iBoot*nPos + j] */
+int *ResampleColumns(int nPos, int nBootstrap) {
+ long lPos = nPos; /* to prevent overflow on very long alignments when multiplying nPos * nBootstrap */
+ int *col = (int*)mymalloc(sizeof(int)*lPos*(size_t)nBootstrap);
+ int i;
+ for (i = 0; i < nBootstrap; i++) {
+ int j;
+ for (j = 0; j < nPos; j++) {
+ int pos = (int)(knuth_rand() * nPos);
+ if (pos<0)
+ pos = 0;
+ else if (pos == nPos)
+ pos = nPos-1;
+ col[i*lPos + j] = pos;
+ }
+ }
+ if (verbose > 5) {
+ for (i=0; i < 3 && i < nBootstrap; i++) {
+ fprintf(stderr,"Boot%d",i);
+ int j;
+ for (j = 0; j < nPos; j++) {
+ fprintf(stderr,"\t%d",col[i*lPos+j]);
+ }
+ fprintf(stderr,"\n");
+ }
+ }
+ return(col);
+}
+
+void ReliabilityNJ(/*IN/OUT*/NJ_t *NJ, int nBootstrap) {
+ /* For each non-root node N, with children A,B, parent P, sibling C, and grandparent G,
+ we test the reliability of the split (A,B) versus rest by comparing the profiles
+ of A, B, C, and the "up-profile" of P.
+
+ Each node's upProfile is the average of its sibling's (down)-profile + its parent's up-profile
+ (If node's parent is the root, then there are two siblings and we don't need an up-profile)
+
+ To save memory, we do depth-first-search down from the root, and we only keep
+ up-profiles for nodes in the active path.
+ */
+ if (NJ->nSeq <= 3 || nBootstrap <= 0)
+ return; /* nothing to do */
+ int *col = ResampleColumns(NJ->nPos, nBootstrap);
+
+ profile_t **upProfiles = UpProfiles(NJ);
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+ int iNodesDone = 0;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (node < NJ->nSeq || node == NJ->root)
+ continue; /* nothing to do for leaves or root */
+
+ if(iNodesDone > 0 && (iNodesDone % 100) == 0)
+ ProgressReport("Local bootstrap for %6d of %6d internal splits", iNodesDone, NJ->nSeq-3, 0, 0);
+ iNodesDone++;
+
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, /*useML*/false);
+
+ NJ->support[node] = SplitSupport(profiles[0], profiles[1], profiles[2], profiles[3],
+ NJ->distance_matrix,
+ NJ->nPos,
+ nBootstrap,
+ col);
+
+ /* no longer needed */
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[0]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[1]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[2]);
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+ col = myfree(col, sizeof(int)*((size_t)NJ->nPos)*nBootstrap);
+}
+
+profile_t *NewProfile(int nPos, int nConstraints) {
+ profile_t *profile = (profile_t *)mymalloc(sizeof(profile_t));
+ profile->weights = mymalloc(sizeof(numeric_t)*nPos);
+ profile->codes = mymalloc(sizeof(unsigned char)*nPos);
+ profile->vectors = NULL;
+ profile->nVectors = 0;
+ profile->codeDist = NULL;
+ if (nConstraints == 0) {
+ profile->nOn = NULL;
+ profile->nOff = NULL;
+ } else {
+ profile->nOn = mymalloc(sizeof(int)*nConstraints);
+ profile->nOff = mymalloc(sizeof(int)*nConstraints);
+ }
+ return(profile);
+}
+
+profile_t *FreeProfile(profile_t *profile, int nPos, int nConstraints) {
+ if(profile==NULL) return(NULL);
+ myfree(profile->codes, nPos);
+ myfree(profile->weights, nPos);
+ myfree(profile->vectors, sizeof(numeric_t)*nCodes*profile->nVectors);
+ myfree(profile->codeDist, sizeof(numeric_t)*nCodes*nPos);
+ if (nConstraints > 0) {
+ myfree(profile->nOn, sizeof(int)*nConstraints);
+ myfree(profile->nOff, sizeof(int)*nConstraints);
+ }
+ return(myfree(profile, sizeof(profile_t)));
+}
+
+void SetupABCD(NJ_t *NJ, int node,
+ /* the 4 profiles; the last one is an outprofile */
+ /*OPTIONAL OUT*/profile_t *profiles[4],
+ /*OPTIONAL IN/OUT*/profile_t **upProfiles,
+ /*OUT*/int nodeABCD[4],
+ bool useML) {
+ int parent = NJ->parent[node];
+ assert(parent >= 0);
+ assert(NJ->child[node].nChild == 2);
+ nodeABCD[0] = NJ->child[node].child[0]; /*A*/
+ nodeABCD[1] = NJ->child[node].child[1]; /*B*/
+
+ profile_t *profile4 = NULL;
+ if (parent == NJ->root) {
+ int sibs[2];
+ RootSiblings(NJ, node, /*OUT*/sibs);
+ nodeABCD[2] = sibs[0];
+ nodeABCD[3] = sibs[1];
+ if (profiles == NULL)
+ return;
+ profile4 = NJ->profiles[sibs[1]];
+ } else {
+ nodeABCD[2] = Sibling(NJ,node);
+ assert(nodeABCD[2] >= 0);
+ nodeABCD[3] = parent;
+ if (profiles == NULL)
+ return;
+ profile4 = GetUpProfile(upProfiles,NJ,parent,useML);
+ }
+ assert(upProfiles != NULL);
+ int i;
+ for (i = 0; i < 3; i++)
+ profiles[i] = NJ->profiles[nodeABCD[i]];
+ profiles[3] = profile4;
+}
+
+
+int Sibling(NJ_t *NJ, int node) {
+ int parent = NJ->parent[node];
+ if (parent < 0 || parent == NJ->root)
+ return(-1);
+ int iChild;
+ for(iChild=0;iChild<NJ->child[parent].nChild;iChild++) {
+ if(NJ->child[parent].child[iChild] != node)
+ return (NJ->child[parent].child[iChild]);
+ }
+ assert(0);
+ return(-1);
+}
+
+void RootSiblings(NJ_t *NJ, int node, /*OUT*/int sibs[2]) {
+ assert(NJ->parent[node] == NJ->root);
+ assert(NJ->child[NJ->root].nChild == 3);
+
+ int nSibs = 0;
+ int iChild;
+ for(iChild=0; iChild < NJ->child[NJ->root].nChild; iChild++) {
+ int child = NJ->child[NJ->root].child[iChild];
+ if (child != node) sibs[nSibs++] = child;
+ }
+ assert(nSibs==2);
+}
+
+void TestSplitsML(/*IN/OUT*/NJ_t *NJ, /*OUT*/SplitCount_t *splitcount, int nBootstrap) {
+ const double tolerance = 1e-6;
+ splitcount->nBadSplits = 0;
+ splitcount->nConstraintViolations = 0;
+ splitcount->nBadBoth = 0;
+ splitcount->nSplits = 0;
+ splitcount->dWorstDeltaUnconstrained = 0;
+ splitcount->dWorstDeltaConstrained = 0;
+
+ profile_t **upProfiles = UpProfiles(NJ);
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+
+ int *col = nBootstrap > 0 ? ResampleColumns(NJ->nPos, nBootstrap) : NULL;
+ double *site_likelihoods[3];
+ int choice;
+ for (choice = 0; choice < 3; choice++)
+ site_likelihoods[choice] = mymalloc(sizeof(double)*NJ->nPos);
+
+ int iNodesDone = 0;
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (node < NJ->nSeq || node == NJ->root)
+ continue; /* nothing to do for leaves or root */
+
+ if(iNodesDone > 0 && (iNodesDone % 100) == 0)
+ ProgressReport("ML split tests for %6d of %6d internal splits", iNodesDone, NJ->nSeq-3, 0, 0);
+ iNodesDone++;
+
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, /*useML*/true);
+ double loglk[3];
+ double len[5];
+ int i;
+ for (i = 0; i < 4; i++)
+ len[i] = NJ->branchlength[nodeABCD[i]];
+ len[4] = NJ->branchlength[node];
+ double lenABvsCD[5] = {len[LEN_A], len[LEN_B], len[LEN_C], len[LEN_D], len[LEN_I]};
+ double lenACvsBD[5] = {len[LEN_A], len[LEN_C], len[LEN_B], len[LEN_D], len[LEN_I]}; /* Swap B & C */
+ double lenADvsBC[5] = {len[LEN_A], len[LEN_D], len[LEN_C], len[LEN_B], len[LEN_I]}; /* Swap B & D */
+
+ {
+#ifdef OPENMP
+ #pragma omp parallel
+ #pragma omp sections
+#endif
+ {
+#ifdef OPENMP
+ #pragma omp section
+#endif
+ {
+ /* Lengths are already optimized for ABvsCD */
+ loglk[ABvsCD] = MLQuartetLogLk(profiles[0], profiles[1], profiles[2], profiles[3],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/lenABvsCD,
+ /*OUT*/site_likelihoods[ABvsCD]);
+ }
+
+#ifdef OPENMP
+ #pragma omp section
+#endif
+ {
+ loglk[ACvsBD] = MLQuartetOptimize(profiles[0], profiles[2], profiles[1], profiles[3],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/lenACvsBD, /*pStarTest*/NULL,
+ /*OUT*/site_likelihoods[ACvsBD]);
+ }
+
+#ifdef OPENMP
+ #pragma omp section
+#endif
+ {
+ loglk[ADvsBC] = MLQuartetOptimize(profiles[0], profiles[3], profiles[2], profiles[1],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/lenADvsBC, /*pStarTest*/NULL,
+ /*OUT*/site_likelihoods[ADvsBC]);
+ }
+ }
+ }
+
+ /* do a second pass on the better alternative if it is close */
+ if (loglk[ACvsBD] > loglk[ADvsBC]) {
+ if (mlAccuracy > 1 || loglk[ACvsBD] > loglk[ABvsCD] - closeLogLkLimit) {
+ loglk[ACvsBD] = MLQuartetOptimize(profiles[0], profiles[2], profiles[1], profiles[3],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/lenACvsBD, /*pStarTest*/NULL,
+ /*OUT*/site_likelihoods[ACvsBD]);
+ }
+ } else {
+ if (mlAccuracy > 1 || loglk[ADvsBC] > loglk[ABvsCD] - closeLogLkLimit) {
+ loglk[ADvsBC] = MLQuartetOptimize(profiles[0], profiles[3], profiles[2], profiles[1],
+ NJ->nPos, NJ->transmat, &NJ->rates, /*IN/OUT*/lenADvsBC, /*pStarTest*/NULL,
+ /*OUT*/site_likelihoods[ADvsBC]);
+ }
+ }
+
+ if (loglk[ABvsCD] >= loglk[ACvsBD] && loglk[ABvsCD] >= loglk[ADvsBC])
+ choice = ABvsCD;
+ else if (loglk[ACvsBD] >= loglk[ABvsCD] && loglk[ACvsBD] >= loglk[ADvsBC])
+ choice = ACvsBD;
+ else
+ choice = ADvsBC;
+ bool badSplit = loglk[choice] > loglk[ABvsCD] + treeLogLkDelta; /* ignore small changes in likelihood */
+
+ /* constraint penalties, indexed by nni_t (lower is better) */
+ double p[3];
+ QuartetConstraintPenalties(profiles, NJ->nConstraints, /*OUT*/p);
+ bool bBadConstr = p[ABvsCD] > p[ACvsBD] + tolerance || p[ABvsCD] > p[ADvsBC] + tolerance;
+ bool violateConstraint = false;
+ int iC;
+ for (iC=0; iC < NJ->nConstraints; iC++) {
+ if (SplitViolatesConstraint(profiles, iC)) {
+ violateConstraint = true;
+ break;
+ }
+ }
+ splitcount->nSplits++;
+ if (violateConstraint)
+ splitcount->nConstraintViolations++;
+ if (badSplit)
+ splitcount->nBadSplits++;
+ if (badSplit && bBadConstr)
+ splitcount->nBadBoth++;
+ if (badSplit) {
+ double delta = loglk[choice] - loglk[ABvsCD];
+ /* If ABvsCD is favored over the more likely NNI by constraints,
+ then this is probably a bad split because of the constraint */
+ if (p[choice] > p[ABvsCD] + tolerance)
+ splitcount->dWorstDeltaConstrained = MAX(delta, splitcount->dWorstDeltaConstrained);
+ else
+ splitcount->dWorstDeltaUnconstrained = MAX(delta, splitcount->dWorstDeltaUnconstrained);
+ }
+ if (nBootstrap>0)
+ NJ->support[node] = badSplit ? 0.0 : SHSupport(NJ->nPos, nBootstrap, col, loglk, site_likelihoods);
+
+ /* No longer needed */
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[0]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[1]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[2]);
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+ if (nBootstrap>0)
+ col = myfree(col, sizeof(int)*((size_t)NJ->nPos)*nBootstrap);
+ for (choice = 0; choice < 3; choice++)
+ site_likelihoods[choice] = myfree(site_likelihoods[choice], sizeof(double)*NJ->nPos);
+}
+
+
+void TestSplitsMinEvo(NJ_t *NJ, /*OUT*/SplitCount_t *splitcount) {
+ const double tolerance = 1e-6;
+ splitcount->nBadSplits = 0;
+ splitcount->nConstraintViolations = 0;
+ splitcount->nBadBoth = 0;
+ splitcount->nSplits = 0;
+ splitcount->dWorstDeltaUnconstrained = 0.0;
+ splitcount->dWorstDeltaConstrained = 0.0;
+
+ profile_t **upProfiles = UpProfiles(NJ);
+ traversal_t traversal = InitTraversal(NJ);
+ int node = NJ->root;
+
+ while((node = TraversePostorder(node, NJ, /*IN/OUT*/traversal, /*pUp*/NULL)) >= 0) {
+ if (node < NJ->nSeq || node == NJ->root)
+ continue; /* nothing to do for leaves or root */
+
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, /*useML*/false);
+
+ if (verbose>2)
+ fprintf(stderr,"Testing Split around %d: A=%d B=%d C=%d D=up(%d) or node parent %d\n",
+ node, nodeABCD[0], nodeABCD[1], nodeABCD[2], nodeABCD[3], NJ->parent[node]);
+
+ double d[6]; /* distances, perhaps log-corrected distances, no constraint penalties */
+ CorrectedPairDistances(profiles, 4, NJ->distance_matrix, NJ->nPos, /*OUT*/d);
+
+ /* alignment-based scores for each split (lower is better) */
+ double sABvsCD = d[qAB] + d[qCD];
+ double sACvsBD = d[qAC] + d[qBD];
+ double sADvsBC = d[qAD] + d[qBC];
+
+ /* constraint penalties, indexed by nni_t (lower is better) */
+ double p[3];
+ QuartetConstraintPenalties(profiles, NJ->nConstraints, /*OUT*/p);
+
+ int nConstraintsViolated = 0;
+ int iC;
+ for (iC=0; iC < NJ->nConstraints; iC++) {
+ if (SplitViolatesConstraint(profiles, iC)) {
+ nConstraintsViolated++;
+ if (verbose > 2) {
+ double penalty[3] = {0.0,0.0,0.0};
+ (void)QuartetConstraintPenaltiesPiece(profiles, iC, /*OUT*/penalty);
+ fprintf(stderr, "Violate constraint %d at %d (children %d %d) penalties %.3f %.3f %.3f %d/%d %d/%d %d/%d %d/%d\n",
+ iC, node, NJ->child[node].child[0], NJ->child[node].child[1],
+ penalty[ABvsCD], penalty[ACvsBD], penalty[ADvsBC],
+ profiles[0]->nOn[iC], profiles[0]->nOff[iC],
+ profiles[1]->nOn[iC], profiles[1]->nOff[iC],
+ profiles[2]->nOn[iC], profiles[2]->nOff[iC],
+ profiles[3]->nOn[iC], profiles[3]->nOff[iC]);
+ }
+ }
+ }
+
+ double delta = sABvsCD - MIN(sACvsBD,sADvsBC);
+ bool bBadDist = delta > tolerance;
+ bool bBadConstr = p[ABvsCD] > p[ACvsBD] + tolerance || p[ABvsCD] > p[ADvsBC] + tolerance;
+
+ splitcount->nSplits++;
+ if (bBadDist) {
+ nni_t choice = sACvsBD < sADvsBC ? ACvsBD : ADvsBC;
+ /* If ABvsCD is favored over the shorter NNI by constraints,
+ then this is probably a bad split because of the constraint */
+ if (p[choice] > p[ABvsCD] + tolerance)
+ splitcount->dWorstDeltaConstrained = MAX(delta, splitcount->dWorstDeltaConstrained);
+ else
+ splitcount->dWorstDeltaUnconstrained = MAX(delta, splitcount->dWorstDeltaUnconstrained);
+ }
+
+ if (nConstraintsViolated > 0)
+ splitcount->nConstraintViolations++; /* count splits with any violations, not #constraints in a splits */
+ if (bBadDist)
+ splitcount->nBadSplits++;
+ if (bBadDist && bBadConstr)
+ splitcount->nBadBoth++;
+ if (bBadConstr && verbose > 2) {
+ /* Which NNI would be better */
+ double dist_advantage = 0;
+ double constraint_penalty = 0;
+ if (p[ACvsBD] < p[ADvsBC]) {
+ dist_advantage = sACvsBD - sABvsCD;
+ constraint_penalty = p[ABvsCD] - p[ACvsBD];
+ } else {
+ dist_advantage = sADvsBC - sABvsCD;
+ constraint_penalty = p[ABvsCD] - p[ADvsBC];
+ }
+ fprintf(stderr, "Violate constraints %d distance_advantage %.3f constraint_penalty %.3f (children %d %d):",
+ node, dist_advantage, constraint_penalty,
+ NJ->child[node].child[0], NJ->child[node].child[1]);
+ /* list the constraints with a penalty, meaning that ABCD all have non-zero
+ values and that AB|CD worse than others */
+ for (iC = 0; iC < NJ->nConstraints; iC++) {
+ double ppart[6];
+ if (QuartetConstraintPenaltiesPiece(profiles, iC, /*OUT*/ppart)) {
+ if (ppart[qAB] + ppart[qCD] > ppart[qAD] + ppart[qBC] + tolerance
+ || ppart[qAB] + ppart[qCD] > ppart[qAC] + ppart[qBD] + tolerance)
+ fprintf(stderr, " %d (%d/%d %d/%d %d/%d %d/%d)", iC,
+ profiles[0]->nOn[iC], profiles[0]->nOff[iC],
+ profiles[1]->nOn[iC], profiles[1]->nOff[iC],
+ profiles[2]->nOn[iC], profiles[2]->nOff[iC],
+ profiles[3]->nOn[iC], profiles[3]->nOff[iC]);
+ }
+ }
+ fprintf(stderr, "\n");
+ }
+
+ /* no longer needed */
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[0]);
+ DeleteUpProfile(upProfiles, NJ, nodeABCD[1]);
+ }
+ traversal = FreeTraversal(traversal,NJ);
+ upProfiles = FreeUpProfiles(upProfiles,NJ);
+}
+
+/* Computes support for (A,B),(C,D) compared to that for (A,C),(B,D) and (A,D),(B,C) */
+double SplitSupport(profile_t *pA, profile_t *pB, profile_t *pC, profile_t *pD,
+ /*OPTIONAL*/distance_matrix_t *dmat,
+ int nPos,
+ int nBootstrap,
+ int *col) {
+ int i,j;
+ long lPos = nPos; /* to avoid overflow when multiplying */
+
+ /* Note distpieces are weighted */
+ double *distpieces[6];
+ double *weights[6];
+ for (j = 0; j < 6; j++) {
+ distpieces[j] = (double*)mymalloc(sizeof(double)*nPos);
+ weights[j] = (double*)mymalloc(sizeof(double)*nPos);
+ }
+
+ int iFreqA = 0;
+ int iFreqB = 0;
+ int iFreqC = 0;
+ int iFreqD = 0;
+ for (i = 0; i < nPos; i++) {
+ numeric_t *fA = GET_FREQ(pA, i, /*IN/OUT*/iFreqA);
+ numeric_t *fB = GET_FREQ(pB, i, /*IN/OUT*/iFreqB);
+ numeric_t *fC = GET_FREQ(pC, i, /*IN/OUT*/iFreqC);
+ numeric_t *fD = GET_FREQ(pD, i, /*IN/OUT*/iFreqD);
+
+ weights[qAB][i] = pA->weights[i] * pB->weights[i];
+ weights[qAC][i] = pA->weights[i] * pC->weights[i];
+ weights[qAD][i] = pA->weights[i] * pD->weights[i];
+ weights[qBC][i] = pB->weights[i] * pC->weights[i];
+ weights[qBD][i] = pB->weights[i] * pD->weights[i];
+ weights[qCD][i] = pC->weights[i] * pD->weights[i];
+
+ distpieces[qAB][i] = weights[qAB][i] * ProfileDistPiece(pA->codes[i], pB->codes[i], fA, fB, dmat, NULL);
+ distpieces[qAC][i] = weights[qAC][i] * ProfileDistPiece(pA->codes[i], pC->codes[i], fA, fC, dmat, NULL);
+ distpieces[qAD][i] = weights[qAD][i] * ProfileDistPiece(pA->codes[i], pD->codes[i], fA, fD, dmat, NULL);
+ distpieces[qBC][i] = weights[qBC][i] * ProfileDistPiece(pB->codes[i], pC->codes[i], fB, fC, dmat, NULL);
+ distpieces[qBD][i] = weights[qBD][i] * ProfileDistPiece(pB->codes[i], pD->codes[i], fB, fD, dmat, NULL);
+ distpieces[qCD][i] = weights[qCD][i] * ProfileDistPiece(pC->codes[i], pD->codes[i], fC, fD, dmat, NULL);
+ }
+ assert(iFreqA == pA->nVectors);
+ assert(iFreqB == pB->nVectors);
+ assert(iFreqC == pC->nVectors);
+ assert(iFreqD == pD->nVectors);
+
+ double totpieces[6];
+ double totweights[6];
+ double dists[6];
+ for (j = 0; j < 6; j++) {
+ totpieces[j] = 0.0;
+ totweights[j] = 0.0;
+ for (i = 0; i < nPos; i++) {
+ totpieces[j] += distpieces[j][i];
+ totweights[j] += weights[j][i];
+ }
+ dists[j] = totweights[j] > 0.01 ? totpieces[j]/totweights[j] : 3.0;
+ if (logdist)
+ dists[j] = LogCorrect(dists[j]);
+ }
+
+ /* Support1 = Support(AB|CD over AC|BD) = d(A,C)+d(B,D)-d(A,B)-d(C,D)
+ Support2 = Support(AB|CD over AD|BC) = d(A,D)+d(B,C)-d(A,B)-d(C,D)
+ */
+ double support1 = dists[qAC] + dists[qBD] - dists[qAB] - dists[qCD];
+ double support2 = dists[qAD] + dists[qBC] - dists[qAB] - dists[qCD];
+
+ if (support1 < 0 || support2 < 0) {
+ nSuboptimalSplits++; /* Another split seems superior */
+ }
+
+ assert(nBootstrap > 0);
+ int nSupport = 0;
+
+ int iBoot;
+ for (iBoot=0;iBoot<nBootstrap;iBoot++) {
+ int *colw = &col[lPos*iBoot];
+
+ for (j = 0; j < 6; j++) {
+ double totp = 0;
+ double totw = 0;
+ double *d = distpieces[j];
+ double *w = weights[j];
+ for (i=0; i<nPos; i++) {
+ int c = colw[i];
+ totp += d[c];
+ totw += w[c];
+ }
+ dists[j] = totw > 0.01 ? totp/totw : 3.0;
+ if (logdist)
+ dists[j] = LogCorrect(dists[j]);
+ }
+ support1 = dists[qAC] + dists[qBD] - dists[qAB] - dists[qCD];
+ support2 = dists[qAD] + dists[qBC] - dists[qAB] - dists[qCD];
+ if (support1 > 0 && support2 > 0)
+ nSupport++;
+ } /* end loop over bootstrap replicates */
+
+ for (j = 0; j < 6; j++) {
+ distpieces[j] = myfree(distpieces[j], sizeof(double)*nPos);
+ weights[j] = myfree(weights[j], sizeof(double)*nPos);
+ }
+ return( nSupport/(double)nBootstrap );
+}
+
+double SHSupport(int nPos, int nBootstrap, int *col, double loglk[3], double *site_likelihoods[3]) {
+ long lPos = nPos; /* to avoid overflow when multiplying */
+ assert(nBootstrap>0);
+ double delta1 = loglk[0]-loglk[1];
+ double delta2 = loglk[0]-loglk[2];
+ double delta = delta1 < delta2 ? delta1 : delta2;
+
+ double *siteloglk[3];
+ int i,j;
+ for (i = 0; i < 3; i++) {
+ siteloglk[i] = mymalloc(sizeof(double)*nPos);
+ for (j = 0; j < nPos; j++)
+ siteloglk[i][j] = log(site_likelihoods[i][j]);
+ }
+
+ int nSupport = 0;
+ int iBoot;
+ for (iBoot = 0; iBoot < nBootstrap; iBoot++) {
+ double resampled[3];
+ for (i = 0; i < 3; i++)
+ resampled[i] = -loglk[i];
+ for (j = 0; j < nPos; j++) {
+ int pos = col[iBoot*lPos+j];
+ for (i = 0; i < 3; i++)
+ resampled[i] += siteloglk[i][pos];
+ }
+ int iBest = 0;
+ for (i = 1; i < 3; i++)
+ if (resampled[i] > resampled[iBest])
+ iBest = i;
+ double resample1 = resampled[iBest] - resampled[(iBest+1)%3];
+ double resample2 = resampled[iBest] - resampled[(iBest+2)%3];
+ double resampleDelta = resample1 < resample2 ? resample1 : resample2;
+ if (resampleDelta < delta)
+ nSupport++;
+ }
+ for (i=0;i<3;i++)
+ siteloglk[i] = myfree(siteloglk[i], sizeof(double)*nPos);
+ return(nSupport/(double)nBootstrap);
+}
+
+
+void SetDistCriterion(/*IN/OUT*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *hit) {
+ if (hit->i < NJ->nSeq && hit->j < NJ->nSeq) {
+ SeqDist(NJ->profiles[hit->i]->codes,
+ NJ->profiles[hit->j]->codes,
+ NJ->nPos, NJ->distance_matrix, /*OUT*/hit);
+ } else {
+ ProfileDist(NJ->profiles[hit->i],
+ NJ->profiles[hit->j],
+ NJ->nPos, NJ->distance_matrix, /*OUT*/hit);
+ hit->dist -= (NJ->diameter[hit->i] + NJ->diameter[hit->j]);
+ }
+ hit->dist += constraintWeight
+ * (double)JoinConstraintPenalty(NJ, hit->i, hit->j);
+ SetCriterion(NJ,nActive,/*IN/OUT*/hit);
+}
+
+void SetCriterion(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *join) {
+ if(join->i < 0
+ || join->j < 0
+ || NJ->parent[join->i] >= 0
+ || NJ->parent[join->j] >= 0)
+ return;
+ assert(NJ->nOutDistActive[join->i] >= nActive);
+ assert(NJ->nOutDistActive[join->j] >= nActive);
+
+ int nDiffAllow = tophitsMult > 0 ? (int)(nActive*staleOutLimit) : 0;
+ if (NJ->nOutDistActive[join->i] - nActive > nDiffAllow)
+ SetOutDistance(NJ, join->i, nActive);
+ if (NJ->nOutDistActive[join->j] - nActive > nDiffAllow)
+ SetOutDistance(NJ, join->j, nActive);
+ double outI = NJ->outDistances[join->i];
+ if (NJ->nOutDistActive[join->i] != nActive)
+ outI *= (nActive-1)/(double)(NJ->nOutDistActive[join->i]-1);
+ double outJ = NJ->outDistances[join->j];
+ if (NJ->nOutDistActive[join->j] != nActive)
+ outJ *= (nActive-1)/(double)(NJ->nOutDistActive[join->j]-1);
+ join->criterion = join->dist - (outI+outJ)/(double)(nActive-2);
+ if (verbose > 2 && nActive <= 5) {
+ fprintf(stderr, "Set Criterion to join %d %d with nActive=%d dist+penalty %.3f criterion %.3f\n",
+ join->i, join->j, nActive, join->dist, join->criterion);
+ }
+}
+
+void SetOutDistance(NJ_t *NJ, int iNode, int nActive) {
+ if (NJ->nOutDistActive[iNode] == nActive)
+ return;
+
+ /* May be called by InitNJ before we have parents */
+ assert(iNode>=0 && (NJ->parent == NULL || NJ->parent[iNode]<0));
+ besthit_t dist;
+ ProfileDist(NJ->profiles[iNode], NJ->outprofile, NJ->nPos, NJ->distance_matrix, &dist);
+ outprofileOps++;
+
+ /* out(A) = sum(X!=A) d(A,X)
+ = sum(X!=A) (profiledist(A,X) - diam(A) - diam(X))
+ = sum(X!=A) profiledist(A,X) - (N-1)*diam(A) - (totdiam - diam(A))
+
+ in the absence of gaps:
+ profiledist(A,out) = mean profiledist(A, all active nodes)
+ sum(X!=A) profiledist(A,X) = N * profiledist(A,out) - profiledist(A,A)
+
+ With gaps, we need to take the weights of the comparisons into account, where
+ w(Ai) is the weight of position i in profile A:
+ w(A,B) = sum_i w(Ai) * w(Bi)
+ d(A,B) = sum_i w(Ai) * w(Bi) * d(Ai,Bi) / w(A,B)
+
+ sum(X!=A) profiledist(A,X) ~= (N-1) * profiledist(A, Out w/o A)
+ profiledist(A, Out w/o A) = sum_X!=A sum_i d(Ai,Xi) * w(Ai) * w(Bi) / ( sum_X!=A sum_i w(Ai) * w(Bi) )
+ d(A, Out) = sum_A sum_i d(Ai,Xi) * w(Ai) * w(Bi) / ( sum_X sum_i w(Ai) * w(Bi) )
+
+ and so we get
+ profiledist(A,out w/o A) = (top of d(A,Out) - top of d(A,A)) / (weight of d(A,Out) - weight of d(A,A))
+ top = dist * weight
+ with another correction of nActive because the weight of the out-profile is the average
+ weight not the total weight.
+ */
+ double top = (nActive-1)
+ * (dist.dist * dist.weight * nActive - NJ->selfweight[iNode] * NJ->selfdist[iNode]);
+ double bottom = (dist.weight * nActive - NJ->selfweight[iNode]);
+ double pdistOutWithoutA = top/bottom;
+ NJ->outDistances[iNode] = bottom > 0.01 ?
+ pdistOutWithoutA - NJ->diameter[iNode] * (nActive-1) - (NJ->totdiam - NJ->diameter[iNode])
+ : 3.0;
+ NJ->nOutDistActive[iNode] = nActive;
+
+ if(verbose>3 && iNode < 5)
+ fprintf(stderr,"NewOutDist for %d %f from dist %f selfd %f diam %f totdiam %f newActive %d\n",
+ iNode, NJ->outDistances[iNode], dist.dist, NJ->selfdist[iNode], NJ->diameter[iNode],
+ NJ->totdiam, nActive);
+ if (verbose>6 && (iNode % 10) == 0) {
+ /* Compute the actual out-distance and compare */
+ double total = 0.0;
+ double total_pd = 0.0;
+ int j;
+ for (j=0;j<NJ->maxnode;j++) {
+ if (j!=iNode && (NJ->parent==NULL || NJ->parent[j]<0)) {
+ besthit_t bh;
+ ProfileDist(NJ->profiles[iNode], NJ->profiles[j], NJ->nPos, NJ->distance_matrix, /*OUT*/&bh);
+ total_pd += bh.dist;
+ total += bh.dist - (NJ->diameter[iNode] + NJ->diameter[j]);
+ }
+ }
+ fprintf(stderr,"OutDist for Node %d %f truth %f profiled %f truth %f pd_err %f\n",
+ iNode, NJ->outDistances[iNode], total, pdistOutWithoutA, total_pd,fabs(pdistOutWithoutA-total_pd));
+ }
+}
+
+top_hits_t *FreeTopHits(top_hits_t *tophits) {
+ if (tophits == NULL)
+ return(NULL);
+ int iNode;
+ for (iNode = 0; iNode < tophits->maxnodes; iNode++) {
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ if (l->hits != NULL)
+ l->hits = myfree(l->hits, sizeof(hit_t) * l->nHits);
+ }
+ tophits->top_hits_lists = myfree(tophits->top_hits_lists, sizeof(top_hits_list_t) * tophits->maxnodes);
+ tophits->visible = myfree(tophits->visible, sizeof(hit_t*) * tophits->maxnodes);
+ tophits->topvisible = myfree(tophits->topvisible, sizeof(int) * tophits->nTopVisible);
+#ifdef OPENMP
+ for (iNode = 0; iNode < tophits->maxnodes; iNode++)
+ omp_destroy_lock(&tophits->locks[iNode]);
+ tophits->locks = myfree(tophits->locks, sizeof(omp_lock_t) * tophits->maxnodes);
+#endif
+ return(myfree(tophits, sizeof(top_hits_t)));
+}
+
+top_hits_t *InitTopHits(NJ_t *NJ, int m) {
+ int iNode;
+ assert(m > 0);
+ top_hits_t *tophits = mymalloc(sizeof(top_hits_t));
+ tophits->m = m;
+ tophits->q = (int)(0.5 + tophits2Mult * sqrt(tophits->m));
+ if (!useTopHits2nd || tophits->q >= tophits->m)
+ tophits->q = 0;
+ tophits->maxnodes = NJ->maxnodes;
+ tophits->top_hits_lists = mymalloc(sizeof(top_hits_list_t) * tophits->maxnodes);
+ tophits->visible = mymalloc(sizeof(hit_t) * tophits->maxnodes);
+ tophits->nTopVisible = (int)(0.5 + topvisibleMult*m);
+ tophits->topvisible = mymalloc(sizeof(int) * tophits->nTopVisible);
+#ifdef OPENMP
+ tophits->locks = mymalloc(sizeof(omp_lock_t) * tophits->maxnodes);
+ for (iNode = 0; iNode < tophits->maxnodes; iNode++)
+ omp_init_lock(&tophits->locks[iNode]);
+#endif
+ int i;
+ for (i = 0; i < tophits->nTopVisible; i++)
+ tophits->topvisible[i] = -1; /* empty */
+ tophits->topvisibleAge = 0;
+
+ for (iNode = 0; iNode < tophits->maxnodes; iNode++) {
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ l->nHits = 0;
+ l->hits = NULL;
+ l->hitSource = -1;
+ l->age = 0;
+ hit_t *v = &tophits->visible[iNode];
+ v->j = -1;
+ v->dist = 1e20;
+ }
+ return(tophits);
+}
+
+/* Helper function for sorting in SetAllLeafTopHits,
+ and the global variables it needs
+*/
+NJ_t *CompareSeedNJ = NULL;
+int *CompareSeedGaps = NULL;
+int CompareSeeds(const void *c1, const void *c2) {
+ int seed1 = *(int *)c1;
+ int seed2 = *(int *)c2;
+ int gapdiff = CompareSeedGaps[seed1] - CompareSeedGaps[seed2];
+ if (gapdiff != 0) return(gapdiff); /* fewer gaps is better */
+ double outdiff = CompareSeedNJ->outDistances[seed1] - CompareSeedNJ->outDistances[seed2];
+ if(outdiff < 0) return(-1); /* closer to more nodes is better */
+ if(outdiff > 0) return(1);
+ return(0);
+}
+
+/* Using the seed heuristic and the close global variable */
+void SetAllLeafTopHits(/*IN/UPDATE*/NJ_t *NJ, /*IN/OUT*/top_hits_t *tophits) {
+ double close = tophitsClose;
+ if (close < 0) {
+ if (fastest && NJ->nSeq >= 50000) {
+ close = 0.99;
+ } else {
+ double logN = log((double)NJ->nSeq)/log(2.0);
+ close = logN/(logN+2.0);
+ }
+ }
+ /* Sort the potential seeds, by a combination of nGaps and NJ->outDistances
+ We don't store nGaps so we need to compute that
+ */
+ int *nGaps = (int*)mymalloc(sizeof(int)*NJ->nSeq);
+ int iNode;
+ for(iNode=0; iNode<NJ->nSeq; iNode++) {
+ nGaps[iNode] = (int)(0.5 + NJ->nPos - NJ->selfweight[iNode]);
+ }
+ int *seeds = (int*)mymalloc(sizeof(int)*NJ->nSeq);
+ for (iNode=0; iNode<NJ->nSeq; iNode++) seeds[iNode] = iNode;
+ CompareSeedNJ = NJ;
+ CompareSeedGaps = nGaps;
+ qsort(/*IN/OUT*/seeds, NJ->nSeq, sizeof(int), CompareSeeds);
+ CompareSeedNJ = NULL;
+ CompareSeedGaps = NULL;
+
+ /* For each seed, save its top 2*m hits and then look for close neighbors */
+ assert(2 * tophits->m <= NJ->nSeq);
+ int iSeed;
+ int nHasTopHits = 0;
+#ifdef OPENMP
+ #pragma omp parallel for schedule(dynamic, 50)
+#endif
+ for(iSeed=0; iSeed < NJ->nSeq; iSeed++) {
+ int seed = seeds[iSeed];
+ if (iSeed > 0 && (iSeed % 100) == 0) {
+#ifdef OPENMP
+ #pragma omp critical
+#endif
+ ProgressReport("Top hits for %6d of %6d seqs (at seed %6d)",
+ nHasTopHits, NJ->nSeq,
+ iSeed, 0);
+ }
+ if (tophits->top_hits_lists[seed].nHits > 0) {
+ if(verbose>2) fprintf(stderr, "Skipping seed %d\n", seed);
+ continue;
+ }
+
+ besthit_t *besthitsSeed = (besthit_t*)mymalloc(sizeof(besthit_t)*NJ->nSeq);
+ besthit_t *besthitsNeighbor = (besthit_t*)mymalloc(sizeof(besthit_t) * 2 * tophits->m);
+ besthit_t bestjoin;
+
+ if(verbose>2) fprintf(stderr,"Trying seed %d\n", seed);
+ SetBestHit(seed, NJ, /*nActive*/NJ->nSeq, /*OUT*/&bestjoin, /*OUT*/besthitsSeed);
+
+ /* sort & save top hits of self. besthitsSeed is now sorted. */
+ SortSaveBestHits(seed, /*IN/SORT*/besthitsSeed, /*IN-SIZE*/NJ->nSeq,
+ /*OUT-SIZE*/tophits->m, /*IN/OUT*/tophits);
+ nHasTopHits++;
+
+ /* find "close" neighbors and compute their top hits */
+ double neardist = besthitsSeed[2 * tophits->m - 1].dist * close;
+ /* must have at least average weight, rem higher is better
+ and allow a bit more than average, e.g. if we are looking for within 30% away,
+ 20% more gaps than usual seems OK
+ Alternatively, have a coverage requirement in case neighbor is short
+ If fastest, consider the top q/2 hits to be close neighbors, regardless
+ */
+ double nearweight = 0;
+ int iClose;
+ for (iClose = 0; iClose < 2 * tophits->m; iClose++)
+ nearweight += besthitsSeed[iClose].weight;
+ nearweight = nearweight/(2.0 * tophits->m); /* average */
+ nearweight *= (1.0-2.0*neardist/3.0);
+ double nearcover = 1.0 - neardist/2.0;
+
+ if(verbose>2) fprintf(stderr,"Distance limit for close neighbors %f weight %f ungapped %d\n",
+ neardist, nearweight, NJ->nPos-nGaps[seed]);
+ for (iClose = 0; iClose < tophits->m; iClose++) {
+ besthit_t *closehit = &besthitsSeed[iClose];
+ int closeNode = closehit->j;
+ if (tophits->top_hits_lists[closeNode].nHits > 0)
+ continue;
+
+ /* If within close-distance, or identical, use as close neighbor */
+ bool close = closehit->dist <= neardist
+ && (closehit->weight >= nearweight
+ || closehit->weight >= (NJ->nPos-nGaps[closeNode])*nearcover);
+ bool identical = closehit->dist < 1e-6
+ && fabs(closehit->weight - (NJ->nPos - nGaps[seed])) < 1e-5
+ && fabs(closehit->weight - (NJ->nPos - nGaps[closeNode])) < 1e-5;
+ if (useTopHits2nd && iClose < tophits->q && (close || identical)) {
+ nHasTopHits++;
+ nClose2Used++;
+ int nUse = MIN(tophits->q * tophits2Safety, 2 * tophits->m);
+ besthit_t *besthitsClose = mymalloc(sizeof(besthit_t) * nUse);
+ TransferBestHits(NJ, /*nActive*/NJ->nSeq,
+ closeNode,
+ /*IN*/besthitsSeed, /*SIZE*/nUse,
+ /*OUT*/besthitsClose,
+ /*updateDistance*/true);
+ SortSaveBestHits(closeNode, /*IN/SORT*/besthitsClose,
+ /*IN-SIZE*/nUse, /*OUT-SIZE*/tophits->q,
+ /*IN/OUT*/tophits);
+ tophits->top_hits_lists[closeNode].hitSource = seed;
+ besthitsClose = myfree(besthitsClose, sizeof(besthit_t) * nUse);
+ } else if (close || identical || (fastest && iClose < (tophits->q+1)/2)) {
+ nHasTopHits++;
+ nCloseUsed++;
+ if(verbose>2) fprintf(stderr, "Near neighbor %d (rank %d weight %f ungapped %d %d)\n",
+ closeNode, iClose, besthitsSeed[iClose].weight,
+ NJ->nPos-nGaps[seed],
+ NJ->nPos-nGaps[closeNode]);
+
+ /* compute top 2*m hits */
+ TransferBestHits(NJ, /*nActive*/NJ->nSeq,
+ closeNode,
+ /*IN*/besthitsSeed, /*SIZE*/2 * tophits->m,
+ /*OUT*/besthitsNeighbor,
+ /*updateDistance*/true);
+ SortSaveBestHits(closeNode, /*IN/SORT*/besthitsNeighbor,
+ /*IN-SIZE*/2 * tophits->m, /*OUT-SIZE*/tophits->m,
+ /*IN/OUT*/tophits);
+
+ /* And then try for a second level of transfer. We assume we
+ are in a good area, because of the 1st
+ level of transfer, and in a small neighborhood, because q is
+ small (32 for 1 million sequences), so we do not make any close checks.
+ */
+ int iClose2;
+ for (iClose2 = 0; iClose2 < tophits->q && iClose2 < 2 * tophits->m; iClose2++) {
+ int closeNode2 = besthitsNeighbor[iClose2].j;
+ assert(closeNode2 >= 0);
+ if (tophits->top_hits_lists[closeNode2].hits == NULL) {
+ nClose2Used++;
+ nHasTopHits++;
+ int nUse = MIN(tophits->q * tophits2Safety, 2 * tophits->m);
+ besthit_t *besthitsClose2 = mymalloc(sizeof(besthit_t) * nUse);
+ TransferBestHits(NJ, /*nActive*/NJ->nSeq,
+ closeNode2,
+ /*IN*/besthitsNeighbor, /*SIZE*/nUse,
+ /*OUT*/besthitsClose2,
+ /*updateDistance*/true);
+ SortSaveBestHits(closeNode2, /*IN/SORT*/besthitsClose2,
+ /*IN-SIZE*/nUse, /*OUT-SIZE*/tophits->q,
+ /*IN/OUT*/tophits);
+ tophits->top_hits_lists[closeNode2].hitSource = closeNode;
+ besthitsClose2 = myfree(besthitsClose2, sizeof(besthit_t) * nUse);
+ } /* end if should do 2nd-level transfer */
+ }
+ }
+ } /* end loop over close candidates */
+ besthitsSeed = myfree(besthitsSeed, sizeof(besthit_t)*NJ->nSeq);
+ besthitsNeighbor = myfree(besthitsNeighbor, sizeof(besthit_t) * 2 * tophits->m);
+ } /* end loop over seeds */
+
+ for (iNode=0; iNode<NJ->nSeq; iNode++) {
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ assert(l->hits != NULL);
+ assert(l->hits[0].j >= 0);
+ assert(l->hits[0].j < NJ->nSeq);
+ assert(l->hits[0].j != iNode);
+ tophits->visible[iNode] = l->hits[0];
+ }
+
+ if (verbose >= 2) fprintf(stderr, "#Close neighbors among leaves: 1st-level %ld 2nd-level %ld seeds %ld\n",
+ nCloseUsed, nClose2Used, NJ->nSeq-nCloseUsed-nClose2Used);
+ nGaps = myfree(nGaps, sizeof(int)*NJ->nSeq);
+ seeds = myfree(seeds, sizeof(int)*NJ->nSeq);
+
+ /* Now add a "checking phase" where we ensure that the q or 2*sqrt(m) hits
+ of i are represented in j (if they should be)
+ */
+ long lReplace = 0;
+ int nCheck = tophits->q > 0 ? tophits->q : (int)(0.5 + 2.0*sqrt(tophits->m));
+ for (iNode = 0; iNode < NJ->nSeq; iNode++) {
+ if ((iNode % 100) == 0)
+ ProgressReport("Checking top hits for %6d of %6d seqs",
+ iNode+1, NJ->nSeq, 0, 0);
+ top_hits_list_t *lNode = &tophits->top_hits_lists[iNode];
+ int iHit;
+ for (iHit = 0; iHit < nCheck && iHit < lNode->nHits; iHit++) {
+ besthit_t bh = HitToBestHit(iNode, lNode->hits[iHit]);
+ SetCriterion(NJ, /*nActive*/NJ->nSeq, /*IN/OUT*/&bh);
+ top_hits_list_t *lTarget = &tophits->top_hits_lists[bh.j];
+
+ /* If this criterion is worse than the nCheck-1 entry of the target,
+ then skip the check.
+ This logic is based on assuming that the list is sorted,
+ which is true initially but may not be true later.
+ Still, is a good heuristic.
+ */
+ assert(nCheck > 0);
+ assert(nCheck <= lTarget->nHits);
+ besthit_t bhCheck = HitToBestHit(bh.j, lTarget->hits[nCheck-1]);
+ SetCriterion(NJ, /*nActive*/NJ->nSeq, /*IN/OUT*/&bhCheck);
+ if (bhCheck.criterion < bh.criterion)
+ continue; /* no check needed */
+
+ /* Check if this is present in the top-hit list */
+ int iHit2;
+ bool bFound = false;
+ for (iHit2 = 0; iHit2 < lTarget->nHits && !bFound; iHit2++)
+ if (lTarget->hits[iHit2].j == iNode)
+ bFound = true;
+ if (!bFound) {
+ /* Find the hit with the worst criterion and replace it with this one */
+ int iWorst = -1;
+ double dWorstCriterion = -1e20;
+ for (iHit2 = 0; iHit2 < lTarget->nHits; iHit2++) {
+ besthit_t bh2 = HitToBestHit(bh.j, lTarget->hits[iHit2]);
+ SetCriterion(NJ, /*nActive*/NJ->nSeq, /*IN/OUT*/&bh2);
+ if (bh2.criterion > dWorstCriterion) {
+ iWorst = iHit2;
+ dWorstCriterion = bh2.criterion;
+ }
+ }
+ if (dWorstCriterion > bh.criterion) {
+ assert(iWorst >= 0);
+ lTarget->hits[iWorst].j = iNode;
+ lTarget->hits[iWorst].dist = bh.dist;
+ lReplace++;
+ /* and perhaps update visible */
+ besthit_t v;
+ bool bSuccess = GetVisible(NJ, /*nActive*/NJ->nSeq, tophits, bh.j, /*OUT*/&v);
+ assert(bSuccess);
+ if (bh.criterion < v.criterion)
+ tophits->visible[bh.j] = lTarget->hits[iWorst];
+ }
+ }
+ }
+ }
+
+ if (verbose >= 2)
+ fprintf(stderr, "Replaced %ld top hit entries\n", lReplace);
+}
+
+/* Updates out-distances but does not reset or update visible set */
+void GetBestFromTopHits(int iNode,
+ /*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ /*IN*/top_hits_t *tophits,
+ /*OUT*/besthit_t *bestjoin) {
+ assert(iNode >= 0);
+ assert(NJ->parent[iNode] < 0);
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ assert(l->nHits > 0);
+ assert(l->hits != NULL);
+
+ if(!fastest)
+ SetOutDistance(NJ, iNode, nActive); /* ensure out-distances are not stale */
+
+ bestjoin->i = -1;
+ bestjoin->j = -1;
+ bestjoin->dist = 1e20;
+ bestjoin->criterion = 1e20;
+
+ int iBest;
+ for(iBest=0; iBest < l->nHits; iBest++) {
+ besthit_t bh = HitToBestHit(iNode, l->hits[iBest]);
+ if (UpdateBestHit(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/&bh, /*update dist*/true)) {
+ SetCriterion(/*IN/OUT*/NJ, nActive, /*IN/OUT*/&bh); /* make sure criterion is correct */
+ if (bh.criterion < bestjoin->criterion)
+ *bestjoin = bh;
+ }
+ }
+ assert(bestjoin->j >= 0); /* a hit was found */
+ assert(bestjoin->i == iNode);
+}
+
+int ActiveAncestor(/*IN*/NJ_t *NJ, int iNode) {
+ if (iNode < 0)
+ return(iNode);
+ while(NJ->parent[iNode] >= 0)
+ iNode = NJ->parent[iNode];
+ return(iNode);
+}
+
+bool UpdateBestHit(/*IN/UPDATE*/NJ_t *NJ, int nActive, /*IN/OUT*/besthit_t *hit,
+ bool bUpdateDist) {
+ int i = ActiveAncestor(/*IN*/NJ, hit->i);
+ int j = ActiveAncestor(/*IN*/NJ, hit->j);
+ if (i < 0 || j < 0 || i == j) {
+ hit->i = -1;
+ hit->j = -1;
+ hit->weight = 0;
+ hit->dist = 1e20;
+ hit->criterion = 1e20;
+ return(false);
+ }
+ if (i != hit->i || j != hit->j) {
+ hit->i = i;
+ hit->j = j;
+ if (bUpdateDist) {
+ SetDistCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/hit);
+ } else {
+ hit->dist = -1e20;
+ hit->criterion = 1e20;
+ }
+ }
+ return(true);
+}
+
+bool GetVisible(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN/OUT*/top_hits_t *tophits,
+ int iNode, /*OUT*/besthit_t *visible) {
+ if (iNode < 0 || NJ->parent[iNode] >= 0)
+ return(false);
+ hit_t *v = &tophits->visible[iNode];
+ if (v->j < 0 || NJ->parent[v->j] >= 0)
+ return(false);
+ *visible = HitToBestHit(iNode, *v);
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/visible);
+ return(true);
+}
+
+besthit_t *UniqueBestHits(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN/SORT*/besthit_t *combined, int nCombined,
+ /*OUT*/int *nUniqueOut) {
+ int iHit;
+ for (iHit = 0; iHit < nCombined; iHit++) {
+ besthit_t *hit = &combined[iHit];
+ UpdateBestHit(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/hit, /*update*/false);
+ }
+ qsort(/*IN/OUT*/combined, nCombined, sizeof(besthit_t), CompareHitsByIJ);
+
+ besthit_t *uniqueList = (besthit_t*)mymalloc(sizeof(besthit_t)*nCombined);
+ int nUnique = 0;
+ int iSavedLast = -1;
+
+ /* First build the new list */
+ for (iHit = 0; iHit < nCombined; iHit++) {
+ besthit_t *hit = &combined[iHit];
+ if (hit->i < 0 || hit->j < 0)
+ continue;
+ if (iSavedLast >= 0) {
+ /* toss out duplicates */
+ besthit_t *saved = &combined[iSavedLast];
+ if (saved->i == hit->i && saved->j == hit->j)
+ continue;
+ }
+ assert(nUnique < nCombined);
+ assert(hit->j >= 0 && NJ->parent[hit->j] < 0);
+ uniqueList[nUnique++] = *hit;
+ iSavedLast = iHit;
+ }
+ *nUniqueOut = nUnique;
+
+ /* Then do any updates to the criterion or the distances in parallel */
+#ifdef OPENMP
+ #pragma omp parallel for schedule(dynamic, 50)
+#endif
+ for (iHit = 0; iHit < nUnique; iHit++) {
+ besthit_t *hit = &uniqueList[iHit];
+ if (hit->dist < 0.0)
+ SetDistCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/hit);
+ else
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/hit);
+ }
+ return(uniqueList);
+}
+
+/*
+ Create a top hit list for the new node, either
+ from children (if there are enough best hits left) or by a "refresh"
+ Also set visible set for newnode
+ Also update visible set for other nodes if we stumble across a "better" hit
+*/
+
+void TopHitJoin(int newnode,
+ /*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ /*IN/OUT*/top_hits_t *tophits) {
+ long startProfileOps = profileOps;
+ long startOutProfileOps = outprofileOps;
+ assert(NJ->child[newnode].nChild == 2);
+ top_hits_list_t *lNew = &tophits->top_hits_lists[newnode];
+ assert(lNew->hits == NULL);
+
+ /* Copy the hits */
+ int i;
+ top_hits_list_t *lChild[2];
+ for (i = 0; i< 2; i++) {
+ lChild[i] = &tophits->top_hits_lists[NJ->child[newnode].child[i]];
+ assert(lChild[i]->hits != NULL && lChild[i]->nHits > 0);
+ }
+ int nCombined = lChild[0]->nHits + lChild[1]->nHits;
+ besthit_t *combinedList = (besthit_t*)mymalloc(sizeof(besthit_t)*nCombined);
+ HitsToBestHits(lChild[0]->hits, lChild[0]->nHits, NJ->child[newnode].child[0],
+ /*OUT*/combinedList);
+ HitsToBestHits(lChild[1]->hits, lChild[1]->nHits, NJ->child[newnode].child[1],
+ /*OUT*/combinedList + lChild[0]->nHits);
+ int nUnique;
+ /* UniqueBestHits() replaces children (used in the calls to HitsToBestHits)
+ with active ancestors, so all distances & criteria will be recomputed */
+ besthit_t *uniqueList = UniqueBestHits(/*IN/UPDATE*/NJ, nActive,
+ /*IN/SORT*/combinedList,
+ nCombined,
+ /*OUT*/&nUnique);
+ int nUniqueAlloc = nCombined;
+ combinedList = myfree(combinedList, sizeof(besthit_t)*nCombined);
+
+ /* Forget the top-hit lists of the joined nodes */
+ for (i = 0; i < 2; i++) {
+ lChild[i]->hits = myfree(lChild[i]->hits, sizeof(hit_t) * lChild[i]->nHits);
+ lChild[i]->nHits = 0;
+ }
+
+ /* Use the average age, rounded up, by 1 Versions 2.0 and earlier
+ used the maximum age, which leads to more refreshes without
+ improving the accuracy of the NJ phase. Intuitively, if one of
+ them was just refreshed then another refresh is unlikely to help.
+ */
+ lNew->age = (lChild[0]->age+lChild[1]->age+1)/2 + 1;
+
+ /* If top hit ages always match (perfectly balanced), then a
+ limit of log2(m) would mean a refresh after
+ m joins, which is about what we want.
+ */
+ int tophitAgeLimit = MAX(1, (int)(0.5 + log((double)tophits->m)/log(2.0)));
+
+ /* Either use the merged list as candidate top hits, or
+ move from 2nd level to 1st level, or do a refresh
+ UniqueBestHits eliminates hits to self, so if nUnique==nActive-1,
+ we've already done the exhaustive search.
+
+ Either way, we set tophits, visible(newnode), update visible of its top hits,
+ and modify topvisible: if we do a refresh, then we reset it, otherwise we update
+ */
+ bool bSecondLevel = lChild[0]->hitSource >= 0 && lChild[1]->hitSource >= 0;
+ bool bUseUnique = nUnique==nActive-1
+ || (lNew->age <= tophitAgeLimit
+ && nUnique >= (bSecondLevel ? (int)(0.5 + tophits2Refresh * tophits->q)
+ : (int)(0.5 + tophits->m * tophitsRefresh) ));
+ if (bUseUnique && verbose > 2)
+ fprintf(stderr,"Top hits for %d from combined %d nActive=%d tophitsage %d %s\n",
+ newnode,nUnique,nActive,lNew->age,
+ bSecondLevel ? "2ndlevel" : "1stlevel");
+
+ if (!bUseUnique
+ && bSecondLevel
+ && lNew->age <= tophitAgeLimit) {
+ int source = ActiveAncestor(NJ, lChild[0]->hitSource);
+ if (source == newnode)
+ source = ActiveAncestor(NJ, lChild[1]->hitSource);
+ /* In parallel mode, it is possible that we would select a node as the
+ hit-source and then over-write that top hit with a short list.
+ So we need this sanity check.
+ */
+ if (source != newnode
+ && source >= 0
+ && tophits->top_hits_lists[source].hitSource < 0) {
+
+ /* switch from 2nd-level to 1st-level top hits -- compute top hits list
+ of node from what we have so far plus the active source plus its top hits */
+ top_hits_list_t *lSource = &tophits->top_hits_lists[source];
+ assert(lSource->hitSource < 0);
+ assert(lSource->nHits > 0);
+ int nMerge = 1 + lSource->nHits + nUnique;
+ besthit_t *mergeList = mymalloc(sizeof(besthit_t) * nMerge);
+ memcpy(/*to*/mergeList, /*from*/uniqueList, nUnique * sizeof(besthit_t));
+
+ int iMerge = nUnique;
+ mergeList[iMerge].i = newnode;
+ mergeList[iMerge].j = source;
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/&mergeList[iMerge]);
+ iMerge++;
+ HitsToBestHits(lSource->hits, lSource->nHits, newnode, /*OUT*/mergeList+iMerge);
+ for (i = 0; i < lSource->nHits; i++) {
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/&mergeList[iMerge]);
+ iMerge++;
+ }
+ assert(iMerge == nMerge);
+
+ uniqueList = myfree(uniqueList, nUniqueAlloc * sizeof(besthit_t));
+ uniqueList = UniqueBestHits(/*IN/UPDATE*/NJ, nActive,
+ /*IN/SORT*/mergeList,
+ nMerge,
+ /*OUT*/&nUnique);
+ nUniqueAlloc = nMerge;
+ mergeList = myfree(mergeList, sizeof(besthit_t)*nMerge);
+
+ assert(nUnique > 0);
+ bUseUnique = nUnique >= (int)(0.5 + tophits->m * tophitsRefresh);
+ bSecondLevel = false;
+
+ if (bUseUnique && verbose > 2)
+ fprintf(stderr, "Top hits for %d from children and source %d's %d hits, nUnique %d\n",
+ newnode, source, lSource->nHits, nUnique);
+ }
+ }
+
+ if (bUseUnique) {
+ if (bSecondLevel) {
+ /* pick arbitrarily */
+ lNew->hitSource = lChild[0]->hitSource;
+ }
+ int nSave = MIN(nUnique, bSecondLevel ? tophits->q : tophits->m);
+ assert(nSave>0);
+ if (verbose > 2)
+ fprintf(stderr, "Combined %d ops so far %ld\n", nUnique, profileOps - startProfileOps);
+ SortSaveBestHits(newnode, /*IN/SORT*/uniqueList, /*nIn*/nUnique,
+ /*nOut*/nSave, /*IN/OUT*/tophits);
+ assert(lNew->hits != NULL); /* set by sort/save */
+ tophits->visible[newnode] = lNew->hits[0];
+ UpdateTopVisible(/*IN*/NJ, nActive, newnode, &tophits->visible[newnode],
+ /*IN/OUT*/tophits);
+ UpdateVisible(/*IN/UPDATE*/NJ, nActive, /*IN*/uniqueList, nSave, /*IN/OUT*/tophits);
+ } else {
+ /* need to refresh: set top hits for node and for its top hits */
+ if(verbose > 2) fprintf(stderr,"Top hits for %d by refresh (%d unique age %d) nActive=%d\n",
+ newnode,nUnique,lNew->age,nActive);
+ nRefreshTopHits++;
+ lNew->age = 0;
+
+ int iNode;
+ /* ensure all out-distances are up to date ahead of time
+ to avoid any data overwriting issues.
+ */
+#ifdef OPENMP
+ #pragma omp parallel for schedule(dynamic, 50)
+#endif
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ if (NJ->parent[iNode] < 0) {
+ if (fastest) {
+ besthit_t bh;
+ bh.i = iNode;
+ bh.j = iNode;
+ bh.dist = 0;
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, &bh);
+ } else {
+ SetOutDistance(/*IN/UDPATE*/NJ, iNode, nActive);
+ }
+ }
+ }
+
+ /* exhaustively get the best 2*m hits for newnode, set visible, and save the top m */
+ besthit_t *allhits = (besthit_t*)mymalloc(sizeof(besthit_t)*NJ->maxnode);
+ assert(2 * tophits->m <= NJ->maxnode);
+ besthit_t bh;
+ SetBestHit(newnode, NJ, nActive, /*OUT*/&bh, /*OUT*/allhits);
+ qsort(/*IN/OUT*/allhits, NJ->maxnode, sizeof(besthit_t), CompareHitsByCriterion);
+ SortSaveBestHits(newnode, /*IN/SORT*/allhits, /*nIn*/NJ->maxnode,
+ /*nOut*/tophits->m, /*IN/OUT*/tophits);
+
+ /* Do not need to call UpdateVisible because we set visible below */
+
+ /* And use the top 2*m entries to expand other best-hit lists, but only for top m */
+ int iHit;
+#ifdef OPENMP
+ #pragma omp parallel for schedule(dynamic, 50)
+#endif
+ for (iHit=0; iHit < tophits->m; iHit++) {
+ if (allhits[iHit].i < 0) continue;
+ int iNode = allhits[iHit].j;
+ assert(iNode>=0);
+ if (NJ->parent[iNode] >= 0) continue;
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ int nHitsOld = l->nHits;
+ assert(nHitsOld <= tophits->m);
+ l->age = 0;
+
+ /* Merge: old hits into 0->nHitsOld and hits from iNode above that */
+ besthit_t *bothList = (besthit_t*)mymalloc(sizeof(besthit_t) * 3 * tophits->m);
+ HitsToBestHits(/*IN*/l->hits, nHitsOld, iNode, /*OUT*/bothList); /* does not compute criterion */
+ for (i = 0; i < nHitsOld; i++)
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/&bothList[i]);
+ if (nActive <= 2 * tophits->m)
+ l->hitSource = -1; /* abandon the 2nd-level top-hits heuristic */
+ int nNewHits = l->hitSource >= 0 ? tophits->q : tophits->m;
+ assert(nNewHits > 0);
+
+ TransferBestHits(/*IN/UPDATE*/NJ, nActive, iNode,
+ /*IN*/allhits, /*nOldHits*/2 * nNewHits,
+ /*OUT*/&bothList[nHitsOld],
+ /*updateDist*/false); /* rely on UniqueBestHits to update dist and/or criterion */
+ int nUnique2;
+ besthit_t *uniqueList2 = UniqueBestHits(/*IN/UPDATE*/NJ, nActive,
+ /*IN/SORT*/bothList, nHitsOld + 2 * nNewHits,
+ /*OUT*/&nUnique2);
+ assert(nUnique2 > 0);
+ bothList = myfree(bothList,3 * tophits->m * sizeof(besthit_t));
+
+ /* Note this will overwrite l, but we saved nHitsOld */
+ SortSaveBestHits(iNode, /*IN/SORT*/uniqueList2, /*nIn*/nUnique2,
+ /*nOut*/nNewHits, /*IN/OUT*/tophits);
+ /* will update topvisible below */
+ tophits->visible[iNode] = tophits->top_hits_lists[iNode].hits[0];
+ uniqueList2 = myfree(uniqueList2, (nHitsOld + 2 * tophits->m) * sizeof(besthit_t));
+ }
+
+ ResetTopVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits); /* outside of the parallel phase */
+ allhits = myfree(allhits,sizeof(besthit_t)*NJ->maxnode);
+ }
+ uniqueList = myfree(uniqueList, nUniqueAlloc * sizeof(besthit_t));
+ if (verbose > 2) {
+ fprintf(stderr, "New top-hit list for %d profile-ops %ld (out-ops %ld): source %d age %d members ",
+ newnode,
+ profileOps - startProfileOps,
+ outprofileOps - startOutProfileOps,
+ lNew->hitSource, lNew->age);
+
+ int i;
+ for (i = 0; i < lNew->nHits; i++)
+ fprintf(stderr, " %d", lNew->hits[i].j);
+ fprintf(stderr,"\n");
+ }
+}
+
+void UpdateVisible(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN*/besthit_t *tophitsNode,
+ int nTopHits,
+ /*IN/OUT*/top_hits_t *tophits) {
+ int iHit;
+
+ for(iHit = 0; iHit < nTopHits; iHit++) {
+ besthit_t *hit = &tophitsNode[iHit];
+ if (hit->i < 0) continue; /* possible empty entries */
+ assert(NJ->parent[hit->i] < 0);
+ assert(hit->j >= 0 && NJ->parent[hit->j] < 0);
+ besthit_t visible;
+ bool bSuccess = GetVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits, hit->j, /*OUT*/&visible);
+ if (!bSuccess || hit->criterion < visible.criterion) {
+ if (bSuccess)
+ nVisibleUpdate++;
+ hit_t *v = &tophits->visible[hit->j];
+ v->j = hit->i;
+ v->dist = hit->dist;
+ UpdateTopVisible(NJ, nActive, hit->j, v, /*IN/OUT*/tophits);
+ if(verbose>5) fprintf(stderr,"NewVisible %d %d %f\n",
+ hit->j,v->j,v->dist);
+ }
+ } /* end loop over hits */
+}
+
+/* Update the top-visible list to perhaps include visible[iNode] */
+void UpdateTopVisible(/*IN*/NJ_t * NJ, int nActive,
+ int iIn, /*IN*/hit_t *hit,
+ /*IN/OUT*/top_hits_t *tophits) {
+ assert(tophits != NULL);
+ bool bIn = false; /* placed in the list */
+ int i;
+
+ /* First, if the list is not full, put it in somewhere */
+ for (i = 0; i < tophits->nTopVisible && !bIn; i++) {
+ int iNode = tophits->topvisible[i];
+ if (iNode == iIn) {
+ /* this node is already in the top hit list */
+ bIn = true;
+ } else if (iNode < 0 || NJ->parent[iNode] >= 0) {
+ /* found an empty spot */
+ bIn = true;
+ tophits->topvisible[i] = iIn;
+ }
+ }
+
+ int iPosWorst = -1;
+ double dCriterionWorst = -1e20;
+ if (!bIn) {
+ /* Search for the worst hit */
+ for (i = 0; i < tophits->nTopVisible && !bIn; i++) {
+ int iNode = tophits->topvisible[i];
+ assert(iNode >= 0 && NJ->parent[iNode] < 0 && iNode != iIn);
+ besthit_t visible;
+ if (!GetVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits, iNode, /*OUT*/&visible)) {
+ /* found an empty spot */
+ tophits->topvisible[i] = iIn;
+ bIn = true;
+ } else if (visible.i == hit->j && visible.j == iIn) {
+ /* the reverse hit is already in the top hit list */
+ bIn = true;
+ } else if (visible.criterion >= dCriterionWorst) {
+ iPosWorst = i;
+ dCriterionWorst = visible.criterion;
+ }
+ }
+ }
+
+ if (!bIn && iPosWorst >= 0) {
+ besthit_t visible = HitToBestHit(iIn, *hit);
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/&visible);
+ if (visible.criterion < dCriterionWorst) {
+ if (verbose > 2) {
+ int iOld = tophits->topvisible[iPosWorst];
+ fprintf(stderr, "TopVisible replace %d=>%d with %d=>%d\n",
+ iOld, tophits->visible[iOld].j, visible.i, visible.j);
+ }
+ tophits->topvisible[iPosWorst] = iIn;
+ }
+ }
+
+ if (verbose > 2) {
+ fprintf(stderr, "Updated TopVisible: ");
+ for (i = 0; i < tophits->nTopVisible; i++) {
+ int iNode = tophits->topvisible[i];
+ if (iNode >= 0 && NJ->parent[iNode] < 0) {
+ besthit_t bh = HitToBestHit(iNode, tophits->visible[iNode]);
+ SetDistCriterion(NJ, nActive, &bh);
+ fprintf(stderr, " %d=>%d:%.4f", bh.i, bh.j, bh.criterion);
+ }
+ }
+ fprintf(stderr,"\n");
+ }
+}
+
+/* Recompute the topvisible list */
+void ResetTopVisible(/*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ /*IN/OUT*/top_hits_t *tophits) {
+ besthit_t *visibleSorted = mymalloc(sizeof(besthit_t)*nActive);
+ int nVisible = 0; /* #entries in visibleSorted */
+ int iNode;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ /* skip joins involving stale nodes */
+ if (NJ->parent[iNode] >= 0)
+ continue;
+ besthit_t v;
+ if (GetVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits, iNode, /*OUT*/&v)) {
+ assert(nVisible < nActive);
+ visibleSorted[nVisible++] = v;
+ }
+ }
+ assert(nVisible > 0);
+
+ qsort(/*IN/OUT*/visibleSorted,nVisible,sizeof(besthit_t),CompareHitsByCriterion);
+
+ /* Only keep the top m items, and try to avoid duplicating i->j with j->i
+ Note that visible(i) -> j does not necessarily imply visible(j) -> i,
+ so we store what the pairing was (or -1 for not used yet)
+ */
+ int *inTopVisible = malloc(sizeof(int) * NJ->maxnodes);
+ int i;
+ for (i = 0; i < NJ->maxnodes; i++)
+ inTopVisible[i] = -1;
+
+ if (verbose > 2)
+ fprintf(stderr, "top-hit search: nActive %d nVisible %d considering up to %d items\n",
+ nActive, nVisible, tophits->m);
+
+ /* save the sorted indices in topvisible */
+ int iSave = 0;
+ for (i = 0; i < nVisible && iSave < tophits->nTopVisible; i++) {
+ besthit_t *v = &visibleSorted[i];
+ if (inTopVisible[v->i] != v->j) { /* not seen already */
+ tophits->topvisible[iSave++] = v->i;
+ inTopVisible[v->i] = v->j;
+ inTopVisible[v->j] = v->i;
+ }
+ }
+ while(iSave < tophits->nTopVisible)
+ tophits->topvisible[iSave++] = -1;
+ myfree(visibleSorted, sizeof(besthit_t)*nActive);
+ myfree(inTopVisible, sizeof(int) * NJ->maxnodes);
+ tophits->topvisibleAge = 0;
+ if (verbose > 2) {
+ fprintf(stderr, "Reset TopVisible: ");
+ for (i = 0; i < tophits->nTopVisible; i++) {
+ int iNode = tophits->topvisible[i];
+ if (iNode < 0)
+ break;
+ fprintf(stderr, " %d=>%d", iNode, tophits->visible[iNode].j);
+ }
+ fprintf(stderr,"\n");
+ }
+}
+
+/*
+ Find best hit to do in O(N*log(N) + m*L*log(N)) time, by
+ copying and sorting the visible list
+ updating out-distances for the top (up to m) candidates
+ selecting the best hit
+ if !fastest then
+ local hill-climbing for a better join,
+ using best-hit lists only, and updating
+ all out-distances in every best-hit list
+*/
+void TopHitNJSearch(/*IN/UPDATE*/NJ_t *NJ, int nActive,
+ /*IN/OUT*/top_hits_t *tophits,
+ /*OUT*/besthit_t *join) {
+ /* first, do we have at least m/2 candidates in topvisible?
+ And remember the best one */
+ int nCandidate = 0;
+ int iNodeBestCandidate = -1;
+ double dBestCriterion = 1e20;
+
+ int i;
+ for (i = 0; i < tophits->nTopVisible; i++) {
+ int iNode = tophits->topvisible[i];
+ besthit_t visible;
+ if (GetVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits, iNode, /*OUT*/&visible)) {
+ nCandidate++;
+ if (iNodeBestCandidate < 0 || visible.criterion < dBestCriterion) {
+ iNodeBestCandidate = iNode;
+ dBestCriterion = visible.criterion;
+ }
+ }
+ }
+
+ tophits->topvisibleAge++;
+ /* Note we may have only nActive/2 joins b/c we try to store them once */
+ if (2 * tophits->topvisibleAge > tophits->m
+ || (3*nCandidate < tophits->nTopVisible && 3*nCandidate < nActive)) {
+ /* recompute top visible */
+ if (verbose > 2)
+ fprintf(stderr, "Resetting the top-visible list at nActive=%d\n",nActive);
+
+ /* If age is low, then our visible set is becoming too sparse, because we have
+ recently recomputed the top visible subset. This is very rare but can happen
+ with -fastest. A quick-and-dirty solution is to walk up
+ the parents to get additional entries in top hit lists. To ensure that the
+ visible set becomes full, pick an arbitrary node if walking up terminates at self.
+ */
+ if (tophits->topvisibleAge <= 2) {
+ if (verbose > 2)
+ fprintf(stderr, "Expanding visible set by walking up to active nodes at nActive=%d\n", nActive);
+ int iNode;
+ for (iNode = 0; iNode < NJ->maxnode; iNode++) {
+ if (NJ->parent[iNode] >= 0)
+ continue;
+ hit_t *v = &tophits->visible[iNode];
+ int newj = ActiveAncestor(NJ, v->j);
+ if (newj >= 0 && newj != v->j) {
+ if (newj == iNode) {
+ /* pick arbitrarily */
+ newj = 0;
+ while (NJ->parent[newj] >= 0 || newj == iNode)
+ newj++;
+ }
+ assert(newj >= 0 && newj < NJ->maxnodes
+ && newj != iNode
+ && NJ->parent[newj] < 0);
+
+ /* Set v to point to newj */
+ besthit_t bh = { iNode, newj, -1e20, -1e20, -1e20 };
+ SetDistCriterion(NJ, nActive, /*IN/OUT*/&bh);
+ v->j = newj;
+ v->dist = bh.dist;
+ }
+ }
+ }
+ ResetTopVisible(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/tophits);
+ /* and recurse to try again */
+ TopHitNJSearch(NJ, nActive, tophits, join);
+ return;
+ }
+ if (verbose > 2)
+ fprintf(stderr, "Top-visible list size %d (nActive %d m %d)\n",
+ nCandidate, nActive, tophits->m);
+ assert(iNodeBestCandidate >= 0 && NJ->parent[iNodeBestCandidate] < 0);
+ bool bSuccess = GetVisible(NJ, nActive, tophits, iNodeBestCandidate, /*OUT*/join);
+ assert(bSuccess);
+ assert(join->i >= 0 && NJ->parent[join->i] < 0);
+ assert(join->j >= 0 && NJ->parent[join->j] < 0);
+
+ if(fastest)
+ return;
+
+ int changed;
+ do {
+ changed = 0;
+
+ besthit_t bestI;
+ GetBestFromTopHits(join->i, NJ, nActive, tophits, /*OUT*/&bestI);
+ assert(bestI.i == join->i);
+ if (bestI.j != join->j && bestI.criterion < join->criterion) {
+ changed = 1;
+ if (verbose>2)
+ fprintf(stderr,"BetterI\t%d\t%d\t%d\t%d\t%f\t%f\n",
+ join->i,join->j,bestI.i,bestI.j,
+ join->criterion,bestI.criterion);
+ *join = bestI;
+ }
+
+ besthit_t bestJ;
+ GetBestFromTopHits(join->j, NJ, nActive, tophits, /*OUT*/&bestJ);
+ assert(bestJ.i == join->j);
+ if (bestJ.j != join->i && bestJ.criterion < join->criterion) {
+ changed = 1;
+ if (verbose>2)
+ fprintf(stderr,"BetterJ\t%d\t%d\t%d\t%d\t%f\t%f\n",
+ join->i,join->j,bestJ.i,bestJ.j,
+ join->criterion,bestJ.criterion);
+ *join = bestJ;
+ }
+ if(changed) nHillBetter++;
+ } while(changed);
+}
+
+int NGaps(/*IN*/NJ_t *NJ, int iNode) {
+ assert(iNode < NJ->nSeq);
+ int nGaps = 0;
+ int p;
+ for(p=0; p<NJ->nPos; p++) {
+ if (NJ->profiles[iNode]->codes[p] == NOCODE)
+ nGaps++;
+ }
+ return(nGaps);
+}
+
+int CompareHitsByCriterion(const void *c1, const void *c2) {
+ const besthit_t *hit1 = (besthit_t*)c1;
+ const besthit_t *hit2 = (besthit_t*)c2;
+ if (hit1->criterion < hit2->criterion) return(-1);
+ if (hit1->criterion > hit2->criterion) return(1);
+ return(0);
+}
+
+int CompareHitsByIJ(const void *c1, const void *c2) {
+ const besthit_t *hit1 = (besthit_t*)c1;
+ const besthit_t *hit2 = (besthit_t*)c2;
+ return hit1->i != hit2->i ? hit1->i - hit2->i : hit1->j - hit2->j;
+}
+
+void SortSaveBestHits(int iNode, /*IN/SORT*/besthit_t *besthits,
+ int nIn, int nOut,
+ /*IN/OUT*/top_hits_t *tophits) {
+ assert(nIn > 0);
+ assert(nOut > 0);
+ top_hits_list_t *l = &tophits->top_hits_lists[iNode];
+ /* */
+ qsort(/*IN/OUT*/besthits,nIn,sizeof(besthit_t),CompareHitsByCriterion);
+
+ /* First count how many we will save
+ Not sure if removing duplicates is actually necessary.
+ */
+ int nSave = 0;
+ int jLast = -1;
+ int iBest;
+ for (iBest = 0; iBest < nIn && nSave < nOut; iBest++) {
+ if (besthits[iBest].i < 0)
+ continue;
+ assert(besthits[iBest].i == iNode);
+ int j = besthits[iBest].j;
+ if (j != iNode && j != jLast && j >= 0) {
+ nSave++;
+ jLast = j;
+ }
+ }
+
+ assert(nSave > 0);
+
+#ifdef OPENMP
+ omp_set_lock(&tophits->locks[iNode]);
+#endif
+ if (l->hits != NULL) {
+ l->hits = myfree(l->hits, l->nHits * sizeof(hit_t));
+ l->nHits = 0;
+ }
+ l->hits = mymalloc(sizeof(hit_t) * nSave);
+ l->nHits = nSave;
+ int iSave = 0;
+ jLast = -1;
+ for (iBest = 0; iBest < nIn && iSave < nSave; iBest++) {
+ int j = besthits[iBest].j;
+ if (j != iNode && j != jLast && j >= 0) {
+ l->hits[iSave].j = j;
+ l->hits[iSave].dist = besthits[iBest].dist;
+ iSave++;
+ jLast = j;
+ }
+ }
+#ifdef OPENMP
+ omp_unset_lock(&tophits->locks[iNode]);
+#endif
+ assert(iSave == nSave);
+}
+
+void TransferBestHits(/*IN/UPDATE*/NJ_t *NJ,
+ int nActive,
+ int iNode,
+ /*IN*/besthit_t *oldhits,
+ int nOldHits,
+ /*OUT*/besthit_t *newhits,
+ bool updateDistances) {
+ assert(iNode >= 0);
+ assert(NJ->parent[iNode] < 0);
+
+ int iBest;
+ for(iBest = 0; iBest < nOldHits; iBest++) {
+ besthit_t *old = &oldhits[iBest];
+ besthit_t *new = &newhits[iBest];
+ new->i = iNode;
+ new->j = ActiveAncestor(/*IN*/NJ, old->j);
+ new->dist = old->dist; /* may get reset below */
+ new->weight = old->weight;
+ new->criterion = old->criterion;
+
+ if(new->j < 0 || new->j == iNode) {
+ new->weight = 0;
+ new->dist = -1e20;
+ new->criterion = 1e20;
+ } else if (new->i != old->i || new->j != old->j) {
+ if (updateDistances)
+ SetDistCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/new);
+ else {
+ new->dist = -1e20;
+ new->criterion = 1e20;
+ }
+ } else {
+ if (updateDistances)
+ SetCriterion(/*IN/UPDATE*/NJ, nActive, /*IN/OUT*/new);
+ else
+ new->criterion = 1e20; /* leave dist alone */
+ }
+ }
+}
+
+void HitsToBestHits(/*IN*/hit_t *hits, int nHits, int iNode, /*OUT*/besthit_t *newhits) {
+ int i;
+ for (i = 0; i < nHits; i++) {
+ hit_t *hit = &hits[i];
+ besthit_t *bh = &newhits[i];
+ bh->i = iNode;
+ bh->j = hit->j;
+ bh->dist = hit->dist;
+ bh->criterion = 1e20;
+ bh->weight = -1; /* not the true value -- we compute these directly when needed */
+ }
+}
+
+besthit_t HitToBestHit(int i, hit_t hit) {
+ besthit_t bh;
+ bh.i = i;
+ bh.j = hit.j;
+ bh.dist = hit.dist;
+ bh.criterion = 1e20;
+ bh.weight = -1;
+ return(bh);
+}
+
+char *OpenMPString(void) {
+#ifdef OPENMP
+ static char buf[100];
+ sprintf(buf, ", OpenMP (%d threads)", omp_get_max_threads());
+ return(buf);
+#else
+ return("");
+#endif
+}
+
+/* Algorithm 26.2.17 from Abromowitz and Stegun, Handbook of Mathematical Functions
+ Absolute accuracy of only about 1e-7, which is enough for us
+*/
+double pnorm(double x)
+{
+ double b1 = 0.319381530;
+ double b2 = -0.356563782;
+ double b3 = 1.781477937;
+ double b4 = -1.821255978;
+ double b5 = 1.330274429;
+ double p = 0.2316419;
+ double c = 0.39894228;
+
+ if(x >= 0.0) {
+ double t = 1.0 / ( 1.0 + p * x );
+ return (1.0 - c * exp( -x * x / 2.0 ) * t *
+ ( t *( t * ( t * ( t * b5 + b4 ) + b3 ) + b2 ) + b1 ));
+ }
+ /*else*/
+ double t = 1.0 / ( 1.0 - p * x );
+ return ( c * exp( -x * x / 2.0 ) * t *
+ ( t *( t * ( t * ( t * b5 + b4 ) + b3 ) + b2 ) + b1 ));
+}
+
+void *mymalloc(size_t sz) {
+ if (sz == 0) return(NULL);
+ void *new = malloc(sz);
+ if (new == NULL) {
+ fprintf(stderr, "Out of memory\n");
+ exit(1);
+ }
+ szAllAlloc += sz;
+ mymallocUsed += sz;
+#ifdef TRACK_MEMORY
+ struct mallinfo mi = mallinfo();
+ if (mi.arena+mi.hblkhd > maxmallocHeap)
+ maxmallocHeap = mi.arena+mi.hblkhd;
+#endif
+ /* gcc malloc should always return 16-byte-aligned values... */
+ assert(IS_ALIGNED(new));
+ return (new);
+}
+
+void *mymemdup(void *data, size_t sz) {
+ if(data==NULL) return(NULL);
+ void *new = mymalloc(sz);
+ memcpy(/*to*/new, /*from*/data, sz);
+ return(new);
+}
+
+void *myrealloc(void *data, size_t szOld, size_t szNew, bool bCopy) {
+ if (data == NULL && szOld == 0)
+ return(mymalloc(szNew));
+ if (data == NULL || szOld == 0 || szNew == 0) {
+ fprintf(stderr,"Empty myrealloc\n");
+ exit(1);
+ }
+ if (szOld == szNew)
+ return(data);
+ void *new = NULL;
+ if (bCopy) {
+ /* Try to reduce memory fragmentation by allocating anew and copying
+ Seems to help in practice */
+ new = mymemdup(data, szNew);
+ myfree(data, szOld);
+ } else {
+ new = realloc(data,szNew);
+ if (new == NULL) {
+ fprintf(stderr, "Out of memory\n");
+ exit(1);
+ }
+ assert(IS_ALIGNED(new));
+ szAllAlloc += (szNew-szOld);
+ mymallocUsed += (szNew-szOld);
+#ifdef TRACK_MEMORY
+ struct mallinfo mi = mallinfo();
+ if (mi.arena+mi.hblkhd > maxmallocHeap)
+ maxmallocHeap = mi.arena+mi.hblkhd;
+#endif
+ }
+ return(new);
+}
+
+void *myfree(void *p, size_t sz) {
+ if(p==NULL) return(NULL);
+ free(p);
+ mymallocUsed -= sz;
+ return(NULL);
+}
+
+/******************************************************************************/
+/* Minimization of a 1-dimensional function by Brent's method (Numerical Recipes)
+ * Borrowed from Tree-Puzzle 5.1 util.c under GPL
+ * Modified by M.N.P to pass in the accessory data for the optimization function,
+ * to use 2x bounds around the starting guess and expand them if necessary,
+ * and to use both a fractional and an absolute tolerance
+ */
+
+#define ITMAX 100
+#define CGOLD 0.3819660
+#define TINY 1.0e-20
+#define ZEPS 1.0e-10
+#define SHFT(a,b,c,d) (a)=(b);(b)=(c);(c)=(d);
+#define SIGN(a,b) ((b) >= 0.0 ? fabs(a) : -fabs(a))
+
+/* Brents method in one dimension */
+double brent(double ax, double bx, double cx, double (*f)(double, void *), void *data,
+ double ftol, double atol,
+ double *foptx, double *f2optx, double fax, double fbx, double fcx)
+{
+ int iter;
+ double a,b,d=0,etemp,fu,fv,fw,fx,p,q,r,tol1,tol2,u,v,w,x,xm;
+ double xw,wv,vx;
+ double e=0.0;
+
+ a=(ax < cx ? ax : cx);
+ b=(ax > cx ? ax : cx);
+ x=bx;
+ fx=fbx;
+ if (fax < fcx) {
+ w=ax;
+ fw=fax;
+ v=cx;
+ fv=fcx;
+ } else {
+ w=cx;
+ fw=fcx;
+ v=ax;
+ fv=fax;
+ }
+ for (iter=1;iter<=ITMAX;iter++) {
+ xm=0.5*(a+b);
+ tol1=ftol*fabs(x);
+ tol2=2.0*(tol1+ZEPS);
+ if (fabs(x-xm) <= (tol2-0.5*(b-a))
+ || fabs(a-b) < atol) {
+ *foptx = fx;
+ xw = x-w;
+ wv = w-v;
+ vx = v-x;
+ *f2optx = 2.0*(fv*xw + fx*wv + fw*vx)/
+ (v*v*xw + x*x*wv + w*w*vx);
+ return x;
+ }
+ if (fabs(e) > tol1) {
+ r=(x-w)*(fx-fv);
+ q=(x-v)*(fx-fw);
+ p=(x-v)*q-(x-w)*r;
+ q=2.0*(q-r);
+ if (q > 0.0) p = -p;
+ q=fabs(q);
+ etemp=e;
+ e=d;
+ if (fabs(p) >= fabs(0.5*q*etemp) || p <= q*(a-x) || p >= q*(b-x))
+ d=CGOLD*(e=(x >= xm ? a-x : b-x));
+ else {
+ d=p/q;
+ u=x+d;
+ if (u-a < tol2 || b-u < tol2)
+ d=SIGN(tol1,xm-x);
+ }
+ } else {
+ d=CGOLD*(e=(x >= xm ? a-x : b-x));
+ }
+ u=(fabs(d) >= tol1 ? x+d : x+SIGN(tol1,d));
+ fu=(*f)(u,data);
+ if (fu <= fx) {
+ if (u >= x) a=x; else b=x;
+ SHFT(v,w,x,u)
+ SHFT(fv,fw,fx,fu)
+ } else {
+ if (u < x) a=u; else b=u;
+ if (fu <= fw || w == x) {
+ v=w;
+ w=u;
+ fv=fw;
+ fw=fu;
+ } else if (fu <= fv || v == x || v == w) {
+ v=u;
+ fv=fu;
+ }
+ }
+ }
+ *foptx = fx;
+ xw = x-w;
+ wv = w-v;
+ vx = v-x;
+ *f2optx = 2.0*(fv*xw + fx*wv + fw*vx)/
+ (v*v*xw + x*x*wv + w*w*vx);
+ return x;
+} /* brent */
+#undef ITMAX
+#undef CGOLD
+#undef ZEPS
+#undef SHFT
+#undef SIGN
+
+/* one-dimensional minimization - as input a lower and an upper limit and a trial
+ value for the minimum is needed: xmin < xguess < xmax
+ the function and a fractional tolerance has to be specified
+ onedimenmin returns the optimal x value and the value of the function
+ and its second derivative at this point
+ */
+double onedimenmin(double xmin, double xguess, double xmax, double (*f)(double,void*), void *data,
+ double ftol, double atol,
+ /*OUT*/double *fx, /*OUT*/double *f2x)
+{
+ double optx, ax, bx, cx, fa, fb, fc;
+
+ /* first attempt to bracketize minimum */
+ if (xguess == xmin) {
+ ax = xmin;
+ bx = 2.0*xguess;
+ cx = 10.0*xguess;
+ } else if (xguess <= 2.0 * xmin) {
+ ax = xmin;
+ bx = xguess;
+ cx = 5.0*xguess;
+ } else {
+ ax = 0.5*xguess;
+ bx = xguess;
+ cx = 2.0*xguess;
+ }
+ if (cx > xmax)
+ cx = xmax;
+ if (bx >= cx)
+ bx = 0.5*(ax+cx);
+ if (verbose > 4)
+ fprintf(stderr, "onedimenmin lo %.4f guess %.4f hi %.4f range %.4f %.4f\n",
+ ax, bx, cx, xmin, xmax);
+ /* ideally this range includes the true minimum, i.e.,
+ fb < fa and fb < fc
+ if not, we gradually expand the boundaries until it does,
+ or we near the boundary of the allowed range and use that
+ */
+ fa = (*f)(ax,data);
+ fb = (*f)(bx,data);
+ fc = (*f)(cx,data);
+ while(fa < fb && ax > xmin) {
+ ax = (ax+xmin)/2.0;
+ if (ax < 2.0*xmin) /* give up on shrinking the region */
+ ax = xmin;
+ fa = (*f)(ax,data);
+ }
+ while(fc < fb && cx < xmax) {
+ cx = (cx+xmax)/2.0;
+ if (cx > xmax * 0.95)
+ cx = xmax;
+ fc = (*f)(cx,data);
+ }
+ optx = brent(ax, bx, cx, f, data, ftol, atol, fx, f2x, fa, fb, fc);
+
+ if (verbose > 4)
+ fprintf(stderr, "onedimenmin reaches optimum f(%.4f) = %.4f f2x %.4f\n", optx, *fx, *f2x);
+ return optx; /* return optimal x */
+} /* onedimenmin */
+
+/* Numerical code for the gamma distribution is modified from the PhyML 3 code
+ (GNU public license) of Stephane Guindon
+*/
+
+double LnGamma (double alpha)
+{
+/* returns ln(gamma(alpha)) for alpha>0, accurate to 10 decimal places.
+ Stirling's formula is used for the central polynomial part of the procedure.
+ Pike MC & Hill ID (1966) Algorithm 291: Logarithm of the gamma function.
+ Communications of the Association for Computing Machinery, 9:684
+*/
+ double x=alpha, f=0, z;
+ if (x<7) {
+ f=1; z=x-1;
+ while (++z<7) f*=z;
+ x=z; f=-(double)log(f);
+ }
+ z = 1/(x*x);
+ return f + (x-0.5)*(double)log(x) - x + .918938533204673
+ + (((-.000595238095238*z+.000793650793651)*z-.002777777777778)*z
+ +.083333333333333)/x;
+}
+
+double IncompleteGamma(double x, double alpha, double ln_gamma_alpha)
+{
+/* returns the incomplete gamma ratio I(x,alpha) where x is the upper
+ limit of the integration and alpha is the shape parameter.
+ returns (-1) if in error
+ ln_gamma_alpha = ln(Gamma(alpha)), is almost redundant.
+ (1) series expansion if (alpha>x || x<=1)
+ (2) continued fraction otherwise
+ RATNEST FORTRAN by
+ Bhattacharjee GP (1970) The incomplete gamma integral. Applied Statistics,
+ 19: 285-287 (AS32)
+*/
+ int i;
+ double p=alpha, g=ln_gamma_alpha;
+ double accurate=1e-8, overflow=1e30;
+ double factor, gin=0, rn=0, a=0,b=0,an=0,dif=0, term=0, pn[6];
+
+ if (x==0) return (0);
+ if (x<0 || p<=0) return (-1);
+
+ factor=(double)exp(p*(double)log(x)-x-g);
+ if (x>1 && x>=p) goto l30;
+ /* (1) series expansion */
+ gin=1; term=1; rn=p;
+ l20:
+ rn++;
+ term*=x/rn; gin+=term;
+
+ if (term > accurate) goto l20;
+ gin*=factor/p;
+ goto l50;
+ l30:
+ /* (2) continued fraction */
+ a=1-p; b=a+x+1; term=0;
+ pn[0]=1; pn[1]=x; pn[2]=x+1; pn[3]=x*b;
+ gin=pn[2]/pn[3];
+ l32:
+ a++; b+=2; term++; an=a*term;
+ for (i=0; i<2; i++) pn[i+4]=b*pn[i+2]-an*pn[i];
+ if (pn[5] == 0) goto l35;
+ rn=pn[4]/pn[5]; dif=fabs(gin-rn);
+ if (dif>accurate) goto l34;
+ if (dif<=accurate*rn) goto l42;
+ l34:
+ gin=rn;
+ l35:
+ for (i=0; i<4; i++) pn[i]=pn[i+2];
+ if (fabs(pn[4]) < overflow) goto l32;
+ for (i=0; i<4; i++) pn[i]/=overflow;
+ goto l32;
+ l42:
+ gin=1-factor*gin;
+
+ l50:
+ return (gin);
+}
+
+double PGamma(double x, double alpha)
+{
+ /* scale = 1/alpha */
+ return IncompleteGamma(x*alpha,alpha,LnGamma(alpha));
+}
+
+/* helper function to subtract timval structures */
+/* Subtract the `struct timeval' values X and Y,
+ storing the result in RESULT.
+ Return 1 if the difference is negative, otherwise 0. */
+int timeval_subtract (struct timeval *result, struct timeval *x, struct timeval *y)
+{
+ /* Perform the carry for the later subtraction by updating y. */
+ if (x->tv_usec < y->tv_usec) {
+ int nsec = (y->tv_usec - x->tv_usec) / 1000000 + 1;
+ y->tv_usec -= 1000000 * nsec;
+ y->tv_sec += nsec;
+ }
+ if (x->tv_usec - y->tv_usec > 1000000) {
+ int nsec = (x->tv_usec - y->tv_usec) / 1000000;
+ y->tv_usec += 1000000 * nsec;
+ y->tv_sec -= nsec;
+ }
+
+ /* Compute the time remaining to wait.
+ tv_usec is certainly positive. */
+ result->tv_sec = x->tv_sec - y->tv_sec;
+ result->tv_usec = x->tv_usec - y->tv_usec;
+
+ /* Return 1 if result is negative. */
+ return x->tv_sec < y->tv_sec;
+}
+
+double clockDiff(/*IN*/struct timeval *clock_start) {
+ struct timeval time_now, elapsed;
+ gettimeofday(/*OUT*/&time_now,NULL);
+ timeval_subtract(/*OUT*/&elapsed,/*IN*/&time_now,/*IN*/clock_start);
+ return(elapsed.tv_sec + elapsed.tv_usec*1e-6);
+}
+
+
+/* The random number generator is taken from D E Knuth
+ http://www-cs-faculty.stanford.edu/~knuth/taocp.html
+*/
+
+/* This program by D E Knuth is in the public domain and freely copyable.
+ * It is explained in Seminumerical Algorithms, 3rd edition, Section 3.6
+ * (or in the errata to the 2nd edition --- see
+ * http://www-cs-faculty.stanford.edu/~knuth/taocp.html
+ * in the changes to Volume 2 on pages 171 and following). */
+
+/* N.B. The MODIFICATIONS introduced in the 9th printing (2002) are
+ included here; there's no backwards compatibility with the original. */
+
+/* This version also adopts Brendan McKay's suggestion to
+ accommodate naive users who forget to call ran_start(seed). */
+
+/* If you find any bugs, please report them immediately to
+ * taocp@cs.stanford.edu
+ * (and you will be rewarded if the bug is genuine). Thanks! */
+
+/************ see the book for explanations and caveats! *******************/
+/************ in particular, you need two's complement arithmetic **********/
+
+#define KK 100 /* the long lag */
+#define LL 37 /* the short lag */
+#define MM (1L<<30) /* the modulus */
+#define mod_diff(x,y) (((x)-(y))&(MM-1)) /* subtraction mod MM */
+
+long ran_x[KK]; /* the generator state */
+
+#ifdef __STDC__
+void ran_array(long aa[],int n)
+#else
+ void ran_array(aa,n) /* put n new random numbers in aa */
+ long *aa; /* destination */
+ int n; /* array length (must be at least KK) */
+#endif
+{
+ register int i,j;
+ for (j=0;j<KK;j++) aa[j]=ran_x[j];
+ for (;j<n;j++) aa[j]=mod_diff(aa[j-KK],aa[j-LL]);
+ for (i=0;i<LL;i++,j++) ran_x[i]=mod_diff(aa[j-KK],aa[j-LL]);
+ for (;i<KK;i++,j++) ran_x[i]=mod_diff(aa[j-KK],ran_x[i-LL]);
+}
+
+/* the following routines are from exercise 3.6--15 */
+/* after calling ran_start, get new randoms by, e.g., "x=ran_arr_next()" */
+
+#define QUALITY 1009 /* recommended quality level for high-res use */
+long ran_arr_buf[QUALITY];
+long ran_arr_dummy=-1, ran_arr_started=-1;
+long *ran_arr_ptr=&ran_arr_dummy; /* the next random number, or -1 */
+
+#define TT 70 /* guaranteed separation between streams */
+#define is_odd(x) ((x)&1) /* units bit of x */
+
+#ifdef __STDC__
+void ran_start(long seed)
+#else
+ void ran_start(seed) /* do this before using ran_array */
+ long seed; /* selector for different streams */
+#endif
+{
+ register int t,j;
+ long x[KK+KK-1]; /* the preparation buffer */
+ register long ss=(seed+2)&(MM-2);
+ for (j=0;j<KK;j++) {
+ x[j]=ss; /* bootstrap the buffer */
+ ss<<=1; if (ss>=MM) ss-=MM-2; /* cyclic shift 29 bits */
+ }
+ x[1]++; /* make x[1] (and only x[1]) odd */
+ for (ss=seed&(MM-1),t=TT-1; t; ) {
+ for (j=KK-1;j>0;j--) x[j+j]=x[j], x[j+j-1]=0; /* "square" */
+ for (j=KK+KK-2;j>=KK;j--)
+ x[j-(KK-LL)]=mod_diff(x[j-(KK-LL)],x[j]),
+ x[j-KK]=mod_diff(x[j-KK],x[j]);
+ if (is_odd(ss)) { /* "multiply by z" */
+ for (j=KK;j>0;j--) x[j]=x[j-1];
+ x[0]=x[KK]; /* shift the buffer cyclically */
+ x[LL]=mod_diff(x[LL],x[KK]);
+ }
+ if (ss) ss>>=1; else t--;
+ }
+ for (j=0;j<LL;j++) ran_x[j+KK-LL]=x[j];
+ for (;j<KK;j++) ran_x[j-LL]=x[j];
+ for (j=0;j<10;j++) ran_array(x,KK+KK-1); /* warm things up */
+ ran_arr_ptr=&ran_arr_started;
+}
+
+#define ran_arr_next() (*ran_arr_ptr>=0? *ran_arr_ptr++: ran_arr_cycle())
+long ran_arr_cycle()
+{
+ if (ran_arr_ptr==&ran_arr_dummy)
+ ran_start(314159L); /* the user forgot to initialize */
+ ran_array(ran_arr_buf,QUALITY);
+ ran_arr_buf[KK]=-1;
+ ran_arr_ptr=ran_arr_buf+1;
+ return ran_arr_buf[0];
+}
+
+/* end of code from Knuth */
+
+double knuth_rand() {
+ return(9.31322574615479e-10 * ran_arr_next()); /* multiply by 2**-30 */
+}
+
+hashstrings_t *MakeHashtable(char **strings, int nStrings) {
+ hashstrings_t *hash = (hashstrings_t*)mymalloc(sizeof(hashstrings_t));
+ hash->nBuckets = 8*nStrings;
+ hash->buckets = (hashbucket_t*)mymalloc(sizeof(hashbucket_t) * hash->nBuckets);
+ int i;
+ for (i=0; i < hash->nBuckets; i++) {
+ hash->buckets[i].string = NULL;
+ hash->buckets[i].nCount = 0;
+ hash->buckets[i].first = -1;
+ }
+ for (i=0; i < nStrings; i++) {
+ hashiterator_t hi = FindMatch(hash, strings[i]);
+ if (hash->buckets[hi].string == NULL) {
+ /* save a unique entry */
+ assert(hash->buckets[hi].nCount == 0);
+ hash->buckets[hi].string = strings[i];
+ hash->buckets[hi].nCount = 1;
+ hash->buckets[hi].first = i;
+ } else {
+ /* record a duplicate entry */
+ assert(hash->buckets[hi].string != NULL);
+ assert(strcmp(hash->buckets[hi].string, strings[i]) == 0);
+ assert(hash->buckets[hi].first >= 0);
+ hash->buckets[hi].nCount++;
+ }
+ }
+ return(hash);
+}
+
+hashstrings_t *FreeHashtable(hashstrings_t* hash) {
+ if (hash != NULL) {
+ myfree(hash->buckets, sizeof(hashbucket_t) * hash->nBuckets);
+ myfree(hash, sizeof(hashstrings_t));
+ }
+ return(NULL);
+}
+
+#define MAXADLER 65521
+hashiterator_t FindMatch(hashstrings_t *hash, char *string) {
+ /* Adler-32 checksum */
+ unsigned int hashA = 1;
+ unsigned int hashB = 0;
+ char *p;
+ for (p = string; *p != '\0'; p++) {
+ hashA = ((unsigned int)*p + hashA);
+ hashB = hashA+hashB;
+ }
+ hashA %= MAXADLER;
+ hashB %= MAXADLER;
+ hashiterator_t hi = (hashB*65536+hashA) % hash->nBuckets;
+ while(hash->buckets[hi].string != NULL
+ && strcmp(hash->buckets[hi].string, string) != 0) {
+ hi++;
+ if (hi >= hash->nBuckets)
+ hi = 0;
+ }
+ return(hi);
+}
+
+char *GetHashString(hashstrings_t *hash, hashiterator_t hi) {
+ return(hash->buckets[hi].string);
+}
+
+int HashCount(hashstrings_t *hash, hashiterator_t hi) {
+ return(hash->buckets[hi].nCount);
+}
+
+int HashFirst(hashstrings_t *hash, hashiterator_t hi) {
+ return(hash->buckets[hi].first);
+}
+
+uniquify_t *UniquifyAln(alignment_t *aln) {
+ int nUniqueSeq = 0;
+ char **uniqueSeq = (char**)mymalloc(aln->nSeq * sizeof(char*)); /* iUnique -> seq */
+ int *uniqueFirst = (int*)mymalloc(aln->nSeq * sizeof(int)); /* iUnique -> iFirst in aln */
+ int *alnNext = (int*)mymalloc(aln->nSeq * sizeof(int)); /* i in aln -> next, or -1 */
+ int *alnToUniq = (int*)mymalloc(aln->nSeq * sizeof(int)); /* i in aln -> iUnique; many -> -1 */
+
+ int i;
+ for (i = 0; i < aln->nSeq; i++) {
+ uniqueSeq[i] = NULL;
+ uniqueFirst[i] = -1;
+ alnNext[i] = -1;
+ alnToUniq[i] = -1;
+ }
+ hashstrings_t *hashseqs = MakeHashtable(aln->seqs, aln->nSeq);
+ for (i=0; i<aln->nSeq; i++) {
+ hashiterator_t hi = FindMatch(hashseqs,aln->seqs[i]);
+ int first = HashFirst(hashseqs,hi);
+ if (first == i) {
+ uniqueSeq[nUniqueSeq] = aln->seqs[i];
+ uniqueFirst[nUniqueSeq] = i;
+ alnToUniq[i] = nUniqueSeq;
+ nUniqueSeq++;
+ } else {
+ int last = first;
+ while (alnNext[last] != -1)
+ last = alnNext[last];
+ assert(last>=0);
+ alnNext[last] = i;
+ assert(alnToUniq[last] >= 0 && alnToUniq[last] < nUniqueSeq);
+ alnToUniq[i] = alnToUniq[last];
+ }
+ }
+ assert(nUniqueSeq>0);
+ hashseqs = FreeHashtable(hashseqs);
+
+ uniquify_t *uniquify = (uniquify_t*)mymalloc(sizeof(uniquify_t));
+ uniquify->nSeq = aln->nSeq;
+ uniquify->nUnique = nUniqueSeq;
+ uniquify->uniqueFirst = uniqueFirst;
+ uniquify->alnNext = alnNext;
+ uniquify->alnToUniq = alnToUniq;
+ uniquify->uniqueSeq = uniqueSeq;
+ return(uniquify);
+}
+
+uniquify_t *FreeUniquify(uniquify_t *unique) {
+ if (unique != NULL) {
+ myfree(unique->uniqueFirst, sizeof(int)*unique->nSeq);
+ myfree(unique->alnNext, sizeof(int)*unique->nSeq);
+ myfree(unique->alnToUniq, sizeof(int)*unique->nSeq);
+ myfree(unique->uniqueSeq, sizeof(char*)*unique->nSeq);
+ myfree(unique,sizeof(uniquify_t));
+ unique = NULL;
+ }
+ return(unique);
+}
+
+traversal_t InitTraversal(NJ_t *NJ) {
+ traversal_t worked = (bool*)mymalloc(sizeof(bool)*NJ->maxnodes);
+ int i;
+ for (i=0; i<NJ->maxnodes; i++)
+ worked[i] = false;
+ return(worked);
+}
+
+void SkipTraversalInto(int node, /*IN/OUT*/traversal_t traversal) {
+ traversal[node] = true;
+}
+
+int TraversePostorder(int node, NJ_t *NJ, /*IN/OUT*/traversal_t traversal,
+ /*OPTIONAL OUT*/bool *pUp) {
+ if (pUp)
+ *pUp = false;
+ while(1) {
+ assert(node >= 0);
+
+ /* move to a child if possible */
+ bool found = false;
+ int iChild;
+ for (iChild=0; iChild < NJ->child[node].nChild; iChild++) {
+ int child = NJ->child[node].child[iChild];
+ if (!traversal[child]) {
+ node = child;
+ found = true;
+ break;
+ }
+ }
+ if (found)
+ continue; /* keep moving down */
+ if (!traversal[node]) {
+ traversal[node] = true;
+ return(node);
+ }
+ /* If we've already done this node, need to move up */
+ if (node == NJ->root)
+ return(-1); /* nowhere to go -- done traversing */
+ node = NJ->parent[node];
+ /* If we go up to someplace that was already marked as visited, this is due
+ to a change in topology, so return it marked as "up" */
+ if (pUp && traversal[node]) {
+ *pUp = true;
+ return(node);
+ }
+ }
+}
+
+traversal_t FreeTraversal(traversal_t traversal, NJ_t *NJ) {
+ myfree(traversal, sizeof(bool)*NJ->maxnodes);
+ return(NULL);
+}
+
+profile_t **UpProfiles(NJ_t *NJ) {
+ profile_t **upProfiles = (profile_t**)mymalloc(sizeof(profile_t*)*NJ->maxnodes);
+ int i;
+ for (i=0; i<NJ->maxnodes; i++) upProfiles[i] = NULL;
+ return(upProfiles);
+}
+
+profile_t *GetUpProfile(/*IN/OUT*/profile_t **upProfiles, NJ_t *NJ, int outnode, bool useML) {
+ assert(outnode != NJ->root && outnode >= NJ->nSeq); /* not for root or leaves */
+ if (upProfiles[outnode] != NULL)
+ return(upProfiles[outnode]);
+
+ int depth;
+ int *pathToRoot = PathToRoot(NJ, outnode, /*OUT*/&depth);
+ int i;
+ /* depth-1 is root */
+ for (i = depth-2; i>=0; i--) {
+ int node = pathToRoot[i];
+
+ if (upProfiles[node] == NULL) {
+ /* Note -- SetupABCD may call GetUpProfile, but it should do it farther
+ up in the path to the root
+ */
+ profile_t *profiles[4];
+ int nodeABCD[4];
+ SetupABCD(NJ, node, /*OUT*/profiles, /*IN/OUT*/upProfiles, /*OUT*/nodeABCD, useML);
+ if (useML) {
+ /* If node is a child of root, then the 4th profile is of the 2nd root-sibling of node
+ Otherwise, the 4th profile is the up-profile of the parent of node, and that
+ is the branch-length we need
+ */
+ double lenC = NJ->branchlength[nodeABCD[2]];
+ double lenD = NJ->branchlength[nodeABCD[3]];
+ if (verbose > 3) {
+ fprintf(stderr, "Computing UpProfile for node %d with lenC %.4f lenD %.4f pair-loglk %.3f\n",
+ node, lenC, lenD,
+ PairLogLk(profiles[2],profiles[3],lenC+lenD,NJ->nPos,NJ->transmat,&NJ->rates, /*site_lk*/NULL));
+ PrintNJInternal(stderr, NJ, /*useLen*/true);
+ }
+ upProfiles[node] = PosteriorProfile(/*C*/profiles[2], /*D*/profiles[3],
+ lenC, lenD,
+ NJ->transmat, &NJ->rates, NJ->nPos, NJ->nConstraints);
+ } else {
+ profile_t *profilesCDAB[4] = { profiles[2], profiles[3], profiles[0], profiles[1] };
+ double weight = QuartetWeight(profilesCDAB, NJ->distance_matrix, NJ->nPos);
+ if (verbose>3)
+ fprintf(stderr, "Compute upprofile of %d from %d and parents (vs. children %d %d) with weight %.3f\n",
+ node, nodeABCD[2], nodeABCD[0], nodeABCD[1], weight);
+ upProfiles[node] = AverageProfile(profiles[2], profiles[3],
+ NJ->nPos, NJ->nConstraints,
+ NJ->distance_matrix,
+ weight);
+ }
+ }
+ }
+ FreePath(pathToRoot,NJ);
+ assert(upProfiles[outnode] != NULL);
+ return(upProfiles[outnode]);
+}
+
+profile_t *DeleteUpProfile(/*IN/OUT*/profile_t **upProfiles, NJ_t *NJ, int node) {
+ assert(node>=0 && node < NJ->maxnodes);
+ if (upProfiles[node] != NULL)
+ upProfiles[node] = FreeProfile(upProfiles[node], NJ->nPos, NJ->nConstraints); /* returns NULL */
+ return(NULL);
+}
+
+profile_t **FreeUpProfiles(profile_t **upProfiles, NJ_t *NJ) {
+ int i;
+ int nUsed = 0;
+ for (i=0; i < NJ->maxnodes; i++) {
+ if (upProfiles[i] != NULL)
+ nUsed++;
+ DeleteUpProfile(upProfiles, NJ, i);
+ }
+ myfree(upProfiles, sizeof(profile_t*)*NJ->maxnodes);
+ if (verbose >= 3)
+ fprintf(stderr,"FreeUpProfiles -- freed %d\n", nUsed);
+ return(NULL);
+}
+
+int *PathToRoot(NJ_t *NJ, int node, /*OUT*/int *outDepth) {
+ int *pathToRoot = (int*)mymalloc(sizeof(int)*NJ->maxnodes);
+ int depth = 0;
+ int ancestor = node;
+ while(ancestor >= 0) {
+ pathToRoot[depth] = ancestor;
+ ancestor = NJ->parent[ancestor];
+ depth++;
+ }
+ *outDepth = depth;
+ return(pathToRoot);
+}
+
+int *FreePath(int *path, NJ_t *NJ) {
+ myfree(path, sizeof(int)*NJ->maxnodes);
+ return(NULL);
+}
+
+transition_matrix_t *CreateGTR(double *r/*ac ag at cg ct gt*/, double *f/*acgt*/) {
+ double matrix[4][MAXCODES];
+ assert(nCodes==4);
+ int i, j;
+ /* Place rates onto a symmetric matrix, but correct by f(target), so that
+ stationary distribution f[] is maintained
+ Leave diagonals as 0 (CreateTransitionMatrix will fix them)
+ */
+ int imat = 0;
+ for (i = 0; i < nCodes; i++) {
+ matrix[i][i] = 0;
+ for (j = i+1; j < nCodes; j++) {
+ double rate = r[imat++];
+ assert(rate > 0);
+ /* Want t(matrix) * f to be 0 */
+ matrix[i][j] = rate * f[i];
+ matrix[j][i] = rate * f[j];
+ }
+ }
+ /* Compute average mutation rate */
+ double total_rate = 0;
+ for (i = 0; i < nCodes; i++)
+ for (j = 0; j < nCodes; j++)
+ total_rate += f[i] * matrix[i][j];
+ assert(total_rate > 1e-6);
+ double inv = 1.0/total_rate;
+ for (i = 0; i < nCodes; i++)
+ for (j = 0; j < nCodes; j++)
+ matrix[i][j] *= inv;
+ return(CreateTransitionMatrix(matrix,f));
+}
+
+transition_matrix_t *CreateTransitionMatrix(/*IN*/double matrix[MAXCODES][MAXCODES],
+ /*IN*/double stat[MAXCODES]) {
+ int i,j,k;
+ transition_matrix_t *transmat = mymalloc(sizeof(transition_matrix_t));
+ double sqrtstat[20];
+ for (i = 0; i < nCodes; i++) {
+ transmat->stat[i] = stat[i];
+ transmat->statinv[i] = 1.0/stat[i];
+ sqrtstat[i] = sqrt(stat[i]);
+ }
+
+ double sym[20*20]; /* symmetrized matrix M' */
+ /* set diagonals so columns sums are 0 before symmetrization */
+ for (i = 0; i < nCodes; i++)
+ for (j = 0; j < nCodes; j++)
+ sym[nCodes*i+j] = matrix[i][j];
+ for (j = 0; j < nCodes; j++) {
+ double sum = 0;
+ sym[nCodes*j+j] = 0;
+ for (i = 0; i < nCodes; i++)
+ sum += sym[nCodes*i+j];
+ sym[nCodes*j+j] = -sum;
+ }
+ /* M' = S**-1 M S */
+ for (i = 0; i < nCodes; i++)
+ for (j = 0; j < nCodes; j++)
+ sym[nCodes*i+j] *= sqrtstat[j]/sqrtstat[i];
+
+ /* eigen decomposition of M' -- note that eigenW is the transpose of what we want,
+ which is eigenvectors in columns */
+ double eigenW[20*20], eval[20], e[20];
+ for (i = 0; i < nCodes*nCodes; i++)
+ eigenW[i] = sym[i];
+ tred2(eigenW, nCodes, nCodes, eval, e);
+ tqli(eval, e, nCodes , nCodes, eigenW);
+
+ /* save eigenvalues */
+ for (i = 0; i < nCodes; i++)
+ transmat->eigenval[i] = eval[i];
+
+ /* compute eigen decomposition of M into t(codeFreq): V = S*W */
+ /* compute inverse of V in eigeninv: V**-1 = t(W) S**-1 */
+ for (i = 0; i < nCodes; i++) {
+ for (j = 0; j < nCodes; j++) {
+ transmat->eigeninv[i][j] = eigenW[nCodes*i+j] / sqrtstat[j];
+ transmat->eigeninvT[j][i] = transmat->eigeninv[i][j];
+ }
+ }
+ for (i = 0; i < nCodes; i++)
+ for (j = 0; j < nCodes; j++)
+ transmat->codeFreq[i][j] = eigenW[j*nCodes+i] * sqrtstat[i];
+ /* codeFreq[NOCODE] is the rotation of (1,1,...) not (1/nCodes,1/nCodes,...), which
+ gives correct posterior probabilities
+ */
+ for (j = 0; j < nCodes; j++) {
+ transmat->codeFreq[NOCODE][j] = 0.0;
+ for (i = 0; i < nCodes; i++)
+ transmat->codeFreq[NOCODE][j] += transmat->codeFreq[i][j];
+ }
+ /* save some posterior probabilities for approximating later:
+ first, we compute P(B | A, t) for t = approxMLnearT, by using
+ V * exp(L*t) * V**-1 */
+ double expvalues[MAXCODES];
+ for (i = 0; i < nCodes; i++)
+ expvalues[i] = exp(approxMLnearT * transmat->eigenval[i]);
+ double LVinv[MAXCODES][MAXCODES]; /* exp(L*t) * V**-1 */
+ for (i = 0; i < nCodes; i++) {
+ for (j = 0; j < nCodes; j++)
+ LVinv[i][j] = transmat->eigeninv[i][j] * expvalues[i];
+ }
+ /* matrix transform for converting A -> B given t: transt[i][j] = P(j->i | t) */
+ double transt[MAXCODES][MAXCODES];
+ for (i = 0; i < nCodes; i++) {
+ for (j = 0; j < nCodes; j++) {
+ transt[i][j] = 0;
+ for (k = 0; k < nCodes; k++)
+ transt[i][j] += transmat->codeFreq[i][k] * LVinv[k][j];
+ }
+ }
+ /* nearP[i][j] = P(parent = j | both children are i) = P(j | i,i) ~ stat(j) * P(j->i | t)**2 */
+ for (i = 0; i < nCodes; i++) {
+ double nearP[MAXCODES];
+ double tot = 0;
+ for (j = 0; j < nCodes; j++) {
+ assert(transt[j][i] > 0);
+ assert(transmat->stat[j] > 0);
+ nearP[j] = transmat->stat[j] * transt[i][j] * transt[i][j];
+ tot += nearP[j];
+ }
+ assert(tot > 0);
+ for (j = 0; j < nCodes; j++)
+ nearP[j] *= 1.0/tot;
+ /* save nearP in transmat->nearP[i][] */
+ for (j = 0; j < nCodes; j++)
+ transmat->nearP[i][j] = nearP[j];
+ /* multiply by 1/stat and rotate nearP */
+ for (j = 0; j < nCodes; j++)
+ nearP[j] /= transmat->stat[j];
+ for (j = 0; j < nCodes; j++) {
+ double rot = 0;
+ for (k = 0; k < nCodes; k++)
+ rot += nearP[k] * transmat->codeFreq[i][j];
+ transmat->nearFreq[i][j] = rot;
+ }
+ }
+ return(transmat);
+ assert(0);
+}
+
+distance_matrix_t *TransMatToDistanceMat(transition_matrix_t *transmat) {
+ if (transmat == NULL)
+ return(NULL);
+ distance_matrix_t *dmat = mymalloc(sizeof(distance_matrix_t));
+ int i, j;
+ for (i=0; i<nCodes; i++) {
+ for (j=0; j<nCodes; j++) {
+ dmat->distances[i][j] = 0; /* never actually used */
+ dmat->eigeninv[i][j] = transmat->eigeninv[i][j];
+ dmat->codeFreq[i][j] = transmat->codeFreq[i][j];
+ }
+ }
+ /* eigentot . rotated-vector is the total frequency of the unrotated vector
+ (used to normalize in NormalizeFreq()
+ For transition matrices, we rotate by transpose of eigenvectors, so
+ we need to multiply by the inverse matrix by 1....1 to get this vector,
+ or in other words, sum the columns
+ */
+ for(i = 0; i<nCodes; i++) {
+ dmat->eigentot[i] = 0.0;
+ for (j = 0; j<nCodes; j++)
+ dmat->eigentot[i] += transmat->eigeninv[i][j];
+ }
+ return(dmat);
+}
+
+/* Numerical recipes code for eigen decomposition (actually taken from RAxML rev_functions.c) */
+void tred2 (double *a, const int n, const int np, double *d, double *e)
+{
+#define a(i,j) a[(j-1)*np + (i-1)]
+#define e(i) e[i-1]
+#define d(i) d[i-1]
+ int i, j, k, l;
+ double f, g, h, hh, scale;
+ for (i = n; i > 1; i--) {
+ l = i-1;
+ h = 0;
+ scale = 0;
+ if ( l > 1 ) {
+ for ( k = 1; k <= l; k++ )
+ scale += fabs(a(i,k));
+ if (scale == 0)
+ e(i) = a(i,l);
+ else {
+ for (k = 1; k <= l; k++) {
+ a(i,k) /= scale;
+ h += a(i,k) * a(i,k);
+ }
+ f = a(i,l);
+ g = -sqrt(h);
+ if (f < 0) g = -g;
+ e(i) = scale *g;
+ h -= f*g;
+ a(i,l) = f-g;
+ f = 0;
+ for (j = 1; j <=l ; j++) {
+ a(j,i) = a(i,j) / h;
+ g = 0;
+ for (k = 1; k <= j; k++)
+ g += a(j,k)*a(i,k);
+ for (k = j+1; k <= l; k++)
+ g += a(k,j)*a(i,k);
+ e(j) = g/h;
+ f += e(j)*a(i,j);
+ }
+ hh = f/(h+h);
+ for (j = 1; j <= l; j++) {
+ f = a(i,j);
+ g = e(j) - hh * f;
+ e(j) = g;
+ for (k = 1; k <= j; k++)
+ a(j,k) -= f*e(k) + g*a(i,k);
+ }
+ }
+ } else
+ e(i) = a(i,l);
+ d(i) = h;
+ }
+ d(1) = 0;
+ e(1) = 0;
+ for (i = 1; i <= n; i++) {
+ l = i-1;
+ if (d(i) != 0) {
+ for (j = 1; j <=l; j++) {
+ g = 0;
+ for (k = 1; k <= l; k++)
+ g += a(i,k)*a(k,j);
+ for (k=1; k <=l; k++)
+ a(k,j) -= g * a(k,i);
+ }
+ }
+ d(i) = a(i,i);
+ a(i,i) = 1;
+ for (j=1; j<=l; j++)
+ a(i,j) = a(j,i) = 0;
+ }
+
+ return;
+#undef a
+#undef e
+#undef d
+}
+
+double pythag(double a, double b) {
+ double absa = fabs(a), absb = fabs(b);
+ return (absa > absb) ?
+ absa * sqrt(1+ (absb/absa)*(absb/absa)) :
+ absb == 0 ?
+ 0 :
+ absb * sqrt(1+ (absa/absb)*(absa/absb));
+}
+
+void tqli(double *d, double *e, int n, int np, double *z)
+{
+#define z(i,j) z[(j-1)*np + (i-1)]
+#define e(i) e[i-1]
+#define d(i) d[i-1]
+
+ int i = 0, iter = 0, k = 0, l = 0, m = 0;
+ double b = 0, c = 0, dd = 0, f = 0, g = 0, p = 0, r = 0, s = 0;
+
+ for(i=2; i<=n; i++)
+ e(i-1) = e(i);
+ e(n) = 0;
+
+ for (l = 1; l <= n; l++)
+ {
+ iter = 0;
+ labelExtra:
+
+ for (m = l; (m < n); m++)
+ {
+ dd = fabs(d(m))+fabs(d(m+1));
+
+ if (fabs(e(m))+dd == dd)
+ break;
+ }
+
+ if (m != l)
+ {
+ assert(iter < 30);
+
+ iter++;
+ g = (d(l+1)-d(l))/(2*e(l));
+ r = pythag(g,1.);
+ g = d(m)-d(l)+e(l)/(g+(g<0?-r:r));
+ s = 1;
+ c = 1;
+ p = 0;
+
+ for (i = m-1; i>=l; i--)
+ {
+ f = s*e(i);
+ b = c*e(i);
+ r = pythag(f,g);
+
+ e(i+1) = r;
+ if (r == 0)
+ {
+ d (i+1) -= p;
+ e (m) = 0;
+
+ goto labelExtra;
+ }
+ s = f/r;
+ c = g/r;
+ g = d(i+1)-p;
+ r = (d(i)-g)*s + 2*c*b;
+ p = s*r;
+ d(i+1) = g + p;
+ g = c*r - b;
+ for (k=1; k <= n; k++)
+ {
+ f = z(k,i+1);
+ z(k,i+1) = s * z(k,i) + c*f;
+ z(k,i) = c * z(k,i) - s*f;
+ }
+ }
+ d(l) -= p;
+ e(l) = g;
+ e(m) = 0;
+
+ goto labelExtra;
+ }
+ }
+
+ return;
+#undef z
+#undef e
+#undef d
+
+}
+
+#ifdef USE_SSE3
+inline float mm_sum(register __m128 sum) {
+#if 1
+ /* stupider but faster */
+ float f[4] ALIGNED;
+ _mm_store_ps(f,sum);
+ return(f[0]+f[1]+f[2]+f[3]);
+#else
+ /* first we get sum[0]+sum[1], sum[2]+sum[3] by selecting 0/1 and 2/3 */
+ sum = _mm_add_ps(sum,_mm_shuffle_ps(sum,sum,_MM_SHUFFLE(0,1,2,3)));
+ /* then get sum[0]+sum[1]+sum[2]+sum[3] by selecting 0/1 and 0/1 */
+ sum = _mm_add_ps(sum,_mm_shuffle_ps(sum,sum,_MM_SHUFFLE(0,1,0,1)));
+ float f;
+ _mm_store_ss(&f, sum); /* save the lowest word */
+ return(f);
+#endif
+}
+#endif
+
+void vector_multiply(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, int n, /*OUT*/numeric_t *fOut) {
+#ifdef USE_SSE3
+ int i;
+ for (i = 0; i < n; i += 4) {
+ __m128 a, b, c;
+ a = _mm_load_ps(f1+i);
+ b = _mm_load_ps(f2+i);
+ c = _mm_mul_ps(a, b);
+ _mm_store_ps(fOut+i,c);
+ }
+#else
+ int i;
+ for (i = 0; i < n; i++)
+ fOut[i] = f1[i]*f2[i];
+#endif
+}
+
+numeric_t vector_multiply_sum(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, int n) {
+#ifdef USE_SSE3
+ if (n == 4)
+ return(f1[0]*f2[0]+f1[1]*f2[1]+f1[2]*f2[2]+f1[3]*f2[3]);
+ __m128 sum = _mm_setzero_ps();
+ int i;
+ for (i = 0; i < n; i += 4) {
+ __m128 a, b, c;
+ a = _mm_load_ps(f1+i);
+ b = _mm_load_ps(f2+i);
+ c = _mm_mul_ps(a, b);
+ sum = _mm_add_ps(c, sum);
+ }
+ return(mm_sum(sum));
+#else
+ int i;
+ numeric_t out = 0.0;
+ for (i=0; i < n; i++)
+ out += f1[i]*f2[i];
+ return(out);
+#endif
+}
+
+/* sum(f1*f2*f3) */
+numeric_t vector_multiply3_sum(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, /*IN*/numeric_t* f3, int n) {
+#ifdef USE_SSE3
+ __m128 sum = _mm_setzero_ps();
+ int i;
+ for (i = 0; i < n; i += 4) {
+ __m128 a1, a2, a3;
+ a1 = _mm_load_ps(f1+i);
+ a2 = _mm_load_ps(f2+i);
+ a3 = _mm_load_ps(f3+i);
+ sum = _mm_add_ps(_mm_mul_ps(_mm_mul_ps(a1,a2),a3),sum);
+ }
+ return(mm_sum(sum));
+#else
+ int i;
+ numeric_t sum = 0.0;
+ for (i = 0; i < n; i++)
+ sum += f1[i]*f2[i]*f3[i];
+ return(sum);
+#endif
+}
+
+numeric_t vector_dot_product_rot(/*IN*/numeric_t *f1, /*IN*/numeric_t *f2, /*IN*/numeric_t *fBy, int n) {
+#ifdef USE_SSE3
+ __m128 sum1 = _mm_setzero_ps();
+ __m128 sum2 = _mm_setzero_ps();
+ int i;
+ for (i = 0; i < n; i += 4) {
+ __m128 a1, a2, aBy;
+ a1 = _mm_load_ps(f1+i);
+ a2 = _mm_load_ps(f2+i);
+ aBy = _mm_load_ps(fBy+i);
+ sum1 = _mm_add_ps(_mm_mul_ps(a1, aBy), sum1);
+ sum2 = _mm_add_ps(_mm_mul_ps(a2, aBy), sum2);
+ }
+ return(mm_sum(sum1)*mm_sum(sum2));
+#else
+ int i;
+ numeric_t out1 = 0.0;
+ numeric_t out2 = 0.0;
+ for (i=0; i < n; i++) {
+ out1 += f1[i]*fBy[i];
+ out2 += f2[i]*fBy[i];
+ }
+ return(out1*out2);
+#endif
+}
+
+numeric_t vector_sum(/*IN*/numeric_t *f1, int n) {
+#ifdef USE_SSE3
+ if (n==4)
+ return(f1[0]+f1[1]+f1[2]+f1[3]);
+ __m128 sum = _mm_setzero_ps();
+ int i;
+ for (i = 0; i < n; i+=4) {
+ __m128 a;
+ a = _mm_load_ps(f1+i);
+ sum = _mm_add_ps(a, sum);
+ }
+ return(mm_sum(sum));
+#else
+ numeric_t out = 0.0;
+ int i;
+ for (i = 0; i < n; i++)
+ out += f1[i];
+ return(out);
+#endif
+}
+
+void vector_multiply_by(/*IN/OUT*/numeric_t *f, /*IN*/numeric_t fBy, int n) {
+ int i;
+#ifdef USE_SSE3
+ __m128 c = _mm_set1_ps(fBy);
+ for (i = 0; i < n; i += 4) {
+ __m128 a, b;
+ a = _mm_load_ps(f+i);
+ b = _mm_mul_ps(a,c);
+ _mm_store_ps(f+i,b);
+ }
+#else
+ for (i = 0; i < n; i++)
+ f[i] *= fBy;
+#endif
+}
+
+void vector_add_mult(/*IN/OUT*/numeric_t *fTot, /*IN*/numeric_t *fAdd, numeric_t weight, int n) {
+#ifdef USE_SSE3
+ int i;
+ __m128 w = _mm_set1_ps(weight);
+ for (i = 0; i < n; i += 4) {
+ __m128 tot, add;
+ tot = _mm_load_ps(fTot+i);
+ add = _mm_load_ps(fAdd+i);
+ _mm_store_ps(fTot+i, _mm_add_ps(tot, _mm_mul_ps(add,w)));
+ }
+#else
+ int i;
+ for (i = 0; i < n; i++)
+ fTot[i] += fAdd[i] * weight;
+#endif
+}
+
+void matrixt_by_vector4(/*IN*/numeric_t mat[4][MAXCODES], /*IN*/numeric_t vec[4], /*OUT*/numeric_t out[4]) {
+#ifdef USE_SSE3
+ /*__m128 v = _mm_load_ps(vec);*/
+ __m128 o = _mm_setzero_ps();
+ int j;
+ /* result is a sum of vectors: sum(k) v[k] * mat[k][] */
+ for (j = 0; j < 4; j++) {
+ __m128 m = _mm_load_ps(&mat[j][0]);
+ __m128 vj = _mm_load1_ps(&vec[j]); /* is it faster to shuffle v? */
+ o = _mm_add_ps(o, _mm_mul_ps(vj,m));
+ }
+ _mm_store_ps(out, o);
+#else
+ int j,k;
+ for (j = 0; j < 4; j++) {
+ double sum = 0;
+ for (k = 0; k < 4; k++)
+ sum += vec[k] * mat[k][j];
+ out[j] = sum;
+ }
+#endif
+}
+
+distance_matrix_t matrixBLOSUM45 =
+ {
+ /*distances*/
+ {
+ {0, 1.31097856157468, 1.06573001937323, 1.2682782988532, 0.90471293383305, 1.05855446876905, 1.05232790675508, 0.769574440593014, 1.27579668305679, 0.964604099952603, 0.987178199640556, 1.05007594438157, 1.05464162250736, 1.1985987403937, 0.967404475245526, 0.700490199584332, 0.880060189098976, 1.09748548316685, 1.28141710375267, 0.800038509951648},
+ {1.31097856157468, 0, 0.8010890222701, 0.953340718498495, 1.36011107208122, 0.631543775840481, 0.791014908659279, 1.15694899265629, 0.761152570032029, 1.45014917711188, 1.17792001455227, 0.394661075648738, 0.998807558909651, 1.135143404599, 1.15432562628921, 1.05309036790541, 1.05010474413616, 1.03938321130789, 0.963216908696184, 1.20274751778601},
+ {1.06573001937323, 0.8010890222701, 0, 0.488217214273568, 1.10567116937273, 0.814970207038261, 0.810176440932339, 0.746487413974582, 0.61876156253224, 1.17886558630004, 1.52003670190022, 0.808442678243754, 1.2889025816028, 1.16264109995678, 1.18228799147301, 0.679475681649858, 0.853658619686283, 1.68988558988005, 1.24297493464833, 1.55207513886163},
+ {1.2682782988532, 0.953340718498495, 0.488217214273568, 0, 1.31581050011876, 0.769778474953791, 0.482077627352988, 0.888361752320536, 0.736360849050364, 1.76756333403346, 1.43574761894039, 0.763612910719347, 1.53386612356483, 1.74323672079854, 0.886347403928663, 0.808614044804528, 1.01590147813779, 1.59617804551619, 1.1740494822217, 1.46600946033173},
+ {0.90471293383305, 1.36011107208122, 1.10567116937273, 1.31581050011876, 0, 1.3836789310481, 1.37553994252576, 1.26740695314856, 1.32361065635259, 1.26087264215993, 1.02417540515351, 1.37259631233791, 1.09416720447891, 0.986982088723923, 1.59321190226694, 0.915638787768407, 0.913042853922533, 1.80744143643002, 1.3294417177004, 0.830022143283238},
+ {1.05855446876905, 0.631543775840481, 0.814970207038261, 0.769778474953791, 1.3836789310481, 0, 0.506942797642807, 1.17699648087288, 0.614595446514896, 1.17092829494457, 1.19833088638994, 0.637341078675405, 0.806490842729072, 1.83315144709714, 0.932064479113502, 0.850321696813199, 1.06830084665916, 1.05739353225849, 0.979907428113788, 1.5416250309563},
+ {1.05232790675508, 0.791014908659279, 0.810176440932339, 0.482077627352988, 1.37553994252576, 0.506942797642807, 0, 1.17007322676118, 0.769786956320484, 1.46659942462342, 1.19128214039009, 0.633592151371708, 1.27269395724349, 1.44641491621774, 0.735428579892476, 0.845319988414402, 1.06201695511881, 1.324395996498, 1.22734387448031, 1.53255698189437},
+ {0.769574440593014, 1.15694899265629, 0.746487413974582, 0.888361752320536, 1.26740695314856, 1.17699648087288, 1.17007322676118, 0, 1.1259007054424, 1.7025415585924, 1.38293205218175, 1.16756929156758, 1.17264582493965, 1.33271035269688, 1.07564768421292, 0.778868281341681, 1.23287107008366, 0.968539655354582, 1.42479529031801, 1.41208067821187},
+ {1.27579668305679, 0.761152570032029, 0.61876156253224, 0.736360849050364, 1.32361065635259, 0.614595446514896, 0.769786956320484, 1.1259007054424, 0, 1.4112324673522, 1.14630894167097, 0.967795284542623, 0.771479459384692, 1.10468029976148, 1.12334774065132, 1.02482926701639, 1.28754326478771, 1.27439749294131, 0.468683841672724, 1.47469999960758},
+ {0.964604099952603, 1.45014917711188, 1.17886558630004, 1.76756333403346, 1.26087264215993, 1.17092829494457, 1.46659942462342, 1.7025415585924, 1.4112324673522, 0, 0.433350517223017, 1.463460928818, 0.462965544381851, 0.66291968000662, 1.07010201755441, 1.23000200130049, 0.973485453109068, 0.963546200571036, 0.708724769805536, 0.351200119909572},
+ {0.987178199640556, 1.17792001455227, 1.52003670190022, 1.43574761894039, 1.02417540515351, 1.19833088638994, 1.19128214039009, 1.38293205218175, 1.14630894167097, 0.433350517223017, 0, 1.49770950074319, 0.473800072611076, 0.538473125003292, 1.37979627224964, 1.5859723170438, 0.996267398224516, 0.986095542821092, 0.725310666139274, 0.570542199221932},
+ {1.05007594438157, 0.394661075648738, 0.808442678243754, 0.763612910719347, 1.37259631233791, 0.637341078675405, 0.633592151371708, 1.16756929156758, 0.967795284542623, 1.463460928818, 1.49770950074319, 0, 1.0079761868248, 1.44331961488922, 0.924599080166146, 1.06275728888356, 1.05974425835993, 1.04892430642749, 0.972058829603409, 1.21378822764856},
+ {1.05464162250736, 0.998807558909651, 1.2889025816028, 1.53386612356483, 1.09416720447891, 0.806490842729072, 1.27269395724349, 1.17264582493965, 0.771479459384692, 0.462965544381851, 0.473800072611076, 1.0079761868248, 0, 0.72479754849538, 1.1699868662153, 1.34481214251794, 1.06435197383538, 1.05348497728858, 0.774878150710318, 0.609532859331199},
+ {1.1985987403937, 1.135143404599, 1.16264109995678, 1.74323672079854, 0.986982088723923, 1.83315144709714, 1.44641491621774, 1.33271035269688, 1.10468029976148, 0.66291968000662, 0.538473125003292, 1.44331961488922, 0.72479754849538, 0, 1.32968844979665, 1.21307373491949, 0.960087571600877, 0.475142555482979, 0.349485367759138, 0.692733248746636},
+ {0.967404475245526, 1.15432562628921, 1.18228799147301, 0.886347403928663, 1.59321190226694, 0.932064479113502, 0.735428579892476, 1.07564768421292, 1.12334774065132, 1.07010201755441, 1.37979627224964, 0.924599080166146, 1.1699868662153, 1.32968844979665, 0, 0.979087429691819, 0.97631161216338, 1.21751652292503, 1.42156458605332, 1.40887880416009},
+ {0.700490199584332, 1.05309036790541, 0.679475681649858, 0.808614044804528, 0.915638787768407, 0.850321696813199, 0.845319988414402, 0.778868281341681, 1.02482926701639, 1.23000200130049, 1.5859723170438, 1.06275728888356, 1.34481214251794, 1.21307373491949, 0.979087429691819, 0, 0.56109848274013, 1.76318885009194, 1.29689226231656, 1.02015839286433},
+ {0.880060189098976, 1.05010474413616, 0.853658619686283, 1.01590147813779, 0.913042853922533, 1.06830084665916, 1.06201695511881, 1.23287107008366, 1.28754326478771, 0.973485453109068, 0.996267398224516, 1.05974425835993, 1.06435197383538, 0.960087571600877, 0.97631161216338, 0.56109848274013, 0, 1.39547634461879, 1.02642577026706, 0.807404666228614},
+ {1.09748548316685, 1.03938321130789, 1.68988558988005, 1.59617804551619, 1.80744143643002, 1.05739353225849, 1.324395996498, 0.968539655354582, 1.27439749294131, 0.963546200571036, 0.986095542821092, 1.04892430642749, 1.05348497728858, 0.475142555482979, 1.21751652292503, 1.76318885009194, 1.39547634461879, 0, 0.320002937404137, 1.268589159299},
+ {1.28141710375267, 0.963216908696184, 1.24297493464833, 1.1740494822217, 1.3294417177004, 0.979907428113788, 1.22734387448031, 1.42479529031801, 0.468683841672724, 0.708724769805536, 0.725310666139274, 0.972058829603409, 0.774878150710318, 0.349485367759138, 1.42156458605332, 1.29689226231656, 1.02642577026706, 0.320002937404137, 0, 0.933095433689795},
+ {0.800038509951648, 1.20274751778601, 1.55207513886163, 1.46600946033173, 0.830022143283238, 1.5416250309563, 1.53255698189437, 1.41208067821187, 1.47469999960758, 0.351200119909572, 0.570542199221932, 1.21378822764856, 0.609532859331199, 0.692733248746636, 1.40887880416009, 1.02015839286433, 0.807404666228614, 1.268589159299, 0.933095433689795, 0}
+ },
+ /*eigeninv*/
+ {
+ {-0.216311217101265, -0.215171653035930, -0.217000020881064, -0.232890860601250, -0.25403526530177, -0.211569372858927, -0.218073620637049, -0.240585637190076, -0.214507049619293, -0.228476323330312, -0.223235445346107, -0.216116483840334, -0.206903836810903, -0.223553828183343, -0.236937609127783, -0.217652789023588, -0.211982652566286, -0.245995223308316, -0.206187718714279, -0.227670670439422},
+ {-0.0843931919568687, -0.0342164464991033, 0.393702284928246, -0.166018266253027, 0.0500896782860136, -0.262731388032538, 0.030139964190519, -0.253997503551094, -0.0932603349591988, -0.32884667697173, 0.199966846276877, -0.117543453869516, 0.196248237055757, -0.456448703853250, 0.139286961076387, 0.241166801918811, -0.0783508285295053, 0.377438091416498, 0.109499076984234, 0.128581669647144},
+ {-0.0690428674271772, 0.0133858672878363, -0.208289917312908, 0.161232925220819, 0.0735806288007248, -0.316269599838174, -0.0640708424745702, -0.117078801507436, 0.360805085405857, 0.336899760384943, 0.0332447078185156, 0.132954055834276, 0.00595209121998118, -0.157755611190327, -0.199839273133436, 0.193688928807663, 0.0970290928040946, 0.374683975138541, -0.478110944870958, -0.243290196936098},
+ {0.117284581850481, 0.310399467781876, -0.143513477698805, 0.088808130300351, 0.105747812943691, -0.373871701179853, 0.189069306295134, 0.133258225034741, -0.213043549687694, 0.301303731259140, -0.182085224761849, -0.161971915020789, 0.229301173581378, -0.293586313243755, -0.0260480060747498, -0.0217953684540699, 0.0202675755458796, -0.160134624443657, 0.431950096999465, -0.329885160320501},
+ {0.256496969244703, 0.0907408349583135, 0.0135731083898029, 0.477557831930769, -0.0727379669280703, 0.101732675207959, -0.147293025369251, -0.348325291603251, -0.255678082078362, -0.187092643740172, -0.177164064346593, -0.225921480146133, 0.422318841046522, 0.319959853469398, -0.0623652546300045, 0.0824203908606883, -0.102057926881110, 0.120728407576411, -0.156845807891241, -0.123528163091204},
+ {-0.00906668858975576, -0.0814722888231236, -0.0762715085459023, 0.055819989938286, -0.0540516675257271, -0.0070589302769034, -0.315813159989213, -0.0103527463419808, -0.194634331372293, -0.0185860407566822, 0.50134169352609, 0.384531812730061, -0.0405008616742061, 0.0781033650669525, 0.069334900096687, 0.396455180448549, -0.204065801866462, -0.215272089630713, 0.171046818996465, -0.396393364716348},
+ {0.201971098571663, 0.489747667606921, 0.00226258734592836, 0.0969514005747054, 0.0853921636903791, 0.0862068740282345, -0.465412154271164, -0.130516676347786, 0.165513616974634, 0.0712238027886633, 0.140746943067963, -0.325919272273406, -0.421213488261598, -0.163508199065965, 0.269695802810568, -0.110296405171437, -0.106834099902202, 0.00509414588152415, 0.00909215239544615, 0.0500401865589727},
+ {0.515854176692456, -0.087468413428258, 0.102796468891449, -0.06046105990993, -0.212014383772414, -0.259853648383794, -0.0997372883043333, -0.109934574535736, 0.284891018406112, -0.250578342940183, 0.142174204994568, 0.210384918947619, 0.118803190788946, -0.0268434355996836, 0.0103721198836548, -0.355555176478458, 0.428042332431476, -0.150610175411631, 0.0464090887952940, -0.140238796382057},
+ {-0.239392215229762, -0.315483492656425, 0.100205194952396, 0.197830195325302, 0.40178804665223, 0.195809461460298, -0.407817115321684, 0.0226836686147386, -0.169780276210306, 0.0818161585952184, -0.172886230584939, 0.174982644851064, 0.0868786992159535, -0.198450519980824, 0.168581078329968, -0.361514336004068, 0.238668430084722, 0.165494019791904, 0.110437707249228, -0.169592003035203},
+ {-0.313151735678025, 0.10757884850664, -0.49249098807229, 0.0993472335619114, -0.148695715250836, 0.0573801136941699, -0.190040373500722, 0.254848437434773, 0.134147888304352, -0.352719341442756, 0.0839609323513986, -0.207904182300122, 0.253940523323376, -0.109832138553288, 0.0980084518687944, 0.209026594443723, 0.406236051871548, -0.0521120230935943, 0.0554108014592302, 0.134681046631955},
+ {-0.102905214421384, 0.235803606800009, 0.213414976431981, -0.253606415825635, 0.00945656859370683, 0.259551282655855, 0.159527348902192, 0.083218761193016, -0.286815935191867, 0.0135069477264877, 0.336758103107357, -0.271707359524149, -0.0400009875851839, 0.0871186292716414, -0.171506310409388, -0.0954276577211755, 0.393467571460712, 0.111732846649458, -0.239886066474217, -0.426474828195231},
+ {-0.0130795552324104, 0.0758967690968058, -0.165099404017689, -0.46035152559912, 0.409888158016031, -0.0235053940299396, 0.0699393201709723, -0.161320910316996, 0.226111732196825, -0.177811841258496, -0.219073917645916, -0.00703219376737286, 0.162831878334912, 0.271670554900684, 0.451033612762052, 0.0820942662443393, -0.0904983490498446, -0.0587000279313978, -0.0938852980928252, -0.306078621571843},
+ {0.345092040577428, -0.257721588971295, -0.301689123771848, -0.0875212184538126, 0.161012613069275, 0.385104899829821, 0.118355290985046, -0.241723794416731, 0.083201920119646, -0.0809095291508749, -0.0820275390511991, -0.115569770103317, -0.250105681098033, -0.164197583037664, -0.299481453795592, 0.255906951902366, 0.129042051416371, 0.203761730442746, 0.347550071284268, -0.109264854744020},
+ {0.056345924962239, 0.072536751679082, 0.303127492633681, -0.368877185781648, -0.343024497082421, 0.206879529669083, -0.413012709639426, 0.078538816203612, 0.103382383425097, 0.288319996147499, -0.392663258459423, 0.0319588502083897, 0.220316797792669, -0.0563686494606947, -0.0869286063283735, 0.323677017794391, 0.0984875197088935, -0.0303289828821742, 0.0450197853450979, -0.0261771221270139},
+ {-0.253701638374729, -0.148922815783583, 0.111794052194159, 0.157313977830326, -0.269846001260543, -0.222989872703583, 0.115441028189268, -0.350456582262355, -0.0409581422905941, 0.174078744248002, -0.130673397086811, -0.123963802708056, -0.351609207081548, 0.281548012920868, 0.340382662112428, 0.180262131025562, 0.3895263830793, 0.0121546812430960, 0.214830943227063, -0.0617782909660214},
+ {-0.025854479416026, 0.480654788977767, -0.138024550829229, -0.130191670810919, 0.107816875829919, -0.111243997319276, -0.0679814460571245, -0.183167991080677, -0.363355166018786, -0.183934891092050, -0.216097125080962, 0.520240628803255, -0.179616013606479, 0.0664131536100941, -0.178350708111064, 0.0352047611606709, 0.223857228692892, 0.128363679623513, -0.000403433628490731, 0.224972110977704},
+ {0.159207394033448, -0.0371517305736114, -0.294302634912281, -0.0866954375908417, -0.259998567870054, 0.284966673982689, 0.205356416771391, -0.257613708650298, -0.264820519037270, 0.293359248624603, 0.0997476397434102, 0.151390539497369, 0.165571346773648, -0.347569523551258, 0.43792310820533, -0.0723248163210163, 0.0379214984816955, -0.0542758730251438, -0.258020301801603, 0.128680501102363},
+ {0.316853842351797, -0.153950010941153, -0.13387065213508, -0.0702971390607613, -0.202558481846057, -0.172941438694837, -0.068882524588574, 0.524738203063889, -0.271670479920716, -0.112864756695310, -0.146831636946145, -0.0352336188578041, -0.211108490884767, 0.097857111349555, 0.276459740956662, 0.0231297536754823, -0.0773173324868396, 0.487208384389438, -0.0734191389266824, -0.113198765573319},
+ {-0.274285525741087, 0.227334266052039, -0.0973746625709059, -0.00965256583655389, -0.402438444750043, 0.198586229519026, 0.0958135064575833, -0.108934376958686, 0.253641732094319, -0.0551918478254021, 0.0243640218331436, 0.181936272247179, 0.090952738347629, 0.0603352483029044, -0.0043821671755761, -0.347720824658591, -0.267879988539971, 0.403804652116592, 0.337654323971186, -0.241509293972297},
+ {-0.0197089518344238, 0.139681034626696, 0.251980475788267, 0.341846624362846, -0.075141195125153, 0.2184951591319, 0.268870823491343, 0.150392399018138, 0.134592404015057, -0.337050200539163, -0.313109373497998, 0.201993318439135, -0.217140733851970, -0.337622749083808, 0.135253284365068, 0.181729249828045, -0.00627813335422765, -0.197218833324039, -0.194060005031698, -0.303055888528004}
+ },
+ /*eigenval*/
+ {
+ 20.29131, 0.5045685, 0.2769945, 0.1551147, 0.03235484, -0.04127639, -0.3516426, -0.469973, -0.5835191, -0.6913107, -0.7207972, -0.7907875, -0.9524307, -1.095310, -1.402153, -1.424179, -1.936704, -2.037965, -3.273561, -5.488734
+ },
+ /*eigentot and codeFreq left out, these are initialized elsewhere*/
+ };
+
+/* The JTT92 matrix, D. T. Jones, W. R. Taylor, & J. M. Thorton, CABIOS 8:275 (1992)
+ Derived from the PhyML source code (models.c) by filling in the other side of the symmetric matrix,
+ scaling the entries by the stationary rate (to give the rate of a->b not b|a), to set the diagonals
+ so the rows sum to 0, to rescale the matrix so that the implied rate of evolution is 1.
+ The resulting matrix is the transpose (I think).
+*/
+#if 0
+{
+ int i,j;
+ for (i=0; i<20; i++) for (j=0; j<i; j++) daa[j*20+i] = daa[i*20+j];
+ for (i = 0; i < 20; i++) for (j = 0; j < 20; j++) daa[i*20+j] *= pi[j] / 100.0;
+ double mr = 0; /* mean rate */
+ for (i = 0; i < 20; i++) {
+ double sum = 0;
+ for (j = 0; j < 20; j++)
+ sum += daa[i*20+j];
+ daa[i*20+i] = -sum;
+ mr += pi[i] * sum;
+ }
+ for (i = 0; i < 20*20; i++)
+ daa[i] /= mr;
+}
+#endif
+
+double statJTT92[MAXCODES] = {0.07674789,0.05169087,0.04264509,0.05154407,0.01980301,0.04075195,0.06182989,0.07315199,0.02294399,0.05376110,0.09190390,0.05867583,0.02382594,0.04012589,0.05090097,0.06876503,0.05856501,0.01426057,0.03210196,0.06600504};
+double matrixJTT92[MAXCODES][MAXCODES] = {
+ { -1.247831,0.044229,0.041179,0.061769,0.042704,0.043467,0.08007,0.136501,0.02059,0.027453,0.022877,0.02669,0.041179,0.011439,0.14794,0.288253,0.362223,0.006863,0.008388,0.227247 },
+ { 0.029789,-1.025965,0.023112,0.008218,0.058038,0.159218,0.014895,0.070364,0.168463,0.011299,0.019517,0.33179,0.022599,0.002568,0.038007,0.051874,0.032871,0.064714,0.010272,0.008731 },
+ { 0.022881,0.019068,-1.280568,0.223727,0.014407,0.03644,0.024576,0.034322,0.165676,0.019915,0.005085,0.11144,0.012712,0.004237,0.006356,0.213134,0.098304,0.00339,0.029661,0.00678 },
+ { 0.041484,0.008194,0.270413,-1.044903,0.005121,0.025095,0.392816,0.066579,0.05736,0.005634,0.003585,0.013316,0.007682,0.002049,0.007682,0.030217,0.019462,0.002049,0.023559,0.015877 },
+ { 0.011019,0.022234,0.00669,0.001968,-0.56571,0.001771,0.000984,0.011609,0.013577,0.003345,0.004526,0.001377,0.0061,0.015348,0.002755,0.043878,0.008264,0.022628,0.041124,0.012199 },
+ { 0.02308,0.125524,0.034823,0.019841,0.003644,-1.04415,0.130788,0.010528,0.241735,0.003644,0.029154,0.118235,0.017411,0.00162,0.066406,0.021461,0.020651,0.007288,0.009718,0.008098 },
+ { 0.064507,0.017816,0.035632,0.471205,0.003072,0.198435,-0.944343,0.073107,0.015973,0.007372,0.005529,0.111197,0.011058,0.003072,0.011058,0.01843,0.019659,0.006143,0.0043,0.027646 },
+ { 0.130105,0.099578,0.058874,0.09449,0.042884,0.018898,0.086495,-0.647831,0.016717,0.004361,0.004361,0.019625,0.010176,0.003634,0.017444,0.146096,0.023986,0.039976,0.005815,0.034162 },
+ { 0.006155,0.074775,0.089138,0.025533,0.01573,0.1361,0.005927,0.005243,-1.135695,0.003648,0.012767,0.010259,0.007523,0.009119,0.026217,0.016642,0.010487,0.001824,0.130629,0.002508 },
+ { 0.01923,0.011752,0.025106,0.005876,0.009081,0.004808,0.00641,0.003205,0.008547,-1.273602,0.122326,0.011218,0.25587,0.047542,0.005342,0.021367,0.130873,0.004808,0.017094,0.513342 },
+ { 0.027395,0.0347,0.010958,0.006392,0.021003,0.065748,0.008219,0.005479,0.051137,0.209115,-0.668139,0.012784,0.354309,0.226465,0.093143,0.053877,0.022829,0.047485,0.021916,0.16437 },
+ { 0.020405,0.376625,0.153332,0.015158,0.004081,0.170239,0.105525,0.015741,0.026235,0.012243,0.008162,-0.900734,0.037896,0.002332,0.012243,0.027401,0.06005,0.00583,0.004664,0.008162 },
+ { 0.012784,0.010416,0.007102,0.003551,0.007339,0.01018,0.004261,0.003314,0.007812,0.113397,0.091854,0.015388,-1.182051,0.01018,0.003788,0.006865,0.053503,0.005682,0.004261,0.076466 },
+ { 0.00598,0.001993,0.003987,0.001595,0.031098,0.001595,0.001993,0.001993,0.015948,0.035484,0.098877,0.001595,0.017144,-0.637182,0.006778,0.03668,0.004784,0.021131,0.213701,0.024719 },
+ { 0.098117,0.037426,0.007586,0.007586,0.007081,0.082944,0.009104,0.012138,0.058162,0.005058,0.051587,0.010621,0.008092,0.008598,-0.727675,0.144141,0.059679,0.003035,0.005058,0.011632 },
+ { 0.258271,0.069009,0.343678,0.040312,0.152366,0.036213,0.020498,0.137334,0.049878,0.02733,0.040312,0.032113,0.019814,0.06286,0.194728,-1.447863,0.325913,0.023914,0.043045,0.025964 },
+ { 0.276406,0.037242,0.135003,0.022112,0.02444,0.029677,0.018621,0.019203,0.026768,0.142567,0.014548,0.059936,0.131511,0.006983,0.068665,0.27757,-1.335389,0.006983,0.01222,0.065174 },
+ { 0.001275,0.017854,0.001134,0.000567,0.016295,0.002551,0.001417,0.007793,0.001134,0.001275,0.007368,0.001417,0.003401,0.00751,0.00085,0.004959,0.0017,-0.312785,0.010061,0.003542 },
+ { 0.003509,0.006379,0.022328,0.014673,0.066664,0.007655,0.002233,0.002552,0.182769,0.010207,0.007655,0.002552,0.005741,0.170967,0.00319,0.020095,0.006698,0.022647,-0.605978,0.005103 },
+ { 0.195438,0.011149,0.010493,0.020331,0.040662,0.013117,0.029512,0.030824,0.007214,0.630254,0.11805,0.009182,0.211834,0.040662,0.015084,0.024922,0.073453,0.016396,0.010493,-1.241722 }
+};
+
+double statWAG01[MAXCODES] = {0.0866279,0.043972, 0.0390894,0.0570451,0.0193078,0.0367281,0.0580589,0.0832518,0.0244314,0.048466, 0.086209, 0.0620286,0.0195027,0.0384319,0.0457631,0.0695179,0.0610127,0.0143859,0.0352742,0.0708956};
+double matrixWAG01[MAXCODES][MAXCODES] = {
+ {-1.117151, 0.050147, 0.046354, 0.067188, 0.093376, 0.082607, 0.143908, 0.128804, 0.028817, 0.017577, 0.036177, 0.082395, 0.081234, 0.019138, 0.130789, 0.306463, 0.192846, 0.010286, 0.021887, 0.182381},
+ {0.025455, -0.974318, 0.029321, 0.006798, 0.024376, 0.140086, 0.020267, 0.026982, 0.098628, 0.008629, 0.022967, 0.246964, 0.031527, 0.004740, 0.031358, 0.056495, 0.025586, 0.053714, 0.017607, 0.011623},
+ {0.020916, 0.026065, -1.452438, 0.222741, 0.010882, 0.063328, 0.038859, 0.046176, 0.162306, 0.022737, 0.005396, 0.123567, 0.008132, 0.003945, 0.008003, 0.163042, 0.083283, 0.002950, 0.044553, 0.008051},
+ {0.044244, 0.008819, 0.325058, -0.989665, 0.001814, 0.036927, 0.369645, 0.051822, 0.055719, 0.002361, 0.005077, 0.028729, 0.006212, 0.002798, 0.025384, 0.064166, 0.022443, 0.007769, 0.019500, 0.009120},
+ {0.020812, 0.010703, 0.005375, 0.000614, -0.487357, 0.002002, 0.000433, 0.006214, 0.005045, 0.003448, 0.007787, 0.001500, 0.007913, 0.008065, 0.002217, 0.028525, 0.010395, 0.014531, 0.011020, 0.020307},
+ {0.035023, 0.117008, 0.059502, 0.023775, 0.003809, -1.379785, 0.210830, 0.012722, 0.165524, 0.004391, 0.033516, 0.150135, 0.059565, 0.003852, 0.035978, 0.039660, 0.033070, 0.008316, 0.008777, 0.011613},
+ {0.096449, 0.026759, 0.057716, 0.376214, 0.001301, 0.333275, -1.236894, 0.034593, 0.034734, 0.007763, 0.009400, 0.157479, 0.019202, 0.004944, 0.041578, 0.042955, 0.050134, 0.009540, 0.011961, 0.035874},
+ {0.123784, 0.051085, 0.098345, 0.075630, 0.026795, 0.028838, 0.049604, -0.497615, 0.021792, 0.002661, 0.005356, 0.032639, 0.015212, 0.004363, 0.021282, 0.117240, 0.019732, 0.029444, 0.009052, 0.016361},
+ {0.008127, 0.054799, 0.101443, 0.023863, 0.006384, 0.110105, 0.014616, 0.006395, -0.992342, 0.003543, 0.012807, 0.022832, 0.010363, 0.017420, 0.017851, 0.018979, 0.012136, 0.006733, 0.099319, 0.003035},
+ {0.009834, 0.009511, 0.028192, 0.002006, 0.008654, 0.005794, 0.006480, 0.001549, 0.007029, -1.233162, 0.161294, 0.016472, 0.216559, 0.053891, 0.005083, 0.016249, 0.074170, 0.010808, 0.021372, 0.397837},
+ {0.036002, 0.045028, 0.011900, 0.007673, 0.034769, 0.078669, 0.013957, 0.005547, 0.045190, 0.286902, -0.726011, 0.023303, 0.439180, 0.191376, 0.037625, 0.031191, 0.029552, 0.060196, 0.036066, 0.162890},
+ {0.058998, 0.348377, 0.196082, 0.031239, 0.004820, 0.253558, 0.168246, 0.024319, 0.057967, 0.021081, 0.016767, -1.124580, 0.060821, 0.005783, 0.036254, 0.062960, 0.090292, 0.008952, 0.008675, 0.019884},
+ {0.018288, 0.013983, 0.004057, 0.002124, 0.007993, 0.031629, 0.006450, 0.003564, 0.008272, 0.087143, 0.099354, 0.019123, -1.322098, 0.024370, 0.003507, 0.010109, 0.031033, 0.010556, 0.008769, 0.042133},
+ {0.008490, 0.004143, 0.003879, 0.001885, 0.016054, 0.004030, 0.003273, 0.002014, 0.027402, 0.042734, 0.085315, 0.003583, 0.048024, -0.713669, 0.006512, 0.022020, 0.006934, 0.061698, 0.260332, 0.026213},
+ {0.069092, 0.032635, 0.009370, 0.020364, 0.005255, 0.044829, 0.032773, 0.011698, 0.033438, 0.004799, 0.019973, 0.026747, 0.008229, 0.007754, -0.605590, 0.077484, 0.038202, 0.006695, 0.010376, 0.015124},
+ {0.245933, 0.089317, 0.289960, 0.078196, 0.102703, 0.075066, 0.051432, 0.097899, 0.054003, 0.023306, 0.025152, 0.070562, 0.036035, 0.039831, 0.117705, -1.392239, 0.319421, 0.038212, 0.057419, 0.016981},
+ {0.135823, 0.035501, 0.129992, 0.024004, 0.032848, 0.054936, 0.052685, 0.014461, 0.030308, 0.093371, 0.020915, 0.088814, 0.097083, 0.011008, 0.050931, 0.280341, -1.154973, 0.007099, 0.018643, 0.088894},
+ {0.001708, 0.017573, 0.001086, 0.001959, 0.010826, 0.003257, 0.002364, 0.005088, 0.003964, 0.003208, 0.010045, 0.002076, 0.007786, 0.023095, 0.002105, 0.007908, 0.001674, -0.466694, 0.037525, 0.005516},
+ {0.008912, 0.014125, 0.040205, 0.012058, 0.020133, 0.008430, 0.007267, 0.003836, 0.143398, 0.015555, 0.014757, 0.004934, 0.015861, 0.238943, 0.007998, 0.029135, 0.010779, 0.092011, -0.726275, 0.011652},
+ {0.149259, 0.018739, 0.014602, 0.011335, 0.074565, 0.022417, 0.043805, 0.013932, 0.008807, 0.581952, 0.133956, 0.022726, 0.153161, 0.048356, 0.023429, 0.017317, 0.103293, 0.027186, 0.023418, -1.085487},
+};